From c66ce62d633885d73f6d7603df34303bd8ba9993 Mon Sep 17 00:00:00 2001 From: =?UTF-8?q?Bjo=CC=88rn=20Antonsson?= Date: Thu, 2 Jun 2016 14:06:57 +0200 Subject: [PATCH] Update to a working version of Scalariform --- .../scala/akka/actor/ActorLifeCycleSpec.scala | 3 +- .../scala/akka/actor/ActorLookupSpec.scala | 16 +- .../scala/akka/actor/ActorMailboxSpec.scala | 39 ++-- .../scala/akka/actor/ActorSelectionSpec.scala | 13 +- .../scala/akka/actor/ActorSystemSpec.scala | 6 +- .../test/scala/akka/actor/ExtensionSpec.scala | 8 +- .../test/scala/akka/actor/FSMActorSpec.scala | 12 +- .../test/scala/akka/actor/FSMTimingSpec.scala | 5 +- .../scala/akka/actor/FSMTransitionSpec.scala | 14 +- .../akka/actor/SupervisorHierarchySpec.scala | 29 +-- .../scala/akka/actor/SupervisorMiscSpec.scala | 2 +- .../test/scala/akka/actor/UidClashTest.scala | 7 +- .../akka/actor/dispatch/ActorModelSpec.scala | 33 +-- .../akka/actor/dispatch/DispatchersSpec.scala | 8 +- .../akka/dispatch/MailboxConfigSpec.scala | 88 +++---- .../test/scala/akka/event/EventBusSpec.scala | 4 +- .../test/scala/akka/event/LoggerSpec.scala | 4 +- .../scala/akka/event/LoggingReceiveSpec.scala | 6 +- .../scala/akka/io/TcpConnectionSpec.scala | 24 +- .../scala/akka/io/TcpIntegrationSpec.scala | 6 +- .../src/test/scala/akka/pattern/AskSpec.scala | 2 +- .../routing/MetricsBasedResizerSpec.scala | 7 +- .../test/scala/akka/routing/RandomSpec.scala | 4 +- .../scala/akka/routing/RoundRobinSpec.scala | 6 +- .../akka/serialization/SerializeSpec.scala | 30 ++- .../test/scala/akka/util/ByteStringSpec.scala | 2 +- .../scala/akka/util/PrettyDurationSpec.scala | 20 +- .../main/scala/akka/actor/AbstractFSM.scala | 7 +- .../src/main/scala/akka/actor/Actor.scala | 8 +- .../src/main/scala/akka/actor/ActorCell.scala | 11 +- .../src/main/scala/akka/actor/ActorPath.scala | 3 +- .../src/main/scala/akka/actor/ActorRef.scala | 39 ++-- .../scala/akka/actor/ActorRefProvider.scala | 37 +-- .../scala/akka/actor/ActorSelection.scala | 7 +- .../main/scala/akka/actor/ActorSystem.scala | 32 +-- .../src/main/scala/akka/actor/Deployer.scala | 16 +- .../src/main/scala/akka/actor/Extension.scala | 2 +- .../src/main/scala/akka/actor/FSM.scala | 5 +- .../main/scala/akka/actor/FaultHandling.scala | 12 +- .../actor/LightArrayRevolverScheduler.scala | 16 +- .../akka/actor/RepointableActorRef.scala | 19 +- .../src/main/scala/akka/actor/Scheduler.scala | 30 +-- .../main/scala/akka/actor/TypedActor.scala | 19 +- .../scala/akka/actor/dungeon/Dispatch.scala | 3 +- .../akka/dispatch/AbstractDispatcher.scala | 27 ++- .../akka/dispatch/BalancingDispatcher.scala | 14 +- .../main/scala/akka/dispatch/Dispatcher.scala | 10 +- .../scala/akka/dispatch/Dispatchers.scala | 21 +- .../src/main/scala/akka/dispatch/Future.scala | 2 +- .../main/scala/akka/dispatch/Mailbox.scala | 55 ++--- .../main/scala/akka/dispatch/Mailboxes.scala | 10 +- .../akka/dispatch/PinnedDispatcher.scala | 11 +- .../akka/dispatch/ThreadPoolBuilder.scala | 24 +- .../akka/dispatch/sysmsg/SystemMessage.scala | 4 +- .../src/main/scala/akka/event/Logging.scala | 6 +- .../main/scala/akka/io/SimpleDnsCache.scala | 2 +- akka-actor/src/main/scala/akka/io/Tcp.scala | 51 ++-- .../main/scala/akka/io/TcpConnection.scala | 25 +- .../scala/akka/io/TcpIncomingConnection.scala | 13 +- .../src/main/scala/akka/io/TcpListener.scala | 11 +- .../scala/akka/io/TcpOutgoingConnection.scala | 9 +- akka-actor/src/main/scala/akka/io/Udp.scala | 7 +- .../src/main/scala/akka/io/UdpConnected.scala | 30 +-- .../main/scala/akka/io/UdpConnection.scala | 12 +- .../src/main/scala/akka/io/UdpListener.scala | 9 +- .../src/main/scala/akka/io/UdpSender.scala | 9 +- .../src/main/scala/akka/io/WithUdpSend.scala | 3 +- .../pattern/BackoffOnRestartSupervisor.scala | 12 +- .../scala/akka/pattern/BackoffOptions.scala | 32 +-- .../akka/pattern/BackoffSupervisor.scala | 52 ++--- .../scala/akka/pattern/CircuitBreaker.scala | 2 +- .../main/scala/akka/routing/Balancing.scala | 10 +- .../main/scala/akka/routing/Broadcast.scala | 8 +- .../scala/akka/routing/ConsistentHash.scala | 19 +- .../akka/routing/ConsistentHashing.scala | 31 +-- .../routing/OptimalSizeExploringResizer.scala | 26 +-- .../src/main/scala/akka/routing/Random.scala | 8 +- .../src/main/scala/akka/routing/Resizer.scala | 26 +-- .../main/scala/akka/routing/RoundRobin.scala | 11 +- .../scala/akka/routing/RoutedActorCell.scala | 15 +- .../scala/akka/routing/RoutedActorRef.scala | 12 +- .../scala/akka/routing/RouterConfig.scala | 12 +- .../routing/ScatterGatherFirstCompleted.scala | 12 +- .../scala/akka/routing/SmallestMailbox.scala | 15 +- .../scala/akka/routing/TailChopping.scala | 16 +- .../akka/serialization/Serialization.scala | 8 +- .../src/main/scala/akka/util/BoxedType.scala | 18 +- .../src/main/scala/akka/util/ByteString.scala | 2 +- .../main/scala/akka/util/LineNumbers.scala | 15 +- .../scala/akka/util/SubclassifiedIndex.scala | 2 +- .../akka/actor/ActorCreationBenchmark.scala | 2 +- .../akka/actor/ForkJoinActorBenchmark.scala | 11 +- .../actor/RouterPoolCreationBenchmark.scala | 2 +- .../scala/akka/actor/ScheduleBenchmark.scala | 8 +- .../akka/actor/StashCreationBenchmark.scala | 2 +- .../scala/akka/actor/TellOnlyBenchmark.scala | 27 ++- .../cluster/ddata/ORSetMergeBenchmark.scala | 2 +- .../ddata/VersionVectorBenchmark.scala | 2 +- .../dispatch/CachingConfigBenchmark.scala | 2 +- .../akka/dispatch/NodeQueueBenchmark.scala | 2 +- .../main/scala/akka/http/HttpBenchmark.scala | 11 +- .../LevelDbBatchingBenchmark.scala | 15 +- .../PersistenceActorDeferBenchmark.scala | 11 +- .../PersistentActorBenchmark.scala | 17 +- ...ctorWithAtLeastOnceDeliveryBenchmark.scala | 13 +- .../akka/stream/FlatMapMergeBenchmark.scala | 8 +- .../scala/akka/stream/FlowMapBenchmark.scala | 9 +- .../akka/stream/GraphBuilderBenchmark.scala | 8 +- .../akka/stream/InterpreterBenchmark.scala | 5 +- .../stream/MaterializationBenchmark.scala | 52 ++--- .../akka/stream/io/FileSourcesBenchmark.scala | 12 +- .../akka/camel/internal/CamelSupervisor.scala | 2 +- .../internal/component/ActorComponent.scala | 11 +- .../akka/camel/CamelExchangeAdapterTest.scala | 26 +-- .../scala/akka/camel/CamelMessageTest.scala | 2 +- .../akka/camel/ConcurrentActivationTest.scala | 6 +- .../scala/akka/camel/MessageScalaTest.scala | 18 +- .../akka/camel/ProducerFeatureTest.scala | 36 +-- .../akka/camel/UntypedProducerTest.scala | 8 +- .../metrics/ClusterMetricsCollector.scala | 6 +- .../metrics/ClusterMetricsExtension.scala | 2 +- .../metrics/ClusterMetricsRouting.scala | 39 ++-- .../scala/akka/cluster/metrics/Metric.scala | 10 +- .../cluster/metrics/MetricsCollector.scala | 8 +- .../metrics/protobuf/MessageSerializer.scala | 3 +- .../metrics/ClusterMetricsRoutingSpec.scala | 13 +- .../metrics/ClusterMetricsRoutingSpec.scala | 8 +- .../scala/akka/cluster/metrics/EWMASpec.scala | 2 +- .../scala/akka/cluster/metrics/TestUtil.scala | 8 +- .../protobuf/MessageSerializerSpec.scala | 6 +- .../cluster/sharding/ClusterSharding.scala | 96 ++++---- .../sharding/ClusterShardingSettings.scala | 54 ++--- .../RemoveInternalClusterShardingData.scala | 3 +- .../scala/akka/cluster/sharding/Shard.scala | 39 ++-- .../cluster/sharding/ShardCoordinator.scala | 39 ++-- .../akka/cluster/sharding/ShardRegion.scala | 33 +-- .../ClusterShardingMessageSerializer.scala | 52 ++--- .../sharding/ClusterShardingLeavingSpec.scala | 2 +- .../sharding/ClusterShardingSpec.scala | 39 ++-- .../LeastShardAllocationStrategySpec.scala | 11 +- ...ClusterShardingMessageSerializerSpec.scala | 4 +- .../akka/cluster/client/ClusterClient.scala | 69 +++--- .../ClusterClientMessageSerializer.scala | 8 +- .../pubsub/DistributedPubSubMediator.scala | 43 ++-- .../cluster/pubsub/PerGroupingBuffer.scala | 2 +- .../DistributedPubSubMessageSerializer.scala | 14 +- .../singleton/ClusterSingletonManager.scala | 47 ++-- .../singleton/ClusterSingletonProxy.scala | 18 +- .../ClusterSingletonMessageSerializer.scala | 8 +- .../cluster/client/ClusterClientSpec.scala | 3 +- .../DistributedPubSubMediatorSpec.scala | 6 +- .../ClusterSingletonManagerChaosSpec.scala | 9 +- .../ClusterSingletonManagerLeaveSpec.scala | 16 +- .../ClusterSingletonManagerSpec.scala | 16 +- .../ClusterSingletonManagerStartupSpec.scala | 16 +- ...stributedPubSubMessageSerializerSpec.scala | 8 +- .../singleton/ClusterSingletonProxySpec.scala | 12 +- .../main/scala/akka/cluster/AutoDown.scala | 2 +- .../src/main/scala/akka/cluster/Cluster.scala | 19 +- .../cluster/ClusterActorRefProvider.scala | 6 +- .../scala/akka/cluster/ClusterDaemon.scala | 43 ++-- .../scala/akka/cluster/ClusterEvent.scala | 10 +- .../scala/akka/cluster/ClusterHeartbeat.scala | 13 +- .../cluster/ClusterMetricsCollector.scala | 22 +- .../scala/akka/cluster/ClusterReadView.scala | 5 +- .../akka/cluster/ClusterRemoteWatcher.scala | 12 +- .../scala/akka/cluster/ClusterSettings.scala | 2 +- .../src/main/scala/akka/cluster/Gossip.scala | 28 +-- .../src/main/scala/akka/cluster/Member.scala | 23 +- .../scala/akka/cluster/Reachability.scala | 10 +- .../protobuf/ClusterMessageSerializer.scala | 53 +++-- .../routing/AdaptiveLoadBalancing.scala | 39 ++-- .../cluster/routing/ClusterRouterConfig.scala | 18 +- .../DeterministicOldestWhenJoiningSpec.scala | 2 +- .../akka/cluster/MultiNodeClusterSpec.scala | 12 +- .../cluster/RestartFirstSeedNodeSpec.scala | 3 +- .../scala/akka/cluster/RestartNode2Spec.scala | 3 +- .../scala/akka/cluster/RestartNode3Spec.scala | 3 +- .../scala/akka/cluster/RestartNodeSpec.scala | 3 +- .../scala/akka/cluster/StressSpec.scala | 40 ++-- .../AdaptiveLoadBalancingRouterSpec.scala | 13 +- .../ClusterConsistentHashingGroupSpec.scala | 6 +- .../ClusterConsistentHashingRouterSpec.scala | 17 +- .../routing/ClusterRoundRobinSpec.scala | 12 +- .../cluster/routing/UseRoleIgnoredSpec.scala | 52 +++-- .../scala/akka/cluster/AutoDownSpec.scala | 2 +- .../akka/cluster/ClusterDomainEventSpec.scala | 6 +- .../test/scala/akka/cluster/EWMASpec.scala | 2 +- .../scala/akka/cluster/ReachabilitySpec.scala | 14 +- .../ClusterMessageSerializerSpec.scala | 6 +- .../cluster/routing/MetricsSelectorSpec.scala | 8 +- .../cluster/routing/WeightedRouteesSpec.scala | 10 +- .../circuitbreaker/CircuitBreakerProxy.scala | 47 ++-- .../akka/contrib/pattern/ReliableProxy.scala | 7 +- .../throttle/TimerBasedThrottler.scala | 13 +- .../CircuitBreakerProxySpec.scala | 4 +- .../sample/CircuitBreaker.scala | 24 +- .../contrib/mailbox/PeekMailboxSpec.scala | 3 +- .../akka/contrib/pattern/AggregatorSpec.scala | 16 +- .../contrib/pattern/ReceivePipelineSpec.scala | 8 +- .../throttle/TimerBasedThrottlerSpec.scala | 3 +- .../scala/akka/cluster/ddata/GCounter.scala | 4 +- .../scala/akka/cluster/ddata/LWWMap.scala | 2 +- .../akka/cluster/ddata/LWWRegister.scala | 4 +- .../main/scala/akka/cluster/ddata/ORMap.scala | 2 +- .../scala/akka/cluster/ddata/ORMultiMap.scala | 2 +- .../main/scala/akka/cluster/ddata/ORSet.scala | 2 +- .../scala/akka/cluster/ddata/PNCounter.scala | 9 +- .../akka/cluster/ddata/PNCounterMap.scala | 4 +- .../scala/akka/cluster/ddata/Replicator.scala | 76 +++--- .../akka/cluster/ddata/VersionVector.scala | 4 +- .../protobuf/ReplicatedDataSerializer.scala | 56 ++--- .../ReplicatorMessageSerializer.scala | 40 ++-- .../ddata/JepsenInspiredInsertSpec.scala | 2 +- .../cluster/ddata/ReplicatorChaosSpec.scala | 3 +- .../cluster/ddata/ReplicatorPruningSpec.scala | 2 +- .../akka/cluster/ddata/ReplicatorSpec.scala | 12 +- .../scala/akka/cluster/ddata/LWWMapSpec.scala | 10 +- .../cluster/ddata/LocalConcurrencySpec.scala | 3 +- .../scala/akka/cluster/ddata/ORMapSpec.scala | 2 +- .../akka/cluster/ddata/ORMultiMapSpec.scala | 30 +-- .../scala/akka/cluster/ddata/ORSetSpec.scala | 36 +-- .../akka/cluster/ddata/PNCounterMapSpec.scala | 10 +- .../cluster/ddata/WriteAggregatorSpec.scala | 2 +- .../ReplicatedDataSerializerSpec.scala | 3 +- .../ReplicatorMessageSerializerSpec.scala | 19 +- .../CircuitBreakerDocSpec.scala | 3 +- .../docs/actor/FaultHandlingDocSample.scala | 7 +- .../docs/actor/FaultHandlingDocSpec.scala | 3 +- .../code/docs/actor/SchedulerDocSpec.scala | 3 +- .../code/docs/actor/TypedActorDocSpec.scala | 3 +- .../code/docs/akka/typed/IntroSpec.scala | 20 +- .../scala/code/docs/camel/Introduction.scala | 6 +- .../scala/code/docs/ddata/TwoPhaseSet.scala | 2 +- .../protobuf/TwoPhaseSetSerializer.scala | 8 +- .../protobuf/TwoPhaseSetSerializer2.scala | 4 +- .../docs/dispatcher/MyUnboundedMailbox.scala | 5 +- .../extension/SettingsExtensionDocSpec.scala | 3 +- .../http/scaladsl/HttpServerExampleSpec.scala | 16 +- .../server/RejectionHandlerExamplesSpec.scala | 6 +- .../server/WebSocketExampleSpec.scala | 18 +- .../BasicDirectivesExamplesSpec.scala | 21 +- .../HeaderDirectivesExamplesSpec.scala | 8 +- .../MiscDirectivesExamplesSpec.scala | 4 +- .../SchemeDirectivesExamplesSpec.scala | 2 +- .../TimeoutDirectivesExamplesSpec.scala | 6 +- .../WebSocketDirectivesExamplesSpec.scala | 10 +- .../pattern/BackoffSupervisorDocSpec.scala | 26 +-- .../docs/pattern/SchedulerPatternSpec.scala | 6 +- .../docs/persistence/PersistenceDocSpec.scala | 8 +- .../PersistencePluginDocSpec.scala | 12 +- .../PersistenceSchemaEvolutionDocSpec.scala | 5 +- .../LeveldbPersistenceQueryDocSpec.scala | 6 +- .../query/MyEventsByTagPublisher.scala | 10 +- .../query/PersistenceQueryDocSpec.scala | 2 +- .../docs/routing/CustomRouterDocSpec.scala | 6 +- .../code/docs/routing/RouterDocSpec.scala | 12 +- .../serialization/SerializationDocSpec.scala | 5 +- .../code/docs/stream/CompositionDocSpec.scala | 5 +- .../scala/code/docs/stream/FlowDocSpec.scala | 20 +- .../code/docs/stream/GraphDSLDocSpec.scala | 34 ++- .../stream/StreamPartialGraphDSLDocSpec.scala | 19 +- .../cookbook/RecipeDroppyBroadcast.scala | 17 +- .../stream/cookbook/RecipeReduceByKey.scala | 7 +- .../docs/stream/io/StreamTcpDocSpec.scala | 6 +- .../code/docs/testkit/TestKitUsageSpec.scala | 3 +- .../client/OutgoingConnectionBlueprint.scala | 7 +- .../impl/engine/client/PoolConductor.scala | 6 +- .../http/impl/engine/client/PoolFlow.scala | 8 +- .../impl/engine/client/PoolMasterActor.scala | 6 +- .../http/impl/engine/client/PoolSlot.scala | 9 +- .../impl/engine/parsing/BodyPartParser.scala | 27 ++- .../engine/parsing/HttpHeaderParser.scala | 32 +-- .../engine/parsing/HttpMessageParser.scala | 12 +- .../engine/parsing/HttpRequestParser.scala | 18 +- .../engine/parsing/HttpResponseParser.scala | 10 +- .../impl/engine/parsing/ParserOutput.scala | 20 +- .../http/impl/engine/parsing/package.scala | 5 +- .../engine/rendering/BodyPartRenderer.scala | 9 +- .../HttpRequestRendererFactory.scala | 11 +- .../HttpResponseRendererFactory.scala | 15 +- .../impl/engine/rendering/RenderSupport.scala | 9 +- .../engine/server/HttpServerBluePrint.scala | 33 +-- .../akka/http/impl/engine/ws/FrameEvent.scala | 28 +-- .../impl/engine/ws/FrameEventParser.scala | 3 +- .../akka/http/impl/engine/ws/Handshake.scala | 3 +- .../akka/http/impl/engine/ws/WebSocket.scala | 27 ++- .../engine/ws/WebSocketClientBlueprint.scala | 14 +- .../http/impl/model/parser/CommonRules.scala | 6 +- .../parser/ContentDispositionHeader.scala | 2 +- .../impl/model/parser/ContentTypeHeader.scala | 11 +- .../http/impl/model/parser/HeaderParser.scala | 12 +- .../ClientConnectionSettingsImpl.scala | 12 +- .../settings/ConnectionPoolSettingsImpl.scala | 10 +- .../impl/settings/ConnectionPoolSetup.scala | 6 +- .../impl/settings/ParserSettingsImpl.scala | 36 +-- .../impl/settings/RoutingSettingsImpl.scala | 12 +- .../impl/settings/ServerSettingsImpl.scala | 30 +-- .../http/impl/util/SettingsCompanion.scala | 2 +- .../akka/http/impl/util/StreamUtils.scala | 6 +- .../akka/http/javadsl/ConnectionContext.scala | 24 +- .../main/scala/akka/http/javadsl/Http.scala | 213 +++++++++-------- .../javadsl/settings/ParserSettings.scala | 8 +- .../http/scaladsl/ConnectionContext.scala | 42 ++-- .../main/scala/akka/http/scaladsl/Http.scala | 166 +++++++------ .../akka/http/scaladsl/model/DateTime.scala | 23 +- .../akka/http/scaladsl/model/HttpEntity.scala | 21 +- .../http/scaladsl/model/HttpMessage.scala | 86 +++---- .../akka/http/scaladsl/model/HttpMethod.scala | 9 +- .../akka/http/scaladsl/model/MediaRange.scala | 4 +- .../akka/http/scaladsl/model/MediaType.scala | 12 +- .../akka/http/scaladsl/model/Multipart.scala | 19 +- .../scala/akka/http/scaladsl/model/Uri.scala | 12 +- .../scaladsl/model/headers/HttpCookie.scala | 37 +-- .../http/scaladsl/model/headers/headers.scala | 2 +- .../model/ws/UpgradeToWebSocket.scala | 19 +- .../scaladsl/model/ws/WebSocketRequest.scala | 4 +- .../scaladsl/settings/ParserSettings.scala | 6 +- .../akka/http/scaladsl/util/FastFuture.scala | 8 +- .../engine/client/ConnectionPoolSpec.scala | 65 +++--- .../HighLevelOutgoingConnectionSpec.scala | 6 +- .../LowLevelOutgoingConnectionSpec.scala | 21 +- .../client/TlsEndpointVerificationSpec.scala | 2 +- .../engine/parsing/HttpHeaderParserSpec.scala | 22 +- .../engine/parsing/RequestParserSpec.scala | 70 ++++-- .../engine/parsing/ResponseParserSpec.scala | 23 +- .../rendering/RequestRendererSpec.scala | 14 +- .../rendering/ResponseRendererSpec.scala | 53 +++-- .../impl/engine/server/HttpServerSpec.scala | 6 +- .../server/HttpServerTestSetupBase.scala | 17 +- .../http/impl/engine/ws/MessageSpec.scala | 2 +- .../impl/engine/ws/WSClientAutobahnTest.scala | 2 +- .../impl/engine/ws/WSServerAutobahnTest.scala | 17 +- .../http/impl/engine/ws/WSTestSetupBase.scala | 30 +-- .../http/impl/engine/ws/WSTestUtils.scala | 10 +- .../impl/engine/ws/WebSocketClientSpec.scala | 13 +- .../impl/model/parser/HttpHeaderSpec.scala | 87 +++---- .../akka/http/javadsl/model/JavaApiSpec.scala | 8 +- .../javadsl/model/JavaApiTestCaseSpecs.scala | 3 +- .../akka/http/scaladsl/ClientServerSpec.scala | 8 +- .../scala/akka/http/scaladsl/TestServer.scala | 3 +- .../http/scaladsl/model/MultipartSpec.scala | 2 +- .../akka/http/scaladsl/model/UriSpec.scala | 55 +++-- .../http/HttpModelIntegrationSpec.scala | 14 +- .../javadsl/testkit/TestRouteResult.scala | 27 +-- .../http/scaladsl/testkit/RouteTest.scala | 11 +- .../testkit/WSTestRequestBuilding.scala | 7 +- .../javadsl/DirectivesConsistencySpec.scala | 8 +- .../akka/http/scaladsl/FormDataSpec.scala | 6 +- ...tentNegotiationGivenResponseCodeSpec.scala | 6 +- .../marshalling/ContentNegotiationSpec.scala | 3 +- .../marshalling/MarshallingSpec.scala | 15 +- ...ntLeakActorsOnFailingConnectionSpecs.scala | 2 +- .../http/scaladsl/server/TestServer.scala | 3 +- .../directives/CookieDirectivesSpec.scala | 6 +- .../directives/FileUploadDirectivesSpec.scala | 10 +- .../directives/FormFieldDirectivesSpec.scala | 34 +-- .../directives/PathDirectivesSpec.scala | 2 +- .../directives/RouteDirectivesSpec.scala | 5 +- .../directives/TimeoutDirectivesSpec.scala | 3 +- .../MultipartUnmarshallersSpec.scala | 64 +++-- .../akka/http/javadsl/server/Marshaller.scala | 26 +-- .../javadsl/server/RejectionHandler.scala | 26 +-- .../akka/http/javadsl/server/Rejections.scala | 5 +- .../http/javadsl/server/RequestContext.scala | 6 +- .../akka/http/javadsl/server/Route.scala | 13 +- .../http/javadsl/server/Unmarshaller.scala | 21 +- .../directives/DebuggingDirectives.scala | 21 +- .../server/directives/HeaderDirectives.scala | 60 ++--- .../directives/MarshallingDirectives.scala | 10 +- .../directives/SecurityDirectives.scala | 128 +++++----- .../akka/http/scaladsl/coding/Decoder.scala | 2 +- .../akka/http/scaladsl/coding/Gzip.scala | 2 +- .../akka/http/scaladsl/coding/NoCoding.scala | 2 +- .../http/scaladsl/common/StrictForm.scala | 56 ++--- .../marshalling/ContentTypeOverrider.scala | 2 +- .../scaladsl/marshalling/EmptyValue.scala | 2 +- .../scaladsl/marshalling/Marshaller.scala | 59 ++--- .../PredefinedToResponseMarshallers.scala | 11 +- .../akka/http/scaladsl/server/Directive.scala | 26 +-- .../scaladsl/server/ExceptionHandler.scala | 3 +- .../scaladsl/server/RejectionHandler.scala | 26 ++- .../http/scaladsl/server/RequestContext.scala | 6 +- .../scaladsl/server/RequestContextImpl.scala | 27 +-- .../akka/http/scaladsl/server/Route.scala | 31 +-- .../http/scaladsl/server/RouteResult.scala | 9 +- .../directives/DebuggingDirectives.scala | 11 +- .../directives/ExecutionDirectives.scala | 17 +- .../FileAndResourceDirectives.scala | 67 +++--- .../directives/FormFieldDirectives.scala | 2 +- .../server/directives/HeaderDirectives.scala | 40 ++-- .../directives/SecurityDirectives.scala | 12 +- .../server/directives/TimeoutDirectives.scala | 34 ++- .../MultipartUnmarshallers.scala | 12 +- .../PredefinedFromStringUnmarshallers.scala | 5 +- .../scaladsl/unmarshalling/Unmarshaller.scala | 16 +- .../akka/remote/testconductor/Conductor.scala | 44 ++-- .../akka/remote/testconductor/DataTypes.scala | 3 +- .../akka/remote/testconductor/Player.scala | 16 +- .../akka/remote/testkit/MultiNodeSpec.scala | 10 +- akka-parsing/build.sbt | 1 + .../akka/parboiled2/ErrorFormatter.scala | 20 +- .../scala/akka/parboiled2/ParseError.scala | 7 +- .../main/scala/akka/parboiled2/Parser.scala | 25 +- .../src/main/scala/akka/parboiled2/Rule.scala | 6 +- .../parboiled2/support/OpTreeContext.scala | 16 +- .../main/scala/akka/shapeless/hlists.scala | 1 - .../scala/akka/shapeless/ops/hlists.scala | 1 - .../persistence/query/EventEnvelope.scala | 6 +- .../persistence/query/PersistenceQuery.scala | 3 +- .../EventsByPersistenceIdPublisher.scala | 2 +- .../leveldb/EventsByTagPublisher.scala | 2 +- .../persistence/AtLeastOnceDelivery.scala | 5 +- .../scala/akka/persistence/Eventsourced.scala | 6 +- .../scala/akka/persistence/Persistence.scala | 3 +- .../scala/akka/persistence/Persistent.scala | 39 ++-- .../akka/persistence/PersistentActor.scala | 4 +- .../akka/persistence/SnapshotProtocol.scala | 4 +- .../akka/persistence/fsm/PersistentFSM.scala | 43 ++-- .../persistence/fsm/PersistentFSMBase.scala | 9 +- .../journal/AsyncWriteJournal.scala | 2 +- .../persistence/journal/EventAdapters.scala | 21 +- .../persistence/journal/ReplayFilter.scala | 14 +- .../journal/inmem/InmemJournal.scala | 8 +- .../journal/leveldb/LeveldbIdMapping.scala | 4 +- .../journal/leveldb/LeveldbKey.scala | 4 +- .../journal/leveldb/LeveldbStore.scala | 3 +- .../persistence/AtLeastOnceDeliverySpec.scala | 41 ++-- .../PersistentActorStashingSpec.scala | 52 +++-- .../journal/SteppingInmemJournal.scala | 2 +- .../remote/RemoteQuarantinePiercingSpec.scala | 2 +- .../RemoteRestartedQuarantinedSpec.scala | 2 +- .../remote/routing/RemoteRandomSpec.scala | 4 +- .../remote/routing/RemoteRoundRobinSpec.scala | 8 +- .../routing/RemoteScatterGatherSpec.scala | 4 +- .../akka/remote/testkit/LogRoleReplace.scala | 4 +- .../scala/akka/remote/AckedDelivery.scala | 10 +- .../akka/remote/DeadlineFailureDetector.scala | 5 +- .../DefaultFailureDetectorRegistry.scala | 2 +- .../src/main/scala/akka/remote/Endpoint.scala | 160 +++++++------ .../akka/remote/FailureDetectorRegistry.scala | 10 +- .../remote/PhiAccrualFailureDetector.scala | 17 +- .../akka/remote/RemoteActorRefProvider.scala | 43 ++-- .../main/scala/akka/remote/RemoteDaemon.scala | 10 +- .../akka/remote/RemoteDeploymentWatcher.scala | 2 +- .../scala/akka/remote/RemoteSettings.scala | 6 +- .../scala/akka/remote/RemoteWatcher.scala | 17 +- .../src/main/scala/akka/remote/Remoting.scala | 129 +++++----- .../akka/remote/RemotingLifecycleEvent.scala | 16 +- .../provider/InternetSeedGenerator.scala | 3 +- .../serialization/MiscMessageSerializer.scala | 4 +- .../transport/AbstractTransportAdapter.scala | 29 ++- .../akka/remote/transport/AkkaPduCodec.scala | 37 +-- .../transport/AkkaProtocolTransport.scala | 109 +++++---- .../FailureInjectorTransportAdapter.scala | 10 +- .../akka/remote/transport/TestTransport.scala | 39 ++-- .../transport/ThrottlerTransportAdapter.scala | 10 +- .../transport/netty/NettyTransport.scala | 16 +- .../remote/transport/netty/TcpSupport.scala | 18 +- .../remote/transport/netty/UdpSupport.scala | 18 +- .../remote/AccrualFailureDetectorSpec.scala | 13 +- .../remote/DeadlineFailureDetectorSpec.scala | 2 +- .../remote/FailureDetectorRegistrySpec.scala | 21 +- .../scala/akka/remote/RemoteConfigSpec.scala | 4 +- .../scala/akka/remote/RemoteRouterSpec.scala | 3 +- .../scala/akka/remote/RemoteWatcherSpec.scala | 3 +- .../test/scala/akka/remote/RemotingSpec.scala | 6 +- .../MiscMessageSerializerSpec.scala | 6 +- .../SystemMessageDeliveryStressTest.scala | 6 +- .../stats/StatsSampleSingleMasterSpec.scala | 2 +- .../cluster/stats/StatsSampleSpec.scala | 4 +- .../TransformationSampleSpec.scala | 4 +- .../stats/StatsSampleSingleMasterSpec.scala | 2 +- .../cluster/stats/StatsSampleSpec.scala | 4 +- .../TransformationSampleSpec.scala | 4 +- .../distributeddata/ServiceRegistrySpec.scala | 2 +- .../distributeddata/VotingServiceSpec.scala | 2 +- .../distributeddata/ReplicatedCache.scala | 18 +- .../distributeddata/ReplicatedMetrics.scala | 26 +-- .../distributeddata/ServiceRegistry.scala | 20 +- .../sample/distributeddata/ShoppingCart.scala | 28 +-- .../distributeddata/VotingService.scala | 24 +- .../distributeddata/ServiceRegistrySpec.scala | 2 +- .../distributeddata/VotingServiceSpec.scala | 4 +- .../akka/event/slf4j/Slf4jLoggerSpec.scala | 4 +- .../akka/stream/testkit/TestGraphStage.scala | 20 +- .../akka/stream/testkit/ChainSetup.scala | 13 +- .../scala/akka/stream/testkit/Coroner.scala | 2 +- .../akka/stream/testkit/ScriptedTest.scala | 18 +- .../testkit/StreamTestDefaultMailbox.scala | 3 +- .../scala/akka/stream/testkit/Utils.scala | 3 +- .../akka/stream/DslConsistencySpec.scala | 28 +-- .../stream/DslFactoriesConsistencySpec.scala | 12 +- .../test/scala/akka/stream/FusingSpec.scala | 2 +- .../stream/actor/ActorPublisherSpec.scala | 21 +- .../stream/actor/ActorSubscriberSpec.scala | 2 +- .../akka/stream/extra/FlowTimedSpec.scala | 4 +- .../akka/stream/impl/StreamLayoutSpec.scala | 4 +- .../fusing/ActorGraphInterpreterSpec.scala | 17 +- .../impl/fusing/GraphInterpreterSpecKit.scala | 6 +- .../fusing/LifecycleInterpreterSpec.scala | 8 +- .../test/scala/akka/stream/io/TcpSpec.scala | 9 +- .../test/scala/akka/stream/io/TlsSpec.scala | 22 +- .../ActorRefBackpressureSinkSpec.scala | 15 +- .../akka/stream/scaladsl/BidiFlowSpec.scala | 55 ++--- .../stream/scaladsl/FlowCollectSpec.scala | 2 +- .../akka/stream/scaladsl/FlowDropSpec.scala | 2 +- .../akka/stream/scaladsl/FlowExpandSpec.scala | 6 +- .../akka/stream/scaladsl/FlowFilterSpec.scala | 4 +- .../stream/scaladsl/FlowGroupBySpec.scala | 2 +- .../stream/scaladsl/FlowGroupedSpec.scala | 2 +- .../scaladsl/FlowGroupedWithinSpec.scala | 6 +- .../akka/stream/scaladsl/FlowJoinSpec.scala | 100 ++++---- .../stream/scaladsl/FlowKillSwitchSpec.scala | 13 +- .../stream/scaladsl/FlowMapAsyncSpec.scala | 2 +- .../scaladsl/FlowMapAsyncUnorderedSpec.scala | 4 +- .../stream/scaladsl/FlowMapConcatSpec.scala | 12 +- .../akka/stream/scaladsl/FlowMapSpec.scala | 2 +- .../scala/akka/stream/scaladsl/FlowSpec.scala | 2 +- .../stream/scaladsl/FlowSplitAfterSpec.scala | 4 +- .../stream/scaladsl/FlowSplitWhenSpec.scala | 4 +- .../scaladsl/FlowStatefulMapConcatSpec.scala | 8 +- .../akka/stream/scaladsl/FlowTakeSpec.scala | 2 +- .../stream/scaladsl/GraphBackedFlowSpec.scala | 169 ++++++-------- .../stream/scaladsl/GraphBalanceSpec.scala | 78 +++---- .../stream/scaladsl/GraphBroadcastSpec.scala | 77 +++--- .../stream/scaladsl/GraphDSLCompileSpec.scala | 4 +- .../stream/scaladsl/GraphMatValueSpec.scala | 78 +++---- .../scaladsl/GraphMergePreferredSpec.scala | 34 ++- .../akka/stream/scaladsl/GraphMergeSpec.scala | 13 +- .../scaladsl/GraphOpsIntegrationSpec.scala | 133 +++++------ .../stream/scaladsl/GraphPartialSpec.scala | 85 ++++--- .../stream/scaladsl/GraphPartitionSpec.scala | 40 ++-- .../akka/stream/scaladsl/GraphUnzipSpec.scala | 22 +- .../akka/stream/scaladsl/GraphZipNSpec.scala | 65 +++--- .../akka/stream/scaladsl/GraphZipSpec.scala | 65 +++--- .../stream/scaladsl/PublisherSinkSpec.scala | 15 +- .../stream/scaladsl/ReverseArrowSpec.scala | 159 ++++++------- .../scaladsl/SinkForeachParallelSpec.scala | 4 +- .../scala/akka/stream/scaladsl/SinkSpec.scala | 46 ++-- .../akka/stream/scaladsl/SourceSpec.scala | 29 ++- .../stream/scaladsl/StageActorRefSpec.scala | 2 +- .../UnfoldResourceAsyncSourceSpec.scala | 36 +-- .../scaladsl/UnfoldResourceSourceSpec.scala | 21 +- .../scala/akka/stream/ActorMaterializer.scala | 97 ++++---- .../main/scala/akka/stream/Attributes.scala | 6 +- .../src/main/scala/akka/stream/Fusing.scala | 20 +- .../main/scala/akka/stream/Materializer.scala | 4 +- .../src/main/scala/akka/stream/Shape.scala | 18 +- .../scala/akka/stream/SslTlsOptions.scala | 6 +- .../akka/stream/actor/ActorPublisher.scala | 3 +- .../stream/impl/ActorMaterializerImpl.scala | 21 +- .../impl/ActorRefBackpressureSinkStage.scala | 4 +- .../stream/impl/CompletedPublishers.scala | 2 +- .../akka/stream/impl/FanoutProcessor.scala | 9 +- .../impl/ResizableMultiReaderRingBuffer.scala | 13 +- .../main/scala/akka/stream/impl/Sinks.scala | 7 +- .../main/scala/akka/stream/impl/Sources.scala | 14 +- .../scala/akka/stream/impl/StreamLayout.scala | 156 +++++++------ .../impl/StreamSubscriptionTimeout.scala | 3 +- .../scala/akka/stream/impl/SubFlowImpl.scala | 7 +- .../scala/akka/stream/impl/Throttle.scala | 11 +- .../impl/fusing/ActorGraphInterpreter.scala | 12 +- .../akka/stream/impl/fusing/Fusing.scala | 35 +-- .../stream/impl/fusing/GraphInterpreter.scala | 45 ++-- .../akka/stream/impl/fusing/GraphStages.scala | 7 +- .../impl/fusing/IteratorInterpreter.scala | 2 +- .../scala/akka/stream/impl/fusing/Ops.scala | 12 +- .../stream/impl/io/ByteStringParser.scala | 7 +- .../stream/impl/io/InputStreamSinkStage.scala | 7 +- .../impl/io/OutputStreamSourceStage.scala | 9 +- .../scala/akka/stream/impl/io/TLSActor.scala | 28 +-- .../scala/akka/stream/impl/io/TcpStages.scala | 37 +-- .../scala/akka/stream/impl/io/TlsModule.scala | 6 +- .../scala/akka/stream/javadsl/BidiFlow.scala | 4 +- .../main/scala/akka/stream/javadsl/Flow.scala | 113 ++++----- .../scala/akka/stream/javadsl/Framing.scala | 16 +- .../scala/akka/stream/javadsl/Graph.scala | 2 +- .../scala/akka/stream/javadsl/Source.scala | 220 +++++++++--------- .../stream/javadsl/StreamConverters.scala | 77 +++--- .../scala/akka/stream/javadsl/SubFlow.scala | 67 +++--- .../scala/akka/stream/javadsl/SubSource.scala | 65 +++--- .../main/scala/akka/stream/javadsl/Tcp.scala | 26 ++- .../scala/akka/stream/scaladsl/BidiFlow.scala | 8 +- .../scala/akka/stream/scaladsl/Flow.scala | 179 +++++++------- .../scala/akka/stream/scaladsl/Framing.scala | 15 +- .../scala/akka/stream/scaladsl/Graph.scala | 8 +- .../stream/scaladsl/StreamConverters.scala | 143 ++++++------ .../main/scala/akka/stream/scaladsl/TLS.scala | 21 +- .../main/scala/akka/stream/scaladsl/Tcp.scala | 44 ++-- .../scala/akka/stream/stage/GraphStage.scala | 11 +- .../main/scala/akka/stream/stage/Stage.scala | 6 +- .../testkit/CallingThreadDispatcher.scala | 6 +- .../scala/akka/testkit/TestActorRef.scala | 9 +- .../akka/testkit/TestEventListener.scala | 39 ++-- .../main/scala/akka/testkit/TestFSMRef.scala | 6 +- .../src/main/scala/akka/testkit/TestKit.scala | 22 +- .../src/main/scala/akka/testkit/package.scala | 1 - .../test/scala/akka/testkit/AkkaSpec.scala | 7 +- .../scala/akka/testkit/AkkaSpecSpec.scala | 4 +- .../src/test/scala/akka/testkit/Coroner.scala | 2 +- .../scala/akka/testkit/TestTimeSpec.scala | 2 +- .../metrics/FileDescriptorMetricSet.scala | 6 +- .../akka/testkit/metrics/HdrHistogram.scala | 4 +- .../akka/testkit/metrics/MetricsKit.scala | 2 +- .../akka/testkit/metrics/MetricsKitOps.scala | 2 +- .../reporter/AkkaConsoleReporter.scala | 4 +- .../main/scala/akka/typed/ActorContext.scala | 12 +- .../main/scala/akka/typed/ActorSystem.scala | 4 +- .../src/main/scala/akka/typed/Ask.scala | 6 +- .../src/main/scala/akka/typed/Behavior.scala | 1 - .../scala/akka/typed/ActorContextSpec.scala | 9 +- .../src/test/scala/akka/typed/StepWise.scala | 2 +- .../src/test/scala/akka/typed/TypedSpec.scala | 10 +- project/Formatting.scala | 28 ++- project/plugins.sbt | 2 +- 616 files changed, 5966 insertions(+), 5436 deletions(-) diff --git a/akka-actor-tests/src/test/scala/akka/actor/ActorLifeCycleSpec.scala b/akka-actor-tests/src/test/scala/akka/actor/ActorLifeCycleSpec.scala index e3704ca54f..fbfb9bee6f 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/ActorLifeCycleSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/ActorLifeCycleSpec.scala @@ -101,7 +101,8 @@ class ActorLifeCycleSpec extends AkkaSpec("akka.actor.serialize-messages=off") w "not invoke preRestart and postRestart when never restarted using OneForOneStrategy" in { val id = newUuid().toString - val supervisor = system.actorOf(Props(classOf[Supervisor], + val supervisor = system.actorOf(Props( + classOf[Supervisor], OneForOneStrategy(maxNrOfRetries = 3)(List(classOf[Exception])))) val gen = new AtomicInteger(0) val props = Props(classOf[LifeCycleTestActor], testActor, id, gen) diff --git a/akka-actor-tests/src/test/scala/akka/actor/ActorLookupSpec.scala b/akka-actor-tests/src/test/scala/akka/actor/ActorLookupSpec.scala index a3edc5468c..be1e537eee 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/ActorLookupSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/ActorLookupSpec.scala @@ -249,14 +249,14 @@ class ActorLookupSpec extends AkkaSpec with DefaultTimeout { val lookname = looker.path.elements.mkString("", "/", "/") for ( (l, r) ← Seq( - LookupString("a/b/c") -> empty(lookname + "a/b/c"), - LookupString("") -> system.deadLetters, - LookupString("akka://all-systems/Nobody") -> system.deadLetters, - LookupPath(system / "hallo") -> empty("user/hallo"), - LookupPath(looker.path child "hallo") -> empty(lookname + "hallo"), // test Java API - LookupPath(looker.path descendant Seq("a", "b").asJava) -> empty(lookname + "a/b"), // test Java API - LookupElems(Seq()) -> system.deadLetters, - LookupElems(Seq("a")) -> empty(lookname + "a")) + LookupString("a/b/c") → empty(lookname + "a/b/c"), + LookupString("") → system.deadLetters, + LookupString("akka://all-systems/Nobody") → system.deadLetters, + LookupPath(system / "hallo") → empty("user/hallo"), + LookupPath(looker.path child "hallo") → empty(lookname + "hallo"), // test Java API + LookupPath(looker.path descendant Seq("a", "b").asJava) → empty(lookname + "a/b"), // test Java API + LookupElems(Seq()) → system.deadLetters, + LookupElems(Seq("a")) → empty(lookname + "a")) ) checkOne(looker, l, r) } for (looker ← all) check(looker) diff --git a/akka-actor-tests/src/test/scala/akka/actor/ActorMailboxSpec.scala b/akka-actor-tests/src/test/scala/akka/actor/ActorMailboxSpec.scala index 6d4f2a7d3f..34a7cbccaa 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/ActorMailboxSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/ActorMailboxSpec.scala @@ -210,7 +210,8 @@ object ActorMailboxSpec { final case class MCBoundedMailbox(val capacity: Int, val pushTimeOut: FiniteDuration) extends MailboxType with ProducesMessageQueue[MCBoundedMessageQueueSemantics] { - def this(settings: ActorSystem.Settings, config: Config) = this(config.getInt("mailbox-capacity"), + def this(settings: ActorSystem.Settings, config: Config) = this( + config.getInt("mailbox-capacity"), config.getNanosDuration("mailbox-push-timeout-time")) final override def create(owner: Option[ActorRef], system: Option[ActorSystem]): MessageQueue = @@ -241,23 +242,29 @@ class ActorMailboxSpec(conf: Config) extends AkkaSpec(conf) with DefaultTimeout } "get an unbounded deque message queue when it is only configured on the props" in { - checkMailboxQueue(Props[QueueReportingActor].withMailbox("akka.actor.mailbox.unbounded-deque-based"), + checkMailboxQueue( + Props[QueueReportingActor].withMailbox("akka.actor.mailbox.unbounded-deque-based"), "default-override-from-props", UnboundedDeqMailboxTypes) } "get an bounded message queue when it's only configured with RequiresMailbox" in { - checkMailboxQueue(Props[BoundedQueueReportingActor], + checkMailboxQueue( + Props[BoundedQueueReportingActor], "default-override-from-trait", BoundedMailboxTypes) } "get an unbounded deque message queue when it's only mixed with Stash" in { - checkMailboxQueue(Props[StashQueueReportingActor], + checkMailboxQueue( + Props[StashQueueReportingActor], "default-override-from-stash", UnboundedDeqMailboxTypes) - checkMailboxQueue(Props(new StashQueueReportingActor), + checkMailboxQueue( + Props(new StashQueueReportingActor), "default-override-from-stash2", UnboundedDeqMailboxTypes) - checkMailboxQueue(Props(classOf[StashQueueReportingActorWithParams], 17, "hello"), + checkMailboxQueue( + Props(classOf[StashQueueReportingActorWithParams], 17, "hello"), "default-override-from-stash3", UnboundedDeqMailboxTypes) - checkMailboxQueue(Props(new StashQueueReportingActorWithParams(17, "hello")), + checkMailboxQueue( + Props(new StashQueueReportingActorWithParams(17, "hello")), "default-override-from-stash4", UnboundedDeqMailboxTypes) } @@ -278,12 +285,14 @@ class ActorMailboxSpec(conf: Config) extends AkkaSpec(conf) with DefaultTimeout } "get an bounded control aware message queue when it's only configured with RequiresMailbox" in { - checkMailboxQueue(Props[BoundedControlAwareQueueReportingActor], + checkMailboxQueue( + Props[BoundedControlAwareQueueReportingActor], "default-override-from-trait-bounded-control-aware", BoundedControlAwareMailboxTypes) } "get an unbounded control aware message queue when it's only configured with RequiresMailbox" in { - checkMailboxQueue(Props[UnboundedControlAwareQueueReportingActor], + checkMailboxQueue( + Props[UnboundedControlAwareQueueReportingActor], "default-override-from-trait-unbounded-control-aware", UnboundedControlAwareMailboxTypes) } @@ -317,7 +326,8 @@ class ActorMailboxSpec(conf: Config) extends AkkaSpec(conf) with DefaultTimeout } "get an unbounded message queue overriding configuration on the props" in { - checkMailboxQueue(Props[QueueReportingActor].withMailbox("akka.actor.mailbox.unbounded-deque-based"), + checkMailboxQueue( + Props[QueueReportingActor].withMailbox("akka.actor.mailbox.unbounded-deque-based"), "bounded-unbounded-override-props", UnboundedMailboxTypes) } @@ -401,17 +411,20 @@ class ActorMailboxSpec(conf: Config) extends AkkaSpec(conf) with DefaultTimeout } "get an unbounded message queue with a balancing dispatcher" in { - checkMailboxQueue(Props[QueueReportingActor].withDispatcher("balancing-dispatcher"), + checkMailboxQueue( + Props[QueueReportingActor].withDispatcher("balancing-dispatcher"), "unbounded-balancing", UnboundedMailboxTypes) } "get a bounded message queue with a balancing bounded dispatcher" in { - checkMailboxQueue(Props[QueueReportingActor].withDispatcher("balancing-bounded-dispatcher"), + checkMailboxQueue( + Props[QueueReportingActor].withDispatcher("balancing-bounded-dispatcher"), "bounded-balancing", BoundedMailboxTypes) } "get a bounded message queue with a requiring balancing bounded dispatcher" in { - checkMailboxQueue(Props[QueueReportingActor].withDispatcher("requiring-balancing-bounded-dispatcher"), + checkMailboxQueue( + Props[QueueReportingActor].withDispatcher("requiring-balancing-bounded-dispatcher"), "requiring-bounded-balancing", BoundedMailboxTypes) } } diff --git a/akka-actor-tests/src/test/scala/akka/actor/ActorSelectionSpec.scala b/akka-actor-tests/src/test/scala/akka/actor/ActorSelectionSpec.scala index 04a2ee9702..f6f2fdbada 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/ActorSelectionSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/ActorSelectionSpec.scala @@ -65,7 +65,8 @@ class ActorSelectionSpec extends AkkaSpec("akka.loglevel=DEBUG") with DefaultTim asked.correlationId should ===(selection) implicit val ec = system.dispatcher - val resolved = Await.result(selection.resolveOne(timeout.duration).mapTo[ActorRef] recover { case _ ⇒ null }, + val resolved = Await.result( + selection.resolveOne(timeout.duration).mapTo[ActorRef] recover { case _ ⇒ null }, timeout.duration) Option(resolved) should ===(result) @@ -248,11 +249,11 @@ class ActorSelectionSpec extends AkkaSpec("akka.loglevel=DEBUG") with DefaultTim val lookname = looker.path.elements.mkString("", "/", "/") for ( (l, r) ← Seq( - SelectString("a/b/c") -> None, - SelectString("akka://all-systems/Nobody") -> None, - SelectPath(system / "hallo") -> None, - SelectPath(looker.path child "hallo") -> None, // test Java API - SelectPath(looker.path descendant Seq("a", "b").asJava) -> None) // test Java API + SelectString("a/b/c") → None, + SelectString("akka://all-systems/Nobody") → None, + SelectPath(system / "hallo") → None, + SelectPath(looker.path child "hallo") → None, // test Java API + SelectPath(looker.path descendant Seq("a", "b").asJava) → None) // test Java API ) checkOne(looker, l, r) } for (looker ← all) check(looker) diff --git a/akka-actor-tests/src/test/scala/akka/actor/ActorSystemSpec.scala b/akka-actor-tests/src/test/scala/akka/actor/ActorSystemSpec.scala index 933dd207e6..fa592e5e89 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/ActorSystemSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/ActorSystemSpec.scala @@ -273,7 +273,8 @@ class ActorSystemSpec extends AkkaSpec(ActorSystemSpec.config) with ImplicitSend } "allow configuration of guardian supervisor strategy" in { - implicit val system = ActorSystem("Stop", + implicit val system = ActorSystem( + "Stop", ConfigFactory.parseString("akka.actor.guardian-supervisor-strategy=akka.actor.StoppingSupervisorStrategy") .withFallback(AkkaSpec.testConf)) val a = system.actorOf(Props(new Actor { @@ -293,7 +294,8 @@ class ActorSystemSpec extends AkkaSpec(ActorSystemSpec.config) with ImplicitSend } "shut down when /user escalates" in { - implicit val system = ActorSystem("Stop", + implicit val system = ActorSystem( + "Stop", ConfigFactory.parseString("akka.actor.guardian-supervisor-strategy=\"akka.actor.ActorSystemSpec$Strategy\"") .withFallback(AkkaSpec.testConf)) val a = system.actorOf(Props(new Actor { diff --git a/akka-actor-tests/src/test/scala/akka/actor/ExtensionSpec.scala b/akka-actor-tests/src/test/scala/akka/actor/ExtensionSpec.scala index 83f13faac5..ad34e3678e 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/ExtensionSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/ExtensionSpec.scala @@ -8,12 +8,11 @@ import java.util.concurrent.atomic.AtomicInteger import akka.testkit.EventFilter import akka.testkit.TestKit._ import com.typesafe.config.ConfigFactory -import org.scalatest.{Matchers, WordSpec} +import org.scalatest.{ Matchers, WordSpec } import org.scalatest.junit.JUnitSuiteLike import scala.util.control.NoStackTrace - class JavaExtensionSpec extends JavaExtension with JUnitSuiteLike object TestExtension extends ExtensionId[TestExtension] with ExtensionIdProvider { @@ -52,7 +51,6 @@ class FailingTestExtension(val system: ExtendedActorSystem) extends Extension { throw new FailingTestExtension.TestException } - class ExtensionSpec extends WordSpec with Matchers { "The ActorSystem extensions support" should { @@ -83,9 +81,8 @@ class ExtensionSpec extends WordSpec with Matchers { shutdownActorSystem(system) } - "fail the actor system if an extension listed in akka.extensions fails to start" in { - intercept[RuntimeException]{ + intercept[RuntimeException] { val system = ActorSystem("failing", ConfigFactory.parseString( """ akka.extensions = ["akka.actor.FailingTestExtension"] @@ -134,7 +131,6 @@ class ExtensionSpec extends WordSpec with Matchers { } } - } } diff --git a/akka-actor-tests/src/test/scala/akka/actor/FSMActorSpec.scala b/akka-actor-tests/src/test/scala/akka/actor/FSMActorSpec.scala index 15e975572e..d97da96b9f 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/FSMActorSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/FSMActorSpec.scala @@ -34,6 +34,7 @@ object FSMActorSpec { class Lock(code: String, timeout: FiniteDuration, latches: Latches) extends Actor with FSM[LockState, CodeState] { import latches._ + import FSM.`→` startWith(Locked, CodeState("", code)) @@ -71,7 +72,7 @@ object FSMActorSpec { } onTransition { - case Locked -> Open ⇒ transitionLatch.open + case Locked → Open ⇒ transitionLatch.open } // verify that old-style does still compile @@ -98,8 +99,9 @@ object FSMActorSpec { final case class CodeState(soFar: String, code: String) } -class FSMActorSpec extends AkkaSpec(Map("akka.actor.debug.fsm" -> true)) with ImplicitSender { +class FSMActorSpec extends AkkaSpec(Map("akka.actor.debug.fsm" → true)) with ImplicitSender { import FSMActorSpec._ + import FSM.`→` val timeout = Timeout(2 seconds) @@ -222,7 +224,7 @@ class FSMActorSpec extends AkkaSpec(Map("akka.actor.debug.fsm" -> true)) with Im case Event("stop", _) ⇒ stop() } onTransition { - case "not-started" -> "started" ⇒ + case "not-started" → "started" ⇒ for (timerName ← timerNames) setTimer(timerName, (), 10 seconds, false) } onTermination { @@ -250,8 +252,8 @@ class FSMActorSpec extends AkkaSpec(Map("akka.actor.debug.fsm" -> true)) with Im "log events and transitions if asked to do so" in { import scala.collection.JavaConverters._ - val config = ConfigFactory.parseMap(Map("akka.loglevel" -> "DEBUG", "akka.actor.serialize-messages" -> "off", - "akka.actor.debug.fsm" -> true).asJava).withFallback(system.settings.config) + val config = ConfigFactory.parseMap(Map("akka.loglevel" → "DEBUG", "akka.actor.serialize-messages" → "off", + "akka.actor.debug.fsm" → true).asJava).withFallback(system.settings.config) val fsmEventSystem = ActorSystem("fsmEvent", config) try { new TestKit(fsmEventSystem) { diff --git a/akka-actor-tests/src/test/scala/akka/actor/FSMTimingSpec.scala b/akka-actor-tests/src/test/scala/akka/actor/FSMTimingSpec.scala index 0e45a1e3e5..1d405e6107 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/FSMTimingSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/FSMTimingSpec.scala @@ -129,7 +129,8 @@ class FSMTimingSpec extends AkkaSpec with ImplicitSender { } "notify unhandled messages" taggedAs TimingTest in { - filterEvents(EventFilter.warning("unhandled event Tick in state TestUnhandled", source = fsm.path.toString, occurrences = 1), + filterEvents( + EventFilter.warning("unhandled event Tick in state TestUnhandled", source = fsm.path.toString, occurrences = 1), EventFilter.warning("unhandled event Unhandled(test) in state TestUnhandled", source = fsm.path.toString, occurrences = 1)) { fsm ! TestUnhandled within(3 second) { @@ -208,7 +209,7 @@ object FSMTimingSpec { goto(Initial) } onTransition { - case Initial -> TestSingleTimerResubmit ⇒ setTimer("blah", Tick, 500.millis.dilated) + case Initial → TestSingleTimerResubmit ⇒ setTimer("blah", Tick, 500.millis.dilated) } when(TestSingleTimerResubmit) { case Event(Tick, _) ⇒ diff --git a/akka-actor-tests/src/test/scala/akka/actor/FSMTransitionSpec.scala b/akka-actor-tests/src/test/scala/akka/actor/FSMTransitionSpec.scala index c150e68370..6096e8202f 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/FSMTransitionSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/FSMTransitionSpec.scala @@ -9,6 +9,7 @@ import scala.concurrent.duration._ import scala.language.postfixOps object FSMTransitionSpec { + import FSM.`→` class Supervisor extends Actor { def receive = { case _ ⇒ } @@ -20,7 +21,7 @@ object FSMTransitionSpec { case Event("stay", _) ⇒ stay() case Event(_, _) ⇒ goto(0) } - onTransition { case from -> to ⇒ target ! (from -> to) } + onTransition { case from → to ⇒ target ! (from → to) } initialize() } @@ -50,8 +51,8 @@ object FSMTransitionSpec { case _ ⇒ goto(1) } onTransition { - case 0 -> 1 ⇒ target ! ((stateData, nextStateData)) - case 1 -> 1 ⇒ target ! ((stateData, nextStateData)) + case 0 → 1 ⇒ target ! ((stateData, nextStateData)) + case 1 → 1 ⇒ target ! ((stateData, nextStateData)) } } @@ -64,16 +65,17 @@ object FSMTransitionSpec { class FSMTransitionSpec extends AkkaSpec with ImplicitSender { import FSMTransitionSpec._ + import FSM.`→` "A FSM transition notifier" must { "not trigger onTransition for stay" in { val fsm = system.actorOf(Props(new SendAnyTransitionFSM(testActor))) - expectMsg(0 -> 0) // caused by initialize(), OK. + expectMsg(0 → 0) // caused by initialize(), OK. fsm ! "stay" // no transition event expectNoMsg(500.millis) fsm ! "goto" // goto(current state) - expectMsg(0 -> 0) + expectMsg(0 → 0) } "notify listeners" in { @@ -150,7 +152,7 @@ class FSMTransitionSpec extends AkkaSpec with ImplicitSender { case Event("switch", _) ⇒ goto(1) using sender() } onTransition { - case x -> y ⇒ nextStateData ! (x -> y) + case x → y ⇒ nextStateData ! (x → y) } when(1) { case Event("test", _) ⇒ diff --git a/akka-actor-tests/src/test/scala/akka/actor/SupervisorHierarchySpec.scala b/akka-actor-tests/src/test/scala/akka/actor/SupervisorHierarchySpec.scala index 023878e452..65586df6e2 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/SupervisorHierarchySpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/SupervisorHierarchySpec.scala @@ -26,6 +26,8 @@ import java.lang.System.identityHashCode import akka.util.Helpers.ConfigOps object SupervisorHierarchySpec { + import FSM.`→` + class FireWorkerException(msg: String) extends Exception(msg) /** @@ -79,7 +81,8 @@ object SupervisorHierarchySpec { extends DispatcherConfigurator(config, prerequisites) { private val instance: MessageDispatcher = - new Dispatcher(this, + new Dispatcher( + this, config.getString("id"), config.getInt("throughput"), config.getNanosDuration("throughput-deadline-time"), @@ -467,7 +470,7 @@ object SupervisorHierarchySpec { } onTransition { - case Init -> Stress ⇒ + case Init → Stress ⇒ self ! Work idleChildren = children activeChildren = children @@ -532,7 +535,7 @@ object SupervisorHierarchySpec { } onTransition { - case Stress -> Finishing ⇒ ignoreFailConstr = true + case Stress → Finishing ⇒ ignoreFailConstr = true } when(Finishing) { @@ -546,7 +549,7 @@ object SupervisorHierarchySpec { } onTransition { - case _ -> LastPing ⇒ + case _ → LastPing ⇒ idleChildren foreach (_ ! "ping") pingChildren ++= idleChildren idleChildren = Vector.empty @@ -563,7 +566,7 @@ object SupervisorHierarchySpec { } onTransition { - case _ -> Stopping ⇒ + case _ → Stopping ⇒ ignoreNotResumedLogs = false hierarchy ! PingOfDeath } @@ -596,7 +599,7 @@ object SupervisorHierarchySpec { stop } case Event(StateTimeout, _) ⇒ - errors :+= self -> ErrorLog("timeout while Stopping", Vector.empty) + errors :+= self → ErrorLog("timeout while Stopping", Vector.empty) println(system.asInstanceOf[ActorSystemImpl].printTree) getErrors(hierarchy, 10) printErrors() @@ -604,7 +607,7 @@ object SupervisorHierarchySpec { testActor ! "timeout in Stopping" stop case Event(e: ErrorLog, _) ⇒ - errors :+= sender() -> e + errors :+= sender() → e goto(Failed) } @@ -630,7 +633,7 @@ object SupervisorHierarchySpec { when(Failed, stateTimeout = 5.seconds.dilated) { case Event(e: ErrorLog, _) ⇒ if (!e.msg.startsWith("not resumed") || !ignoreNotResumedLogs) - errors :+= sender() -> e + errors :+= sender() → e stay case Event(Terminated(r), _) if r == hierarchy ⇒ printErrors() @@ -650,8 +653,8 @@ object SupervisorHierarchySpec { target match { case l: LocalActorRef ⇒ l.underlying.actor match { - case h: Hierarchy ⇒ errors :+= target -> ErrorLog("forced", h.log) - case _ ⇒ errors :+= target -> ErrorLog("fetched", stateCache.get(target.path).log) + case h: Hierarchy ⇒ errors :+= target → ErrorLog("forced", h.log) + case _ ⇒ errors :+= target → ErrorLog("fetched", stateCache.get(target.path).log) } if (depth > 0) { l.underlying.children foreach (getErrors(_, depth - 1)) @@ -663,8 +666,8 @@ object SupervisorHierarchySpec { target match { case l: LocalActorRef ⇒ l.underlying.actor match { - case h: Hierarchy ⇒ errors :+= target -> ErrorLog("forced", h.log) - case _ ⇒ errors :+= target -> ErrorLog("fetched", stateCache.get(target.path).log) + case h: Hierarchy ⇒ errors :+= target → ErrorLog("forced", h.log) + case _ ⇒ errors :+= target → ErrorLog("fetched", stateCache.get(target.path).log) } if (target != hierarchy) getErrorsUp(l.getParent) } @@ -693,7 +696,7 @@ object SupervisorHierarchySpec { case Event(e: ErrorLog, _) ⇒ if (e.msg.startsWith("not resumed")) stay else { - errors :+= sender() -> e + errors :+= sender() → e // don’t stop the hierarchy, that is going to happen all by itself and in the right order goto(Failed) } diff --git a/akka-actor-tests/src/test/scala/akka/actor/SupervisorMiscSpec.scala b/akka-actor-tests/src/test/scala/akka/actor/SupervisorMiscSpec.scala index dc02187aa3..0efc29a02d 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/SupervisorMiscSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/SupervisorMiscSpec.scala @@ -58,7 +58,7 @@ class SupervisorMiscSpec extends AkkaSpec(SupervisorMiscSpec.config) with Defaul countDownLatch.await(10, TimeUnit.SECONDS) - Seq("actor1" -> actor1, "actor2" -> actor2, "actor3" -> actor3, "actor4" -> actor4) map { + Seq("actor1" → actor1, "actor2" → actor2, "actor3" → actor3, "actor4" → actor4) map { case (id, ref) ⇒ (id, ref ? "status") } foreach { case (id, f) ⇒ (id, Await.result(f, timeout.duration)) should ===((id, "OK")) diff --git a/akka-actor-tests/src/test/scala/akka/actor/UidClashTest.scala b/akka-actor-tests/src/test/scala/akka/actor/UidClashTest.scala index a461b7d520..013fe2cd21 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/UidClashTest.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/UidClashTest.scala @@ -16,9 +16,10 @@ object UidClashTest { @volatile var oldActor: ActorRef = _ - private[akka] class EvilCollidingActorRef(override val provider: ActorRefProvider, - override val path: ActorPath, - val eventStream: EventStream) extends MinimalActorRef { + private[akka] class EvilCollidingActorRef( + override val provider: ActorRefProvider, + override val path: ActorPath, + val eventStream: EventStream) extends MinimalActorRef { //Ignore everything override def isTerminated: Boolean = true diff --git a/akka-actor-tests/src/test/scala/akka/actor/dispatch/ActorModelSpec.scala b/akka-actor-tests/src/test/scala/akka/actor/dispatch/ActorModelSpec.scala index e22443d0f0..5d4fd68501 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/dispatch/ActorModelSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/dispatch/ActorModelSpec.scala @@ -181,13 +181,13 @@ object ActorModelSpec { dispatcher.asInstanceOf[MessageDispatcherInterceptor].getStats(actorRef) def assertRefDefaultZero(actorRef: ActorRef, dispatcher: MessageDispatcher = null)( - suspensions: Long = 0, - resumes: Long = 0, - registers: Long = 0, - unregisters: Long = 0, - msgsReceived: Long = 0, + suspensions: Long = 0, + resumes: Long = 0, + registers: Long = 0, + unregisters: Long = 0, + msgsReceived: Long = 0, msgsProcessed: Long = 0, - restarts: Long = 0)(implicit system: ActorSystem) { + restarts: Long = 0)(implicit system: ActorSystem) { assertRef(actorRef, dispatcher)( suspensions, resumes, @@ -199,13 +199,13 @@ object ActorModelSpec { } def assertRef(actorRef: ActorRef, dispatcher: MessageDispatcher = null)( - suspensions: Long = statsFor(actorRef, dispatcher).suspensions.get(), - resumes: Long = statsFor(actorRef, dispatcher).resumes.get(), - registers: Long = statsFor(actorRef, dispatcher).registers.get(), - unregisters: Long = statsFor(actorRef, dispatcher).unregisters.get(), - msgsReceived: Long = statsFor(actorRef, dispatcher).msgsReceived.get(), + suspensions: Long = statsFor(actorRef, dispatcher).suspensions.get(), + resumes: Long = statsFor(actorRef, dispatcher).resumes.get(), + registers: Long = statsFor(actorRef, dispatcher).registers.get(), + unregisters: Long = statsFor(actorRef, dispatcher).unregisters.get(), + msgsReceived: Long = statsFor(actorRef, dispatcher).msgsReceived.get(), msgsProcessed: Long = statsFor(actorRef, dispatcher).msgsProcessed.get(), - restarts: Long = statsFor(actorRef, dispatcher).restarts.get())(implicit system: ActorSystem) { + restarts: Long = statsFor(actorRef, dispatcher).restarts.get())(implicit system: ActorSystem) { val stats = statsFor(actorRef, Option(dispatcher).getOrElse(actorRef.asInstanceOf[ActorRefWithCell].underlying.asInstanceOf[ActorCell].dispatcher)) val deadline = System.currentTimeMillis + 1000 try { @@ -218,7 +218,8 @@ object ActorModelSpec { await(deadline)(stats.restarts.get() == restarts) } catch { case e: Throwable ⇒ - system.eventStream.publish(Error(e, + system.eventStream.publish(Error( + e, Option(dispatcher).toString, (Option(dispatcher) getOrElse this).getClass, "actual: " + stats + ", required: InterceptorStats(susp=" + suspensions + @@ -529,7 +530,8 @@ object DispatcherModelSpec { import akka.util.Helpers.ConfigOps private val instance: MessageDispatcher = - new Dispatcher(this, + new Dispatcher( + this, config.getString("id"), config.getInt("throughput"), config.getNanosDuration("throughput-deadline-time"), @@ -602,7 +604,8 @@ object BalancingDispatcherModelSpec { import akka.util.Helpers.ConfigOps override protected def create(mailboxType: MailboxType): BalancingDispatcher = - new BalancingDispatcher(this, + new BalancingDispatcher( + this, config.getString("id"), config.getInt("throughput"), config.getNanosDuration("throughput-deadline-time"), diff --git a/akka-actor-tests/src/test/scala/akka/actor/dispatch/DispatchersSpec.scala b/akka-actor-tests/src/test/scala/akka/actor/dispatch/DispatchersSpec.scala index 386cd592e2..aecd44928d 100644 --- a/akka-actor-tests/src/test/scala/akka/actor/dispatch/DispatchersSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/actor/dispatch/DispatchersSpec.scala @@ -104,15 +104,15 @@ class DispatchersSpec extends AkkaSpec(DispatchersSpec.config) with ImplicitSend def ofType[T <: MessageDispatcher: ClassTag]: (MessageDispatcher) ⇒ Boolean = _.getClass == implicitly[ClassTag[T]].runtimeClass def typesAndValidators: Map[String, (MessageDispatcher) ⇒ Boolean] = Map( - "PinnedDispatcher" -> ofType[PinnedDispatcher], - "Dispatcher" -> ofType[Dispatcher]) + "PinnedDispatcher" → ofType[PinnedDispatcher], + "Dispatcher" → ofType[Dispatcher]) def validTypes = typesAndValidators.keys.toList val defaultDispatcherConfig = settings.config.getConfig("akka.actor.default-dispatcher") lazy val allDispatchers: Map[String, MessageDispatcher] = { - validTypes.map(t ⇒ (t, from(ConfigFactory.parseMap(Map(tipe -> t, id -> t).asJava). + validTypes.map(t ⇒ (t, from(ConfigFactory.parseMap(Map(tipe → t, id → t).asJava). withFallback(defaultDispatcherConfig)))).toMap } @@ -150,7 +150,7 @@ class DispatchersSpec extends AkkaSpec(DispatchersSpec.config) with ImplicitSend "throw ConfigurationException if type does not exist" in { intercept[ConfigurationException] { - from(ConfigFactory.parseMap(Map(tipe -> "typedoesntexist", id -> "invalid-dispatcher").asJava). + from(ConfigFactory.parseMap(Map(tipe → "typedoesntexist", id → "invalid-dispatcher").asJava). withFallback(defaultDispatcherConfig)) } } diff --git a/akka-actor-tests/src/test/scala/akka/dispatch/MailboxConfigSpec.scala b/akka-actor-tests/src/test/scala/akka/dispatch/MailboxConfigSpec.scala index d7209c65b0..147a11b43f 100644 --- a/akka-actor-tests/src/test/scala/akka/dispatch/MailboxConfigSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/dispatch/MailboxConfigSpec.scala @@ -125,55 +125,57 @@ abstract class MailboxSpec extends AkkaSpec with BeforeAndAfterAll with BeforeAn q.hasMessages should ===(false) } - def testEnqueueDequeue(config: MailboxType, - enqueueN: Int = 10000, - dequeueN: Int = 10000, - parallel: Boolean = true): Unit = within(10 seconds) { + def testEnqueueDequeue( + config: MailboxType, + enqueueN: Int = 10000, + dequeueN: Int = 10000, + parallel: Boolean = true): Unit = within(10 seconds) { val q = factory(config) ensureInitialMailboxState(config, q) - EventFilter.warning(pattern = ".*received dead letter from Actor.*MailboxSpec/deadLetters.*", + EventFilter.warning( + pattern = ".*received dead letter from Actor.*MailboxSpec/deadLetters.*", occurrences = (enqueueN - dequeueN)) intercept { - def createProducer(fromNum: Int, toNum: Int): Future[Vector[Envelope]] = spawn { - val messages = Vector() ++ (for (i ← fromNum to toNum) yield createMessageInvocation(i)) - for (i ← messages) q.enqueue(testActor, i) - messages - } - - val producers = { - val step = 500 - val ps = for (i ← (1 to enqueueN by step).toList) yield createProducer(i, Math.min(enqueueN, i + step - 1)) - - if (parallel == false) - ps foreach { Await.ready(_, remainingOrDefault) } - - ps - } - - def createConsumer: Future[Vector[Envelope]] = spawn { - var r = Vector[Envelope]() - - while (producers.exists(_.isCompleted == false) || q.hasMessages) - Option(q.dequeue) foreach { message ⇒ r = r :+ message } - - r - } - - val consumers = List.fill(maxConsumers)(createConsumer) - - val ps = producers.map(Await.result(_, remainingOrDefault)) - val cs = consumers.map(Await.result(_, remainingOrDefault)) - - ps.map(_.size).sum should ===(enqueueN) //Must have produced 1000 messages - cs.map(_.size).sum should ===(dequeueN) //Must have consumed all produced messages - //No message is allowed to be consumed by more than one consumer - cs.flatten.distinct.size should ===(dequeueN) - //All consumed messages should have been produced - (cs.flatten diff ps.flatten).size should ===(0) - //The ones that were produced and not consumed - (ps.flatten diff cs.flatten).size should ===(enqueueN - dequeueN) + def createProducer(fromNum: Int, toNum: Int): Future[Vector[Envelope]] = spawn { + val messages = Vector() ++ (for (i ← fromNum to toNum) yield createMessageInvocation(i)) + for (i ← messages) q.enqueue(testActor, i) + messages } + + val producers = { + val step = 500 + val ps = for (i ← (1 to enqueueN by step).toList) yield createProducer(i, Math.min(enqueueN, i + step - 1)) + + if (parallel == false) + ps foreach { Await.ready(_, remainingOrDefault) } + + ps + } + + def createConsumer: Future[Vector[Envelope]] = spawn { + var r = Vector[Envelope]() + + while (producers.exists(_.isCompleted == false) || q.hasMessages) + Option(q.dequeue) foreach { message ⇒ r = r :+ message } + + r + } + + val consumers = List.fill(maxConsumers)(createConsumer) + + val ps = producers.map(Await.result(_, remainingOrDefault)) + val cs = consumers.map(Await.result(_, remainingOrDefault)) + + ps.map(_.size).sum should ===(enqueueN) //Must have produced 1000 messages + cs.map(_.size).sum should ===(dequeueN) //Must have consumed all produced messages + //No message is allowed to be consumed by more than one consumer + cs.flatten.distinct.size should ===(dequeueN) + //All consumed messages should have been produced + (cs.flatten diff ps.flatten).size should ===(0) + //The ones that were produced and not consumed + (ps.flatten diff cs.flatten).size should ===(enqueueN - dequeueN) + } } } diff --git a/akka-actor-tests/src/test/scala/akka/event/EventBusSpec.scala b/akka-actor-tests/src/test/scala/akka/event/EventBusSpec.scala index 11d04ec6b4..344eb161f2 100644 --- a/akka-actor-tests/src/test/scala/akka/event/EventBusSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/event/EventBusSpec.scala @@ -10,8 +10,8 @@ import org.scalatest.BeforeAndAfterEach import akka.testkit._ import scala.concurrent.duration._ -import akka.actor.{ Props, Actor, ActorRef, ActorSystem, PoisonPill} -import akka.japi.{ Procedure} +import akka.actor.{ Props, Actor, ActorRef, ActorSystem, PoisonPill } +import akka.japi.{ Procedure } import com.typesafe.config.{ Config, ConfigFactory } object EventBusSpec { diff --git a/akka-actor-tests/src/test/scala/akka/event/LoggerSpec.scala b/akka-actor-tests/src/test/scala/akka/event/LoggerSpec.scala index a62ec761e8..88c5592863 100644 --- a/akka-actor-tests/src/test/scala/akka/event/LoggerSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/event/LoggerSpec.scala @@ -117,10 +117,10 @@ object LoggerSpec { override def mdc(currentMessage: Any): MDC = { reqId += 1 - val always = Map("requestId" -> reqId) + val always = Map("requestId" → reqId) val cmim = "Current Message in MDC" val perMessage = currentMessage match { - case `cmim` ⇒ Map[String, Any]("currentMsg" -> cmim, "currentMsgLength" -> cmim.length) + case `cmim` ⇒ Map[String, Any]("currentMsg" → cmim, "currentMsgLength" → cmim.length) case _ ⇒ Map() } always ++ perMessage diff --git a/akka-actor-tests/src/test/scala/akka/event/LoggingReceiveSpec.scala b/akka-actor-tests/src/test/scala/akka/event/LoggingReceiveSpec.scala index 063ee72f9f..02e84f44d1 100644 --- a/akka-actor-tests/src/test/scala/akka/event/LoggingReceiveSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/event/LoggingReceiveSpec.scala @@ -28,9 +28,9 @@ class LoggingReceiveSpec extends WordSpec with BeforeAndAfterAll { akka.loglevel=DEBUG akka.actor.serialize-messages = off # debug noise from serialization """).withFallback(AkkaSpec.testConf) - val appLogging = ActorSystem("logging", ConfigFactory.parseMap(Map("akka.actor.debug.receive" -> true).asJava).withFallback(config)) - val appAuto = ActorSystem("autoreceive", ConfigFactory.parseMap(Map("akka.actor.debug.autoreceive" -> true).asJava).withFallback(config)) - val appLifecycle = ActorSystem("lifecycle", ConfigFactory.parseMap(Map("akka.actor.debug.lifecycle" -> true).asJava).withFallback(config)) + val appLogging = ActorSystem("logging", ConfigFactory.parseMap(Map("akka.actor.debug.receive" → true).asJava).withFallback(config)) + val appAuto = ActorSystem("autoreceive", ConfigFactory.parseMap(Map("akka.actor.debug.autoreceive" → true).asJava).withFallback(config)) + val appLifecycle = ActorSystem("lifecycle", ConfigFactory.parseMap(Map("akka.actor.debug.lifecycle" → true).asJava).withFallback(config)) val filter = TestEvent.Mute(EventFilter.custom { case _: Logging.Debug ⇒ true diff --git a/akka-actor-tests/src/test/scala/akka/io/TcpConnectionSpec.scala b/akka-actor-tests/src/test/scala/akka/io/TcpConnectionSpec.scala index dd324fb596..1dcacf1b0d 100644 --- a/akka-actor-tests/src/test/scala/akka/io/TcpConnectionSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/io/TcpConnectionSpec.scala @@ -886,10 +886,11 @@ class TcpConnectionSpec extends AkkaSpec(""" def setServerSocketOptions() = () - def createConnectionActor(serverAddress: InetSocketAddress = serverAddress, - options: immutable.Seq[SocketOption] = Nil, - timeout: Option[FiniteDuration] = None, - pullMode: Boolean = false): TestActorRef[TcpOutgoingConnection] = { + def createConnectionActor( + serverAddress: InetSocketAddress = serverAddress, + options: immutable.Seq[SocketOption] = Nil, + timeout: Option[FiniteDuration] = None, + pullMode: Boolean = false): TestActorRef[TcpOutgoingConnection] = { val ref = createConnectionActorWithoutRegistration(serverAddress, options, timeout, pullMode) ref ! newChannelRegistration ref @@ -901,10 +902,11 @@ class TcpConnectionSpec extends AkkaSpec(""" def disableInterest(op: Int): Unit = interestCallReceiver.ref ! -op } - def createConnectionActorWithoutRegistration(serverAddress: InetSocketAddress = serverAddress, - options: immutable.Seq[SocketOption] = Nil, - timeout: Option[FiniteDuration] = None, - pullMode: Boolean = false): TestActorRef[TcpOutgoingConnection] = + def createConnectionActorWithoutRegistration( + serverAddress: InetSocketAddress = serverAddress, + options: immutable.Seq[SocketOption] = Nil, + timeout: Option[FiniteDuration] = None, + pullMode: Boolean = false): TestActorRef[TcpOutgoingConnection] = TestActorRef( new TcpOutgoingConnection(Tcp(system), this, userHandler.ref, Connect(serverAddress, options = options, timeout = timeout, pullMode = pullMode)) { @@ -931,8 +933,8 @@ class TcpConnectionSpec extends AkkaSpec(""" abstract class EstablishedConnectionTest( keepOpenOnPeerClosed: Boolean = false, - useResumeWriting: Boolean = true, - pullMode: Boolean = false) + useResumeWriting: Boolean = true, + pullMode: Boolean = false) extends UnacceptedConnectionTest(pullMode) { // lazy init since potential exceptions should not be triggered in the constructor but during execution of `run` @@ -1074,7 +1076,7 @@ class TcpConnectionSpec extends AkkaSpec(""" } val interestsNames = - Seq(OP_ACCEPT -> "accepting", OP_CONNECT -> "connecting", OP_READ -> "reading", OP_WRITE -> "writing") + Seq(OP_ACCEPT → "accepting", OP_CONNECT → "connecting", OP_READ → "reading", OP_WRITE → "writing") def interestsDesc(interests: Int): String = interestsNames.filter(i ⇒ (i._1 & interests) != 0).map(_._2).mkString(", ") diff --git a/akka-actor-tests/src/test/scala/akka/io/TcpIntegrationSpec.scala b/akka-actor-tests/src/test/scala/akka/io/TcpIntegrationSpec.scala index 50ab314c86..4834a4a193 100644 --- a/akka-actor-tests/src/test/scala/akka/io/TcpIntegrationSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/io/TcpIntegrationSpec.scala @@ -185,11 +185,11 @@ class TcpIntegrationSpec extends AkkaSpec(""" } def chitchat( - clientHandler: TestProbe, + clientHandler: TestProbe, clientConnection: ActorRef, - serverHandler: TestProbe, + serverHandler: TestProbe, serverConnection: ActorRef, - rounds: Int = 100) = { + rounds: Int = 100) = { val testData = ByteString(0) (1 to rounds) foreach { _ ⇒ diff --git a/akka-actor-tests/src/test/scala/akka/pattern/AskSpec.scala b/akka-actor-tests/src/test/scala/akka/pattern/AskSpec.scala index 8838af1e6b..088026f8c1 100644 --- a/akka-actor-tests/src/test/scala/akka/pattern/AskSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/pattern/AskSpec.scala @@ -213,7 +213,7 @@ class AskSpec extends AkkaSpec { val act = system.actorOf(Props(new Actor { def receive = { - case msg ⇒ p.ref ! sender() -> msg + case msg ⇒ p.ref ! sender() → msg } })) diff --git a/akka-actor-tests/src/test/scala/akka/routing/MetricsBasedResizerSpec.scala b/akka-actor-tests/src/test/scala/akka/routing/MetricsBasedResizerSpec.scala index 4a43515fa3..ee10ccd5f1 100644 --- a/akka-actor-tests/src/test/scala/akka/routing/MetricsBasedResizerSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/routing/MetricsBasedResizerSpec.scala @@ -44,9 +44,10 @@ object MetricsBasedResizerSpec { var msgs: Set[TestLatch] = Set() - def mockSend(await: Boolean, - l: TestLatch = TestLatch(), - routeeIdx: Int = Random.nextInt(routees.length)): Latches = { + def mockSend( + await: Boolean, + l: TestLatch = TestLatch(), + routeeIdx: Int = Random.nextInt(routees.length)): Latches = { val target = routees(routeeIdx) val first = TestLatch() val latches = Latches(first, l) diff --git a/akka-actor-tests/src/test/scala/akka/routing/RandomSpec.scala b/akka-actor-tests/src/test/scala/akka/routing/RandomSpec.scala index cf94967653..3dd1b2b0f0 100644 --- a/akka-actor-tests/src/test/scala/akka/routing/RandomSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/routing/RandomSpec.scala @@ -50,7 +50,7 @@ class RandomSpec extends AkkaSpec with DefaultTimeout with ImplicitSender { val counter = new AtomicInteger var replies = Map.empty[Int, Int] for (i ← 0 until connectionCount) { - replies = replies + (i -> 0) + replies = replies + (i → 0) } val actor = system.actorOf(RandomPool(connectionCount).props(routeeProps = @@ -65,7 +65,7 @@ class RandomSpec extends AkkaSpec with DefaultTimeout with ImplicitSender { for (i ← 0 until iterationCount) { for (k ← 0 until connectionCount) { val id = Await.result((actor ? "hit").mapTo[Int], timeout.duration) - replies = replies + (id -> (replies(id) + 1)) + replies = replies + (id → (replies(id) + 1)) } } diff --git a/akka-actor-tests/src/test/scala/akka/routing/RoundRobinSpec.scala b/akka-actor-tests/src/test/scala/akka/routing/RoundRobinSpec.scala index e531d7c682..4d94f427f9 100644 --- a/akka-actor-tests/src/test/scala/akka/routing/RoundRobinSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/routing/RoundRobinSpec.scala @@ -64,7 +64,7 @@ class RoundRobinSpec extends AkkaSpec with DefaultTimeout with ImplicitSender { for (_ ← 1 to iterationCount; _ ← 1 to connectionCount) { val id = Await.result((actor ? "hit").mapTo[Int], timeout.duration) - replies = replies + (id -> (replies(id) + 1)) + replies = replies + (id → (replies(id) + 1)) } counter.get should ===(connectionCount) @@ -138,7 +138,7 @@ class RoundRobinSpec extends AkkaSpec with DefaultTimeout with ImplicitSender { for (_ ← 1 to iterationCount; _ ← 1 to connectionCount) { val id = Await.result((actor ? "hit").mapTo[String], timeout.duration) - replies = replies + (id -> (replies(id) + 1)) + replies = replies + (id → (replies(id) + 1)) } actor ! akka.routing.Broadcast("end") @@ -184,7 +184,7 @@ class RoundRobinSpec extends AkkaSpec with DefaultTimeout with ImplicitSender { for (_ ← 1 to iterationCount; _ ← 1 to connectionCount) { val id = Await.result((actor ? "hit").mapTo[String], timeout.duration) - replies = replies + (id -> (replies(id) + 1)) + replies = replies + (id → (replies(id) + 1)) } watch(actor) diff --git a/akka-actor-tests/src/test/scala/akka/serialization/SerializeSpec.scala b/akka-actor-tests/src/test/scala/akka/serialization/SerializeSpec.scala index fa76783b5c..701d72c16a 100644 --- a/akka-actor-tests/src/test/scala/akka/serialization/SerializeSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/serialization/SerializeSpec.scala @@ -323,7 +323,8 @@ class SerializationCompatibilitySpec extends AkkaSpec(SerializationTests.mostlyR "be preserved for the Create SystemMessage" in { // Using null as the cause to avoid a large serialized message and JDK differences - verify(Create(Some(null)), + verify( + Create(Some(null)), if (scala.util.Properties.versionNumberString.startsWith("2.10.")) { "aced00057372001b616b6b612e64697370617463682e7379736d73672e4372656174650000000000" + "0000010200014c00076661696c75726574000e4c7363616c612f4f7074696f6e3b78707372000a73" + @@ -337,53 +338,62 @@ class SerializationCompatibilitySpec extends AkkaSpec(SerializationTests.mostlyR }) } "be preserved for the Recreate SystemMessage" in { - verify(Recreate(null), + verify( + Recreate(null), "aced00057372001d616b6b612e64697370617463682e7379736d73672e5265637265617465000000" + "00000000010200014c000563617573657400154c6a6176612f6c616e672f5468726f7761626c653b" + "787070") } "be preserved for the Suspend SystemMessage" in { - verify(Suspend(), + verify( + Suspend(), "aced00057372001c616b6b612e64697370617463682e7379736d73672e53757370656e6400000000" + "000000010200007870") } "be preserved for the Resume SystemMessage" in { - verify(Resume(null), + verify( + Resume(null), "aced00057372001b616b6b612e64697370617463682e7379736d73672e526573756d650000000000" + "0000010200014c000f63617573656442794661696c7572657400154c6a6176612f6c616e672f5468" + "726f7761626c653b787070") } "be preserved for the Terminate SystemMessage" in { - verify(Terminate(), + verify( + Terminate(), "aced00057372001e616b6b612e64697370617463682e7379736d73672e5465726d696e6174650000" + "0000000000010200007870") } "be preserved for the Supervise SystemMessage" in { - verify(Supervise(null, true), + verify( + Supervise(null, true), "aced00057372001e616b6b612e64697370617463682e7379736d73672e5375706572766973650000" + "0000000000010200025a00056173796e634c00056368696c647400154c616b6b612f6163746f722f" + "4163746f725265663b78700170") } "be preserved for the Watch SystemMessage" in { - verify(Watch(null, null), + verify( + Watch(null, null), "aced00057372001a616b6b612e64697370617463682e7379736d73672e5761746368000000000000" + "00010200024c00077761746368656574001d4c616b6b612f6163746f722f496e7465726e616c4163" + "746f725265663b4c00077761746368657271007e000178707070") } "be preserved for the Unwatch SystemMessage" in { - verify(Unwatch(null, null), + verify( + Unwatch(null, null), "aced00057372001c616b6b612e64697370617463682e7379736d73672e556e776174636800000000" + "000000010200024c0007776174636865657400154c616b6b612f6163746f722f4163746f72526566" + "3b4c00077761746368657271007e000178707070") } "be preserved for the NoMessage SystemMessage" in { - verify(NoMessage, + verify( + NoMessage, "aced00057372001f616b6b612e64697370617463682e7379736d73672e4e6f4d6573736167652400" + "000000000000010200007870") } "be preserved for the Failed SystemMessage" in { // Using null as the cause to avoid a large serialized message and JDK differences - verify(Failed(null, cause = null, uid = 0), + verify( + Failed(null, cause = null, uid = 0), "aced00057372001b616b6b612e64697370617463682e7379736d73672e4661696c65640000000000" + "0000010200034900037569644c000563617573657400154c6a6176612f6c616e672f5468726f7761" + "626c653b4c00056368696c647400154c616b6b612f6163746f722f4163746f725265663b78700000" + diff --git a/akka-actor-tests/src/test/scala/akka/util/ByteStringSpec.scala b/akka-actor-tests/src/test/scala/akka/util/ByteStringSpec.scala index b1291e52d4..57dac8c482 100644 --- a/akka-actor-tests/src/test/scala/akka/util/ByteStringSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/util/ByteStringSpec.scala @@ -121,7 +121,7 @@ class ByteStringSpec extends WordSpec with Matchers with Checkers { val (bsAIt, bsBIt) = (a.iterator, b.iterator) val (vecAIt, vecBIt) = (Vector(a: _*).iterator.buffered, Vector(b: _*).iterator.buffered) (body(bsAIt, bsBIt) == body(vecAIt, vecBIt)) && - (!strict || (bsAIt.toSeq -> bsBIt.toSeq) == (vecAIt.toSeq -> vecBIt.toSeq)) + (!strict || (bsAIt.toSeq → bsBIt.toSeq) == (vecAIt.toSeq → vecBIt.toSeq)) } def likeVecBld(body: Builder[Byte, _] ⇒ Unit): Boolean = { diff --git a/akka-actor-tests/src/test/scala/akka/util/PrettyDurationSpec.scala b/akka-actor-tests/src/test/scala/akka/util/PrettyDurationSpec.scala index c34c6f26fe..ead93a64e3 100644 --- a/akka-actor-tests/src/test/scala/akka/util/PrettyDurationSpec.scala +++ b/akka-actor-tests/src/test/scala/akka/util/PrettyDurationSpec.scala @@ -15,16 +15,16 @@ class PrettyDurationSpec extends FlatSpec with Matchers { import scala.concurrent.duration._ val cases: Seq[(Duration, String)] = - 9.nanos -> "9.000 ns" :: - 95.nanos -> "95.00 ns" :: - 999.nanos -> "999.0 ns" :: - 1000.nanos -> "1.000 μs" :: - 9500.nanos -> "9.500 μs" :: - 9500.micros -> "9.500 ms" :: - 9500.millis -> "9.500 s" :: - 95.seconds -> "1.583 min" :: - 95.minutes -> "1.583 h" :: - 95.hours -> "3.958 d" :: + 9.nanos → "9.000 ns" :: + 95.nanos → "95.00 ns" :: + 999.nanos → "999.0 ns" :: + 1000.nanos → "1.000 μs" :: + 9500.nanos → "9.500 μs" :: + 9500.micros → "9.500 ms" :: + 9500.millis → "9.500 s" :: + 95.seconds → "1.583 min" :: + 95.minutes → "1.583 h" :: + 95.hours → "3.958 d" :: Nil cases foreach { diff --git a/akka-actor/src/main/scala/akka/actor/AbstractFSM.scala b/akka-actor/src/main/scala/akka/actor/AbstractFSM.scala index 50c5900202..62c0c86ad0 100644 --- a/akka-actor/src/main/scala/akka/actor/AbstractFSM.scala +++ b/akka-actor/src/main/scala/akka/actor/AbstractFSM.scala @@ -66,9 +66,10 @@ abstract class AbstractFSM[S, D] extends FSM[S, D] { * @param stateTimeout default state timeout for this state * @param stateFunctionBuilder partial function builder describing response to input */ - final def when(stateName: S, - stateTimeout: FiniteDuration, - stateFunctionBuilder: FSMStateFunctionBuilder[S, D]): Unit = + final def when( + stateName: S, + stateTimeout: FiniteDuration, + stateFunctionBuilder: FSMStateFunctionBuilder[S, D]): Unit = when(stateName, stateTimeout)(stateFunctionBuilder.build()) /** diff --git a/akka-actor/src/main/scala/akka/actor/Actor.scala b/akka-actor/src/main/scala/akka/actor/Actor.scala index dde2ae4e07..7be9612952 100644 --- a/akka-actor/src/main/scala/akka/actor/Actor.scala +++ b/akka-actor/src/main/scala/akka/actor/Actor.scala @@ -96,7 +96,7 @@ final case class ActorIdentity(correlationId: Any, ref: Option[ActorRef]) { @SerialVersionUID(1L) final case class Terminated private[akka] (@BeanProperty actor: ActorRef)( @BeanProperty val existenceConfirmed: Boolean, - @BeanProperty val addressTerminated: Boolean) + @BeanProperty val addressTerminated: Boolean) extends AutoReceivedMessage with PossiblyHarmful with DeadLetterSuppression /** @@ -189,7 +189,8 @@ object ActorInitializationException { */ @SerialVersionUID(1L) final case class PreRestartException private[akka] (actor: ActorRef, cause: Throwable, originalCause: Throwable, messageOption: Option[Any]) - extends ActorInitializationException(actor, + extends ActorInitializationException( + actor, "exception in preRestart(" + (if (originalCause == null) "null" else originalCause.getClass) + ", " + (messageOption match { case Some(m: AnyRef) ⇒ m.getClass; case _ ⇒ "None" }) + @@ -205,7 +206,8 @@ final case class PreRestartException private[akka] (actor: ActorRef, cause: Thro */ @SerialVersionUID(1L) final case class PostRestartException private[akka] (actor: ActorRef, cause: Throwable, originalCause: Throwable) - extends ActorInitializationException(actor, + extends ActorInitializationException( + actor, "exception post restart (" + (if (originalCause == null) "null" else originalCause.getClass) + ")", cause) /** diff --git a/akka-actor/src/main/scala/akka/actor/ActorCell.scala b/akka-actor/src/main/scala/akka/actor/ActorCell.scala index e5753a4c08..4dea299d93 100644 --- a/akka-actor/src/main/scala/akka/actor/ActorCell.scala +++ b/akka-actor/src/main/scala/akka/actor/ActorCell.scala @@ -372,11 +372,11 @@ private[akka] object ActorCell { * for! (waves hand) */ private[akka] class ActorCell( - val system: ActorSystemImpl, - val self: InternalActorRef, + val system: ActorSystemImpl, + val self: InternalActorRef, final val props: Props, // Must be final so that it can be properly cleared in clearActorCellFields - val dispatcher: MessageDispatcher, - val parent: InternalActorRef) + val dispatcher: MessageDispatcher, + val parent: InternalActorRef) extends UntypedActorContext with AbstractActorContext with Cell with dungeon.ReceiveTimeout with dungeon.Children @@ -598,7 +598,8 @@ private[akka] class ActorCell( case NonFatal(e) ⇒ clearOutActorIfNonNull() e match { - case i: InstantiationException ⇒ throw ActorInitializationException(self, + case i: InstantiationException ⇒ throw ActorInitializationException( + self, """exception during creation, this problem is likely to occur because the class of the Actor you tried to create is either, a non-static inner class (in which case make it a static inner class or use Props(new ...) or Props( new Creator ... ) or is missing an appropriate, reachable no-args constructor. diff --git a/akka-actor/src/main/scala/akka/actor/ActorPath.scala b/akka-actor/src/main/scala/akka/actor/ActorPath.scala index 4336464054..989c4af7d3 100644 --- a/akka-actor/src/main/scala/akka/actor/ActorPath.scala +++ b/akka-actor/src/main/scala/akka/actor/ActorPath.scala @@ -254,7 +254,8 @@ sealed trait ActorPath extends Comparable[ActorPath] with Serializable { */ @SerialVersionUID(1L) final case class RootActorPath(address: Address, name: String = "/") extends ActorPath { - require(name.length == 1 || name.indexOf('/', 1) == -1, + require( + name.length == 1 || name.indexOf('/', 1) == -1, "/ may only exist at the beginning of the root actors name, " + "it is a path separator and is not legal in ActorPath names: [%s]" format name) require(name.indexOf('#') == -1, "# is a fragment separator and is not legal in ActorPath names: [%s]" format name) diff --git a/akka-actor/src/main/scala/akka/actor/ActorRef.scala b/akka-actor/src/main/scala/akka/actor/ActorRef.scala index 0e2cc5bc17..523a12e44b 100644 --- a/akka-actor/src/main/scala/akka/actor/ActorRef.scala +++ b/akka-actor/src/main/scala/akka/actor/ActorRef.scala @@ -302,11 +302,11 @@ private[akka] case object Nobody extends MinimalActorRef { * INTERNAL API */ private[akka] class LocalActorRef private[akka] ( - _system: ActorSystemImpl, - _props: Props, - _dispatcher: MessageDispatcher, - _mailboxType: MailboxType, - _supervisor: InternalActorRef, + _system: ActorSystemImpl, + _props: Props, + _dispatcher: MessageDispatcher, + _mailboxType: MailboxType, + _supervisor: InternalActorRef, override val path: ActorPath) extends ActorRefWithCell with LocalRef { @@ -518,9 +518,10 @@ private[akka] object DeadLetterActorRef { * * INTERNAL API */ -private[akka] class EmptyLocalActorRef(override val provider: ActorRefProvider, - override val path: ActorPath, - val eventStream: EventStream) extends MinimalActorRef { +private[akka] class EmptyLocalActorRef( + override val provider: ActorRefProvider, + override val path: ActorPath, + val eventStream: EventStream) extends MinimalActorRef { @deprecated("Use context.watch(actor) and receive Terminated(actor)", "2.2") override private[akka] def isTerminated = true @@ -570,9 +571,10 @@ private[akka] class EmptyLocalActorRef(override val provider: ActorRefProvider, * * INTERNAL API */ -private[akka] class DeadLetterActorRef(_provider: ActorRefProvider, - _path: ActorPath, - _eventStream: EventStream) extends EmptyLocalActorRef(_provider, _path, _eventStream) { +private[akka] class DeadLetterActorRef( + _provider: ActorRefProvider, + _path: ActorPath, + _eventStream: EventStream) extends EmptyLocalActorRef(_provider, _path, _eventStream) { override def !(message: Any)(implicit sender: ActorRef = this): Unit = message match { case null ⇒ throw new InvalidMessageException("Message is null") @@ -601,10 +603,10 @@ private[akka] class DeadLetterActorRef(_provider: ActorRefProvider, * INTERNAL API */ private[akka] class VirtualPathContainer( - override val provider: ActorRefProvider, - override val path: ActorPath, + override val provider: ActorRefProvider, + override val path: ActorPath, override val getParent: InternalActorRef, - val log: LoggingAdapter) extends MinimalActorRef { + val log: LoggingAdapter) extends MinimalActorRef { private val children = new ConcurrentHashMap[String, InternalActorRef] @@ -705,10 +707,11 @@ private[akka] class VirtualPathContainer( * When using the watch() feature you must ensure that upon reception of the * Terminated message the watched actorRef is unwatch()ed. */ -private[akka] final class FunctionRef(override val path: ActorPath, - override val provider: ActorRefProvider, - val eventStream: EventStream, - f: (ActorRef, Any) ⇒ Unit) extends MinimalActorRef { +private[akka] final class FunctionRef( + override val path: ActorPath, + override val provider: ActorRefProvider, + val eventStream: EventStream, + f: (ActorRef, Any) ⇒ Unit) extends MinimalActorRef { override def !(message: Any)(implicit sender: ActorRef = Actor.noSender): Unit = { f(sender, message) diff --git a/akka-actor/src/main/scala/akka/actor/ActorRefProvider.scala b/akka-actor/src/main/scala/akka/actor/ActorRefProvider.scala index 2dc6aed149..bf99880055 100644 --- a/akka-actor/src/main/scala/akka/actor/ActorRefProvider.scala +++ b/akka-actor/src/main/scala/akka/actor/ActorRefProvider.scala @@ -105,14 +105,14 @@ trait ActorRefProvider { * the latter can be suppressed by setting ``lookupDeploy`` to ``false``. */ def actorOf( - system: ActorSystemImpl, - props: Props, - supervisor: InternalActorRef, - path: ActorPath, + system: ActorSystemImpl, + props: Props, + supervisor: InternalActorRef, + path: ActorPath, systemService: Boolean, - deploy: Option[Deploy], - lookupDeploy: Boolean, - async: Boolean): InternalActorRef + deploy: Option[Deploy], + lookupDeploy: Boolean, + async: Boolean): InternalActorRef /** * INTERNAL API @@ -475,20 +475,22 @@ private[akka] object LocalActorRefProvider { * Depending on this class is not supported, only the [[ActorRefProvider]] interface is supported. */ private[akka] class LocalActorRefProvider private[akka] ( - _systemName: String, + _systemName: String, override val settings: ActorSystem.Settings, - val eventStream: EventStream, - val dynamicAccess: DynamicAccess, + val eventStream: EventStream, + val dynamicAccess: DynamicAccess, override val deployer: Deployer, - _deadLetters: Option[ActorPath ⇒ InternalActorRef]) + _deadLetters: Option[ActorPath ⇒ InternalActorRef]) extends ActorRefProvider { // this is the constructor needed for reflectively instantiating the provider - def this(_systemName: String, - settings: ActorSystem.Settings, - eventStream: EventStream, - dynamicAccess: DynamicAccess) = - this(_systemName, + def this( + _systemName: String, + settings: ActorSystem.Settings, + eventStream: EventStream, + dynamicAccess: DynamicAccess) = + this( + _systemName, settings, eventStream, dynamicAccess, @@ -776,7 +778,8 @@ private[akka] class LocalActorRefProvider private[akka] ( if (!system.dispatchers.hasDispatcher(r.routerDispatcher)) throw new ConfigurationException(s"Dispatcher [${p.dispatcher}] not configured for router of $path") - val routerProps = Props(p.deploy.copy(dispatcher = p.routerConfig.routerDispatcher), + val routerProps = Props( + p.deploy.copy(dispatcher = p.routerConfig.routerDispatcher), classOf[RoutedActorCell.RouterActorCreator], Vector(p.routerConfig)) val routeeProps = p.withRouter(NoRouter) diff --git a/akka-actor/src/main/scala/akka/actor/ActorSelection.scala b/akka-actor/src/main/scala/akka/actor/ActorSelection.scala index 278bcf0d43..d013f20ad0 100644 --- a/akka-actor/src/main/scala/akka/actor/ActorSelection.scala +++ b/akka-actor/src/main/scala/akka/actor/ActorSelection.scala @@ -218,7 +218,8 @@ object ActorSelection { if (matchingChildren.isEmpty && !sel.wildcardFanOut) emptyRef.tell(sel, sender) else { - val m = sel.copy(elements = iter.toVector, + val m = sel.copy( + elements = iter.toVector, wildcardFanOut = sel.wildcardFanOut || matchingChildren.size > 1) matchingChildren.foreach(c ⇒ deliverSelection(c.asInstanceOf[InternalActorRef], sender, m)) } @@ -253,8 +254,8 @@ trait ScalaActorSelection { */ @SerialVersionUID(2L) // it has protobuf serialization in akka-remote private[akka] final case class ActorSelectionMessage( - msg: Any, - elements: immutable.Iterable[SelectionPathElement], + msg: Any, + elements: immutable.Iterable[SelectionPathElement], wildcardFanOut: Boolean) extends AutoReceivedMessage with PossiblyHarmful { diff --git a/akka-actor/src/main/scala/akka/actor/ActorSystem.scala b/akka-actor/src/main/scala/akka/actor/ActorSystem.scala index a981f32500..c0789e1481 100644 --- a/akka-actor/src/main/scala/akka/actor/ActorSystem.scala +++ b/akka-actor/src/main/scala/akka/actor/ActorSystem.scala @@ -505,11 +505,11 @@ abstract class ExtendedActorSystem extends ActorSystem { } private[akka] class ActorSystemImpl( - val name: String, - applicationConfig: Config, - classLoader: ClassLoader, + val name: String, + applicationConfig: Config, + classLoader: ClassLoader, defaultExecutionContext: Option[ExecutionContext], - val guardianProps: Option[Props]) extends ExtendedActorSystem { + val guardianProps: Option[Props]) extends ExtendedActorSystem { if (!name.matches("""^[a-zA-Z0-9][a-zA-Z0-9-_]*$""")) throw new IllegalArgumentException( @@ -593,7 +593,7 @@ private[akka] class ActorSystemImpl( eventStream.startStdoutLogger(settings) val logFilter: LoggingFilter = { - val arguments = Vector(classOf[Settings] -> settings, classOf[EventStream] -> eventStream) + val arguments = Vector(classOf[Settings] → settings, classOf[EventStream] → eventStream) dynamicAccess.createInstanceFor[LoggingFilter](LoggingFilter, arguments).get } @@ -603,10 +603,10 @@ private[akka] class ActorSystemImpl( val provider: ActorRefProvider = try { val arguments = Vector( - classOf[String] -> name, - classOf[Settings] -> settings, - classOf[EventStream] -> eventStream, - classOf[DynamicAccess] -> dynamicAccess) + classOf[String] → name, + classOf[Settings] → settings, + classOf[EventStream] → eventStream, + classOf[DynamicAccess] → dynamicAccess) dynamicAccess.createInstanceFor[ActorRefProvider](ProviderClass, arguments).get } catch { @@ -698,9 +698,9 @@ private[akka] class ActorSystemImpl( */ protected def createScheduler(): Scheduler = dynamicAccess.createInstanceFor[Scheduler](settings.SchedulerClass, immutable.Seq( - classOf[Config] -> settings.config, - classOf[LoggingAdapter] -> log, - classOf[ThreadFactory] -> threadFactory.withName(threadFactory.name + "-scheduler"))).get + classOf[Config] → settings.config, + classOf[LoggingAdapter] → log, + classOf[ThreadFactory] → threadFactory.withName(threadFactory.name + "-scheduler"))).get //#create-scheduler /* @@ -767,12 +767,12 @@ private[akka] class ActorSystemImpl( def loadExtensions(key: String, throwOnLoadFail: Boolean): Unit = { immutableSeq(settings.config.getStringList(key)) foreach { fqcn ⇒ dynamicAccess.getObjectFor[AnyRef](fqcn) recoverWith { case _ ⇒ dynamicAccess.createInstanceFor[AnyRef](fqcn, Nil) } match { - case Success(p: ExtensionIdProvider) ⇒ registerExtension(p.lookup()) - case Success(p: ExtensionId[_]) ⇒ registerExtension(p) - case Success(other)⇒ + case Success(p: ExtensionIdProvider) ⇒ registerExtension(p.lookup()) + case Success(p: ExtensionId[_]) ⇒ registerExtension(p) + case Success(other) ⇒ if (!throwOnLoadFail) log.error("[{}] is not an 'ExtensionIdProvider' or 'ExtensionId', skipping...", fqcn) else throw new RuntimeException(s"[$fqcn] is not an 'ExtensionIdProvider' or 'ExtensionId'") - case Failure(problem) ⇒ + case Failure(problem) ⇒ if (!throwOnLoadFail) log.error(problem, "While trying to load extension [{}], skipping...", fqcn) else throw new RuntimeException(s"While trying to load extension [$fqcn]", problem) } diff --git a/akka-actor/src/main/scala/akka/actor/Deployer.scala b/akka-actor/src/main/scala/akka/actor/Deployer.scala index 7f71bb072a..9431139801 100644 --- a/akka-actor/src/main/scala/akka/actor/Deployer.scala +++ b/akka-actor/src/main/scala/akka/actor/Deployer.scala @@ -35,12 +35,12 @@ object Deploy { */ @SerialVersionUID(2L) final case class Deploy( - path: String = "", - config: Config = ConfigFactory.empty, + path: String = "", + config: Config = ConfigFactory.empty, routerConfig: RouterConfig = NoRouter, - scope: Scope = NoScopeGiven, - dispatcher: String = Deploy.NoDispatcherGiven, - mailbox: String = Deploy.NoMailboxGiven) { + scope: Scope = NoScopeGiven, + dispatcher: String = Deploy.NoDispatcherGiven, + mailbox: String = Deploy.NoMailboxGiven) { /** * Java API to create a Deploy with the given RouterConfig @@ -137,7 +137,7 @@ private[akka] class Deployer(val settings: ActorSystem.Settings, val dynamicAcce protected val default = config.getConfig("default") val routerTypeMapping: Map[String, String] = settings.config.getConfig("akka.actor.router.type-mapping").root.unwrapped.asScala.collect { - case (key, value: String) ⇒ (key -> value) + case (key, value: String) ⇒ (key → value) }.toMap config.root.asScala flatMap { @@ -198,8 +198,8 @@ private[akka] class Deployer(val settings: ActorSystem.Settings, val dynamicAcce s"[${args(0)._1.getName}] and optional [${args(1)._1.getName}] parameter", cause) // first try with Config param, and then with Config and DynamicAccess parameters - val args1 = List(classOf[Config] -> deployment2) - val args2 = List(classOf[Config] -> deployment2, classOf[DynamicAccess] -> dynamicAccess) + val args1 = List(classOf[Config] → deployment2) + val args2 = List(classOf[Config] → deployment2, classOf[DynamicAccess] → dynamicAccess) dynamicAccess.createInstanceFor[RouterConfig](fqn, args1).recover({ case e @ (_: IllegalArgumentException | _: ConfigException) ⇒ throw e case e: NoSuchMethodException ⇒ diff --git a/akka-actor/src/main/scala/akka/actor/Extension.scala b/akka-actor/src/main/scala/akka/actor/Extension.scala index 175e839143..077785c28f 100644 --- a/akka-actor/src/main/scala/akka/actor/Extension.scala +++ b/akka-actor/src/main/scala/akka/actor/Extension.scala @@ -150,5 +150,5 @@ abstract class ExtensionKey[T <: Extension](implicit m: ClassTag[T]) extends Ext def this(clazz: Class[T]) = this()(ClassTag(clazz)) override def lookup(): ExtensionId[T] = this - def createExtension(system: ExtendedActorSystem): T = system.dynamicAccess.createInstanceFor[T](m.runtimeClass, List(classOf[ExtendedActorSystem] -> system)).get + def createExtension(system: ExtendedActorSystem): T = system.dynamicAccess.createInstanceFor[T](m.runtimeClass, List(classOf[ExtendedActorSystem] → system)).get } diff --git a/akka-actor/src/main/scala/akka/actor/FSM.scala b/akka-actor/src/main/scala/akka/actor/FSM.scala index bb0c35145e..242083a730 100644 --- a/akka-actor/src/main/scala/akka/actor/FSM.scala +++ b/akka-actor/src/main/scala/akka/actor/FSM.scala @@ -110,9 +110,10 @@ object FSM { * This extractor is just convenience for matching a (S, S) pair, including a * reminder what the new state is. */ - object -> { + object `->` { def unapply[S](in: (S, S)) = Some(in) } + val `→` = `->` /** * Log Entry of the [[akka.actor.LoggingFSM]], can be obtained by calling `getLog`. @@ -319,7 +320,7 @@ trait FSM[S, D] extends Actor with Listeners with ActorLogging { * This extractor is just convenience for matching a (S, S) pair, including a * reminder what the new state is. */ - val -> = FSM.-> + val `->` = FSM.`->` /** * This case object is received in case of a state timeout. diff --git a/akka-actor/src/main/scala/akka/actor/FaultHandling.scala b/akka-actor/src/main/scala/akka/actor/FaultHandling.scala index e2e38d7eb8..186888d725 100644 --- a/akka-actor/src/main/scala/akka/actor/FaultHandling.scala +++ b/akka-actor/src/main/scala/akka/actor/FaultHandling.scala @@ -380,9 +380,9 @@ abstract class SupervisorStrategy { * @param loggingEnabled the strategy logs the failure if this is enabled (true), by default it is enabled */ case class AllForOneStrategy( - maxNrOfRetries: Int = -1, - withinTimeRange: Duration = Duration.Inf, - override val loggingEnabled: Boolean = true)(val decider: SupervisorStrategy.Decider) + maxNrOfRetries: Int = -1, + withinTimeRange: Duration = Duration.Inf, + override val loggingEnabled: Boolean = true)(val decider: SupervisorStrategy.Decider) extends SupervisorStrategy { import SupervisorStrategy._ @@ -458,9 +458,9 @@ case class AllForOneStrategy( * @param loggingEnabled the strategy logs the failure if this is enabled (true), by default it is enabled */ case class OneForOneStrategy( - maxNrOfRetries: Int = -1, - withinTimeRange: Duration = Duration.Inf, - override val loggingEnabled: Boolean = true)(val decider: SupervisorStrategy.Decider) + maxNrOfRetries: Int = -1, + withinTimeRange: Duration = Duration.Inf, + override val loggingEnabled: Boolean = true)(val decider: SupervisorStrategy.Decider) extends SupervisorStrategy { /** diff --git a/akka-actor/src/main/scala/akka/actor/LightArrayRevolverScheduler.scala b/akka-actor/src/main/scala/akka/actor/LightArrayRevolverScheduler.scala index bb9a627b22..4f62dbe812 100644 --- a/akka-actor/src/main/scala/akka/actor/LightArrayRevolverScheduler.scala +++ b/akka-actor/src/main/scala/akka/actor/LightArrayRevolverScheduler.scala @@ -34,9 +34,10 @@ import akka.dispatch.AbstractNodeQueue * scheduled possibly one tick later than they could be (if checking that * “now() + delay <= nextTick” were done). */ -class LightArrayRevolverScheduler(config: Config, - log: LoggingAdapter, - threadFactory: ThreadFactory) +class LightArrayRevolverScheduler( + config: Config, + log: LoggingAdapter, + threadFactory: ThreadFactory) extends Scheduler with Closeable { import Helpers.Requiring @@ -88,9 +89,10 @@ class LightArrayRevolverScheduler(config: Config, } } - override def schedule(initialDelay: FiniteDuration, - delay: FiniteDuration, - runnable: Runnable)(implicit executor: ExecutionContext): Cancellable = { + override def schedule( + initialDelay: FiniteDuration, + delay: FiniteDuration, + runnable: Runnable)(implicit executor: ExecutionContext): Cancellable = { checkMaxDelay(roundUp(delay).toNanos) val preparedEC = executor.prepare() try new AtomicReference[Cancellable](InitialRepeatMarker) with Cancellable { self ⇒ @@ -221,7 +223,7 @@ class LightArrayRevolverScheduler(config: Config, time - start + // calculate the nanos since timer start (ticks * tickNanos) + // adding the desired delay tickNanos - 1 // rounding up - ) / tickNanos).toInt // and converting to slot number + ) / tickNanos).toInt // and converting to slot number // tick is an Int that will wrap around, but toInt of futureTick gives us modulo operations // and the difference (offset) will be correct in any case val offset = futureTick - tick diff --git a/akka-actor/src/main/scala/akka/actor/RepointableActorRef.scala b/akka-actor/src/main/scala/akka/actor/RepointableActorRef.scala index 660dea44e3..9b074b6c9d 100644 --- a/akka-actor/src/main/scala/akka/actor/RepointableActorRef.scala +++ b/akka-actor/src/main/scala/akka/actor/RepointableActorRef.scala @@ -24,12 +24,12 @@ import scala.util.control.NonFatal * and swap out the cell ref. */ private[akka] class RepointableActorRef( - val system: ActorSystemImpl, - val props: Props, - val dispatcher: MessageDispatcher, + val system: ActorSystemImpl, + val props: Props, + val dispatcher: MessageDispatcher, val mailboxType: MailboxType, - val supervisor: InternalActorRef, - val path: ActorPath) + val supervisor: InternalActorRef, + val path: ActorPath) extends ActorRefWithCell with RepointableRef { import AbstractActorRef.{ cellOffset, lookupOffset } @@ -176,10 +176,11 @@ private[akka] class RepointableActorRef( protected def writeReplace(): AnyRef = SerializedActorRef(this) } -private[akka] class UnstartedCell(val systemImpl: ActorSystemImpl, - val self: RepointableActorRef, - val props: Props, - val supervisor: InternalActorRef) extends Cell { +private[akka] class UnstartedCell( + val systemImpl: ActorSystemImpl, + val self: RepointableActorRef, + val props: Props, + val supervisor: InternalActorRef) extends Cell { /* * This lock protects all accesses to this cell’s queues. It also ensures diff --git a/akka-actor/src/main/scala/akka/actor/Scheduler.scala b/akka-actor/src/main/scala/akka/actor/Scheduler.scala index 9bca96a592..56ee193990 100644 --- a/akka-actor/src/main/scala/akka/actor/Scheduler.scala +++ b/akka-actor/src/main/scala/akka/actor/Scheduler.scala @@ -42,10 +42,11 @@ trait Scheduler { */ final def schedule( initialDelay: FiniteDuration, - interval: FiniteDuration, - receiver: ActorRef, - message: Any)(implicit executor: ExecutionContext, - sender: ActorRef = Actor.noSender): Cancellable = + interval: FiniteDuration, + receiver: ActorRef, + message: Any)(implicit + executor: ExecutionContext, + sender: ActorRef = Actor.noSender): Cancellable = schedule(initialDelay, interval, new Runnable { def run = { receiver ! message @@ -71,8 +72,9 @@ trait Scheduler { */ final def schedule( initialDelay: FiniteDuration, - interval: FiniteDuration)(f: ⇒ Unit)( - implicit executor: ExecutionContext): Cancellable = + interval: FiniteDuration)(f: ⇒ Unit)( + implicit + executor: ExecutionContext): Cancellable = schedule(initialDelay, interval, new Runnable { override def run = f }) /** @@ -93,8 +95,8 @@ trait Scheduler { */ def schedule( initialDelay: FiniteDuration, - interval: FiniteDuration, - runnable: Runnable)(implicit executor: ExecutionContext): Cancellable + interval: FiniteDuration, + runnable: Runnable)(implicit executor: ExecutionContext): Cancellable /** * Schedules a message to be sent once with a delay, i.e. a time period that has @@ -103,10 +105,11 @@ trait Scheduler { * Java & Scala API */ final def scheduleOnce( - delay: FiniteDuration, + delay: FiniteDuration, receiver: ActorRef, - message: Any)(implicit executor: ExecutionContext, - sender: ActorRef = Actor.noSender): Cancellable = + message: Any)(implicit + executor: ExecutionContext, + sender: ActorRef = Actor.noSender): Cancellable = scheduleOnce(delay, new Runnable { override def run = receiver ! message }) @@ -118,7 +121,8 @@ trait Scheduler { * Scala API */ final def scheduleOnce(delay: FiniteDuration)(f: ⇒ Unit)( - implicit executor: ExecutionContext): Cancellable = + implicit + executor: ExecutionContext): Cancellable = scheduleOnce(delay, new Runnable { override def run = f }) /** @@ -128,7 +132,7 @@ trait Scheduler { * Java & Scala API */ def scheduleOnce( - delay: FiniteDuration, + delay: FiniteDuration, runnable: Runnable)(implicit executor: ExecutionContext): Cancellable /** diff --git a/akka-actor/src/main/scala/akka/actor/TypedActor.scala b/akka-actor/src/main/scala/akka/actor/TypedActor.scala index 9ec9b2e0f3..6c30647dba 100644 --- a/akka-actor/src/main/scala/akka/actor/TypedActor.scala +++ b/akka-actor/src/main/scala/akka/actor/TypedActor.scala @@ -523,11 +523,11 @@ object TypedProps { @SerialVersionUID(1L) final case class TypedProps[T <: AnyRef] protected[TypedProps] ( interfaces: immutable.Seq[Class[_]], - creator: () ⇒ T, - dispatcher: String = TypedProps.defaultDispatcherId, - deploy: Deploy = Props.defaultDeploy, - timeout: Option[Timeout] = TypedProps.defaultTimeout, - loader: Option[ClassLoader] = TypedProps.defaultLoader) { + creator: () ⇒ T, + dispatcher: String = TypedProps.defaultDispatcherId, + deploy: Deploy = Props.defaultDeploy, + timeout: Option[Timeout] = TypedProps.defaultTimeout, + loader: Option[ClassLoader] = TypedProps.defaultLoader) { /** * Uses the supplied class as the factory for the TypedActor implementation, @@ -536,7 +536,8 @@ final case class TypedProps[T <: AnyRef] protected[TypedProps] ( * appended in the sequence of interfaces. */ def this(implementation: Class[T]) = - this(interfaces = TypedProps.extractInterfaces(implementation), + this( + interfaces = TypedProps.extractInterfaces(implementation), creator = instantiator(implementation)) /** @@ -546,7 +547,8 @@ final case class TypedProps[T <: AnyRef] protected[TypedProps] ( * appended in the sequence of interfaces. */ def this(interface: Class[_ >: T], implementation: Creator[T]) = - this(interfaces = TypedProps.extractInterfaces(interface), + this( + interfaces = TypedProps.extractInterfaces(interface), creator = implementation.create _) /** @@ -556,7 +558,8 @@ final case class TypedProps[T <: AnyRef] protected[TypedProps] ( * appended in the sequence of interfaces. */ def this(interface: Class[_ >: T], implementation: Class[T]) = - this(interfaces = TypedProps.extractInterfaces(interface), + this( + interfaces = TypedProps.extractInterfaces(interface), creator = instantiator(implementation)) /** diff --git a/akka-actor/src/main/scala/akka/actor/dungeon/Dispatch.scala b/akka-actor/src/main/scala/akka/actor/dungeon/Dispatch.scala index 0906266843..6f186254d9 100644 --- a/akka-actor/src/main/scala/akka/actor/dungeon/Dispatch.scala +++ b/akka-actor/src/main/scala/akka/actor/dungeon/Dispatch.scala @@ -62,7 +62,8 @@ private[akka] trait Dispatch { this: ActorCell ⇒ if (req isInstance mbox.messageQueue) Create(None) else { val gotType = if (mbox.messageQueue == null) "null" else mbox.messageQueue.getClass.getName - Create(Some(ActorInitializationException(self, + Create(Some(ActorInitializationException( + self, s"Actor [$self] requires mailbox type [$req] got [$gotType]"))) } case _ ⇒ Create(None) diff --git a/akka-actor/src/main/scala/akka/dispatch/AbstractDispatcher.scala b/akka-actor/src/main/scala/akka/dispatch/AbstractDispatcher.scala index b0fb0a2625..800e0cfcfa 100644 --- a/akka-actor/src/main/scala/akka/dispatch/AbstractDispatcher.scala +++ b/akka-actor/src/main/scala/akka/dispatch/AbstractDispatcher.scala @@ -324,8 +324,8 @@ abstract class MessageDispatcherConfigurator(_config: Config, val prerequisites: case "thread-pool-executor" ⇒ new ThreadPoolExecutorConfigurator(config.getConfig("thread-pool-executor"), prerequisites) case fqcn ⇒ val args = List( - classOf[Config] -> config, - classOf[DispatcherPrerequisites] -> prerequisites) + classOf[Config] → config, + classOf[DispatcherPrerequisites] → prerequisites) prerequisites.dynamicAccess.createInstanceFor[ExecutorServiceConfigurator](fqcn, args).recover({ case exception ⇒ throw new IllegalArgumentException( ("""Cannot instantiate ExecutorServiceConfigurator ("executor = [%s]"), defined in [%s], @@ -379,14 +379,16 @@ object ForkJoinExecutorConfigurator { /** * INTERNAL AKKA USAGE ONLY */ - final class AkkaForkJoinPool(parallelism: Int, - threadFactory: ForkJoinPool.ForkJoinWorkerThreadFactory, - unhandledExceptionHandler: Thread.UncaughtExceptionHandler, - asyncMode: Boolean) + final class AkkaForkJoinPool( + parallelism: Int, + threadFactory: ForkJoinPool.ForkJoinWorkerThreadFactory, + unhandledExceptionHandler: Thread.UncaughtExceptionHandler, + asyncMode: Boolean) extends ForkJoinPool(parallelism, threadFactory, unhandledExceptionHandler, asyncMode) with LoadMetrics { - def this(parallelism: Int, - threadFactory: ForkJoinPool.ForkJoinWorkerThreadFactory, - unhandledExceptionHandler: Thread.UncaughtExceptionHandler) = this(parallelism, threadFactory, unhandledExceptionHandler, asyncMode = true) + def this( + parallelism: Int, + threadFactory: ForkJoinPool.ForkJoinWorkerThreadFactory, + unhandledExceptionHandler: Thread.UncaughtExceptionHandler) = this(parallelism, threadFactory, unhandledExceptionHandler, asyncMode = true) override def execute(r: Runnable): Unit = if (r ne null) @@ -427,9 +429,10 @@ class ForkJoinExecutorConfigurator(config: Config, prerequisites: DispatcherPrer case x ⇒ throw new IllegalStateException("The prerequisites for the ForkJoinExecutorConfigurator is a ForkJoinPool.ForkJoinWorkerThreadFactory!") } - class ForkJoinExecutorServiceFactory(val threadFactory: ForkJoinPool.ForkJoinWorkerThreadFactory, - val parallelism: Int, - val asyncMode: Boolean) extends ExecutorServiceFactory { + class ForkJoinExecutorServiceFactory( + val threadFactory: ForkJoinPool.ForkJoinWorkerThreadFactory, + val parallelism: Int, + val asyncMode: Boolean) extends ExecutorServiceFactory { def this(threadFactory: ForkJoinPool.ForkJoinWorkerThreadFactory, parallelism: Int) = this(threadFactory, parallelism, asyncMode = true) def createExecutorService: ExecutorService = new AkkaForkJoinPool(parallelism, threadFactory, MonitorableThreadFactory.doNothing, asyncMode) } diff --git a/akka-actor/src/main/scala/akka/dispatch/BalancingDispatcher.scala b/akka-actor/src/main/scala/akka/dispatch/BalancingDispatcher.scala index d79eed90fa..6568df3ade 100644 --- a/akka-actor/src/main/scala/akka/dispatch/BalancingDispatcher.scala +++ b/akka-actor/src/main/scala/akka/dispatch/BalancingDispatcher.scala @@ -30,14 +30,14 @@ import scala.concurrent.duration.FiniteDuration */ @deprecated("Use BalancingPool instead of BalancingDispatcher", "2.3") class BalancingDispatcher( - _configurator: MessageDispatcherConfigurator, - _id: String, - throughput: Int, - throughputDeadlineTime: Duration, - _mailboxType: MailboxType, + _configurator: MessageDispatcherConfigurator, + _id: String, + throughput: Int, + throughputDeadlineTime: Duration, + _mailboxType: MailboxType, _executorServiceFactoryProvider: ExecutorServiceFactoryProvider, - _shutdownTimeout: FiniteDuration, - attemptTeamWork: Boolean) + _shutdownTimeout: FiniteDuration, + attemptTeamWork: Boolean) extends Dispatcher(_configurator, _id, throughput, throughputDeadlineTime, _executorServiceFactoryProvider, _shutdownTimeout) { /** diff --git a/akka-actor/src/main/scala/akka/dispatch/Dispatcher.scala b/akka-actor/src/main/scala/akka/dispatch/Dispatcher.scala index c962535388..e533faa071 100644 --- a/akka-actor/src/main/scala/akka/dispatch/Dispatcher.scala +++ b/akka-actor/src/main/scala/akka/dispatch/Dispatcher.scala @@ -26,12 +26,12 @@ import java.util.concurrent.atomic.AtomicReferenceFieldUpdater * Larger values (or zero or negative) increase throughput, smaller values increase fairness */ class Dispatcher( - _configurator: MessageDispatcherConfigurator, - val id: String, - val throughput: Int, - val throughputDeadlineTime: Duration, + _configurator: MessageDispatcherConfigurator, + val id: String, + val throughput: Int, + val throughputDeadlineTime: Duration, executorServiceFactoryProvider: ExecutorServiceFactoryProvider, - val shutdownTimeout: FiniteDuration) + val shutdownTimeout: FiniteDuration) extends MessageDispatcher(_configurator) { import configurator.prerequisites._ diff --git a/akka-actor/src/main/scala/akka/dispatch/Dispatchers.scala b/akka-actor/src/main/scala/akka/dispatch/Dispatchers.scala index 78ffa96527..5ddaca44c7 100644 --- a/akka-actor/src/main/scala/akka/dispatch/Dispatchers.scala +++ b/akka-actor/src/main/scala/akka/dispatch/Dispatchers.scala @@ -30,12 +30,12 @@ trait DispatcherPrerequisites { * INTERNAL API */ private[akka] final case class DefaultDispatcherPrerequisites( - val threadFactory: ThreadFactory, - val eventStream: EventStream, - val scheduler: Scheduler, - val dynamicAccess: DynamicAccess, - val settings: ActorSystem.Settings, - val mailboxes: Mailboxes, + val threadFactory: ThreadFactory, + val eventStream: EventStream, + val scheduler: Scheduler, + val dynamicAccess: DynamicAccess, + val settings: ActorSystem.Settings, + val mailboxes: Mailboxes, val defaultExecutionContext: Option[ExecutionContext]) extends DispatcherPrerequisites object Dispatchers { @@ -135,13 +135,13 @@ class Dispatchers(val settings: ActorSystem.Settings, val prerequisites: Dispatc def simpleName = id.substring(id.lastIndexOf('.') + 1) idConfig(id) .withFallback(appConfig) - .withFallback(ConfigFactory.parseMap(Map("name" -> simpleName).asJava)) + .withFallback(ConfigFactory.parseMap(Map("name" → simpleName).asJava)) .withFallback(defaultDispatcherConfig) } private def idConfig(id: String): Config = { import scala.collection.JavaConverters._ - ConfigFactory.parseMap(Map("id" -> id).asJava) + ConfigFactory.parseMap(Map("id" → id).asJava) } /** @@ -180,7 +180,7 @@ class Dispatchers(val settings: ActorSystem.Settings, val prerequisites: Dispatc classOf[BalancingDispatcherConfigurator].getName) case "PinnedDispatcher" ⇒ new PinnedDispatcherConfigurator(cfg, prerequisites) case fqn ⇒ - val args = List(classOf[Config] -> cfg, classOf[DispatcherPrerequisites] -> prerequisites) + val args = List(classOf[Config] → cfg, classOf[DispatcherPrerequisites] → prerequisites) prerequisites.dynamicAccess.createInstanceFor[MessageDispatcherConfigurator](fqn, args).recover({ case exception ⇒ throw new ConfigurationException( @@ -288,7 +288,8 @@ class PinnedDispatcherConfigurator(config: Config, prerequisites: DispatcherPrer case e: ThreadPoolExecutorConfigurator ⇒ e.threadPoolConfig case other ⇒ prerequisites.eventStream.publish( - Warning("PinnedDispatcherConfigurator", + Warning( + "PinnedDispatcherConfigurator", this.getClass, "PinnedDispatcher [%s] not configured to use ThreadPoolExecutor, falling back to default config.".format( config.getString("id")))) diff --git a/akka-actor/src/main/scala/akka/dispatch/Future.scala b/akka-actor/src/main/scala/akka/dispatch/Future.scala index d25c8251af..9c9e9d277b 100644 --- a/akka-actor/src/main/scala/akka/dispatch/Future.scala +++ b/akka-actor/src/main/scala/akka/dispatch/Future.scala @@ -9,7 +9,7 @@ import akka.japi.{ Function ⇒ JFunc, Option ⇒ JOption, Procedure } import scala.concurrent.{ Future, Promise, ExecutionContext, ExecutionContextExecutor, ExecutionContextExecutorService } import java.lang.{ Iterable ⇒ JIterable } import java.util.{ LinkedList ⇒ JLinkedList } -import java.util.concurrent.{ Executor, ExecutorService, Callable} +import java.util.concurrent.{ Executor, ExecutorService, Callable } import scala.util.{ Try, Success, Failure } import java.util.concurrent.CompletionStage import java.util.concurrent.CompletableFuture diff --git a/akka-actor/src/main/scala/akka/dispatch/Mailbox.scala b/akka-actor/src/main/scala/akka/dispatch/Mailbox.scala index 0e53f4f120..cc834ce986 100644 --- a/akka-actor/src/main/scala/akka/dispatch/Mailbox.scala +++ b/akka-actor/src/main/scala/akka/dispatch/Mailbox.scala @@ -54,7 +54,7 @@ private[akka] object Mailbox { * INTERNAL API */ private[akka] abstract class Mailbox(val messageQueue: MessageQueue) - extends ForkJoinTask[Unit] with SystemMessageQueue with Runnable { + extends ForkJoinTask[Unit] with SystemMessageQueue with Runnable { import Mailbox._ @@ -248,7 +248,7 @@ private[akka] abstract class Mailbox(val messageQueue: MessageQueue) * Process the messages in the mailbox */ @tailrec private final def processMailbox( - left: Int = java.lang.Math.max(dispatcher.throughput, 1), + left: Int = java.lang.Math.max(dispatcher.throughput, 1), deadlineNs: Long = if (dispatcher.isThroughputDeadlineTimeDefined == true) System.nanoTime + dispatcher.throughputDeadlineTime.toNanos else 0L): Unit = if (shouldProcessMessage) { val next = dequeue() @@ -391,7 +391,7 @@ class NodeMessageQueue extends AbstractNodeQueue[Envelope] with MessageQueue wit * Discards overflowing messages into DeadLetters. */ class BoundedNodeMessageQueue(capacity: Int) extends AbstractBoundedNodeQueue[Envelope](capacity) - with MessageQueue with BoundedMessageQueueSemantics with MultipleConsumerSemantics { + with MessageQueue with BoundedMessageQueueSemantics with MultipleConsumerSemantics { final def pushTimeOut: Duration = Duration.Undefined final def enqueue(receiver: ActorRef, handle: Envelope): Unit = @@ -654,10 +654,11 @@ case class NonBlockingBoundedMailbox(val capacity: Int) extends MailboxType with * BoundedMailbox is the default bounded MailboxType used by Akka Actors. */ final case class BoundedMailbox(val capacity: Int, override val pushTimeOut: FiniteDuration) - extends MailboxType with ProducesMessageQueue[BoundedMailbox.MessageQueue] - with ProducesPushTimeoutSemanticsMailbox { + extends MailboxType with ProducesMessageQueue[BoundedMailbox.MessageQueue] + with ProducesPushTimeoutSemanticsMailbox { - def this(settings: ActorSystem.Settings, config: Config) = this(config.getInt("mailbox-capacity"), + def this(settings: ActorSystem.Settings, config: Config) = this( + config.getInt("mailbox-capacity"), config.getNanosDuration("mailbox-push-timeout-time")) if (capacity < 0) throw new IllegalArgumentException("The capacity for BoundedMailbox can not be negative") @@ -669,7 +670,7 @@ final case class BoundedMailbox(val capacity: Int, override val pushTimeOut: Fin object BoundedMailbox { class MessageQueue(capacity: Int, final val pushTimeOut: FiniteDuration) - extends LinkedBlockingQueue[Envelope](capacity) with BoundedQueueBasedMessageQueue { + extends LinkedBlockingQueue[Envelope](capacity) with BoundedQueueBasedMessageQueue { final def queue: BlockingQueue[Envelope] = this } } @@ -679,7 +680,7 @@ object BoundedMailbox { * Extend this class and provide the Comparator in the constructor. */ class UnboundedPriorityMailbox(val cmp: Comparator[Envelope], val initialCapacity: Int) - extends MailboxType with ProducesMessageQueue[UnboundedPriorityMailbox.MessageQueue] { + extends MailboxType with ProducesMessageQueue[UnboundedPriorityMailbox.MessageQueue] { def this(cmp: Comparator[Envelope]) = this(cmp, 11) final override def create(owner: Option[ActorRef], system: Option[ActorSystem]): MessageQueue = new UnboundedPriorityMailbox.MessageQueue(initialCapacity, cmp) @@ -687,7 +688,7 @@ class UnboundedPriorityMailbox(val cmp: Comparator[Envelope], val initialCapacit object UnboundedPriorityMailbox { class MessageQueue(initialCapacity: Int, cmp: Comparator[Envelope]) - extends PriorityBlockingQueue[Envelope](initialCapacity, cmp) with UnboundedQueueBasedMessageQueue { + extends PriorityBlockingQueue[Envelope](initialCapacity, cmp) with UnboundedQueueBasedMessageQueue { final def queue: Queue[Envelope] = this } } @@ -697,8 +698,8 @@ object UnboundedPriorityMailbox { * Extend this class and provide the Comparator in the constructor. */ class BoundedPriorityMailbox( final val cmp: Comparator[Envelope], final val capacity: Int, override final val pushTimeOut: Duration) - extends MailboxType with ProducesMessageQueue[BoundedPriorityMailbox.MessageQueue] - with ProducesPushTimeoutSemanticsMailbox { + extends MailboxType with ProducesMessageQueue[BoundedPriorityMailbox.MessageQueue] + with ProducesPushTimeoutSemanticsMailbox { if (capacity < 0) throw new IllegalArgumentException("The capacity for BoundedMailbox can not be negative") if (pushTimeOut eq null) throw new IllegalArgumentException("The push time-out for BoundedMailbox can not be null") @@ -709,8 +710,8 @@ class BoundedPriorityMailbox( final val cmp: Comparator[Envelope], final val cap object BoundedPriorityMailbox { class MessageQueue(capacity: Int, cmp: Comparator[Envelope], val pushTimeOut: Duration) - extends BoundedBlockingQueue[Envelope](capacity, new PriorityQueue[Envelope](11, cmp)) - with BoundedQueueBasedMessageQueue { + extends BoundedBlockingQueue[Envelope](capacity, new PriorityQueue[Envelope](11, cmp)) + with BoundedQueueBasedMessageQueue { final def queue: BlockingQueue[Envelope] = this } } @@ -721,7 +722,7 @@ object BoundedPriorityMailbox { * Extend this class and provide the Comparator in the constructor. */ class UnboundedStablePriorityMailbox(val cmp: Comparator[Envelope], val initialCapacity: Int) - extends MailboxType with ProducesMessageQueue[UnboundedStablePriorityMailbox.MessageQueue] { + extends MailboxType with ProducesMessageQueue[UnboundedStablePriorityMailbox.MessageQueue] { def this(cmp: Comparator[Envelope]) = this(cmp, 11) final override def create(owner: Option[ActorRef], system: Option[ActorSystem]): MessageQueue = new UnboundedStablePriorityMailbox.MessageQueue(initialCapacity, cmp) @@ -729,7 +730,7 @@ class UnboundedStablePriorityMailbox(val cmp: Comparator[Envelope], val initialC object UnboundedStablePriorityMailbox { class MessageQueue(initialCapacity: Int, cmp: Comparator[Envelope]) - extends StablePriorityBlockingQueue[Envelope](initialCapacity, cmp) with UnboundedQueueBasedMessageQueue { + extends StablePriorityBlockingQueue[Envelope](initialCapacity, cmp) with UnboundedQueueBasedMessageQueue { final def queue: Queue[Envelope] = this } } @@ -740,8 +741,8 @@ object UnboundedStablePriorityMailbox { * Extend this class and provide the Comparator in the constructor. */ class BoundedStablePriorityMailbox( final val cmp: Comparator[Envelope], final val capacity: Int, override final val pushTimeOut: Duration) - extends MailboxType with ProducesMessageQueue[BoundedStablePriorityMailbox.MessageQueue] - with ProducesPushTimeoutSemanticsMailbox { + extends MailboxType with ProducesMessageQueue[BoundedStablePriorityMailbox.MessageQueue] + with ProducesPushTimeoutSemanticsMailbox { if (capacity < 0) throw new IllegalArgumentException("The capacity for BoundedMailbox can not be negative") if (pushTimeOut eq null) throw new IllegalArgumentException("The push time-out for BoundedMailbox can not be null") @@ -752,8 +753,8 @@ class BoundedStablePriorityMailbox( final val cmp: Comparator[Envelope], final v object BoundedStablePriorityMailbox { class MessageQueue(capacity: Int, cmp: Comparator[Envelope], val pushTimeOut: Duration) - extends BoundedBlockingQueue[Envelope](capacity, new StablePriorityQueue[Envelope](11, cmp)) - with BoundedQueueBasedMessageQueue { + extends BoundedBlockingQueue[Envelope](capacity, new StablePriorityQueue[Envelope](11, cmp)) + with BoundedQueueBasedMessageQueue { final def queue: BlockingQueue[Envelope] = this } } @@ -779,10 +780,11 @@ object UnboundedDequeBasedMailbox { * BoundedDequeBasedMailbox is an bounded MailboxType, backed by a Deque. */ case class BoundedDequeBasedMailbox( final val capacity: Int, override final val pushTimeOut: FiniteDuration) - extends MailboxType with ProducesMessageQueue[BoundedDequeBasedMailbox.MessageQueue] - with ProducesPushTimeoutSemanticsMailbox { + extends MailboxType with ProducesMessageQueue[BoundedDequeBasedMailbox.MessageQueue] + with ProducesPushTimeoutSemanticsMailbox { - def this(settings: ActorSystem.Settings, config: Config) = this(config.getInt("mailbox-capacity"), + def this(settings: ActorSystem.Settings, config: Config) = this( + config.getInt("mailbox-capacity"), config.getNanosDuration("mailbox-push-timeout-time")) if (capacity < 0) throw new IllegalArgumentException("The capacity for BoundedDequeBasedMailbox can not be negative") @@ -794,7 +796,7 @@ case class BoundedDequeBasedMailbox( final val capacity: Int, override final val object BoundedDequeBasedMailbox { class MessageQueue(capacity: Int, val pushTimeOut: FiniteDuration) - extends LinkedBlockingDeque[Envelope](capacity) with BoundedDequeBasedMessageQueue { + extends LinkedBlockingDeque[Envelope](capacity) with BoundedDequeBasedMessageQueue { final val queue = this } } @@ -856,9 +858,10 @@ object UnboundedControlAwareMailbox { * to allow messages that extend [[akka.dispatch.ControlMessage]] to be delivered with priority. */ final case class BoundedControlAwareMailbox(capacity: Int, override final val pushTimeOut: FiniteDuration) extends MailboxType - with ProducesMessageQueue[BoundedControlAwareMailbox.MessageQueue] - with ProducesPushTimeoutSemanticsMailbox { - def this(settings: ActorSystem.Settings, config: Config) = this(config.getInt("mailbox-capacity"), + with ProducesMessageQueue[BoundedControlAwareMailbox.MessageQueue] + with ProducesPushTimeoutSemanticsMailbox { + def this(settings: ActorSystem.Settings, config: Config) = this( + config.getInt("mailbox-capacity"), config.getNanosDuration("mailbox-push-timeout-time")) def create(owner: Option[ActorRef], system: Option[ActorSystem]): MessageQueue = new BoundedControlAwareMailbox.MessageQueue(capacity, pushTimeOut) diff --git a/akka-actor/src/main/scala/akka/dispatch/Mailboxes.scala b/akka-actor/src/main/scala/akka/dispatch/Mailboxes.scala index 1fb40b643a..9529c7c35c 100644 --- a/akka-actor/src/main/scala/akka/dispatch/Mailboxes.scala +++ b/akka-actor/src/main/scala/akka/dispatch/Mailboxes.scala @@ -23,10 +23,10 @@ object Mailboxes { } private[akka] class Mailboxes( - val settings: ActorSystem.Settings, + val settings: ActorSystem.Settings, val eventStream: EventStream, - dynamicAccess: DynamicAccess, - deadLetters: ActorRef) { + dynamicAccess: DynamicAccess, + deadLetters: ActorRef) { import Mailboxes._ @@ -187,7 +187,7 @@ private[akka] class Mailboxes( val mailboxType = conf.getString("mailbox-type") match { case "" ⇒ throw new ConfigurationException(s"The setting mailbox-type, defined in [$id] is empty") case fqcn ⇒ - val args = List(classOf[ActorSystem.Settings] -> settings, classOf[Config] -> conf) + val args = List(classOf[ActorSystem.Settings] → settings, classOf[Config] → conf) dynamicAccess.createInstanceFor[MailboxType](fqcn, args).recover({ case exception ⇒ throw new IllegalArgumentException( @@ -228,7 +228,7 @@ private[akka] class Mailboxes( //INTERNAL API private def config(id: String): Config = { import scala.collection.JavaConverters._ - ConfigFactory.parseMap(Map("id" -> id).asJava) + ConfigFactory.parseMap(Map("id" → id).asJava) .withFallback(settings.config.getConfig(id)) .withFallback(defaultMailboxConfig) } diff --git a/akka-actor/src/main/scala/akka/dispatch/PinnedDispatcher.scala b/akka-actor/src/main/scala/akka/dispatch/PinnedDispatcher.scala index 3eba061d19..12c1d58a76 100644 --- a/akka-actor/src/main/scala/akka/dispatch/PinnedDispatcher.scala +++ b/akka-actor/src/main/scala/akka/dispatch/PinnedDispatcher.scala @@ -15,12 +15,13 @@ import scala.concurrent.duration.FiniteDuration * the `lookup` method in [[akka.dispatch.Dispatchers]]. */ class PinnedDispatcher( - _configurator: MessageDispatcherConfigurator, - _actor: ActorCell, - _id: String, - _shutdownTimeout: FiniteDuration, + _configurator: MessageDispatcherConfigurator, + _actor: ActorCell, + _id: String, + _shutdownTimeout: FiniteDuration, _threadPoolConfig: ThreadPoolConfig) - extends Dispatcher(_configurator, + extends Dispatcher( + _configurator, _id, Int.MaxValue, Duration.Zero, diff --git a/akka-actor/src/main/scala/akka/dispatch/ThreadPoolBuilder.scala b/akka-actor/src/main/scala/akka/dispatch/ThreadPoolBuilder.scala index ce88a4340d..cb9ed25f73 100644 --- a/akka-actor/src/main/scala/akka/dispatch/ThreadPoolBuilder.scala +++ b/akka-actor/src/main/scala/akka/dispatch/ThreadPoolBuilder.scala @@ -65,12 +65,13 @@ trait ExecutorServiceFactoryProvider { /** * A small configuration DSL to create ThreadPoolExecutors that can be provided as an ExecutorServiceFactoryProvider to Dispatcher */ -final case class ThreadPoolConfig(allowCorePoolTimeout: Boolean = ThreadPoolConfig.defaultAllowCoreThreadTimeout, - corePoolSize: Int = ThreadPoolConfig.defaultCorePoolSize, - maxPoolSize: Int = ThreadPoolConfig.defaultMaxPoolSize, - threadTimeout: Duration = ThreadPoolConfig.defaultTimeout, - queueFactory: ThreadPoolConfig.QueueFactory = ThreadPoolConfig.linkedBlockingQueue(), - rejectionPolicy: RejectedExecutionHandler = ThreadPoolConfig.defaultRejectionPolicy) +final case class ThreadPoolConfig( + allowCorePoolTimeout: Boolean = ThreadPoolConfig.defaultAllowCoreThreadTimeout, + corePoolSize: Int = ThreadPoolConfig.defaultCorePoolSize, + maxPoolSize: Int = ThreadPoolConfig.defaultMaxPoolSize, + threadTimeout: Duration = ThreadPoolConfig.defaultTimeout, + queueFactory: ThreadPoolConfig.QueueFactory = ThreadPoolConfig.linkedBlockingQueue(), + rejectionPolicy: RejectedExecutionHandler = ThreadPoolConfig.defaultRejectionPolicy) extends ExecutorServiceFactoryProvider { class ThreadPoolExecutorServiceFactory(val threadFactory: ThreadFactory) extends ExecutorServiceFactory { def createExecutorService: ExecutorService = { @@ -173,11 +174,12 @@ object MonitorableThreadFactory { } } -final case class MonitorableThreadFactory(name: String, - daemonic: Boolean, - contextClassLoader: Option[ClassLoader], - exceptionHandler: Thread.UncaughtExceptionHandler = MonitorableThreadFactory.doNothing, - protected val counter: AtomicLong = new AtomicLong) +final case class MonitorableThreadFactory( + name: String, + daemonic: Boolean, + contextClassLoader: Option[ClassLoader], + exceptionHandler: Thread.UncaughtExceptionHandler = MonitorableThreadFactory.doNothing, + protected val counter: AtomicLong = new AtomicLong) extends ThreadFactory with ForkJoinPool.ForkJoinWorkerThreadFactory { def newThread(pool: ForkJoinPool): ForkJoinWorkerThread = { diff --git a/akka-actor/src/main/scala/akka/dispatch/sysmsg/SystemMessage.scala b/akka-actor/src/main/scala/akka/dispatch/sysmsg/SystemMessage.scala index 5dc30913f3..9c0da4a6d2 100644 --- a/akka-actor/src/main/scala/akka/dispatch/sysmsg/SystemMessage.scala +++ b/akka-actor/src/main/scala/akka/dispatch/sysmsg/SystemMessage.scala @@ -261,6 +261,6 @@ private[akka] final case class Failed(child: ActorRef, cause: Throwable, uid: In @SerialVersionUID(1L) private[akka] final case class DeathWatchNotification( - actor: ActorRef, + actor: ActorRef, existenceConfirmed: Boolean, - addressTerminated: Boolean) extends SystemMessage with DeadLetterSuppression + addressTerminated: Boolean) extends SystemMessage with DeadLetterSuppression diff --git a/akka-actor/src/main/scala/akka/event/Logging.scala b/akka-actor/src/main/scala/akka/event/Logging.scala index c602bd2ce9..b2dbae6ea3 100644 --- a/akka-actor/src/main/scala/akka/event/Logging.scala +++ b/akka-actor/src/main/scala/akka/event/Logging.scala @@ -572,9 +572,9 @@ object Logging { } /** - * Obtain LoggingAdapter with MDC support for the given actor. - * Don't use it outside its specific Actor as it isn't thread safe - */ + * Obtain LoggingAdapter with MDC support for the given actor. + * Don't use it outside its specific Actor as it isn't thread safe + */ def getLogger(logSource: Actor): DiagnosticLoggingAdapter = apply(logSource) /** diff --git a/akka-actor/src/main/scala/akka/io/SimpleDnsCache.scala b/akka-actor/src/main/scala/akka/io/SimpleDnsCache.scala index 6ee9aab3ca..9a342d5b4f 100644 --- a/akka-actor/src/main/scala/akka/io/SimpleDnsCache.scala +++ b/akka-actor/src/main/scala/akka/io/SimpleDnsCache.scala @@ -58,7 +58,7 @@ object SimpleDnsCache { new Cache( queue + new ExpiryEntry(answer.name, until), - cache + (answer.name -> CacheEntry(answer, until)), + cache + (answer.name → CacheEntry(answer, until)), clock) } diff --git a/akka-actor/src/main/scala/akka/io/Tcp.scala b/akka-actor/src/main/scala/akka/io/Tcp.scala index d8f42f721e..37bae8e5ce 100644 --- a/akka-actor/src/main/scala/akka/io/Tcp.scala +++ b/akka-actor/src/main/scala/akka/io/Tcp.scala @@ -110,11 +110,12 @@ object Tcp extends ExtensionId[TcpExt] with ExtensionIdProvider { * @param localAddress optionally specifies a specific address to bind to * @param options Please refer to the `Tcp.SO` object for a list of all supported options. */ - final case class Connect(remoteAddress: InetSocketAddress, - localAddress: Option[InetSocketAddress] = None, - options: immutable.Traversable[SocketOption] = Nil, - timeout: Option[FiniteDuration] = None, - pullMode: Boolean = false) extends Command + final case class Connect( + remoteAddress: InetSocketAddress, + localAddress: Option[InetSocketAddress] = None, + options: immutable.Traversable[SocketOption] = Nil, + timeout: Option[FiniteDuration] = None, + pullMode: Boolean = false) extends Command /** * The Bind message is send to the TCP manager actor, which is obtained via @@ -135,11 +136,12 @@ object Tcp extends ExtensionId[TcpExt] with ExtensionIdProvider { * * @param options Please refer to the `Tcp.SO` object for a list of all supported options. */ - final case class Bind(handler: ActorRef, - localAddress: InetSocketAddress, - backlog: Int = 100, - options: immutable.Traversable[SocketOption] = Nil, - pullMode: Boolean = false) extends Command + final case class Bind( + handler: ActorRef, + localAddress: InetSocketAddress, + backlog: Int = 100, + options: immutable.Traversable[SocketOption] = Nil, + pullMode: Boolean = false) extends Command /** * This message must be sent to a TCP connection actor after receiving the @@ -624,11 +626,12 @@ object TcpMessage { * @param timeout is the desired connection timeout, `null` means "no timeout" * @param pullMode enables pull based reading from the connection */ - def connect(remoteAddress: InetSocketAddress, - localAddress: InetSocketAddress, - options: JIterable[SocketOption], - timeout: FiniteDuration, - pullMode: Boolean): Command = Connect(remoteAddress, Option(localAddress), options, Option(timeout), pullMode) + def connect( + remoteAddress: InetSocketAddress, + localAddress: InetSocketAddress, + options: JIterable[SocketOption], + timeout: FiniteDuration, + pullMode: Boolean): Command = Connect(remoteAddress, Option(localAddress), options, Option(timeout), pullMode) /** * Connect to the given `remoteAddress` without binding to a local address and without @@ -658,17 +661,19 @@ object TcpMessage { * @param pullMode enables pull based accepting and of connections and pull * based reading from the accepted connections. */ - def bind(handler: ActorRef, - endpoint: InetSocketAddress, - backlog: Int, - options: JIterable[SocketOption], - pullMode: Boolean): Command = Bind(handler, endpoint, backlog, options, pullMode) + def bind( + handler: ActorRef, + endpoint: InetSocketAddress, + backlog: Int, + options: JIterable[SocketOption], + pullMode: Boolean): Command = Bind(handler, endpoint, backlog, options, pullMode) /** * Open a listening socket without specifying options. */ - def bind(handler: ActorRef, - endpoint: InetSocketAddress, - backlog: Int): Command = Bind(handler, endpoint, backlog, Nil) + def bind( + handler: ActorRef, + endpoint: InetSocketAddress, + backlog: Int): Command = Bind(handler, endpoint, backlog, Nil) /** * This message must be sent to a TCP connection actor after receiving the diff --git a/akka-actor/src/main/scala/akka/io/TcpConnection.scala b/akka-actor/src/main/scala/akka/io/TcpConnection.scala index 6cd9d60280..d97be3d1ff 100644 --- a/akka-actor/src/main/scala/akka/io/TcpConnection.scala +++ b/akka-actor/src/main/scala/akka/io/TcpConnection.scala @@ -388,9 +388,9 @@ private[io] abstract class TcpConnection(val tcp: TcpExt, val channel: SocketCha class PendingBufferWrite( val commander: ActorRef, remainingData: ByteString, - ack: Any, - buffer: ByteBuffer, - tail: WriteCommand) extends PendingWrite { + ack: Any, + buffer: ByteBuffer, + tail: WriteCommand) extends PendingWrite { def doWrite(info: ConnectionInfo): PendingWrite = { @tailrec def writeToChannel(data: ByteString): PendingWrite = { @@ -429,11 +429,11 @@ private[io] abstract class TcpConnection(val tcp: TcpExt, val channel: SocketCha class PendingWriteFile( val commander: ActorRef, - fileChannel: FileChannel, - offset: Long, - remaining: Long, - ack: Event, - tail: WriteCommand) extends PendingWrite with Runnable { + fileChannel: FileChannel, + offset: Long, + remaining: Long, + ack: Event, + tail: WriteCommand) extends PendingWrite with Runnable { def doWrite(info: ConnectionInfo): PendingWrite = { tcp.fileIoDispatcher.execute(this) @@ -479,10 +479,11 @@ private[io] object TcpConnection { /** * Groups required connection-related data that are only available once the connection has been fully established. */ - final case class ConnectionInfo(registration: ChannelRegistration, - handler: ActorRef, - keepOpenOnPeerClosed: Boolean, - useResumeWriting: Boolean) + final case class ConnectionInfo( + registration: ChannelRegistration, + handler: ActorRef, + keepOpenOnPeerClosed: Boolean, + useResumeWriting: Boolean) // INTERNAL MESSAGES diff --git a/akka-actor/src/main/scala/akka/io/TcpIncomingConnection.scala b/akka-actor/src/main/scala/akka/io/TcpIncomingConnection.scala index 689a5b8e62..f7efe2bbf1 100644 --- a/akka-actor/src/main/scala/akka/io/TcpIncomingConnection.scala +++ b/akka-actor/src/main/scala/akka/io/TcpIncomingConnection.scala @@ -15,12 +15,13 @@ import akka.io.Inet.SocketOption * * INTERNAL API */ -private[io] class TcpIncomingConnection(_tcp: TcpExt, - _channel: SocketChannel, - registry: ChannelRegistry, - bindHandler: ActorRef, - options: immutable.Traversable[SocketOption], - readThrottling: Boolean) +private[io] class TcpIncomingConnection( + _tcp: TcpExt, + _channel: SocketChannel, + registry: ChannelRegistry, + bindHandler: ActorRef, + options: immutable.Traversable[SocketOption], + readThrottling: Boolean) extends TcpConnection(_tcp, _channel, readThrottling) { signDeathPact(bindHandler) diff --git a/akka-actor/src/main/scala/akka/io/TcpListener.scala b/akka-actor/src/main/scala/akka/io/TcpListener.scala index ddf4c9bc82..0f5ca05e16 100644 --- a/akka-actor/src/main/scala/akka/io/TcpListener.scala +++ b/akka-actor/src/main/scala/akka/io/TcpListener.scala @@ -31,11 +31,12 @@ private[io] object TcpListener { /** * INTERNAL API */ -private[io] class TcpListener(selectorRouter: ActorRef, - tcp: TcpExt, - channelRegistry: ChannelRegistry, - bindCommander: ActorRef, - bind: Bind) +private[io] class TcpListener( + selectorRouter: ActorRef, + tcp: TcpExt, + channelRegistry: ChannelRegistry, + bindCommander: ActorRef, + bind: Bind) extends Actor with ActorLogging with RequiresMessageQueue[UnboundedMessageQueueSemantics] { import TcpListener._ diff --git a/akka-actor/src/main/scala/akka/io/TcpOutgoingConnection.scala b/akka-actor/src/main/scala/akka/io/TcpOutgoingConnection.scala index e6fce9c7f0..05f64eb35b 100644 --- a/akka-actor/src/main/scala/akka/io/TcpOutgoingConnection.scala +++ b/akka-actor/src/main/scala/akka/io/TcpOutgoingConnection.scala @@ -19,10 +19,11 @@ import akka.io.Tcp._ * * INTERNAL API */ -private[io] class TcpOutgoingConnection(_tcp: TcpExt, - channelRegistry: ChannelRegistry, - commander: ActorRef, - connect: Connect) +private[io] class TcpOutgoingConnection( + _tcp: TcpExt, + channelRegistry: ChannelRegistry, + commander: ActorRef, + connect: Connect) extends TcpConnection(_tcp, SocketChannel.open().configureBlocking(false).asInstanceOf[SocketChannel], connect.pullMode) { import context._ diff --git a/akka-actor/src/main/scala/akka/io/Udp.scala b/akka-actor/src/main/scala/akka/io/Udp.scala index 035cd315ff..8bc3e425b0 100644 --- a/akka-actor/src/main/scala/akka/io/Udp.scala +++ b/akka-actor/src/main/scala/akka/io/Udp.scala @@ -92,9 +92,10 @@ object Udp extends ExtensionId[UdpExt] with ExtensionIdProvider { * The listener actor for the newly bound port will reply with a [[Bound]] * message, or the manager will reply with a [[CommandFailed]] message. */ - final case class Bind(handler: ActorRef, - localAddress: InetSocketAddress, - options: immutable.Traversable[SocketOption] = Nil) extends Command + final case class Bind( + handler: ActorRef, + localAddress: InetSocketAddress, + options: immutable.Traversable[SocketOption] = Nil) extends Command /** * Send this message to the listener actor that previously sent a [[Bound]] diff --git a/akka-actor/src/main/scala/akka/io/UdpConnected.scala b/akka-actor/src/main/scala/akka/io/UdpConnected.scala index 1d9a39c3e5..6c611abb1b 100644 --- a/akka-actor/src/main/scala/akka/io/UdpConnected.scala +++ b/akka-actor/src/main/scala/akka/io/UdpConnected.scala @@ -84,10 +84,11 @@ object UdpConnected extends ExtensionId[UdpConnectedExt] with ExtensionIdProvide * which is restricted to sending to and receiving from the given `remoteAddress`. * All received datagrams will be sent to the designated `handler` actor. */ - final case class Connect(handler: ActorRef, - remoteAddress: InetSocketAddress, - localAddress: Option[InetSocketAddress] = None, - options: immutable.Traversable[SocketOption] = Nil) extends Command + final case class Connect( + handler: ActorRef, + remoteAddress: InetSocketAddress, + localAddress: Option[InetSocketAddress] = None, + options: immutable.Traversable[SocketOption] = Nil) extends Command /** * Send this message to a connection actor (which had previously sent the @@ -176,21 +177,24 @@ object UdpConnectedMessage { * which is restricted to sending to and receiving from the given `remoteAddress`. * All received datagrams will be sent to the designated `handler` actor. */ - def connect(handler: ActorRef, - remoteAddress: InetSocketAddress, - localAddress: InetSocketAddress, - options: JIterable[SocketOption]): Command = Connect(handler, remoteAddress, Some(localAddress), options) + def connect( + handler: ActorRef, + remoteAddress: InetSocketAddress, + localAddress: InetSocketAddress, + options: JIterable[SocketOption]): Command = Connect(handler, remoteAddress, Some(localAddress), options) /** * Connect without specifying the `localAddress`. */ - def connect(handler: ActorRef, - remoteAddress: InetSocketAddress, - options: JIterable[SocketOption]): Command = Connect(handler, remoteAddress, None, options) + def connect( + handler: ActorRef, + remoteAddress: InetSocketAddress, + options: JIterable[SocketOption]): Command = Connect(handler, remoteAddress, None, options) /** * Connect without specifying the `localAddress` or `options`. */ - def connect(handler: ActorRef, - remoteAddress: InetSocketAddress): Command = Connect(handler, remoteAddress, None, Nil) + def connect( + handler: ActorRef, + remoteAddress: InetSocketAddress): Command = Connect(handler, remoteAddress, None, Nil) /** * This message is understood by the connection actors to send data to their diff --git a/akka-actor/src/main/scala/akka/io/UdpConnection.scala b/akka-actor/src/main/scala/akka/io/UdpConnection.scala index 0f3051d128..e391f27590 100644 --- a/akka-actor/src/main/scala/akka/io/UdpConnection.scala +++ b/akka-actor/src/main/scala/akka/io/UdpConnection.scala @@ -18,10 +18,11 @@ import akka.io.UdpConnected._ /** * INTERNAL API */ -private[io] class UdpConnection(udpConn: UdpConnectedExt, - channelRegistry: ChannelRegistry, - commander: ActorRef, - connect: Connect) +private[io] class UdpConnection( + udpConn: UdpConnectedExt, + channelRegistry: ChannelRegistry, + commander: ActorRef, + connect: Connect) extends Actor with ActorLogging with RequiresMessageQueue[UnboundedMessageQueueSemantics] { import connect._ @@ -153,7 +154,8 @@ private[io] class UdpConnection(udpConn: UdpConnectedExt, thunk } catch { case NonFatal(e) ⇒ - log.debug("Failure while connecting UDP channel to remote address [{}] local address [{}]: {}", + log.debug( + "Failure while connecting UDP channel to remote address [{}] local address [{}]: {}", remoteAddress, localAddress.getOrElse("undefined"), e) commander ! CommandFailed(connect) context.stop(self) diff --git a/akka-actor/src/main/scala/akka/io/UdpListener.scala b/akka-actor/src/main/scala/akka/io/UdpListener.scala index 96708869fc..a071b9d6c8 100644 --- a/akka-actor/src/main/scala/akka/io/UdpListener.scala +++ b/akka-actor/src/main/scala/akka/io/UdpListener.scala @@ -19,10 +19,11 @@ import akka.io.Udp._ /** * INTERNAL API */ -private[io] class UdpListener(val udp: UdpExt, - channelRegistry: ChannelRegistry, - bindCommander: ActorRef, - bind: Bind) +private[io] class UdpListener( + val udp: UdpExt, + channelRegistry: ChannelRegistry, + bindCommander: ActorRef, + bind: Bind) extends Actor with ActorLogging with WithUdpSend with RequiresMessageQueue[UnboundedMessageQueueSemantics] { import udp.bufferPool diff --git a/akka-actor/src/main/scala/akka/io/UdpSender.scala b/akka-actor/src/main/scala/akka/io/UdpSender.scala index a52bfc4f2e..c96e43b6d5 100644 --- a/akka-actor/src/main/scala/akka/io/UdpSender.scala +++ b/akka-actor/src/main/scala/akka/io/UdpSender.scala @@ -14,10 +14,11 @@ import akka.actor._ /** * INTERNAL API */ -private[io] class UdpSender(val udp: UdpExt, - channelRegistry: ChannelRegistry, - commander: ActorRef, - options: immutable.Traversable[SocketOption]) +private[io] class UdpSender( + val udp: UdpExt, + channelRegistry: ChannelRegistry, + commander: ActorRef, + options: immutable.Traversable[SocketOption]) extends Actor with ActorLogging with WithUdpSend with RequiresMessageQueue[UnboundedMessageQueueSemantics] { val channel = { diff --git a/akka-actor/src/main/scala/akka/io/WithUdpSend.scala b/akka-actor/src/main/scala/akka/io/WithUdpSend.scala index 5759650c8a..7063e8b049 100644 --- a/akka-actor/src/main/scala/akka/io/WithUdpSend.scala +++ b/akka-actor/src/main/scala/akka/io/WithUdpSend.scala @@ -51,7 +51,8 @@ private[io] trait WithUdpSend { } catch { case NonFatal(e) ⇒ sender() ! CommandFailed(send) - log.debug("Failure while sending UDP datagram to remote address [{}]: {}", + log.debug( + "Failure while sending UDP datagram to remote address [{}]: {}", send.target, e) retriedSend = false pendingSend = null diff --git a/akka-actor/src/main/scala/akka/pattern/BackoffOnRestartSupervisor.scala b/akka-actor/src/main/scala/akka/pattern/BackoffOnRestartSupervisor.scala index f575148609..8541459d84 100644 --- a/akka-actor/src/main/scala/akka/pattern/BackoffOnRestartSupervisor.scala +++ b/akka-actor/src/main/scala/akka/pattern/BackoffOnRestartSupervisor.scala @@ -16,12 +16,12 @@ import akka.actor.SupervisorStrategy._ */ private class BackoffOnRestartSupervisor( val childProps: Props, - val childName: String, - minBackoff: FiniteDuration, - maxBackoff: FiniteDuration, - val reset: BackoffReset, - randomFactor: Double, - strategy: OneForOneStrategy) + val childName: String, + minBackoff: FiniteDuration, + maxBackoff: FiniteDuration, + val reset: BackoffReset, + randomFactor: Double, + strategy: OneForOneStrategy) extends Actor with HandleBackoff with ActorLogging { diff --git a/akka-actor/src/main/scala/akka/pattern/BackoffOptions.scala b/akka-actor/src/main/scala/akka/pattern/BackoffOptions.scala index 36a5dca998..d7af6f7ea7 100644 --- a/akka-actor/src/main/scala/akka/pattern/BackoffOptions.scala +++ b/akka-actor/src/main/scala/akka/pattern/BackoffOptions.scala @@ -70,10 +70,10 @@ object Backoff { * In order to skip this additional delay pass in `0`. */ def onFailure( - childProps: Props, - childName: String, - minBackoff: FiniteDuration, - maxBackoff: FiniteDuration, + childProps: Props, + childName: String, + minBackoff: FiniteDuration, + maxBackoff: FiniteDuration, randomFactor: Double): BackoffOptions = BackoffOptionsImpl(RestartImpliesFailure, childProps, childName, minBackoff, maxBackoff, randomFactor) @@ -131,10 +131,10 @@ object Backoff { * In order to skip this additional delay pass in `0`. */ def onStop( - childProps: Props, - childName: String, - minBackoff: FiniteDuration, - maxBackoff: FiniteDuration, + childProps: Props, + childName: String, + minBackoff: FiniteDuration, + maxBackoff: FiniteDuration, randomFactor: Double): BackoffOptions = BackoffOptionsImpl(StopImpliesFailure, childProps, childName, minBackoff, maxBackoff, randomFactor) } @@ -183,14 +183,14 @@ trait BackoffOptions { } private final case class BackoffOptionsImpl( - backoffType: BackoffType = RestartImpliesFailure, - childProps: Props, - childName: String, - minBackoff: FiniteDuration, - maxBackoff: FiniteDuration, - randomFactor: Double, - reset: Option[BackoffReset] = None, - supervisorStrategy: OneForOneStrategy = OneForOneStrategy()(SupervisorStrategy.defaultStrategy.decider)) extends BackoffOptions { + backoffType: BackoffType = RestartImpliesFailure, + childProps: Props, + childName: String, + minBackoff: FiniteDuration, + maxBackoff: FiniteDuration, + randomFactor: Double, + reset: Option[BackoffReset] = None, + supervisorStrategy: OneForOneStrategy = OneForOneStrategy()(SupervisorStrategy.defaultStrategy.decider)) extends BackoffOptions { val backoffReset = reset.getOrElse(AutoReset(minBackoff)) diff --git a/akka-actor/src/main/scala/akka/pattern/BackoffSupervisor.scala b/akka-actor/src/main/scala/akka/pattern/BackoffSupervisor.scala index aa19dd0d1f..7f09d07929 100644 --- a/akka-actor/src/main/scala/akka/pattern/BackoffSupervisor.scala +++ b/akka-actor/src/main/scala/akka/pattern/BackoffSupervisor.scala @@ -37,10 +37,10 @@ object BackoffSupervisor { * In order to skip this additional delay pass in `0`. */ def props( - childProps: Props, - childName: String, - minBackoff: FiniteDuration, - maxBackoff: FiniteDuration, + childProps: Props, + childName: String, + minBackoff: FiniteDuration, + maxBackoff: FiniteDuration, randomFactor: Double): Props = { propsWithSupervisorStrategy(childProps, childName, minBackoff, maxBackoff, randomFactor, SupervisorStrategy.defaultStrategy) } @@ -66,12 +66,12 @@ object BackoffSupervisor { * in the child */ def propsWithSupervisorStrategy( - childProps: Props, - childName: String, - minBackoff: FiniteDuration, - maxBackoff: FiniteDuration, + childProps: Props, + childName: String, + minBackoff: FiniteDuration, + maxBackoff: FiniteDuration, randomFactor: Double, - strategy: SupervisorStrategy): Props = { + strategy: SupervisorStrategy): Props = { require(minBackoff > Duration.Zero, "minBackoff must be > 0") require(maxBackoff >= minBackoff, "maxBackoff must be >= minBackoff") require(0.0 <= randomFactor && randomFactor <= 1.0, "randomFactor must be between 0.0 and 1.0") @@ -145,8 +145,8 @@ object BackoffSupervisor { */ private[akka] def calculateDelay( restartCount: Int, - minBackoff: FiniteDuration, - maxBackoff: FiniteDuration, + minBackoff: FiniteDuration, + maxBackoff: FiniteDuration, randomFactor: Double): FiniteDuration = { val rnd = 1.0 + ThreadLocalRandom.current().nextDouble() * randomFactor if (restartCount >= 30) // Duration overflow protection (> 100 years) @@ -166,12 +166,12 @@ object BackoffSupervisor { */ final class BackoffSupervisor( val childProps: Props, - val childName: String, - minBackoff: FiniteDuration, - maxBackoff: FiniteDuration, - val reset: BackoffReset, - randomFactor: Double, - strategy: SupervisorStrategy) + val childName: String, + minBackoff: FiniteDuration, + maxBackoff: FiniteDuration, + val reset: BackoffReset, + randomFactor: Double, + strategy: SupervisorStrategy) extends Actor with HandleBackoff { import BackoffSupervisor._ @@ -192,20 +192,20 @@ final class BackoffSupervisor( // for binary compatibility with 2.4.1 def this( - childProps: Props, - childName: String, - minBackoff: FiniteDuration, - maxBackoff: FiniteDuration, - randomFactor: Double, + childProps: Props, + childName: String, + minBackoff: FiniteDuration, + maxBackoff: FiniteDuration, + randomFactor: Double, supervisorStrategy: SupervisorStrategy) = this(childProps, childName, minBackoff, maxBackoff, AutoReset(minBackoff), randomFactor, supervisorStrategy) // for binary compatibility with 2.4.0 def this( - childProps: Props, - childName: String, - minBackoff: FiniteDuration, - maxBackoff: FiniteDuration, + childProps: Props, + childName: String, + minBackoff: FiniteDuration, + maxBackoff: FiniteDuration, randomFactor: Double) = this(childProps, childName, minBackoff, maxBackoff, randomFactor, SupervisorStrategy.defaultStrategy) diff --git a/akka-actor/src/main/scala/akka/pattern/CircuitBreaker.scala b/akka-actor/src/main/scala/akka/pattern/CircuitBreaker.scala index 2d83675bc9..9e0a52c2ce 100644 --- a/akka-actor/src/main/scala/akka/pattern/CircuitBreaker.scala +++ b/akka-actor/src/main/scala/akka/pattern/CircuitBreaker.scala @@ -515,5 +515,5 @@ class CircuitBreaker(scheduler: Scheduler, maxFailures: Int, callTimeout: Finite */ class CircuitBreakerOpenException( val remainingDuration: FiniteDuration, - message: String = "Circuit Breaker is open; calls are failing fast") + message: String = "Circuit Breaker is open; calls are failing fast") extends AkkaException(message) with NoStackTrace diff --git a/akka-actor/src/main/scala/akka/routing/Balancing.scala b/akka-actor/src/main/scala/akka/routing/Balancing.scala index e7210b7039..3660b28aa3 100644 --- a/akka-actor/src/main/scala/akka/routing/Balancing.scala +++ b/akka-actor/src/main/scala/akka/routing/Balancing.scala @@ -66,9 +66,9 @@ private[akka] final class BalancingRoutingLogic extends RoutingLogic { */ @SerialVersionUID(1L) final case class BalancingPool( - override val nrOfInstances: Int, + override val nrOfInstances: Int, override val supervisorStrategy: SupervisorStrategy = Pool.defaultSupervisorStrategy, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) extends Pool { def this(config: Config) = @@ -112,12 +112,14 @@ final case class BalancingPool( // dispatcher of this pool val deployDispatcherConfigPath = s"akka.actor.deployment.$deployPath.pool-dispatcher" val systemConfig = context.system.settings.config - val dispatcherConfig = context.system.dispatchers.config(dispatcherId, + val dispatcherConfig = context.system.dispatchers.config( + dispatcherId, // use the user defined 'pool-dispatcher' config as fallback, if any if (systemConfig.hasPath(deployDispatcherConfigPath)) systemConfig.getConfig(deployDispatcherConfigPath) else ConfigFactory.empty) - dispatchers.registerConfigurator(dispatcherId, new BalancingDispatcherConfigurator(dispatcherConfig, + dispatchers.registerConfigurator(dispatcherId, new BalancingDispatcherConfigurator( + dispatcherConfig, dispatchers.prerequisites)) } diff --git a/akka-actor/src/main/scala/akka/routing/Broadcast.scala b/akka-actor/src/main/scala/akka/routing/Broadcast.scala index fbc54e4af2..b71f3153bf 100644 --- a/akka-actor/src/main/scala/akka/routing/Broadcast.scala +++ b/akka-actor/src/main/scala/akka/routing/Broadcast.scala @@ -58,8 +58,8 @@ final class BroadcastRoutingLogic extends RoutingLogic { final case class BroadcastPool( override val nrOfInstances: Int, override val resizer: Option[Resizer] = None, override val supervisorStrategy: SupervisorStrategy = Pool.defaultSupervisorStrategy, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, - override val usePoolDispatcher: Boolean = false) + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, + override val usePoolDispatcher: Boolean = false) extends Pool with PoolOverrideUnsetConfig[BroadcastPool] { def this(config: Config) = @@ -118,8 +118,8 @@ final case class BroadcastPool( */ @SerialVersionUID(1L) final case class BroadcastGroup( - override val paths: immutable.Iterable[String], - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) + override val paths: immutable.Iterable[String], + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) extends Group { def this(config: Config) = diff --git a/akka-actor/src/main/scala/akka/routing/ConsistentHash.scala b/akka-actor/src/main/scala/akka/routing/ConsistentHash.scala index 69671a134a..15b5101e7b 100644 --- a/akka-actor/src/main/scala/akka/routing/ConsistentHash.scala +++ b/akka-actor/src/main/scala/akka/routing/ConsistentHash.scala @@ -39,7 +39,8 @@ class ConsistentHash[T: ClassTag] private (nodes: immutable.SortedMap[Int, T], v */ def :+(node: T): ConsistentHash[T] = { val nodeHash = hashFor(node.toString) - new ConsistentHash(nodes ++ ((1 to virtualNodesFactor) map { r ⇒ (concatenateNodeHash(nodeHash, r) -> node) }), + new ConsistentHash( + nodes ++ ((1 to virtualNodesFactor) map { r ⇒ (concatenateNodeHash(nodeHash, r) → node) }), virtualNodesFactor) } @@ -57,7 +58,8 @@ class ConsistentHash[T: ClassTag] private (nodes: immutable.SortedMap[Int, T], v */ def :-(node: T): ConsistentHash[T] = { val nodeHash = hashFor(node.toString) - new ConsistentHash(nodes -- ((1 to virtualNodesFactor) map { r ⇒ concatenateNodeHash(nodeHash, r) }), + new ConsistentHash( + nodes -- ((1 to virtualNodesFactor) map { r ⇒ concatenateNodeHash(nodeHash, r) }), virtualNodesFactor) } @@ -110,12 +112,13 @@ class ConsistentHash[T: ClassTag] private (nodes: immutable.SortedMap[Int, T], v object ConsistentHash { def apply[T: ClassTag](nodes: Iterable[T], virtualNodesFactor: Int): ConsistentHash[T] = { - new ConsistentHash(immutable.SortedMap.empty[Int, T] ++ - (for { - node ← nodes - nodeHash = hashFor(node.toString) - vnode ← 1 to virtualNodesFactor - } yield (concatenateNodeHash(nodeHash, vnode) -> node)), + new ConsistentHash( + immutable.SortedMap.empty[Int, T] ++ + (for { + node ← nodes + nodeHash = hashFor(node.toString) + vnode ← 1 to virtualNodesFactor + } yield (concatenateNodeHash(nodeHash, vnode) → node)), virtualNodesFactor) } diff --git a/akka-actor/src/main/scala/akka/routing/ConsistentHashing.scala b/akka-actor/src/main/scala/akka/routing/ConsistentHashing.scala index 34cbb549ab..78dd4ff505 100644 --- a/akka-actor/src/main/scala/akka/routing/ConsistentHashing.scala +++ b/akka-actor/src/main/scala/akka/routing/ConsistentHashing.scala @@ -135,9 +135,9 @@ object ConsistentHashingRoutingLogic { */ @SerialVersionUID(1L) final case class ConsistentHashingRoutingLogic( - system: ActorSystem, - virtualNodesFactor: Int = 0, - hashMapping: ConsistentHashingRouter.ConsistentHashMapping = ConsistentHashingRouter.emptyConsistentHashMapping) + system: ActorSystem, + virtualNodesFactor: Int = 0, + hashMapping: ConsistentHashingRouter.ConsistentHashMapping = ConsistentHashingRouter.emptyConsistentHashMapping) extends RoutingLogic { import ConsistentHashingRouter._ @@ -219,7 +219,8 @@ final case class ConsistentHashingRoutingLogic( case _ if hashMapping.isDefinedAt(message) ⇒ target(hashMapping(message)) case hashable: ConsistentHashable ⇒ target(hashable.consistentHashKey) case other ⇒ - log.warning("Message [{}] must be handled by hashMapping, or implement [{}] or be wrapped in [{}]", + log.warning( + "Message [{}] must be handled by hashMapping, or implement [{}] or be wrapped in [{}]", message.getClass.getName, classOf[ConsistentHashable].getName, classOf[ConsistentHashableEnvelope].getName) NoRoutee @@ -266,13 +267,13 @@ final case class ConsistentHashingRoutingLogic( */ @SerialVersionUID(1L) final case class ConsistentHashingPool( - override val nrOfInstances: Int, - override val resizer: Option[Resizer] = None, - val virtualNodesFactor: Int = 0, - val hashMapping: ConsistentHashingRouter.ConsistentHashMapping = ConsistentHashingRouter.emptyConsistentHashMapping, - override val supervisorStrategy: SupervisorStrategy = Pool.defaultSupervisorStrategy, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, - override val usePoolDispatcher: Boolean = false) + override val nrOfInstances: Int, + override val resizer: Option[Resizer] = None, + val virtualNodesFactor: Int = 0, + val hashMapping: ConsistentHashingRouter.ConsistentHashMapping = ConsistentHashingRouter.emptyConsistentHashMapping, + override val supervisorStrategy: SupervisorStrategy = Pool.defaultSupervisorStrategy, + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, + override val usePoolDispatcher: Boolean = false) extends Pool with PoolOverrideUnsetConfig[ConsistentHashingPool] { def this(config: Config) = @@ -354,10 +355,10 @@ final case class ConsistentHashingPool( */ @SerialVersionUID(1L) final case class ConsistentHashingGroup( - override val paths: immutable.Iterable[String], - val virtualNodesFactor: Int = 0, - val hashMapping: ConsistentHashingRouter.ConsistentHashMapping = ConsistentHashingRouter.emptyConsistentHashMapping, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) + override val paths: immutable.Iterable[String], + val virtualNodesFactor: Int = 0, + val hashMapping: ConsistentHashingRouter.ConsistentHashMapping = ConsistentHashingRouter.emptyConsistentHashMapping, + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) extends Group { def this(config: Config) = diff --git a/akka-actor/src/main/scala/akka/routing/OptimalSizeExploringResizer.scala b/akka-actor/src/main/scala/akka/routing/OptimalSizeExploringResizer.scala index d14704250b..bf2da2c760 100644 --- a/akka-actor/src/main/scala/akka/routing/OptimalSizeExploringResizer.scala +++ b/akka-actor/src/main/scala/akka/routing/OptimalSizeExploringResizer.scala @@ -44,9 +44,9 @@ case object OptimalSizeExploringResizer { */ private[routing] case class ResizeRecord( underutilizationStreak: Option[UnderUtilizationStreak] = None, - messageCount: Long = 0, - totalQueueLength: Int = 0, - checkTime: Long = 0) + messageCount: Long = 0, + totalQueueLength: Int = 0, + checkTime: Long = 0) /** * INTERNAL API @@ -115,16 +115,16 @@ case object OptimalSizeExploringResizer { */ @SerialVersionUID(1L) case class DefaultOptimalSizeExploringResizer( - lowerBound: PoolSize = 1, - upperBound: PoolSize = 30, - chanceOfScalingDownWhenFull: Double = 0.2, - actionInterval: Duration = 5.seconds, - numOfAdjacentSizesToConsiderDuringOptimization: Int = 16, - exploreStepSize: Double = 0.1, - downsizeRatio: Double = 0.8, - downsizeAfterUnderutilizedFor: Duration = 72.hours, - explorationProbability: Double = 0.4, - weightOfLatestMetric: Double = 0.5) extends OptimalSizeExploringResizer { + lowerBound: PoolSize = 1, + upperBound: PoolSize = 30, + chanceOfScalingDownWhenFull: Double = 0.2, + actionInterval: Duration = 5.seconds, + numOfAdjacentSizesToConsiderDuringOptimization: Int = 16, + exploreStepSize: Double = 0.1, + downsizeRatio: Double = 0.8, + downsizeAfterUnderutilizedFor: Duration = 72.hours, + explorationProbability: Double = 0.4, + weightOfLatestMetric: Double = 0.5) extends OptimalSizeExploringResizer { /** * Leave package accessible for testing purpose */ diff --git a/akka-actor/src/main/scala/akka/routing/Random.scala b/akka-actor/src/main/scala/akka/routing/Random.scala index 7984033f93..19f00e19d9 100644 --- a/akka-actor/src/main/scala/akka/routing/Random.scala +++ b/akka-actor/src/main/scala/akka/routing/Random.scala @@ -59,8 +59,8 @@ final class RandomRoutingLogic extends RoutingLogic { final case class RandomPool( override val nrOfInstances: Int, override val resizer: Option[Resizer] = None, override val supervisorStrategy: SupervisorStrategy = Pool.defaultSupervisorStrategy, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, - override val usePoolDispatcher: Boolean = false) + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, + override val usePoolDispatcher: Boolean = false) extends Pool with PoolOverrideUnsetConfig[RandomPool] { def this(config: Config) = @@ -119,8 +119,8 @@ final case class RandomPool( */ @SerialVersionUID(1L) final case class RandomGroup( - override val paths: immutable.Iterable[String], - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) + override val paths: immutable.Iterable[String], + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) extends Group { def this(config: Config) = diff --git a/akka-actor/src/main/scala/akka/routing/Resizer.scala b/akka-actor/src/main/scala/akka/routing/Resizer.scala index b1b57d742b..dc0eb93eb3 100644 --- a/akka-actor/src/main/scala/akka/routing/Resizer.scala +++ b/akka-actor/src/main/scala/akka/routing/Resizer.scala @@ -126,13 +126,13 @@ case object DefaultResizer { */ @SerialVersionUID(1L) case class DefaultResizer( - val lowerBound: Int = 1, - val upperBound: Int = 10, - val pressureThreshold: Int = 1, - val rampupRate: Double = 0.2, - val backoffThreshold: Double = 0.3, - val backoffRate: Double = 0.1, - val messagesPerResize: Int = 10) extends Resizer { + val lowerBound: Int = 1, + val upperBound: Int = 10, + val pressureThreshold: Int = 1, + val rampupRate: Double = 0.2, + val backoffThreshold: Double = 0.3, + val backoffRate: Double = 0.1, + val messagesPerResize: Int = 10) extends Resizer { /** * Java API constructor for default values except bounds. @@ -246,13 +246,13 @@ case class DefaultResizer( * INTERNAL API */ private[akka] final class ResizablePoolCell( - _system: ActorSystemImpl, - _ref: InternalActorRef, - _routerProps: Props, + _system: ActorSystemImpl, + _ref: InternalActorRef, + _routerProps: Props, _routerDispatcher: MessageDispatcher, - _routeeProps: Props, - _supervisor: InternalActorRef, - val pool: Pool) + _routeeProps: Props, + _supervisor: InternalActorRef, + val pool: Pool) extends RoutedActorCell(_system, _ref, _routerProps, _routerDispatcher, _routeeProps, _supervisor) { require(pool.resizer.isDefined, "RouterConfig must be a Pool with defined resizer") diff --git a/akka-actor/src/main/scala/akka/routing/RoundRobin.scala b/akka-actor/src/main/scala/akka/routing/RoundRobin.scala index 3ae0016815..0e983bc027 100644 --- a/akka-actor/src/main/scala/akka/routing/RoundRobin.scala +++ b/akka-actor/src/main/scala/akka/routing/RoundRobin.scala @@ -67,12 +67,13 @@ final class RoundRobinRoutingLogic extends RoutingLogic { final case class RoundRobinPool( override val nrOfInstances: Int, override val resizer: Option[Resizer] = None, override val supervisorStrategy: SupervisorStrategy = Pool.defaultSupervisorStrategy, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, - override val usePoolDispatcher: Boolean = false) + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, + override val usePoolDispatcher: Boolean = false) extends Pool with PoolOverrideUnsetConfig[RoundRobinPool] { def this(config: Config) = - this(nrOfInstances = config.getInt("nr-of-instances"), + this( + nrOfInstances = config.getInt("nr-of-instances"), resizer = Resizer.fromConfig(config), usePoolDispatcher = config.hasPath("pool-dispatcher")) @@ -127,8 +128,8 @@ final case class RoundRobinPool( */ @SerialVersionUID(1L) final case class RoundRobinGroup( - override val paths: immutable.Iterable[String], - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) + override val paths: immutable.Iterable[String], + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) extends Group { def this(config: Config) = diff --git a/akka-actor/src/main/scala/akka/routing/RoutedActorCell.scala b/akka-actor/src/main/scala/akka/routing/RoutedActorCell.scala index 4c10cabd2b..7b37408fc9 100644 --- a/akka-actor/src/main/scala/akka/routing/RoutedActorCell.scala +++ b/akka-actor/src/main/scala/akka/routing/RoutedActorCell.scala @@ -35,12 +35,12 @@ private[akka] object RoutedActorCell { * INTERNAL API */ private[akka] class RoutedActorCell( - _system: ActorSystemImpl, - _ref: InternalActorRef, - _routerProps: Props, + _system: ActorSystemImpl, + _ref: InternalActorRef, + _routerProps: Props, _routerDispatcher: MessageDispatcher, - val routeeProps: Props, - _supervisor: InternalActorRef) + val routeeProps: Props, + _supervisor: InternalActorRef) extends ActorCell(_system, _ref, _routerProps, _routerDispatcher, _supervisor) { private[akka] val routerConfig = _routerProps.routerConfig @@ -154,8 +154,9 @@ private[akka] class RouterActor extends Actor { } val routingLogicController: Option[ActorRef] = cell.routerConfig.routingLogicController( - cell.router.logic).map(props ⇒ context.actorOf(props.withDispatcher(context.props.dispatcher), - name = "routingLogicController")) + cell.router.logic).map(props ⇒ context.actorOf( + props.withDispatcher(context.props.dispatcher), + name = "routingLogicController")) def receive = { case GetRoutees ⇒ diff --git a/akka-actor/src/main/scala/akka/routing/RoutedActorRef.scala b/akka-actor/src/main/scala/akka/routing/RoutedActorRef.scala index 4cfade0d27..3e52b4c70e 100644 --- a/akka-actor/src/main/scala/akka/routing/RoutedActorRef.scala +++ b/akka-actor/src/main/scala/akka/routing/RoutedActorRef.scala @@ -22,13 +22,13 @@ import akka.dispatch.MessageDispatcher * send a message to one (or more) of these actors. */ private[akka] class RoutedActorRef( - _system: ActorSystemImpl, - _routerProps: Props, + _system: ActorSystemImpl, + _routerProps: Props, _routerDispatcher: MessageDispatcher, - _routerMailbox: MailboxType, - _routeeProps: Props, - _supervisor: InternalActorRef, - _path: ActorPath) + _routerMailbox: MailboxType, + _routeeProps: Props, + _supervisor: InternalActorRef, + _path: ActorPath) extends RepointableActorRef(_system, _routerProps, _routerDispatcher, _routerMailbox, _supervisor, _path) { // verify that a BalancingDispatcher is not used with a Router diff --git a/akka-actor/src/main/scala/akka/routing/RouterConfig.scala b/akka-actor/src/main/scala/akka/routing/RouterConfig.scala index 347493d283..27f4df9085 100644 --- a/akka-actor/src/main/scala/akka/routing/RouterConfig.scala +++ b/akka-actor/src/main/scala/akka/routing/RouterConfig.scala @@ -3,7 +3,6 @@ */ package akka.routing - import scala.collection.immutable import akka.ConfigurationException import akka.actor.ActorContext @@ -282,9 +281,9 @@ case object FromConfig extends FromConfig { */ def getInstance = this @inline final def apply( - resizer: Option[Resizer] = None, + resizer: Option[Resizer] = None, supervisorStrategy: SupervisorStrategy = Pool.defaultSupervisorStrategy, - routerDispatcher: String = Dispatchers.DefaultDispatcherId) = + routerDispatcher: String = Dispatchers.DefaultDispatcherId) = new FromConfig(resizer, supervisorStrategy, routerDispatcher) @inline final def unapply(fc: FromConfig): Option[String] = Some(fc.routerDispatcher) @@ -297,9 +296,10 @@ case object FromConfig extends FromConfig { * (defaults to default-dispatcher). */ @SerialVersionUID(1L) -class FromConfig(override val resizer: Option[Resizer], - override val supervisorStrategy: SupervisorStrategy, - override val routerDispatcher: String) extends Pool { +class FromConfig( + override val resizer: Option[Resizer], + override val supervisorStrategy: SupervisorStrategy, + override val routerDispatcher: String) extends Pool { def this() = this(None, Pool.defaultSupervisorStrategy, Dispatchers.DefaultDispatcherId) diff --git a/akka-actor/src/main/scala/akka/routing/ScatterGatherFirstCompleted.scala b/akka-actor/src/main/scala/akka/routing/ScatterGatherFirstCompleted.scala index 0a79e3f477..75d2e3b57b 100644 --- a/akka-actor/src/main/scala/akka/routing/ScatterGatherFirstCompleted.scala +++ b/akka-actor/src/main/scala/akka/routing/ScatterGatherFirstCompleted.scala @@ -97,10 +97,10 @@ private[akka] final case class ScatterGatherFirstCompletedRoutees( @SerialVersionUID(1L) final case class ScatterGatherFirstCompletedPool( override val nrOfInstances: Int, override val resizer: Option[Resizer] = None, - within: FiniteDuration, + within: FiniteDuration, override val supervisorStrategy: SupervisorStrategy = Pool.defaultSupervisorStrategy, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, - override val usePoolDispatcher: Boolean = false) + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, + override val usePoolDispatcher: Boolean = false) extends Pool with PoolOverrideUnsetConfig[ScatterGatherFirstCompletedPool] { def this(config: Config) = @@ -165,9 +165,9 @@ final case class ScatterGatherFirstCompletedPool( */ @SerialVersionUID(1L) final case class ScatterGatherFirstCompletedGroup( - override val paths: immutable.Iterable[String], - within: FiniteDuration, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) + override val paths: immutable.Iterable[String], + within: FiniteDuration, + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) extends Group { def this(config: Config) = diff --git a/akka-actor/src/main/scala/akka/routing/SmallestMailbox.scala b/akka-actor/src/main/scala/akka/routing/SmallestMailbox.scala index ae7c027010..3c559c8ac9 100644 --- a/akka-actor/src/main/scala/akka/routing/SmallestMailbox.scala +++ b/akka-actor/src/main/scala/akka/routing/SmallestMailbox.scala @@ -45,11 +45,12 @@ class SmallestMailboxRoutingLogic extends RoutingLogic { // 4. An ActorRef with unknown mailbox size that isn't processing anything // 5. An ActorRef with a known mailbox size // 6. An ActorRef without any messages - @tailrec private def selectNext(targets: immutable.IndexedSeq[Routee], - proposedTarget: Routee = NoRoutee, - currentScore: Long = Long.MaxValue, - at: Int = 0, - deep: Boolean = false): Routee = { + @tailrec private def selectNext( + targets: immutable.IndexedSeq[Routee], + proposedTarget: Routee = NoRoutee, + currentScore: Long = Long.MaxValue, + at: Int = 0, + deep: Boolean = false): Routee = { if (targets.isEmpty) NoRoutee else if (at >= targets.size) { @@ -174,8 +175,8 @@ class SmallestMailboxRoutingLogic extends RoutingLogic { final case class SmallestMailboxPool( override val nrOfInstances: Int, override val resizer: Option[Resizer] = None, override val supervisorStrategy: SupervisorStrategy = Pool.defaultSupervisorStrategy, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, - override val usePoolDispatcher: Boolean = false) + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, + override val usePoolDispatcher: Boolean = false) extends Pool with PoolOverrideUnsetConfig[SmallestMailboxPool] { def this(config: Config) = diff --git a/akka-actor/src/main/scala/akka/routing/TailChopping.scala b/akka-actor/src/main/scala/akka/routing/TailChopping.scala index c2d5d59acc..213cca5813 100644 --- a/akka-actor/src/main/scala/akka/routing/TailChopping.scala +++ b/akka-actor/src/main/scala/akka/routing/TailChopping.scala @@ -142,11 +142,11 @@ private[akka] final case class TailChoppingRoutees( @SerialVersionUID(1L) final case class TailChoppingPool( override val nrOfInstances: Int, override val resizer: Option[Resizer] = None, - within: FiniteDuration, - interval: FiniteDuration, + within: FiniteDuration, + interval: FiniteDuration, override val supervisorStrategy: SupervisorStrategy = Pool.defaultSupervisorStrategy, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, - override val usePoolDispatcher: Boolean = false) + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, + override val usePoolDispatcher: Boolean = false) extends Pool with PoolOverrideUnsetConfig[TailChoppingPool] { def this(config: Config) = @@ -227,10 +227,10 @@ final case class TailChoppingPool( * router management messages */ final case class TailChoppingGroup( - override val paths: immutable.Iterable[String], - within: FiniteDuration, - interval: FiniteDuration, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) extends Group { + override val paths: immutable.Iterable[String], + within: FiniteDuration, + interval: FiniteDuration, + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) extends Group { def this(config: Config) = this( diff --git a/akka-actor/src/main/scala/akka/serialization/Serialization.scala b/akka-actor/src/main/scala/akka/serialization/Serialization.scala index b0f6f275de..4ece346ed1 100644 --- a/akka-actor/src/main/scala/akka/serialization/Serialization.scala +++ b/akka-actor/src/main/scala/akka/serialization/Serialization.scala @@ -35,7 +35,7 @@ object Serialization { private final def configToMap(path: String): Map[String, String] = { import scala.collection.JavaConverters._ - config.getConfig(path).root.unwrapped.asScala.toMap map { case (k, v) ⇒ (k -> v.toString) } + config.getConfig(path).root.unwrapped.asScala.toMap map { case (k, v) ⇒ (k → v.toString) } } } @@ -194,7 +194,7 @@ class Serialization(val system: ExtendedActorSystem) extends Extension { * loading is performed by the system’s [[akka.actor.DynamicAccess]]. */ def serializerOf(serializerFQN: String): Try[Serializer] = - system.dynamicAccess.createInstanceFor[Serializer](serializerFQN, List(classOf[ExtendedActorSystem] -> system)) recoverWith { + system.dynamicAccess.createInstanceFor[Serializer](serializerFQN, List(classOf[ExtendedActorSystem] → system)) recoverWith { case _: NoSuchMethodException ⇒ system.dynamicAccess.createInstanceFor[Serializer](serializerFQN, Nil) } @@ -203,7 +203,7 @@ class Serialization(val system: ExtendedActorSystem) extends Extension { * By default always contains the following mapping: "java" -> akka.serialization.JavaSerializer */ private val serializers: Map[String, Serializer] = - for ((k: String, v: String) ← settings.Serializers) yield k -> serializerOf(v).get + for ((k: String, v: String) ← settings.Serializers) yield k → serializerOf(v).get /** * bindings is a Seq of tuple representing the mapping from Class to Serializer. @@ -244,7 +244,7 @@ class Serialization(val system: ExtendedActorSystem) extends Extension { * Maps from a Serializer Identity (Int) to a Serializer instance (optimization) */ val serializerByIdentity: Map[Int, Serializer] = - Map(NullSerializer.identifier -> NullSerializer) ++ serializers map { case (_, v) ⇒ (v.identifier, v) } + Map(NullSerializer.identifier → NullSerializer) ++ serializers map { case (_, v) ⇒ (v.identifier, v) } private val isJavaSerializationWarningEnabled = settings.config.getBoolean("akka.actor.warn-about-java-serializer-usage") diff --git a/akka-actor/src/main/scala/akka/util/BoxedType.scala b/akka-actor/src/main/scala/akka/util/BoxedType.scala index 51286f7ae9..87db921b4d 100644 --- a/akka-actor/src/main/scala/akka/util/BoxedType.scala +++ b/akka-actor/src/main/scala/akka/util/BoxedType.scala @@ -7,15 +7,15 @@ object BoxedType { import java.{ lang ⇒ jl } private val toBoxed = Map[Class[_], Class[_]]( - classOf[Boolean] -> classOf[jl.Boolean], - classOf[Byte] -> classOf[jl.Byte], - classOf[Char] -> classOf[jl.Character], - classOf[Short] -> classOf[jl.Short], - classOf[Int] -> classOf[jl.Integer], - classOf[Long] -> classOf[jl.Long], - classOf[Float] -> classOf[jl.Float], - classOf[Double] -> classOf[jl.Double], - classOf[Unit] -> classOf[scala.runtime.BoxedUnit]) + classOf[Boolean] → classOf[jl.Boolean], + classOf[Byte] → classOf[jl.Byte], + classOf[Char] → classOf[jl.Character], + classOf[Short] → classOf[jl.Short], + classOf[Int] → classOf[jl.Integer], + classOf[Long] → classOf[jl.Long], + classOf[Float] → classOf[jl.Float], + classOf[Double] → classOf[jl.Double], + classOf[Unit] → classOf[scala.runtime.BoxedUnit]) final def apply(c: Class[_]): Class[_] = if (c.isPrimitive) toBoxed(c) else c } diff --git a/akka-actor/src/main/scala/akka/util/ByteString.scala b/akka-actor/src/main/scala/akka/util/ByteString.scala index 4587724a98..8ccfa2518b 100644 --- a/akka-actor/src/main/scala/akka/util/ByteString.scala +++ b/akka-actor/src/main/scala/akka/util/ByteString.scala @@ -357,7 +357,7 @@ object ByteString { private[akka] object Companion { private val companionMap = Seq(ByteString1, ByteString1C, ByteStrings). - map(x ⇒ x.SerializationIdentity -> x).toMap. + map(x ⇒ x.SerializationIdentity → x).toMap. withDefault(x ⇒ throw new IllegalArgumentException("Invalid serialization id " + x)) def apply(from: Byte): Companion = companionMap(from) diff --git a/akka-actor/src/main/scala/akka/util/LineNumbers.scala b/akka-actor/src/main/scala/akka/util/LineNumbers.scala index 3aa1ea0af1..25f355fed8 100644 --- a/akka-actor/src/main/scala/akka/util/LineNumbers.scala +++ b/akka-actor/src/main/scala/akka/util/LineNumbers.scala @@ -187,7 +187,7 @@ object LineNumbers { val cl = c.getClassLoader val r = cl.getResourceAsStream(resource) if (debug) println(s"LNB: resource '$resource' resolved to stream $r") - Option(r).map(_ -> None) + Option(r).map(_ → None) } private def getStreamForLambda(l: AnyRef): Option[(InputStream, Some[String])] = @@ -269,7 +269,7 @@ object LineNumbers { val count = d.readUnsignedShort() if (debug) println(s"LNB: reading $count methods") if (c.contains("Code") && c.contains("LineNumberTable")) { - (1 to count).map(_ ⇒ readMethod(d, c("Code"), c("LineNumberTable"), filter)).flatten.foldLeft(Int.MaxValue -> 0) { + (1 to count).map(_ ⇒ readMethod(d, c("Code"), c("LineNumberTable"), filter)).flatten.foldLeft(Int.MaxValue → 0) { case ((low, high), (start, end)) ⇒ (Math.min(low, start), Math.max(high, end)) } match { case (Int.MaxValue, 0) ⇒ None @@ -282,10 +282,11 @@ object LineNumbers { } } - private def readMethod(d: DataInputStream, - codeTag: Int, - lineNumberTableTag: Int, - filter: Option[String])(implicit c: Constants): Option[(Int, Int)] = { + private def readMethod( + d: DataInputStream, + codeTag: Int, + lineNumberTableTag: Int, + filter: Option[String])(implicit c: Constants): Option[(Int, Int)] = { skip(d, 2) // access flags val name = d.readUnsignedShort() // name skip(d, 2) // signature @@ -315,7 +316,7 @@ object LineNumbers { skip(d, 2) // start PC d.readUnsignedShort() // finally: the line number } - Some(lines.min -> lines.max) + Some(lines.min → lines.max) } } if (debug) println(s"LNB: nested attributes yielded: $possibleLines") diff --git a/akka-actor/src/main/scala/akka/util/SubclassifiedIndex.scala b/akka-actor/src/main/scala/akka/util/SubclassifiedIndex.scala index 0ba6d45bf7..dc86cf2ec0 100644 --- a/akka-actor/src/main/scala/akka/util/SubclassifiedIndex.scala +++ b/akka-actor/src/main/scala/akka/util/SubclassifiedIndex.scala @@ -127,7 +127,7 @@ private[akka] class SubclassifiedIndex[K, V] private (protected var values: Set[ if (!found) { val v = values + value val n = new Nonroot(root, key, v) - integrate(n) ++ n.innerAddValue(key, value) :+ (key -> v) + integrate(n) ++ n.innerAddValue(key, value) :+ (key → v) } else ch } diff --git a/akka-bench-jmh/src/main/scala/akka/actor/ActorCreationBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/actor/ActorCreationBenchmark.scala index abd481d463..28e486320d 100644 --- a/akka-bench-jmh/src/main/scala/akka/actor/ActorCreationBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/actor/ActorCreationBenchmark.scala @@ -34,7 +34,7 @@ class ActorCreationBenchmark { } @TearDown(Level.Trial) - def shutdown():Unit = { + def shutdown(): Unit = { system.terminate() Await.ready(system.whenTerminated, 15.seconds) } diff --git a/akka-bench-jmh/src/main/scala/akka/actor/ForkJoinActorBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/actor/ForkJoinActorBenchmark.scala index 3a352282c4..794c506b3b 100644 --- a/akka-bench-jmh/src/main/scala/akka/actor/ForkJoinActorBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/actor/ForkJoinActorBenchmark.scala @@ -28,7 +28,7 @@ class ForkJoinActorBenchmark { implicit var system: ActorSystem = _ @Setup(Level.Trial) - def setup():Unit = { + def setup(): Unit = { system = ActorSystem("ForkJoinActorBenchmark", ConfigFactory.parseString( s"""| akka { | log-dead-letters = off @@ -44,11 +44,12 @@ class ForkJoinActorBenchmark { | } | } | } - """.stripMargin)) + """.stripMargin + )) } @TearDown(Level.Trial) - def shutdown():Unit = { + def shutdown(): Unit = { system.terminate() Await.ready(system.whenTerminated, 15.seconds) } @@ -56,7 +57,7 @@ class ForkJoinActorBenchmark { @Benchmark @Measurement(timeUnit = TimeUnit.MILLISECONDS) @OperationsPerInvocation(messages) - def pingPong():Unit = { + def pingPong(): Unit = { val ping = system.actorOf(Props[ForkJoinActorBenchmark.PingPong]) val pong = system.actorOf(Props[ForkJoinActorBenchmark.PingPong]) @@ -72,7 +73,7 @@ class ForkJoinActorBenchmark { @Benchmark @Measurement(timeUnit = TimeUnit.MILLISECONDS) @OperationsPerInvocation(messages) - def floodPipe():Unit = { + def floodPipe(): Unit = { val end = system.actorOf(Props(classOf[ForkJoinActorBenchmark.Pipe], None)) val middle = system.actorOf(Props(classOf[ForkJoinActorBenchmark.Pipe], Some(end))) diff --git a/akka-bench-jmh/src/main/scala/akka/actor/RouterPoolCreationBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/actor/RouterPoolCreationBenchmark.scala index 1e7d86110c..d63d68d767 100644 --- a/akka-bench-jmh/src/main/scala/akka/actor/RouterPoolCreationBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/actor/RouterPoolCreationBenchmark.scala @@ -26,7 +26,7 @@ class RouterPoolCreationBenchmark { var size = 0 @TearDown(Level.Trial) - def shutdown():Unit = { + def shutdown(): Unit = { system.terminate() Await.ready(system.whenTerminated, 15.seconds) } diff --git a/akka-bench-jmh/src/main/scala/akka/actor/ScheduleBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/actor/ScheduleBenchmark.scala index 4097f3a678..82c0a38130 100644 --- a/akka-bench-jmh/src/main/scala/akka/actor/ScheduleBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/actor/ScheduleBenchmark.scala @@ -56,13 +56,13 @@ class ScheduleBenchmark { var promise: Promise[Any] = _ @Setup(Level.Iteration) - def setup():Unit = { + def setup(): Unit = { winner = (to * ratio + 1).toInt promise = Promise[Any]() } @TearDown - def shutdown():Unit = { + def shutdown(): Unit = { system.terminate() Await.ready(system.whenTerminated, 15.seconds) } @@ -70,7 +70,7 @@ class ScheduleBenchmark { def op(idx: Int) = if (idx == winner) promise.trySuccess(idx) else idx @Benchmark - def oneSchedule():Unit = { + def oneSchedule(): Unit = { val aIdx = new AtomicInteger(1) val tryWithNext = scheduler.schedule(0.millis, interval) { val idx = aIdx.getAndIncrement @@ -84,7 +84,7 @@ class ScheduleBenchmark { } @Benchmark - def multipleScheduleOnce():Unit = { + def multipleScheduleOnce(): Unit = { val tryWithNext = (1 to to).foldLeft(0.millis -> List[Cancellable]()) { case ((interv, c), idx) ⇒ (interv + interval, scheduler.scheduleOnce(interv) { diff --git a/akka-bench-jmh/src/main/scala/akka/actor/StashCreationBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/actor/StashCreationBenchmark.scala index bda620c9c0..19b30dd2b6 100644 --- a/akka-bench-jmh/src/main/scala/akka/actor/StashCreationBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/actor/StashCreationBenchmark.scala @@ -35,7 +35,7 @@ class StashCreationBenchmark { val probe = TestProbe() @TearDown(Level.Trial) - def shutdown():Unit = { + def shutdown(): Unit = { system.terminate() Await.ready(system.whenTerminated, 15.seconds) } diff --git a/akka-bench-jmh/src/main/scala/akka/actor/TellOnlyBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/actor/TellOnlyBenchmark.scala index 6fe247c86f..fe4e410d05 100644 --- a/akka-bench-jmh/src/main/scala/akka/actor/TellOnlyBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/actor/TellOnlyBenchmark.scala @@ -25,7 +25,7 @@ class TellOnlyBenchmark { implicit var system: ActorSystem = _ @Setup(Level.Trial) - def setup():Unit = { + def setup(): Unit = { system = ActorSystem("TellOnlyBenchmark", ConfigFactory.parseString( s"""| akka { | log-dead-letters = off @@ -46,11 +46,12 @@ class TellOnlyBenchmark { | type = "akka.actor.TellOnlyBenchmark$$DroppingDispatcherConfigurator" | mailbox-type = "akka.actor.TellOnlyBenchmark$$UnboundedDroppingMailbox" | } - | """.stripMargin)) + | """.stripMargin + )) } @TearDown(Level.Trial) - def shutdown():Unit = { + def shutdown(): Unit = { system.terminate() Await.ready(system.whenTerminated, 15.seconds) } @@ -59,7 +60,7 @@ class TellOnlyBenchmark { var probe: TestProbe = _ @Setup(Level.Iteration) - def setupIteration():Unit = { + def setupIteration(): Unit = { actor = system.actorOf(Props[TellOnlyBenchmark.Echo].withDispatcher("dropping-dispatcher")) probe = TestProbe() probe.watch(actor) @@ -71,7 +72,7 @@ class TellOnlyBenchmark { } @TearDown(Level.Iteration) - def shutdownIteration():Unit = { + def shutdownIteration(): Unit = { probe.send(actor, flipDrop) probe.expectNoMsg(200.millis) actor ! stop @@ -82,7 +83,7 @@ class TellOnlyBenchmark { @Benchmark @OutputTimeUnit(TimeUnit.MICROSECONDS) - def tell():Unit = { + def tell(): Unit = { probe.send(actor, message) } } @@ -105,7 +106,7 @@ object TellOnlyBenchmark { class DroppingMessageQueue extends UnboundedMailbox.MessageQueue { @volatile var dropping = false - override def enqueue(receiver: ActorRef, handle: Envelope):Unit = { + override def enqueue(receiver: ActorRef, handle: Envelope): Unit = { if (handle.message == flipDrop) dropping = !dropping else if (!dropping) super.enqueue(receiver, handle) } @@ -125,21 +126,22 @@ object TellOnlyBenchmark { _throughput: Int, _throughputDeadlineTime: Duration, _executorServiceFactoryProvider: ExecutorServiceFactoryProvider, - _shutdownTimeout: FiniteDuration) - extends Dispatcher(_configurator, _id, _throughput, _throughputDeadlineTime, _executorServiceFactoryProvider, _shutdownTimeout) { + _shutdownTimeout: FiniteDuration + ) + extends Dispatcher(_configurator, _id, _throughput, _throughputDeadlineTime, _executorServiceFactoryProvider, _shutdownTimeout) { override protected[akka] def dispatch(receiver: ActorCell, invocation: Envelope): Unit = { val mbox = receiver.mailbox mbox.enqueue(receiver.self, invocation) mbox.messageQueue match { case mb: DroppingMessageQueue if mb.dropping ⇒ // do nothing - case _ ⇒ registerForExecution(mbox, true, false) + case _ ⇒ registerForExecution(mbox, true, false) } } } class DroppingDispatcherConfigurator(config: Config, prerequisites: DispatcherPrerequisites) - extends MessageDispatcherConfigurator(config, prerequisites) { + extends MessageDispatcherConfigurator(config, prerequisites) { override def dispatcher(): MessageDispatcher = new DroppingDispatcher( this, @@ -147,6 +149,7 @@ object TellOnlyBenchmark { config.getInt("throughput"), config.getNanosDuration("throughput-deadline-time"), configureExecutor(), - config.getMillisDuration("shutdown-timeout")) + config.getMillisDuration("shutdown-timeout") + ) } } diff --git a/akka-bench-jmh/src/main/scala/akka/cluster/ddata/ORSetMergeBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/cluster/ddata/ORSetMergeBenchmark.scala index a62ea6da6c..553bbee0f0 100644 --- a/akka-bench-jmh/src/main/scala/akka/cluster/ddata/ORSetMergeBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/cluster/ddata/ORSetMergeBenchmark.scala @@ -48,7 +48,7 @@ class ORSetMergeBenchmark { var elem2: String = _ @Setup(Level.Trial) - def setup():Unit = { + def setup(): Unit = { set1 = (1 to set1Size).foldLeft(ORSet.empty[String])((s, n) => s.add(nextNode(), "elem" + n)) addFromSameNode = set1.add(nodeA, "elem" + set1Size + 1).merge(set1) addFromOtherNode = set1.add(nodeB, "elem" + set1Size + 1).merge(set1) diff --git a/akka-bench-jmh/src/main/scala/akka/cluster/ddata/VersionVectorBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/cluster/ddata/VersionVectorBenchmark.scala index 6b04e499ce..612387cb2d 100644 --- a/akka-bench-jmh/src/main/scala/akka/cluster/ddata/VersionVectorBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/cluster/ddata/VersionVectorBenchmark.scala @@ -45,7 +45,7 @@ class VersionVectorBenchmark { var dot1: VersionVector = _ @Setup(Level.Trial) - def setup():Unit = { + def setup(): Unit = { vv1 = (1 to size).foldLeft(VersionVector.empty)((vv, n) => vv + nextNode()) vv2 = vv1 + nextNode() vv3 = vv1 + nextNode() diff --git a/akka-bench-jmh/src/main/scala/akka/dispatch/CachingConfigBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/dispatch/CachingConfigBenchmark.scala index 6e238efd0a..56ccdedc05 100644 --- a/akka-bench-jmh/src/main/scala/akka/dispatch/CachingConfigBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/dispatch/CachingConfigBenchmark.scala @@ -21,7 +21,7 @@ class CachingConfigBenchmark { val deepConfig = ConfigFactory.parseString(deepConfigString) val deepCaching = new CachingConfig(deepConfig) - @Benchmark def deep_config = deepConfig.hasPath(deepKey) + @Benchmark def deep_config = deepConfig.hasPath(deepKey) @Benchmark def deep_caching = deepCaching.hasPath(deepKey) } diff --git a/akka-bench-jmh/src/main/scala/akka/dispatch/NodeQueueBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/dispatch/NodeQueueBenchmark.scala index 0ca7640522..1ebf82d1f6 100644 --- a/akka-bench-jmh/src/main/scala/akka/dispatch/NodeQueueBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/dispatch/NodeQueueBenchmark.scala @@ -42,7 +42,7 @@ mailbox { val ref = sys.actorOf(Props(new Actor { def receive = { case Stop => sender() ! Stop - case _ => + case _ => } }).withDispatcher("dispatcher").withMailbox("mailbox"), "receiver") diff --git a/akka-bench-jmh/src/main/scala/akka/http/HttpBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/http/HttpBenchmark.scala index c0718b9b1c..706c9c49ed 100644 --- a/akka-bench-jmh/src/main/scala/akka/http/HttpBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/http/HttpBenchmark.scala @@ -28,7 +28,8 @@ class HttpBenchmark { """ akka { loglevel = "ERROR" - }""".stripMargin).withFallback(ConfigFactory.load()) + }""".stripMargin + ).withFallback(ConfigFactory.load()) implicit val system = ActorSystem("HttpBenchmark", config) implicit val materializer = ActorMaterializer() @@ -38,7 +39,7 @@ class HttpBenchmark { var pool: Flow[(HttpRequest, Int), (Try[HttpResponse], Int), _] = _ @Setup - def setup():Unit = { + def setup(): Unit = { val route = { path("test") { get { @@ -53,21 +54,21 @@ class HttpBenchmark { } @TearDown - def shutdown():Unit = { + def shutdown(): Unit = { Await.ready(Http().shutdownAllConnectionPools(), 1.second) binding.unbind() Await.result(system.terminate(), 5.seconds) } @Benchmark - def single_request():Unit = { + def single_request(): Unit = { import system.dispatcher val response = Await.result(Http().singleRequest(request), 1.second) Await.result(Unmarshal(response.entity).to[String], 1.second) } @Benchmark - def single_request_pool():Unit = { + def single_request_pool(): Unit = { import system.dispatcher val (response, id) = Await.result(Source.single(HttpRequest(uri = "/test") -> 42).via(pool).runWith(Sink.head), 1.second) Await.result(Unmarshal(response.get.entity).to[String], 1.second) diff --git a/akka-bench-jmh/src/main/scala/akka/persistence/LevelDbBatchingBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/persistence/LevelDbBatchingBenchmark.scala index 239441bbb5..a025a809d8 100644 --- a/akka-bench-jmh/src/main/scala/akka/persistence/LevelDbBatchingBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/persistence/LevelDbBatchingBenchmark.scala @@ -45,7 +45,7 @@ class LevelDbBatchingBenchmark { val batch_200 = List.fill(200) { AtomicWrite(PersistentRepr("data", 12, "pa")) } @Setup(Level.Trial) - def setup():Unit = { + def setup(): Unit = { sys = ActorSystem("sys") deleteStorage(sys) SharedLeveldbJournal.setStore(store, sys) @@ -55,7 +55,7 @@ class LevelDbBatchingBenchmark { } @TearDown(Level.Trial) - def tearDown():Unit = { + def tearDown(): Unit = { store ! PoisonPill Thread.sleep(500) @@ -66,7 +66,7 @@ class LevelDbBatchingBenchmark { @Benchmark @Measurement(timeUnit = TimeUnit.MICROSECONDS) @OperationsPerInvocation(1) - def write_1():Unit = { + def write_1(): Unit = { probe.send(store, WriteMessages(batch_1)) probe.expectMsgType[Any] } @@ -74,7 +74,7 @@ class LevelDbBatchingBenchmark { @Benchmark @Measurement(timeUnit = TimeUnit.MICROSECONDS) @OperationsPerInvocation(10) - def writeBatch_10():Unit = { + def writeBatch_10(): Unit = { probe.send(store, WriteMessages(batch_10)) probe.expectMsgType[Any] } @@ -82,7 +82,7 @@ class LevelDbBatchingBenchmark { @Benchmark @Measurement(timeUnit = TimeUnit.MICROSECONDS) @OperationsPerInvocation(100) - def writeBatch_100():Unit = { + def writeBatch_100(): Unit = { probe.send(store, WriteMessages(batch_100)) probe.expectMsgType[Any] } @@ -90,7 +90,7 @@ class LevelDbBatchingBenchmark { @Benchmark @Measurement(timeUnit = TimeUnit.MICROSECONDS) @OperationsPerInvocation(200) - def writeBatch_200():Unit = { + def writeBatch_200(): Unit = { probe.send(store, WriteMessages(batch_200)) probe.expectMsgType[Any] } @@ -101,7 +101,8 @@ class LevelDbBatchingBenchmark { val storageLocations = List( "akka.persistence.journal.leveldb.dir", "akka.persistence.journal.leveldb-shared.store.dir", - "akka.persistence.snapshot-store.local.dir").map(s ⇒ new File(sys.settings.config.getString(s))) + "akka.persistence.snapshot-store.local.dir" + ).map(s ⇒ new File(sys.settings.config.getString(s))) storageLocations.foreach(FileUtils.deleteDirectory) } diff --git a/akka-bench-jmh/src/main/scala/akka/persistence/PersistenceActorDeferBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/persistence/PersistenceActorDeferBenchmark.scala index c7612ce10d..4ed8264520 100644 --- a/akka-bench-jmh/src/main/scala/akka/persistence/PersistenceActorDeferBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/persistence/PersistenceActorDeferBenchmark.scala @@ -32,7 +32,8 @@ class PersistentActorDeferBenchmark { lazy val storageLocations = List( "akka.persistence.journal.leveldb.dir", "akka.persistence.journal.leveldb-shared.store.dir", - "akka.persistence.snapshot-store.local.dir").map(s ⇒ new File(system.settings.config.getString(s))) + "akka.persistence.snapshot-store.local.dir" + ).map(s ⇒ new File(system.settings.config.getString(s))) var system: ActorSystem = _ @@ -43,7 +44,7 @@ class PersistentActorDeferBenchmark { val data10k = (1 to 10000).toArray @Setup - def setup():Unit = { + def setup(): Unit = { system = ActorSystem("test", config) probe = TestProbe()(system) @@ -54,7 +55,7 @@ class PersistentActorDeferBenchmark { } @TearDown - def shutdown():Unit = { + def shutdown(): Unit = { system.terminate() Await.ready(system.whenTerminated, 15.seconds) @@ -63,7 +64,7 @@ class PersistentActorDeferBenchmark { @Benchmark @OperationsPerInvocation(10000) - def tell_persistAsync_defer_persistAsync_reply():Unit = { + def tell_persistAsync_defer_persistAsync_reply(): Unit = { for (i <- data10k) persistAsync_defer.tell(i, probe.ref) probe.expectMsg(data10k.last) @@ -71,7 +72,7 @@ class PersistentActorDeferBenchmark { @Benchmark @OperationsPerInvocation(10000) - def tell_persistAsync_defer_persistAsync_replyASAP():Unit = { + def tell_persistAsync_defer_persistAsync_replyASAP(): Unit = { for (i <- data10k) persistAsync_defer_replyASAP.tell(i, probe.ref) probe.expectMsg(data10k.last) diff --git a/akka-bench-jmh/src/main/scala/akka/persistence/PersistentActorBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/persistence/PersistentActorBenchmark.scala index de8912d54e..f0e2b31a60 100644 --- a/akka-bench-jmh/src/main/scala/akka/persistence/PersistentActorBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/persistence/PersistentActorBenchmark.scala @@ -21,7 +21,8 @@ class PersistentActorThroughputBenchmark { lazy val storageLocations = List( "akka.persistence.journal.leveldb.dir", "akka.persistence.journal.leveldb-shared.store.dir", - "akka.persistence.snapshot-store.local.dir").map(s ⇒ new File(system.settings.config.getString(s))) + "akka.persistence.snapshot-store.local.dir" + ).map(s ⇒ new File(system.settings.config.getString(s))) var system: ActorSystem = _ @@ -35,7 +36,7 @@ class PersistentActorThroughputBenchmark { val data10k = (1 to 10000).toArray @Setup - def setup():Unit = { + def setup(): Unit = { system = ActorSystem("test", config) probe = TestProbe()(system) @@ -52,7 +53,7 @@ class PersistentActorThroughputBenchmark { } @TearDown - def shutdown():Unit = { + def shutdown(): Unit = { system.terminate() Await.ready(system.whenTerminated, 15.seconds) @@ -61,7 +62,7 @@ class PersistentActorThroughputBenchmark { @Benchmark @OperationsPerInvocation(10000) - def actor_normalActor_reply_baseline():Unit = { + def actor_normalActor_reply_baseline(): Unit = { for (i <- data10k) actor.tell(i, probe.ref) probe.expectMsg(data10k.last) @@ -69,7 +70,7 @@ class PersistentActorThroughputBenchmark { @Benchmark @OperationsPerInvocation(10000) - def persistentActor_persist_reply():Unit = { + def persistentActor_persist_reply(): Unit = { for (i <- data10k) persistPersistentActor.tell(i, probe.ref) probe.expectMsg(Evt(data10k.last)) @@ -77,7 +78,7 @@ class PersistentActorThroughputBenchmark { @Benchmark @OperationsPerInvocation(10000) - def persistentActor_persistAsync_reply():Unit = { + def persistentActor_persistAsync_reply(): Unit = { for (i <- data10k) persistAsync1PersistentActor.tell(i, probe.ref) probe.expectMsg(Evt(data10k.last)) @@ -85,7 +86,7 @@ class PersistentActorThroughputBenchmark { @Benchmark @OperationsPerInvocation(10000) - def persistentActor_noPersist_reply():Unit = { + def persistentActor_noPersist_reply(): Unit = { for (i <- data10k) noPersistPersistentActor.tell(i, probe.ref) probe.expectMsg(Evt(data10k.last)) @@ -93,7 +94,7 @@ class PersistentActorThroughputBenchmark { @Benchmark @OperationsPerInvocation(10000) - def persistentActor_persistAsync_replyRightOnCommandReceive():Unit = { + def persistentActor_persistAsync_replyRightOnCommandReceive(): Unit = { for (i <- data10k) persistAsyncQuickReplyPersistentActor.tell(i, probe.ref) probe.expectMsg(Evt(data10k.last)) diff --git a/akka-bench-jmh/src/main/scala/akka/persistence/PersistentActorWithAtLeastOnceDeliveryBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/persistence/PersistentActorWithAtLeastOnceDeliveryBenchmark.scala index 59a300c8ff..80fee8833e 100644 --- a/akka-bench-jmh/src/main/scala/akka/persistence/PersistentActorWithAtLeastOnceDeliveryBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/persistence/PersistentActorWithAtLeastOnceDeliveryBenchmark.scala @@ -22,7 +22,8 @@ class PersistentActorWithAtLeastOnceDeliveryBenchmark { lazy val storageLocations = List( "akka.persistence.journal.leveldb.dir", "akka.persistence.journal.leveldb-shared.store.dir", - "akka.persistence.snapshot-store.local.dir").map(s ⇒ new File(system.settings.config.getString(s))) + "akka.persistence.snapshot-store.local.dir" + ).map(s ⇒ new File(system.settings.config.getString(s))) var system: ActorSystem = _ @@ -36,7 +37,7 @@ class PersistentActorWithAtLeastOnceDeliveryBenchmark { val dataCount = 10000 @Setup - def setup():Unit = { + def setup(): Unit = { system = ActorSystem("PersistentActorWithAtLeastOnceDeliveryBenchmark", config) probe = TestProbe()(system) @@ -51,7 +52,7 @@ class PersistentActorWithAtLeastOnceDeliveryBenchmark { } @TearDown - def shutdown():Unit = { + def shutdown(): Unit = { system.terminate() Await.ready(system.whenTerminated, 15.seconds) @@ -60,7 +61,7 @@ class PersistentActorWithAtLeastOnceDeliveryBenchmark { @Benchmark @OperationsPerInvocation(10000) - def persistentActor_persistAsync_with_AtLeastOnceDelivery():Unit = { + def persistentActor_persistAsync_with_AtLeastOnceDelivery(): Unit = { for (i <- 1 to dataCount) persistAsyncPersistentActorWithAtLeastOnceDelivery.tell(i, probe.ref) probe.expectMsg(20.seconds, Evt(dataCount)) @@ -68,7 +69,7 @@ class PersistentActorWithAtLeastOnceDeliveryBenchmark { @Benchmark @OperationsPerInvocation(10000) - def persistentActor_persist_with_AtLeastOnceDelivery():Unit = { + def persistentActor_persist_with_AtLeastOnceDelivery(): Unit = { for (i <- 1 to dataCount) persistPersistentActorWithAtLeastOnceDelivery.tell(i, probe.ref) probe.expectMsg(2.minutes, Evt(dataCount)) @@ -76,7 +77,7 @@ class PersistentActorWithAtLeastOnceDeliveryBenchmark { @Benchmark @OperationsPerInvocation(10000) - def persistentActor_noPersist_with_AtLeastOnceDelivery():Unit = { + def persistentActor_noPersist_with_AtLeastOnceDelivery(): Unit = { for (i <- 1 to dataCount) noPersistPersistentActorWithAtLeastOnceDelivery.tell(i, probe.ref) probe.expectMsg(20.seconds, Evt(dataCount)) diff --git a/akka-bench-jmh/src/main/scala/akka/stream/FlatMapMergeBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/stream/FlatMapMergeBenchmark.scala index 8e60d645e9..0e39fa6032 100644 --- a/akka-bench-jmh/src/main/scala/akka/stream/FlatMapMergeBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/stream/FlatMapMergeBenchmark.scala @@ -4,7 +4,7 @@ package akka.stream -import akka.{Done, NotUsed} +import akka.{ Done, NotUsed } import akka.actor.ActorSystem import akka.stream.scaladsl._ import java.util.concurrent.TimeUnit @@ -30,7 +30,7 @@ class FlatMapMergeBenchmark { def createSource(count: Int): Graph[SourceShape[Int], NotUsed] = akka.stream.Fusing.aggressive(Source.repeat(1).take(count)) @Setup - def setup():Unit = { + def setup(): Unit = { val source = NumberOfStreams match { // Base line: process NumberOfElements-many elements from a single source without using flatMapMerge case 0 => createSource(NumberOfElements) @@ -43,13 +43,13 @@ class FlatMapMergeBenchmark { } @TearDown - def shutdown():Unit = { + def shutdown(): Unit = { Await.result(system.terminate(), 5.seconds) } @Benchmark @OperationsPerInvocation(100000) // Note: needs to match NumberOfElements. - def flat_map_merge_100k_elements():Unit = { + def flat_map_merge_100k_elements(): Unit = { Await.result(graph.run(), Duration.Inf) } } diff --git a/akka-bench-jmh/src/main/scala/akka/stream/FlowMapBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/stream/FlowMapBenchmark.scala index 5e5cf0df3f..44f97b3375 100644 --- a/akka-bench-jmh/src/main/scala/akka/stream/FlowMapBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/stream/FlowMapBenchmark.scala @@ -47,7 +47,8 @@ class FlowMapBenchmark { type = akka.testkit.CallingThreadDispatcherConfigurator } } - }""".stripMargin).withFallback(ConfigFactory.load()) + }""".stripMargin + ).withFallback(ConfigFactory.load()) implicit val system = ActorSystem("test", config) @@ -69,7 +70,7 @@ class FlowMapBenchmark { var numberOfMapOps = 0 @Setup - def setup():Unit = { + def setup(): Unit = { val settings = ActorMaterializerSettings(system) .withInputBuffer(initialInputBufferSize, initialInputBufferSize) @@ -111,13 +112,13 @@ class FlowMapBenchmark { } @TearDown - def shutdown():Unit = { + def shutdown(): Unit = { Await.result(system.terminate(), 5.seconds) } @Benchmark @OperationsPerInvocation(100000) - def flow_map_100k_elements():Unit = { + def flow_map_100k_elements(): Unit = { val lock = new Lock() // todo rethink what is the most lightweight way to await for a streams completion lock.acquire() diff --git a/akka-bench-jmh/src/main/scala/akka/stream/GraphBuilderBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/stream/GraphBuilderBenchmark.scala index 477d9ec149..2a791feabb 100644 --- a/akka-bench-jmh/src/main/scala/akka/stream/GraphBuilderBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/stream/GraphBuilderBenchmark.scala @@ -16,22 +16,22 @@ class GraphBuilderBenchmark { var complexity = 0 @Benchmark - def flow_with_map():Unit = { + def flow_with_map(): Unit = { MaterializationBenchmark.flowWithMapBuilder(complexity) } @Benchmark - def graph_with_junctions():Unit ={ + def graph_with_junctions(): Unit = { MaterializationBenchmark.graphWithJunctionsBuilder(complexity) } @Benchmark - def graph_with_nested_imports():Unit = { + def graph_with_nested_imports(): Unit = { MaterializationBenchmark.graphWithNestedImportsBuilder(complexity) } @Benchmark - def graph_with_imported_flow():Unit = { + def graph_with_imported_flow(): Unit = { MaterializationBenchmark.graphWithImportedFlowBuilder(complexity) } } diff --git a/akka-bench-jmh/src/main/scala/akka/stream/InterpreterBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/stream/InterpreterBenchmark.scala index afb1ecf472..d48653187c 100644 --- a/akka-bench-jmh/src/main/scala/akka/stream/InterpreterBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/stream/InterpreterBenchmark.scala @@ -1,13 +1,12 @@ package akka.stream import akka.event._ -import akka.stream.impl.fusing.{ GraphInterpreterSpecKit, GraphStages} +import akka.stream.impl.fusing.{ GraphInterpreterSpecKit, GraphStages } import akka.stream.impl.fusing.GraphStages import akka.stream.impl.fusing.GraphInterpreter.{ DownstreamBoundaryStageLogic, UpstreamBoundaryStageLogic } import akka.stream.stage._ import org.openjdk.jmh.annotations._ - import java.util.concurrent.TimeUnit @State(Scope.Benchmark) @@ -24,7 +23,7 @@ class InterpreterBenchmark { @Benchmark @OperationsPerInvocation(100000) - def graph_interpreter_100k_elements():Unit = { + def graph_interpreter_100k_elements(): Unit = { new GraphInterpreterSpecKit { new TestSetup { val identities = Vector.fill(numberOfIds)(GraphStages.identity[Int]) diff --git a/akka-bench-jmh/src/main/scala/akka/stream/MaterializationBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/stream/MaterializationBenchmark.scala index 76e5e562a6..ac5b6ab267 100644 --- a/akka-bench-jmh/src/main/scala/akka/stream/MaterializationBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/stream/MaterializationBenchmark.scala @@ -43,33 +43,30 @@ object MaterializationBenchmark { val graphWithNestedImportsBuilder = (numOfNestedGraphs: Int) => { var flow: Graph[FlowShape[Unit, Unit], NotUsed] = Flow[Unit].map(identity) for (_ <- 1 to numOfNestedGraphs) { - flow = GraphDSL.create(flow) { b ⇒ - flow ⇒ - FlowShape(flow.in, flow.out) + flow = GraphDSL.create(flow) { b ⇒ flow ⇒ + FlowShape(flow.in, flow.out) } } - RunnableGraph.fromGraph(GraphDSL.create(flow) { implicit b ⇒ - flow ⇒ - import GraphDSL.Implicits._ - Source.single(()) ~> flow ~> Sink.ignore - ClosedShape + RunnableGraph.fromGraph(GraphDSL.create(flow) { implicit b ⇒ flow ⇒ + import GraphDSL.Implicits._ + Source.single(()) ~> flow ~> Sink.ignore + ClosedShape }) } val graphWithImportedFlowBuilder = (numOfFlows: Int) => - RunnableGraph.fromGraph(GraphDSL.create(Source.single(())) { implicit b ⇒ - source ⇒ - import GraphDSL.Implicits._ - val flow = Flow[Unit].map(identity) - var out: Outlet[Unit] = source.out - for (i <- 0 until numOfFlows) { - val flowShape = b.add(flow) - out ~> flowShape - out = flowShape.outlet - } - out ~> Sink.ignore - ClosedShape + RunnableGraph.fromGraph(GraphDSL.create(Source.single(())) { implicit b ⇒ source ⇒ + import GraphDSL.Implicits._ + val flow = Flow[Unit].map(identity) + var out: Outlet[Unit] = source.out + for (i <- 0 until numOfFlows) { + val flowShape = b.add(flow) + out ~> flowShape + out = flowShape.outlet + } + out ~> Sink.ignore + ClosedShape }) } @@ -91,7 +88,7 @@ class MaterializationBenchmark { var complexity = 0 @Setup - def setup():Unit = { + def setup(): Unit = { flowWithMap = flowWithMapBuilder(complexity) graphWithJunctions = graphWithJunctionsBuilder(complexity) graphWithNestedImports = graphWithNestedImportsBuilder(complexity) @@ -99,22 +96,19 @@ class MaterializationBenchmark { } @TearDown - def shutdown():Unit = { + def shutdown(): Unit = { Await.result(system.terminate(), 5.seconds) } @Benchmark - def flow_with_map():Unit = flowWithMap.run() - + def flow_with_map(): Unit = flowWithMap.run() @Benchmark - def graph_with_junctions():Unit = graphWithJunctions.run() - + def graph_with_junctions(): Unit = graphWithJunctions.run() @Benchmark - def graph_with_nested_imports():Unit = graphWithNestedImports.run() - + def graph_with_nested_imports(): Unit = graphWithNestedImports.run() @Benchmark - def graph_with_imported_flow():Unit = graphWithImportedFlow.run() + def graph_with_imported_flow(): Unit = graphWithImportedFlow.run() } diff --git a/akka-bench-jmh/src/main/scala/akka/stream/io/FileSourcesBenchmark.scala b/akka-bench-jmh/src/main/scala/akka/stream/io/FileSourcesBenchmark.scala index cba982d040..7075b15050 100644 --- a/akka-bench-jmh/src/main/scala/akka/stream/io/FileSourcesBenchmark.scala +++ b/akka-bench-jmh/src/main/scala/akka/stream/io/FileSourcesBenchmark.scala @@ -49,7 +49,7 @@ class FileSourcesBenchmark { var ioSourceLinesIterator: Source[ByteString, NotUsed] = _ @Setup - def setup():Unit = { + def setup(): Unit = { fileChannelSource = FileIO.fromPath(file, bufSize) fileInputStreamSource = StreamConverters.fromInputStream(() ⇒ Files.newInputStream(file), bufSize) ioSourceLinesIterator = Source.fromIterator(() ⇒ scala.io.Source.fromFile(file.toFile).getLines()).map(ByteString(_)) @@ -61,26 +61,26 @@ class FileSourcesBenchmark { } @TearDown - def shutdown():Unit = { + def shutdown(): Unit = { Await.result(system.terminate(), Duration.Inf) } @Benchmark - def fileChannel():Unit = { + def fileChannel(): Unit = { val h = fileChannelSource.to(Sink.ignore).run() Await.result(h, 30.seconds) } @Benchmark - def fileChannel_noReadAhead():Unit = { + def fileChannel_noReadAhead(): Unit = { val h = fileChannelSource.withAttributes(Attributes.inputBuffer(1, 1)).to(Sink.ignore).run() Await.result(h, 30.seconds) } @Benchmark - def inputStream():Unit = { + def inputStream(): Unit = { val h = fileInputStreamSource.to(Sink.ignore).run() Await.result(h, 30.seconds) @@ -92,7 +92,7 @@ class FileSourcesBenchmark { * FileSourcesBenchmark.naive_ioSourceLinesIterator avgt 20 7067.944 ± 1341.847 ms/op */ @Benchmark - def naive_ioSourceLinesIterator():Unit = { + def naive_ioSourceLinesIterator(): Unit = { val p = Promise[Done]() ioSourceLinesIterator.to(Sink.onComplete(p.complete(_))).run() diff --git a/akka-camel/src/main/scala/akka/camel/internal/CamelSupervisor.scala b/akka-camel/src/main/scala/akka/camel/internal/CamelSupervisor.scala index c898788490..09556b3306 100644 --- a/akka-camel/src/main/scala/akka/camel/internal/CamelSupervisor.scala +++ b/akka-camel/src/main/scala/akka/camel/internal/CamelSupervisor.scala @@ -163,7 +163,7 @@ private[camel] class ProducerRegistrar(activationTracker: ActorRef) extends Acto try { val endpoint = camelContext.getEndpoint(endpointUri) val processor = new SendProcessor(endpoint) - camelObjects = camelObjects.updated(producer, endpoint -> processor) + camelObjects = camelObjects.updated(producer, endpoint → processor) // if this throws, the supervisor stops the producer and de-registers it on termination processor.start() producer ! CamelProducerObjects(endpoint, processor) diff --git a/akka-camel/src/main/scala/akka/camel/internal/component/ActorComponent.scala b/akka-camel/src/main/scala/akka/camel/internal/component/ActorComponent.scala index ccab13e0a2..8413f60de0 100644 --- a/akka-camel/src/main/scala/akka/camel/internal/component/ActorComponent.scala +++ b/akka-camel/src/main/scala/akka/camel/internal/component/ActorComponent.scala @@ -49,10 +49,11 @@ private[camel] class ActorComponent(camel: Camel, system: ActorSystem) extends D * [actorPath]?[options]%s, * where [actorPath] refers to the actor path to the actor. */ -private[camel] class ActorEndpoint(uri: String, - comp: ActorComponent, - val path: ActorEndpointPath, - val camel: Camel) extends DefaultEndpoint(uri, comp) with ActorEndpointConfig { +private[camel] class ActorEndpoint( + uri: String, + comp: ActorComponent, + val path: ActorEndpointPath, + val camel: Camel) extends DefaultEndpoint(uri, comp) with ActorEndpointConfig { /** * The ActorEndpoint only supports receiving messages from Camel. @@ -174,7 +175,7 @@ private[camel] class ActorProducer(val endpoint: ActorEndpoint, camel: Camel) ex path.findActorIn(camel.system) getOrElse (throw new ActorNotRegisteredException(path.actorPath)) private[this] def messageFor(exchange: CamelExchangeAdapter) = - exchange.toRequestMessage(Map(CamelMessage.MessageExchangeId -> exchange.getExchangeId)) + exchange.toRequestMessage(Map(CamelMessage.MessageExchangeId → exchange.getExchangeId)) } /** diff --git a/akka-camel/src/test/scala/akka/camel/CamelExchangeAdapterTest.scala b/akka-camel/src/test/scala/akka/camel/CamelExchangeAdapterTest.scala index 1fd8d06899..2043d7aed6 100644 --- a/akka-camel/src/test/scala/akka/camel/CamelExchangeAdapterTest.scala +++ b/akka-camel/src/test/scala/akka/camel/CamelExchangeAdapterTest.scala @@ -50,17 +50,17 @@ class CamelExchangeAdapterTest extends FunSuite with SharedCamelSystem { test("mustCreateRequestMessageFromInMessage") { val m = sampleInOnly.toRequestMessage - assert(m === CamelMessage("test-in", Map("key-in" -> "val-in"))) + assert(m === CamelMessage("test-in", Map("key-in" → "val-in"))) } test("mustCreateResponseMessageFromInMessage") { val m = sampleInOnly.toResponseMessage - assert(m === CamelMessage("test-in", Map("key-in" -> "val-in"))) + assert(m === CamelMessage("test-in", Map("key-in" → "val-in"))) } test("mustCreateResponseMessageFromOutMessage") { val m = sampleInOut.toResponseMessage - assert(m === CamelMessage("test-out", Map("key-out" -> "val-out"))) + assert(m === CamelMessage("test-out", Map("key-out" → "val-out"))) } test("mustCreateFailureMessageFromExceptionAndInMessage") { @@ -82,30 +82,30 @@ class CamelExchangeAdapterTest extends FunSuite with SharedCamelSystem { } test("mustCreateRequestMessageFromInMessageWithAdditionalHeader") { - val m = sampleInOnly.toRequestMessage(Map("x" -> "y")) - assert(m === CamelMessage("test-in", Map("key-in" -> "val-in", "x" -> "y"))) + val m = sampleInOnly.toRequestMessage(Map("x" → "y")) + assert(m === CamelMessage("test-in", Map("key-in" → "val-in", "x" → "y"))) } test("mustCreateResponseMessageFromInMessageWithAdditionalHeader") { - val m = sampleInOnly.toResponseMessage(Map("x" -> "y")) - assert(m === CamelMessage("test-in", Map("key-in" -> "val-in", "x" -> "y"))) + val m = sampleInOnly.toResponseMessage(Map("x" → "y")) + assert(m === CamelMessage("test-in", Map("key-in" → "val-in", "x" → "y"))) } test("mustCreateResponseMessageFromOutMessageWithAdditionalHeader") { - val m = sampleInOut.toResponseMessage(Map("x" -> "y")) - assert(m === CamelMessage("test-out", Map("key-out" -> "val-out", "x" -> "y"))) + val m = sampleInOut.toResponseMessage(Map("x" → "y")) + assert(m === CamelMessage("test-out", Map("key-out" → "val-out", "x" → "y"))) } test("mustCreateFailureMessageFromExceptionAndInMessageWithAdditionalHeader") { val e1 = sampleInOnly e1.setException(new Exception("test1")) assert(e1.toAkkaCamelException.getMessage === "test1") - val headers = e1.toAkkaCamelException(Map("x" -> "y")).headers + val headers = e1.toAkkaCamelException(Map("x" → "y")).headers assert(headers("key-in") === "val-in") assert(headers("x") === "y") assert(e1.toFailureMessage.cause.getMessage === "test1") - val failureHeaders = e1.toFailureResult(Map("x" -> "y")).headers + val failureHeaders = e1.toFailureResult(Map("x" → "y")).headers assert(failureHeaders("key-in") === "val-in") assert(failureHeaders("x") === "y") @@ -115,11 +115,11 @@ class CamelExchangeAdapterTest extends FunSuite with SharedCamelSystem { val e1 = sampleInOut e1.setException(new Exception("test2")) assert(e1.toAkkaCamelException.getMessage === "test2") - val headers = e1.toAkkaCamelException(Map("x" -> "y")).headers + val headers = e1.toAkkaCamelException(Map("x" → "y")).headers assert(headers("key-out") === "val-out") assert(headers("x") === "y") assert(e1.toFailureMessage.cause.getMessage === "test2") - val failureHeaders = e1.toFailureResult(Map("x" -> "y")).headers + val failureHeaders = e1.toFailureResult(Map("x" → "y")).headers assert(failureHeaders("key-out") === "val-out") assert(failureHeaders("x") === "y") } diff --git a/akka-camel/src/test/scala/akka/camel/CamelMessageTest.scala b/akka-camel/src/test/scala/akka/camel/CamelMessageTest.scala index f79ba3ccd7..7bff0f7a4f 100644 --- a/akka-camel/src/test/scala/akka/camel/CamelMessageTest.scala +++ b/akka-camel/src/test/scala/akka/camel/CamelMessageTest.scala @@ -25,7 +25,7 @@ class CamelMessageTest extends Matchers with WordSpecLike with SharedCamelSystem message.setExchange(new DefaultExchange(camel.context)) val attachmentToAdd = new DataHandler(new URL("https://another.url")) - CamelMessage.copyContent(new CamelMessage("body", Map("key" -> "baz"), Map("key" -> attachmentToAdd)), message) + CamelMessage.copyContent(new CamelMessage("body", Map("key" → "baz"), Map("key" → attachmentToAdd)), message) assert(message.getBody === "body") assert(message.getHeader("foo") === "bar") diff --git a/akka-camel/src/test/scala/akka/camel/ConcurrentActivationTest.scala b/akka-camel/src/test/scala/akka/camel/ConcurrentActivationTest.scala index c48562ba0a..b8edf30fed 100644 --- a/akka-camel/src/test/scala/akka/camel/ConcurrentActivationTest.scala +++ b/akka-camel/src/test/scala/akka/camel/ConcurrentActivationTest.scala @@ -67,8 +67,8 @@ class ConcurrentActivationTest extends WordSpec with Matchers with NonSharedCame } val (activatedConsumerNames, activatedProducerNames) = partitionNames(activations) val (deactivatedConsumerNames, deactivatedProducerNames) = partitionNames(deactivations) - assertContainsSameElements(activatedConsumerNames -> deactivatedConsumerNames) - assertContainsSameElements(activatedProducerNames -> deactivatedProducerNames) + assertContainsSameElements(activatedConsumerNames → deactivatedConsumerNames) + assertContainsSameElements(activatedProducerNames → deactivatedProducerNames) } finally { system.eventStream.publish(TestEvent.UnMute(eventFilter)) } @@ -95,7 +95,7 @@ class ConsumerBroadcast(promise: Promise[(Future[List[List[ActorRef]]], Future[L val routee = context.actorOf(Props(classOf[Registrar], i, number, activationListPromise, deactivationListPromise), "registrar-" + i) routee.path.toString } - promise.success(Future.sequence(allActivationFutures) -> Future.sequence(allDeactivationFutures)) + promise.success(Future.sequence(allActivationFutures) → Future.sequence(allDeactivationFutures)) broadcaster = Some(context.actorOf(BroadcastGroup(routeePaths).props(), "registrarRouter")) case reg: Any ⇒ diff --git a/akka-camel/src/test/scala/akka/camel/MessageScalaTest.scala b/akka-camel/src/test/scala/akka/camel/MessageScalaTest.scala index 85fc931617..3c37885019 100644 --- a/akka-camel/src/test/scala/akka/camel/MessageScalaTest.scala +++ b/akka-camel/src/test/scala/akka/camel/MessageScalaTest.scala @@ -24,31 +24,31 @@ class MessageScalaTest extends FunSuite with Matchers with SharedCamelSystem { } test("mustConvertDoubleHeaderToString") { - val message = CamelMessage("test", Map("test" -> 1.4)) + val message = CamelMessage("test", Map("test" → 1.4)) message.headerAs[String]("test").get should ===("1.4") } test("mustReturnSubsetOfHeaders") { - val message = CamelMessage("test", Map("A" -> "1", "B" -> "2")) - message.headers(Set("B")) should ===(Map("B" -> "2")) + val message = CamelMessage("test", Map("A" → "1", "B" → "2")) + message.headers(Set("B")) should ===(Map("B" → "2")) } test("mustTransformBodyAndPreserveHeaders") { - CamelMessage("a", Map("A" -> "1")).mapBody((body: String) ⇒ body + "b") should ===(CamelMessage("ab", Map("A" -> "1"))) + CamelMessage("a", Map("A" → "1")).mapBody((body: String) ⇒ body + "b") should ===(CamelMessage("ab", Map("A" → "1"))) } test("mustConvertBodyAndPreserveHeaders") { - CamelMessage(1.4, Map("A" -> "1")).withBodyAs[String] should ===(CamelMessage("1.4", Map("A" -> "1"))) + CamelMessage(1.4, Map("A" → "1")).withBodyAs[String] should ===(CamelMessage("1.4", Map("A" → "1"))) } test("mustSetBodyAndPreserveHeaders") { - CamelMessage("test1", Map("A" -> "1")).copy(body = "test2") should ===( - CamelMessage("test2", Map("A" -> "1"))) + CamelMessage("test1", Map("A" → "1")).copy(body = "test2") should ===( + CamelMessage("test2", Map("A" → "1"))) } test("mustSetHeadersAndPreserveBody") { - CamelMessage("test1", Map("A" -> "1")).copy(headers = Map("C" -> "3")) should ===( - CamelMessage("test1", Map("C" -> "3"))) + CamelMessage("test1", Map("A" → "1")).copy(headers = Map("C" → "3")) should ===( + CamelMessage("test1", Map("C" → "3"))) } test("mustBeAbleToReReadStreamCacheBody") { diff --git a/akka-camel/src/test/scala/akka/camel/ProducerFeatureTest.scala b/akka-camel/src/test/scala/akka/camel/ProducerFeatureTest.scala index 6106ff7f37..7dfeb9127b 100644 --- a/akka-camel/src/test/scala/akka/camel/ProducerFeatureTest.scala +++ b/akka-camel/src/test/scala/akka/camel/ProducerFeatureTest.scala @@ -45,9 +45,9 @@ class ProducerFeatureTest extends TestKit(ActorSystem("ProducerFeatureTest", Akk "01 produce a message and receive normal response" in { val producer = system.actorOf(Props(new TestProducer("direct:producer-test-2", true)), name = "01-direct-producer-2") - val message = CamelMessage("test", Map(CamelMessage.MessageExchangeId -> "123")) + val message = CamelMessage("test", Map(CamelMessage.MessageExchangeId → "123")) producer.tell(message, testActor) - expectMsg(CamelMessage("received TEST", Map(CamelMessage.MessageExchangeId -> "123"))) + expectMsg(CamelMessage("received TEST", Map(CamelMessage.MessageExchangeId → "123"))) } "02 produce a message and receive failure response" in { @@ -72,13 +72,13 @@ class ProducerFeatureTest extends TestKit(ActorSystem("ProducerFeatureTest", Akk supervisor.tell(Props(new TestProducer("direct:producer-test-2")), testActor) val producer = receiveOne(timeoutDuration).asInstanceOf[ActorRef] - val message = CamelMessage("fail", Map(CamelMessage.MessageExchangeId -> "123")) + val message = CamelMessage("fail", Map(CamelMessage.MessageExchangeId → "123")) filterEvents(EventFilter[AkkaCamelException](occurrences = 1)) { producer.tell(message, testActor) expectMsgPF(timeoutDuration) { case Failure(e: AkkaCamelException) ⇒ e.getMessage should ===("failure") - e.headers should ===(Map(CamelMessage.MessageExchangeId -> "123")) + e.headers should ===(Map(CamelMessage.MessageExchangeId → "123")) } } Await.ready(latch, timeoutDuration) @@ -106,21 +106,21 @@ class ProducerFeatureTest extends TestKit(ActorSystem("ProducerFeatureTest", Akk "10 produce message to direct:producer-test-3 and receive normal response" in { val producer = system.actorOf(Props(new TestProducer("direct:producer-test-3")), name = "10-direct-producer-test-3") - val message = CamelMessage("test", Map(CamelMessage.MessageExchangeId -> "123")) + val message = CamelMessage("test", Map(CamelMessage.MessageExchangeId → "123")) producer.tell(message, testActor) - expectMsg(CamelMessage("received test", Map(CamelMessage.MessageExchangeId -> "123"))) + expectMsg(CamelMessage("received test", Map(CamelMessage.MessageExchangeId → "123"))) } "11 produce message to direct:producer-test-3 and receive failure response" in { val producer = system.actorOf(Props(new TestProducer("direct:producer-test-3")), name = "11-direct-producer-test-3-receive-failure") - val message = CamelMessage("fail", Map(CamelMessage.MessageExchangeId -> "123")) + val message = CamelMessage("fail", Map(CamelMessage.MessageExchangeId → "123")) filterEvents(EventFilter[AkkaCamelException](occurrences = 1)) { producer.tell(message, testActor) expectMsgPF(timeoutDuration) { case Failure(e: AkkaCamelException) ⇒ e.getMessage should ===("failure") - e.headers should ===(Map(CamelMessage.MessageExchangeId -> "123")) + e.headers should ===(Map(CamelMessage.MessageExchangeId → "123")) } } } @@ -128,22 +128,22 @@ class ProducerFeatureTest extends TestKit(ActorSystem("ProducerFeatureTest", Akk "12 produce message, forward normal response of direct:producer-test-2 to a replying target actor and receive response" in { val target = system.actorOf(Props[ReplyingForwardTarget], name = "12-reply-forwarding-target") val producer = system.actorOf(Props(new TestForwarder("direct:producer-test-2", target)), name = "12-direct-producer-test-2-forwarder") - val message = CamelMessage("test", Map(CamelMessage.MessageExchangeId -> "123")) + val message = CamelMessage("test", Map(CamelMessage.MessageExchangeId → "123")) producer.tell(message, testActor) - expectMsg(CamelMessage("received test", Map(CamelMessage.MessageExchangeId -> "123", "test" -> "result"))) + expectMsg(CamelMessage("received test", Map(CamelMessage.MessageExchangeId → "123", "test" → "result"))) } "13 produce message, forward failure response of direct:producer-test-2 to a replying target actor and receive response" in { val target = system.actorOf(Props[ReplyingForwardTarget], name = "13-reply-forwarding-target") val producer = system.actorOf(Props(new TestForwarder("direct:producer-test-2", target)), name = "13-direct-producer-test-2-forwarder-failure") - val message = CamelMessage("fail", Map(CamelMessage.MessageExchangeId -> "123")) + val message = CamelMessage("fail", Map(CamelMessage.MessageExchangeId → "123")) filterEvents(EventFilter[AkkaCamelException](occurrences = 1)) { producer.tell(message, testActor) expectMsgPF(timeoutDuration) { case Failure(e: AkkaCamelException) ⇒ e.getMessage should ===("failure") - e.headers should ===(Map(CamelMessage.MessageExchangeId -> "123", "test" -> "failure")) + e.headers should ===(Map(CamelMessage.MessageExchangeId → "123", "test" → "failure")) } } } @@ -170,23 +170,23 @@ class ProducerFeatureTest extends TestKit(ActorSystem("ProducerFeatureTest", Akk "16 produce message, forward normal response from direct:producer-test-3 to a replying target actor and receive response" in { val target = system.actorOf(Props[ReplyingForwardTarget], name = "16-reply-forwarding-target") val producer = system.actorOf(Props(new TestForwarder("direct:producer-test-3", target)), name = "16-direct-producer-test-3-to-replying-actor") - val message = CamelMessage("test", Map(CamelMessage.MessageExchangeId -> "123")) + val message = CamelMessage("test", Map(CamelMessage.MessageExchangeId → "123")) producer.tell(message, testActor) - expectMsg(CamelMessage("received test", Map(CamelMessage.MessageExchangeId -> "123", "test" -> "result"))) + expectMsg(CamelMessage("received test", Map(CamelMessage.MessageExchangeId → "123", "test" → "result"))) } "17 produce message, forward failure response from direct:producer-test-3 to a replying target actor and receive response" in { val target = system.actorOf(Props[ReplyingForwardTarget], name = "17-reply-forwarding-target") val producer = system.actorOf(Props(new TestForwarder("direct:producer-test-3", target)), name = "17-direct-producer-test-3-forward-failure") - val message = CamelMessage("fail", Map(CamelMessage.MessageExchangeId -> "123")) + val message = CamelMessage("fail", Map(CamelMessage.MessageExchangeId → "123")) filterEvents(EventFilter[AkkaCamelException](occurrences = 1)) { producer.tell(message, testActor) expectMsgPF(timeoutDuration) { case Failure(e: AkkaCamelException) ⇒ e.getMessage should ===("failure") - e.headers should ===(Map(CamelMessage.MessageExchangeId -> "123", "test" -> "failure")) + e.headers should ===(Map(CamelMessage.MessageExchangeId → "123", "test" → "failure")) } } } @@ -324,10 +324,10 @@ object ProducerFeatureTest { class ReplyingForwardTarget extends Actor { def receive = { case msg: CamelMessage ⇒ - context.sender() ! (msg.copy(headers = msg.headers + ("test" -> "result"))) + context.sender() ! (msg.copy(headers = msg.headers + ("test" → "result"))) case msg: akka.actor.Status.Failure ⇒ msg.cause match { - case e: AkkaCamelException ⇒ context.sender() ! Status.Failure(new AkkaCamelException(e, e.headers + ("test" -> "failure"))) + case e: AkkaCamelException ⇒ context.sender() ! Status.Failure(new AkkaCamelException(e, e.headers + ("test" → "failure"))) } } } diff --git a/akka-camel/src/test/scala/akka/camel/UntypedProducerTest.scala b/akka-camel/src/test/scala/akka/camel/UntypedProducerTest.scala index 0ce10b714e..4bd3d03b04 100644 --- a/akka-camel/src/test/scala/akka/camel/UntypedProducerTest.scala +++ b/akka-camel/src/test/scala/akka/camel/UntypedProducerTest.scala @@ -34,10 +34,10 @@ class UntypedProducerTest extends WordSpec with Matchers with BeforeAndAfterAll "produce a message and receive a normal response" in { val producer = system.actorOf(Props[SampleUntypedReplyingProducer], name = "sample-untyped-replying-producer") - val message = CamelMessage("test", Map(CamelMessage.MessageExchangeId -> "123")) + val message = CamelMessage("test", Map(CamelMessage.MessageExchangeId → "123")) val future = producer.ask(message)(timeout) - val expected = CamelMessage("received test", Map(CamelMessage.MessageExchangeId -> "123")) + val expected = CamelMessage("received test", Map(CamelMessage.MessageExchangeId → "123")) Await.result(future, timeout) match { case result: CamelMessage ⇒ result should ===(expected) case unexpected ⇒ fail("Actor responded with unexpected message:" + unexpected) @@ -48,14 +48,14 @@ class UntypedProducerTest extends WordSpec with Matchers with BeforeAndAfterAll "produce a message and receive a failure response" in { val producer = system.actorOf(Props[SampleUntypedReplyingProducer], name = "sample-untyped-replying-producer-failure") - val message = CamelMessage("fail", Map(CamelMessage.MessageExchangeId -> "123")) + val message = CamelMessage("fail", Map(CamelMessage.MessageExchangeId → "123")) filterEvents(EventFilter[AkkaCamelException](occurrences = 1)) { val future = producer.ask(message)(timeout).failed Await.result(future, timeout) match { case e: AkkaCamelException ⇒ e.getMessage should ===("failure") - e.headers should ===(Map(CamelMessage.MessageExchangeId -> "123")) + e.headers should ===(Map(CamelMessage.MessageExchangeId → "123")) case unexpected ⇒ fail("Actor responded with unexpected message:" + unexpected) } } diff --git a/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/ClusterMetricsCollector.scala b/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/ClusterMetricsCollector.scala index 0b77b79e6d..6ee75e16f9 100644 --- a/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/ClusterMetricsCollector.scala +++ b/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/ClusterMetricsCollector.scala @@ -153,13 +153,15 @@ private[metrics] class ClusterMetricsCollector extends Actor with ActorLogging { /** * Start periodic gossip to random nodes in cluster */ - val gossipTask = scheduler.schedule(PeriodicTasksInitialDelay max CollectorGossipInterval, + val gossipTask = scheduler.schedule( + PeriodicTasksInitialDelay max CollectorGossipInterval, CollectorGossipInterval, self, GossipTick) /** * Start periodic metrics collection */ - val sampleTask = scheduler.schedule(PeriodicTasksInitialDelay max CollectorSampleInterval, + val sampleTask = scheduler.schedule( + PeriodicTasksInitialDelay max CollectorSampleInterval, CollectorSampleInterval, self, MetricsTick) override def preStart(): Unit = { diff --git a/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/ClusterMetricsExtension.scala b/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/ClusterMetricsExtension.scala index 02c818cf30..9361a4be07 100644 --- a/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/ClusterMetricsExtension.scala +++ b/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/ClusterMetricsExtension.scala @@ -44,7 +44,7 @@ class ClusterMetricsExtension(system: ExtendedActorSystem) extends Extension { * Supervision strategy. */ private[metrics] val strategy = system.dynamicAccess.createInstanceFor[SupervisorStrategy]( - SupervisorStrategyProvider, immutable.Seq(classOf[Config] -> SupervisorStrategyConfiguration)) + SupervisorStrategyProvider, immutable.Seq(classOf[Config] → SupervisorStrategyConfiguration)) .getOrElse { val log: LoggingAdapter = Logging(system, getClass.getName) log.error(s"Configured strategy provider ${SupervisorStrategyProvider} failed to load, using default ${classOf[ClusterMetricsStrategy].getName}.") diff --git a/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/ClusterMetricsRouting.scala b/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/ClusterMetricsRouting.scala index 9e80a1f649..e80d46be40 100644 --- a/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/ClusterMetricsRouting.scala +++ b/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/ClusterMetricsRouting.scala @@ -120,15 +120,16 @@ final case class AdaptiveLoadBalancingRoutingLogic(system: ActorSystem, metricsS */ @SerialVersionUID(1L) final case class AdaptiveLoadBalancingPool( - metricsSelector: MetricsSelector = MixMetricsSelector, - override val nrOfInstances: Int = 0, + metricsSelector: MetricsSelector = MixMetricsSelector, + override val nrOfInstances: Int = 0, override val supervisorStrategy: SupervisorStrategy = Pool.defaultSupervisorStrategy, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, - override val usePoolDispatcher: Boolean = false) + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, + override val usePoolDispatcher: Boolean = false) extends Pool { def this(config: Config, dynamicAccess: DynamicAccess) = - this(nrOfInstances = ClusterRouterSettingsBase.getMaxTotalNrOfInstances(config), + this( + nrOfInstances = ClusterRouterSettingsBase.getMaxTotalNrOfInstances(config), metricsSelector = MetricsSelector.fromConfig(config, dynamicAccess), usePoolDispatcher = config.hasPath("pool-dispatcher")) @@ -148,7 +149,8 @@ final case class AdaptiveLoadBalancingPool( new Router(AdaptiveLoadBalancingRoutingLogic(system, metricsSelector)) override def routingLogicController(routingLogic: RoutingLogic): Option[Props] = - Some(Props(classOf[AdaptiveLoadBalancingMetricsListener], + Some(Props( + classOf[AdaptiveLoadBalancingMetricsListener], routingLogic.asInstanceOf[AdaptiveLoadBalancingRoutingLogic])) /** @@ -200,13 +202,14 @@ final case class AdaptiveLoadBalancingPool( */ @SerialVersionUID(1L) final case class AdaptiveLoadBalancingGroup( - metricsSelector: MetricsSelector = MixMetricsSelector, - override val paths: immutable.Iterable[String] = Nil, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) + metricsSelector: MetricsSelector = MixMetricsSelector, + override val paths: immutable.Iterable[String] = Nil, + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) extends Group { def this(config: Config, dynamicAccess: DynamicAccess) = - this(metricsSelector = MetricsSelector.fromConfig(config, dynamicAccess), + this( + metricsSelector = MetricsSelector.fromConfig(config, dynamicAccess), paths = immutableSeq(config.getStringList("routees.paths"))) /** @@ -216,8 +219,9 @@ final case class AdaptiveLoadBalancingGroup( * @param routeesPaths string representation of the actor paths of the routees, messages are * sent with [[akka.actor.ActorSelection]] to these paths */ - def this(metricsSelector: MetricsSelector, - routeesPaths: java.lang.Iterable[String]) = this(paths = immutableSeq(routeesPaths)) + def this( + metricsSelector: MetricsSelector, + routeesPaths: java.lang.Iterable[String]) = this(paths = immutableSeq(routeesPaths)) override def paths(system: ActorSystem): immutable.Iterable[String] = this.paths @@ -225,7 +229,8 @@ final case class AdaptiveLoadBalancingGroup( new Router(AdaptiveLoadBalancingRoutingLogic(system, metricsSelector)) override def routingLogicController(routingLogic: RoutingLogic): Option[Props] = - Some(Props(classOf[AdaptiveLoadBalancingMetricsListener], + Some(Props( + classOf[AdaptiveLoadBalancingMetricsListener], routingLogic.asInstanceOf[AdaptiveLoadBalancingRoutingLogic])) /** @@ -365,9 +370,9 @@ abstract class MixMetricsSelectorBase(selectors: immutable.IndexedSeq[CapacityMe combined.foldLeft(Map.empty[Address, (Double, Int)].withDefaultValue((0.0, 0))) { case (acc, (address, capacity)) ⇒ val (sum, count) = acc(address) - acc + (address -> ((sum + capacity, count + 1))) + acc + (address → ((sum + capacity, count + 1))) }.map { - case (addr, (sum, count)) ⇒ (addr -> sum / count) + case (addr, (sum, count)) ⇒ addr → (sum / count) } } @@ -381,7 +386,7 @@ object MetricsSelector { case "cpu" ⇒ CpuMetricsSelector case "load" ⇒ SystemLoadAverageMetricsSelector case fqn ⇒ - val args = List(classOf[Config] -> config) + val args = List(classOf[Config] → config) dynamicAccess.createInstanceFor[MetricsSelector](fqn, args).recover({ case exception ⇒ throw new IllegalArgumentException( (s"Cannot instantiate metrics-selector [$fqn], " + @@ -429,7 +434,7 @@ abstract class CapacityMetricsSelector extends MetricsSelector { val (_, min) = capacity.minBy { case (_, c) ⇒ c } // lowest usable capacity is 1% (>= 0.5% will be rounded to weight 1), also avoids div by zero val divisor = math.max(0.01, min) - capacity map { case (addr, c) ⇒ (addr -> math.round((c) / divisor).toInt) } + capacity map { case (addr, c) ⇒ (addr → math.round((c) / divisor).toInt) } } } diff --git a/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/Metric.scala b/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/Metric.scala index 3f8cf45ae9..dd0338ed14 100644 --- a/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/Metric.scala +++ b/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/Metric.scala @@ -207,12 +207,12 @@ object StandardMetrics { */ @SerialVersionUID(1L) final case class Cpu( - address: Address, - timestamp: Long, + address: Address, + timestamp: Long, systemLoadAverage: Option[Double], - cpuCombined: Option[Double], - cpuStolen: Option[Double], - processors: Int) { + cpuCombined: Option[Double], + cpuStolen: Option[Double], + processors: Int) { cpuCombined match { case Some(x) ⇒ require(0.0 <= x && x <= 1.0, s"cpuCombined must be between [0.0 - 1.0], was [$x]") diff --git a/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/MetricsCollector.scala b/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/MetricsCollector.scala index f33f54d89f..81f46dd11e 100644 --- a/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/MetricsCollector.scala +++ b/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/MetricsCollector.scala @@ -60,7 +60,7 @@ private[metrics] object MetricsCollector { def create(provider: String) = TryNative { log.debug(s"Trying ${provider}.") system.asInstanceOf[ExtendedActorSystem].dynamicAccess - .createInstanceFor[MetricsCollector](provider, List(classOf[ActorSystem] -> system)).get + .createInstanceFor[MetricsCollector](provider, List(classOf[ActorSystem] → system)).get } val collector = if (useCustom) @@ -86,7 +86,8 @@ class JmxMetricsCollector(address: Address, decayFactor: Double) extends Metrics import StandardMetrics._ private def this(address: Address, settings: ClusterMetricsSettings) = - this(address, + this( + address, EWMA.alpha(settings.CollectorMovingAverageHalfLife, settings.CollectorSampleInterval)) /** @@ -193,7 +194,8 @@ class SigarMetricsCollector(address: Address, decayFactor: Double, sigar: SigarP import org.hyperic.sigar.CpuPerc def this(address: Address, settings: ClusterMetricsSettings, sigar: SigarProxy) = - this(address, + this( + address, EWMA.alpha(settings.CollectorMovingAverageHalfLife, settings.CollectorSampleInterval), sigar) diff --git a/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/protobuf/MessageSerializer.scala b/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/protobuf/MessageSerializer.scala index 208493c886..2a48613dc0 100644 --- a/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/protobuf/MessageSerializer.scala +++ b/akka-cluster-metrics/src/main/scala/akka/cluster/metrics/protobuf/MessageSerializer.scala @@ -177,7 +177,8 @@ class MessageSerializer(val system: ExtendedActorSystem) extends SerializerWithS case NumberType.Float_VALUE ⇒ jl.Float.intBitsToFloat(number.getValue32) case NumberType.Integer_VALUE ⇒ number.getValue32 case NumberType.Serialized_VALUE ⇒ - val in = new ClassLoaderObjectInputStream(system.dynamicAccess.classLoader, + val in = new ClassLoaderObjectInputStream( + system.dynamicAccess.classLoader, new ByteArrayInputStream(number.getSerialized.toByteArray)) val obj = in.readObject in.close() diff --git a/akka-cluster-metrics/src/multi-jvm/scala/akka/cluster/metrics/ClusterMetricsRoutingSpec.scala b/akka-cluster-metrics/src/multi-jvm/scala/akka/cluster/metrics/ClusterMetricsRoutingSpec.scala index d87163eafd..3c2c8975eb 100644 --- a/akka-cluster-metrics/src/multi-jvm/scala/akka/cluster/metrics/ClusterMetricsRoutingSpec.scala +++ b/akka-cluster-metrics/src/multi-jvm/scala/akka/cluster/metrics/ClusterMetricsRoutingSpec.scala @@ -122,11 +122,11 @@ abstract class AdaptiveLoadBalancingRouterSpec extends MultiNodeSpec(AdaptiveLoa Await.result(router ? GetRoutees, timeout.duration).asInstanceOf[Routees].routees def receiveReplies(expectedReplies: Int): Map[Address, Int] = { - val zero = Map.empty[Address, Int] ++ roles.map(address(_) -> 0) + val zero = Map.empty[Address, Int] ++ roles.map(address(_) → 0) (receiveWhile(5 seconds, messages = expectedReplies) { case Reply(address) ⇒ address }).foldLeft(zero) { - case (replyMap, address) ⇒ replyMap + (address -> (replyMap(address) + 1)) + case (replyMap, address) ⇒ replyMap + (address → (replyMap(address) + 1)) } } @@ -139,10 +139,11 @@ abstract class AdaptiveLoadBalancingRouterSpec extends MultiNodeSpec(AdaptiveLoa } def startRouter(name: String): ActorRef = { - val router = system.actorOf(ClusterRouterPool( - local = AdaptiveLoadBalancingPool(HeapMetricsSelector), - settings = ClusterRouterPoolSettings(totalInstances = 10, maxInstancesPerNode = 1, allowLocalRoutees = true, useRole = None)). - props(Props[Echo]), + val router = system.actorOf( + ClusterRouterPool( + local = AdaptiveLoadBalancingPool(HeapMetricsSelector), + settings = ClusterRouterPoolSettings(totalInstances = 10, maxInstancesPerNode = 1, allowLocalRoutees = true, useRole = None)). + props(Props[Echo]), name) // it may take some time until router receives cluster member events awaitAssert { currentRoutees(router).size should ===(roles.size) } diff --git a/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/ClusterMetricsRoutingSpec.scala b/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/ClusterMetricsRoutingSpec.scala index fa753c56b3..12f011aee8 100644 --- a/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/ClusterMetricsRoutingSpec.scala +++ b/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/ClusterMetricsRoutingSpec.scala @@ -62,15 +62,15 @@ class MetricsSelectorSpec extends WordSpec with Matchers { "CapacityMetricsSelector" must { "calculate weights from capacity" in { - val capacity = Map(a1 -> 0.6, b1 -> 0.3, c1 -> 0.1) + val capacity = Map(a1 → 0.6, b1 → 0.3, c1 → 0.1) val weights = abstractSelector.weights(capacity) - weights should ===(Map(c1 -> 1, b1 -> 3, a1 -> 6)) + weights should ===(Map(c1 → 1, b1 → 3, a1 → 6)) } "handle low and zero capacity" in { - val capacity = Map(a1 -> 0.0, b1 -> 1.0, c1 -> 0.005, d1 -> 0.004) + val capacity = Map(a1 → 0.0, b1 → 1.0, c1 → 0.005, d1 → 0.004) val weights = abstractSelector.weights(capacity) - weights should ===(Map(a1 -> 0, b1 -> 100, c1 -> 1, d1 -> 0)) + weights should ===(Map(a1 → 0, b1 → 100, c1 → 1, d1 → 0)) } } diff --git a/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/EWMASpec.scala b/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/EWMASpec.scala index db0d06d2a1..2938213546 100644 --- a/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/EWMASpec.scala +++ b/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/EWMASpec.scala @@ -91,7 +91,7 @@ class EWMASpec extends AkkaSpec(MetricsConfig.defaultEnabled) with MetricsCollec } else None } } - streamingDataSet ++= changes.map(m ⇒ m.name -> m) + streamingDataSet ++= changes.map(m ⇒ m.name → m) } } } diff --git a/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/TestUtil.scala b/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/TestUtil.scala index 425b484866..6f6689b3e2 100644 --- a/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/TestUtil.scala +++ b/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/TestUtil.scala @@ -49,11 +49,11 @@ case class SimpleSigarProvider(location: String = "native") extends SigarProvide * Provide sigar library as static mock. */ case class MockitoSigarProvider( - pid: Long = 123, + pid: Long = 123, loadAverage: Array[Double] = Array(0.7, 0.3, 0.1), - cpuCombined: Double = 0.5, - cpuStolen: Double = 0.2, - steps: Int = 5) extends SigarProvider with MockitoSugar { + cpuCombined: Double = 0.5, + cpuStolen: Double = 0.2, + steps: Int = 5) extends SigarProvider with MockitoSugar { import org.hyperic.sigar._ import org.mockito.Mockito._ diff --git a/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/protobuf/MessageSerializerSpec.scala b/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/protobuf/MessageSerializerSpec.scala index 175977c15d..ffa044a193 100644 --- a/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/protobuf/MessageSerializerSpec.scala +++ b/akka-cluster-metrics/src/test/scala/akka/cluster/metrics/protobuf/MessageSerializerSpec.scala @@ -42,8 +42,10 @@ class MessageSerializerSpec extends AkkaSpec( "be serializable" in { - val metricsGossip = MetricsGossip(Set(NodeMetrics(a1.address, 4711, Set(Metric("foo", 1.2, None))), - NodeMetrics(b1.address, 4712, Set(Metric("foo", 2.1, Some(EWMA(value = 100.0, alpha = 0.18))), + val metricsGossip = MetricsGossip(Set( + NodeMetrics(a1.address, 4711, Set(Metric("foo", 1.2, None))), + NodeMetrics(b1.address, 4712, Set( + Metric("foo", 2.1, Some(EWMA(value = 100.0, alpha = 0.18))), Metric("bar1", Double.MinPositiveValue, None), Metric("bar2", Float.MaxValue, None), Metric("bar3", Int.MaxValue, None), diff --git a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ClusterSharding.scala b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ClusterSharding.scala index 2b9215496f..631d064939 100644 --- a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ClusterSharding.scala +++ b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ClusterSharding.scala @@ -167,7 +167,8 @@ class ClusterSharding(system: ExtendedActorSystem) extends Extension { } private[akka] def requireClusterRole(role: Option[String]): Unit = - require(role.forall(cluster.selfRoles.contains), + require( + role.forall(cluster.selfRoles.contains), s"This cluster member [${cluster.selfAddress}] doesn't have the role [$role]") /** @@ -193,11 +194,11 @@ class ClusterSharding(system: ExtendedActorSystem) extends Extension { * @return the actor ref of the [[ShardRegion]] that is to be responsible for the shard */ def start( - typeName: String, - entityProps: Props, - settings: ClusterShardingSettings, - extractEntityId: ShardRegion.ExtractEntityId, - extractShardId: ShardRegion.ExtractShardId, + typeName: String, + entityProps: Props, + settings: ClusterShardingSettings, + extractEntityId: ShardRegion.ExtractEntityId, + extractShardId: ShardRegion.ExtractShardId, allocationStrategy: ShardAllocationStrategy, handOffStopMessage: Any): ActorRef = { @@ -232,11 +233,11 @@ class ClusterSharding(system: ExtendedActorSystem) extends Extension { * @return the actor ref of the [[ShardRegion]] that is to be responsible for the shard */ def start( - typeName: String, - entityProps: Props, - settings: ClusterShardingSettings, + typeName: String, + entityProps: Props, + settings: ClusterShardingSettings, extractEntityId: ShardRegion.ExtractEntityId, - extractShardId: ShardRegion.ExtractShardId): ActorRef = { + extractShardId: ShardRegion.ExtractShardId): ActorRef = { val allocationStrategy = new LeastShardAllocationStrategy( settings.tuningParameters.leastShardAllocationRebalanceThreshold, @@ -265,18 +266,18 @@ class ClusterSharding(system: ExtendedActorSystem) extends Extension { * @return the actor ref of the [[ShardRegion]] that is to be responsible for the shard */ def start( - typeName: String, - entityProps: Props, - settings: ClusterShardingSettings, - messageExtractor: ShardRegion.MessageExtractor, + typeName: String, + entityProps: Props, + settings: ClusterShardingSettings, + messageExtractor: ShardRegion.MessageExtractor, allocationStrategy: ShardAllocationStrategy, handOffStopMessage: Any): ActorRef = { start(typeName, entityProps, settings, extractEntityId = { - case msg if messageExtractor.entityId(msg) ne null ⇒ - (messageExtractor.entityId(msg), messageExtractor.entityMessage(msg)) - }, + case msg if messageExtractor.entityId(msg) ne null ⇒ + (messageExtractor.entityId(msg), messageExtractor.entityMessage(msg)) + }, extractShardId = msg ⇒ messageExtractor.shardId(msg), allocationStrategy = allocationStrategy, handOffStopMessage = handOffStopMessage) @@ -301,9 +302,9 @@ class ClusterSharding(system: ExtendedActorSystem) extends Extension { * @return the actor ref of the [[ShardRegion]] that is to be responsible for the shard */ def start( - typeName: String, - entityProps: Props, - settings: ClusterShardingSettings, + typeName: String, + entityProps: Props, + settings: ClusterShardingSettings, messageExtractor: ShardRegion.MessageExtractor): ActorRef = { val allocationStrategy = new LeastShardAllocationStrategy( @@ -333,10 +334,10 @@ class ClusterSharding(system: ExtendedActorSystem) extends Extension { * @return the actor ref of the [[ShardRegion]] that is to be responsible for the shard */ def startProxy( - typeName: String, - role: Option[String], + typeName: String, + role: Option[String], extractEntityId: ShardRegion.ExtractEntityId, - extractShardId: ShardRegion.ExtractShardId): ActorRef = { + extractShardId: ShardRegion.ExtractShardId): ActorRef = { implicit val timeout = system.settings.CreationTimeout val settings = ClusterShardingSettings(system).withRole(role) @@ -363,15 +364,15 @@ class ClusterSharding(system: ExtendedActorSystem) extends Extension { * @return the actor ref of the [[ShardRegion]] that is to be responsible for the shard */ def startProxy( - typeName: String, - role: Optional[String], + typeName: String, + role: Optional[String], messageExtractor: ShardRegion.MessageExtractor): ActorRef = { startProxy(typeName, Option(role.orElse(null)), extractEntityId = { - case msg if messageExtractor.entityId(msg) ne null ⇒ - (messageExtractor.entityId(msg), messageExtractor.entityMessage(msg)) - }, + case msg if messageExtractor.entityId(msg) ne null ⇒ + (messageExtractor.entityId(msg), messageExtractor.entityMessage(msg)) + }, extractShardId = msg ⇒ messageExtractor.shardId(msg)) } @@ -443,21 +444,23 @@ private[akka] class ClusterShardingGuardian extends Actor { randomFactor = 0.2).withDeploy(Deploy.local) val singletonSettings = settings.coordinatorSingletonSettings .withSingletonName("singleton").withRole(role) - context.actorOf(ClusterSingletonManager.props( - singletonProps, - terminationMessage = PoisonPill, - singletonSettings).withDispatcher(context.props.dispatcher), + context.actorOf( + ClusterSingletonManager.props( + singletonProps, + terminationMessage = PoisonPill, + singletonSettings).withDispatcher(context.props.dispatcher), name = cName) } - context.actorOf(ShardRegion.props( - typeName = typeName, - entityProps = entityProps, - settings = settings, - coordinatorPath = cPath, - extractEntityId = extractEntityId, - extractShardId = extractShardId, - handOffStopMessage = handOffStopMessage).withDispatcher(context.props.dispatcher), + context.actorOf( + ShardRegion.props( + typeName = typeName, + entityProps = entityProps, + settings = settings, + coordinatorPath = cPath, + extractEntityId = extractEntityId, + extractShardId = extractShardId, + handOffStopMessage = handOffStopMessage).withDispatcher(context.props.dispatcher), name = encName) } sender() ! Started(shardRegion) @@ -467,12 +470,13 @@ private[akka] class ClusterShardingGuardian extends Actor { val cName = coordinatorSingletonManagerName(encName) val cPath = coordinatorPath(encName) val shardRegion = context.child(encName).getOrElse { - context.actorOf(ShardRegion.proxyProps( - typeName = typeName, - settings = settings, - coordinatorPath = cPath, - extractEntityId = extractEntityId, - extractShardId = extractShardId).withDispatcher(context.props.dispatcher), + context.actorOf( + ShardRegion.proxyProps( + typeName = typeName, + settings = settings, + coordinatorPath = cPath, + extractEntityId = extractEntityId, + extractShardId = extractShardId).withDispatcher(context.props.dispatcher), name = encName) } sender() ! Started(shardRegion) diff --git a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ClusterShardingSettings.scala b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ClusterShardingSettings.scala index 51597422b2..b77fb80eb8 100644 --- a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ClusterShardingSettings.scala +++ b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ClusterShardingSettings.scala @@ -71,19 +71,19 @@ object ClusterShardingSettings { if (role == "") None else Option(role) class TuningParameters( - val coordinatorFailureBackoff: FiniteDuration, - val retryInterval: FiniteDuration, - val bufferSize: Int, - val handOffTimeout: FiniteDuration, - val shardStartTimeout: FiniteDuration, - val shardFailureBackoff: FiniteDuration, - val entityRestartBackoff: FiniteDuration, - val rebalanceInterval: FiniteDuration, - val snapshotAfter: Int, - val leastShardAllocationRebalanceThreshold: Int, + val coordinatorFailureBackoff: FiniteDuration, + val retryInterval: FiniteDuration, + val bufferSize: Int, + val handOffTimeout: FiniteDuration, + val shardStartTimeout: FiniteDuration, + val shardFailureBackoff: FiniteDuration, + val entityRestartBackoff: FiniteDuration, + val rebalanceInterval: FiniteDuration, + val snapshotAfter: Int, + val leastShardAllocationRebalanceThreshold: Int, val leastShardAllocationMaxSimultaneousRebalance: Int, - val waitingForStateTimeout: FiniteDuration, - val updatingStateTimeout: FiniteDuration) + val waitingForStateTimeout: FiniteDuration, + val updatingStateTimeout: FiniteDuration) } /** @@ -102,15 +102,16 @@ object ClusterShardingSettings { * @param tuningParameters additional tuning parameters, see descriptions in reference.conf */ final class ClusterShardingSettings( - val role: Option[String], - val rememberEntities: Boolean, - val journalPluginId: String, - val snapshotPluginId: String, - val stateStoreMode: String, - val tuningParameters: ClusterShardingSettings.TuningParameters, + val role: Option[String], + val rememberEntities: Boolean, + val journalPluginId: String, + val snapshotPluginId: String, + val stateStoreMode: String, + val tuningParameters: ClusterShardingSettings.TuningParameters, val coordinatorSingletonSettings: ClusterSingletonManagerSettings) extends NoSerializationVerificationNeeded { - require(stateStoreMode == "persistence" || stateStoreMode == "ddata", + require( + stateStoreMode == "persistence" || stateStoreMode == "ddata", s"Unknown 'state-store-mode' [$stateStoreMode], valid values are 'persistence' or 'ddata'") def withRole(role: String): ClusterShardingSettings = copy(role = ClusterShardingSettings.roleOption(role)) @@ -139,13 +140,14 @@ final class ClusterShardingSettings( def withCoordinatorSingletonSettings(coordinatorSingletonSettings: ClusterSingletonManagerSettings): ClusterShardingSettings = copy(coordinatorSingletonSettings = coordinatorSingletonSettings) - private def copy(role: Option[String] = role, - rememberEntities: Boolean = rememberEntities, - journalPluginId: String = journalPluginId, - snapshotPluginId: String = snapshotPluginId, - stateStoreMode: String = stateStoreMode, - tuningParameters: ClusterShardingSettings.TuningParameters = tuningParameters, - coordinatorSingletonSettings: ClusterSingletonManagerSettings = coordinatorSingletonSettings): ClusterShardingSettings = + private def copy( + role: Option[String] = role, + rememberEntities: Boolean = rememberEntities, + journalPluginId: String = journalPluginId, + snapshotPluginId: String = snapshotPluginId, + stateStoreMode: String = stateStoreMode, + tuningParameters: ClusterShardingSettings.TuningParameters = tuningParameters, + coordinatorSingletonSettings: ClusterSingletonManagerSettings = coordinatorSingletonSettings): ClusterShardingSettings = new ClusterShardingSettings( role, rememberEntities, diff --git a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/RemoveInternalClusterShardingData.scala b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/RemoveInternalClusterShardingData.scala index cced284598..25606fc982 100644 --- a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/RemoveInternalClusterShardingData.scala +++ b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/RemoveInternalClusterShardingData.scala @@ -92,7 +92,8 @@ object RemoveInternalClusterShardingData { } val completion = Promise[Unit]() - system.actorOf(props(journalPluginId, typeNames, completion, remove2dot3Data), + system.actorOf( + props(journalPluginId, typeNames, completion, remove2dot3Data), name = "removeInternalClusterShardingData") completion.future } diff --git a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/Shard.scala b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/Shard.scala index fa029f5f91..e8381da165 100644 --- a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/Shard.scala +++ b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/Shard.scala @@ -80,13 +80,14 @@ private[akka] object Shard { * If `settings.rememberEntities` is enabled the `PersistentShard` * subclass is used, otherwise `Shard`. */ - def props(typeName: String, - shardId: ShardRegion.ShardId, - entityProps: Props, - settings: ClusterShardingSettings, - extractEntityId: ShardRegion.ExtractEntityId, - extractShardId: ShardRegion.ExtractShardId, - handOffStopMessage: Any): Props = { + def props( + typeName: String, + shardId: ShardRegion.ShardId, + entityProps: Props, + settings: ClusterShardingSettings, + extractEntityId: ShardRegion.ExtractEntityId, + extractShardId: ShardRegion.ExtractShardId, + handOffStopMessage: Any): Props = { if (settings.rememberEntities) Props(new PersistentShard(typeName, shardId, entityProps, settings, extractEntityId, extractShardId, handOffStopMessage)) .withDeploy(Deploy.local) @@ -105,12 +106,12 @@ private[akka] object Shard { * @see [[ClusterSharding$ ClusterSharding extension]] */ private[akka] class Shard( - typeName: String, - shardId: ShardRegion.ShardId, - entityProps: Props, - settings: ClusterShardingSettings, - extractEntityId: ShardRegion.ExtractEntityId, - extractShardId: ShardRegion.ExtractShardId, + typeName: String, + shardId: ShardRegion.ShardId, + entityProps: Props, + settings: ClusterShardingSettings, + extractEntityId: ShardRegion.ExtractEntityId, + extractShardId: ShardRegion.ExtractShardId, handOffStopMessage: Any) extends Actor with ActorLogging { import ShardRegion.{ handOffStopperProps, EntityId, Msg, Passivate, ShardInitialized } @@ -301,12 +302,12 @@ private[akka] class Shard( * @see [[ClusterSharding$ ClusterSharding extension]] */ private[akka] class PersistentShard( - typeName: String, - shardId: ShardRegion.ShardId, - entityProps: Props, - settings: ClusterShardingSettings, - extractEntityId: ShardRegion.ExtractEntityId, - extractShardId: ShardRegion.ExtractShardId, + typeName: String, + shardId: ShardRegion.ShardId, + entityProps: Props, + settings: ClusterShardingSettings, + extractEntityId: ShardRegion.ExtractEntityId, + extractShardId: ShardRegion.ExtractShardId, handOffStopMessage: Any) extends Shard( typeName, shardId, entityProps, settings, extractEntityId, extractShardId, handOffStopMessage) with PersistentActor with ActorLogging { diff --git a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ShardCoordinator.scala b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ShardCoordinator.scala index f28031aaeb..370a635f1f 100644 --- a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ShardCoordinator.scala +++ b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ShardCoordinator.scala @@ -43,7 +43,7 @@ object ShardCoordinator { */ private[akka] def props(typeName: String, settings: ClusterShardingSettings, allocationStrategy: ShardAllocationStrategy, - replicator: ActorRef): Props = + replicator: ActorRef): Props = Props(new DDataShardCoordinator(typeName: String, settings, allocationStrategy, replicator)).withDeploy(Deploy.local) /** @@ -73,8 +73,9 @@ object ShardCoordinator { * you should not include these in the returned set * @return a `Future` of the shards to be migrated, may be empty to skip rebalance in this round */ - def rebalance(currentShardAllocations: Map[ActorRef, immutable.IndexedSeq[ShardId]], - rebalanceInProgress: Set[ShardId]): Future[Set[ShardId]] + def rebalance( + currentShardAllocations: Map[ActorRef, immutable.IndexedSeq[ShardId]], + rebalanceInProgress: Set[ShardId]): Future[Set[ShardId]] } /** @@ -89,8 +90,9 @@ object ShardCoordinator { allocateShard(requester, shardId, currentShardAllocations.asJava) } - override final def rebalance(currentShardAllocations: Map[ActorRef, immutable.IndexedSeq[ShardId]], - rebalanceInProgress: Set[ShardId]): Future[Set[ShardId]] = { + override final def rebalance( + currentShardAllocations: Map[ActorRef, immutable.IndexedSeq[ShardId]], + rebalanceInProgress: Set[ShardId]): Future[Set[ShardId]] = { import scala.collection.JavaConverters._ implicit val ec = ExecutionContexts.sameThreadExecutionContext rebalance(currentShardAllocations.asJava, rebalanceInProgress.asJava).map(_.asScala.toSet) @@ -117,8 +119,9 @@ object ShardCoordinator { * you should not include these in the returned set * @return a `Future` of the shards to be migrated, may be empty to skip rebalance in this round */ - def rebalance(currentShardAllocations: java.util.Map[ActorRef, immutable.IndexedSeq[String]], - rebalanceInProgress: java.util.Set[String]): Future[java.util.Set[String]] + def rebalance( + currentShardAllocations: java.util.Map[ActorRef, immutable.IndexedSeq[String]], + rebalanceInProgress: java.util.Set[String]): Future[java.util.Set[String]] } private val emptyRebalanceResult = Future.successful(Set.empty[ShardId]) @@ -141,8 +144,9 @@ object ShardCoordinator { Future.successful(regionWithLeastShards) } - override def rebalance(currentShardAllocations: Map[ActorRef, immutable.IndexedSeq[ShardId]], - rebalanceInProgress: Set[ShardId]): Future[Set[ShardId]] = { + override def rebalance( + currentShardAllocations: Map[ActorRef, immutable.IndexedSeq[ShardId]], + rebalanceInProgress: Set[ShardId]): Future[Set[ShardId]] = { if (rebalanceInProgress.size < maxSimultaneousRebalance) { val (regionWithLeastShards, leastShards) = currentShardAllocations.minBy { case (_, v) ⇒ v.size } val mostShards = currentShardAllocations.collect { @@ -255,10 +259,10 @@ object ShardCoordinator { // region for each shard shards: Map[ShardId, ActorRef] = Map.empty, // shards for each region - regions: Map[ActorRef, Vector[ShardId]] = Map.empty, - regionProxies: Set[ActorRef] = Set.empty, - unallocatedShards: Set[ShardId] = Set.empty, - rememberEntities: Boolean = false) extends ClusterShardingSerializable { + regions: Map[ActorRef, Vector[ShardId]] = Map.empty, + regionProxies: Set[ActorRef] = Set.empty, + unallocatedShards: Set[ShardId] = Set.empty, + rememberEntities: Boolean = false) extends ClusterShardingSerializable { def withRememberEntities(enabled: Boolean): State = { if (enabled) @@ -550,7 +554,7 @@ abstract class ShardCoordinator(typeName: String, settings: ClusterShardingSetti implicit val timeout: Timeout = waitMax Future.sequence(aliveRegions.map { regionActor ⇒ (regionActor ? ShardRegion.GetShardRegionStats).mapTo[ShardRegion.ShardRegionStats] - .map(stats ⇒ regionActor -> stats) + .map(stats ⇒ regionActor → stats) }).map { allRegionStats ⇒ ShardRegion.ClusterShardingStats(allRegionStats.map { case (region, stats) ⇒ @@ -559,7 +563,7 @@ abstract class ShardCoordinator(typeName: String, settings: ClusterShardingSetti if (regionAddress.hasLocalScope && regionAddress.system == cluster.selfAddress.system) cluster.selfAddress else regionAddress - address -> stats + address → stats }.toMap) }.recover { case x: AskTimeoutException ⇒ ShardRegion.ClusterShardingStats(Map.empty) @@ -688,7 +692,8 @@ abstract class ShardCoordinator(typeName: String, settings: ClusterShardingSetti getShardHomeSender ! ShardHome(evt.shard, evt.region) } } else - log.debug("Allocated region {} for shard [{}] is not (any longer) one of the registered regions: {}", + log.debug( + "Allocated region {} for shard [{}] is not (any longer) one of the registered regions: {}", region, shard, state) } } @@ -805,7 +810,7 @@ class PersistentShardCoordinator(typeName: String, settings: ClusterShardingSett */ class DDataShardCoordinator(typeName: String, settings: ClusterShardingSettings, allocationStrategy: ShardCoordinator.ShardAllocationStrategy, - replicator: ActorRef) + replicator: ActorRef) extends ShardCoordinator(typeName, settings, allocationStrategy) with Stash { import ShardCoordinator.Internal._ import akka.cluster.ddata.Replicator.Update diff --git a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ShardRegion.scala b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ShardRegion.scala index 96f04799cd..c73eeb8f64 100644 --- a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ShardRegion.scala +++ b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/ShardRegion.scala @@ -29,12 +29,12 @@ object ShardRegion { * Factory method for the [[akka.actor.Props]] of the [[ShardRegion]] actor. */ private[akka] def props( - typeName: String, - entityProps: Props, - settings: ClusterShardingSettings, - coordinatorPath: String, - extractEntityId: ShardRegion.ExtractEntityId, - extractShardId: ShardRegion.ExtractShardId, + typeName: String, + entityProps: Props, + settings: ClusterShardingSettings, + coordinatorPath: String, + extractEntityId: ShardRegion.ExtractEntityId, + extractShardId: ShardRegion.ExtractShardId, handOffStopMessage: Any): Props = Props(new ShardRegion(typeName, Some(entityProps), settings, coordinatorPath, extractEntityId, extractShardId, handOffStopMessage)).withDeploy(Deploy.local) @@ -45,11 +45,11 @@ object ShardRegion { * when using it in proxy only mode. */ private[akka] def proxyProps( - typeName: String, - settings: ClusterShardingSettings, + typeName: String, + settings: ClusterShardingSettings, coordinatorPath: String, extractEntityId: ShardRegion.ExtractEntityId, - extractShardId: ShardRegion.ExtractShardId): Props = + extractShardId: ShardRegion.ExtractShardId): Props = Props(new ShardRegion(typeName, None, settings, coordinatorPath, extractEntityId, extractShardId, PoisonPill)) .withDeploy(Deploy.local) @@ -337,12 +337,12 @@ object ShardRegion { * @see [[ClusterSharding$ ClusterSharding extension]] */ class ShardRegion( - typeName: String, - entityProps: Option[Props], - settings: ClusterShardingSettings, - coordinatorPath: String, - extractEntityId: ShardRegion.ExtractEntityId, - extractShardId: ShardRegion.ExtractShardId, + typeName: String, + entityProps: Option[Props], + settings: ClusterShardingSettings, + coordinatorPath: String, + extractEntityId: ShardRegion.ExtractEntityId, + extractShardId: ShardRegion.ExtractShardId, handOffStopMessage: Any) extends Actor with ActorLogging { import ShardCoordinator.Internal._ @@ -609,7 +609,8 @@ class ShardRegion( def register(): Unit = { coordinatorSelection.foreach(_ ! registrationMessage) if (shardBuffers.nonEmpty && retryCount >= 5) - log.warning("Trying to register to coordinator at [{}], but no acknowledgement. Total [{}] buffered messages.", + log.warning( + "Trying to register to coordinator at [{}], but no acknowledgement. Total [{}] buffered messages.", coordinatorSelection, totalBufferSize) } diff --git a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/protobuf/ClusterShardingMessageSerializer.scala b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/protobuf/ClusterShardingMessageSerializer.scala index e9071c6579..48d297de0a 100644 --- a/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/protobuf/ClusterShardingMessageSerializer.scala +++ b/akka-cluster-sharding/src/main/scala/akka/cluster/sharding/protobuf/ClusterShardingMessageSerializer.scala @@ -64,33 +64,33 @@ private[akka] class ClusterShardingMessageSerializer(val system: ExtendedActorSy private val ShardStatsManifest = "DB" private val fromBinaryMap = collection.immutable.HashMap[String, Array[Byte] ⇒ AnyRef]( - EntityStateManifest -> entityStateFromBinary, - EntityStartedManifest -> entityStartedFromBinary, - EntityStoppedManifest -> entityStoppedFromBinary, + EntityStateManifest → entityStateFromBinary, + EntityStartedManifest → entityStartedFromBinary, + EntityStoppedManifest → entityStoppedFromBinary, - CoordinatorStateManifest -> coordinatorStateFromBinary, - ShardRegionRegisteredManifest -> { bytes ⇒ ShardRegionRegistered(actorRefMessageFromBinary(bytes)) }, - ShardRegionProxyRegisteredManifest -> { bytes ⇒ ShardRegionProxyRegistered(actorRefMessageFromBinary(bytes)) }, - ShardRegionTerminatedManifest -> { bytes ⇒ ShardRegionTerminated(actorRefMessageFromBinary(bytes)) }, - ShardRegionProxyTerminatedManifest -> { bytes ⇒ ShardRegionProxyTerminated(actorRefMessageFromBinary(bytes)) }, - ShardHomeAllocatedManifest -> shardHomeAllocatedFromBinary, - ShardHomeDeallocatedManifest -> { bytes ⇒ ShardHomeDeallocated(shardIdMessageFromBinary(bytes)) }, + CoordinatorStateManifest → coordinatorStateFromBinary, + ShardRegionRegisteredManifest → { bytes ⇒ ShardRegionRegistered(actorRefMessageFromBinary(bytes)) }, + ShardRegionProxyRegisteredManifest → { bytes ⇒ ShardRegionProxyRegistered(actorRefMessageFromBinary(bytes)) }, + ShardRegionTerminatedManifest → { bytes ⇒ ShardRegionTerminated(actorRefMessageFromBinary(bytes)) }, + ShardRegionProxyTerminatedManifest → { bytes ⇒ ShardRegionProxyTerminated(actorRefMessageFromBinary(bytes)) }, + ShardHomeAllocatedManifest → shardHomeAllocatedFromBinary, + ShardHomeDeallocatedManifest → { bytes ⇒ ShardHomeDeallocated(shardIdMessageFromBinary(bytes)) }, - RegisterManifest -> { bytes ⇒ Register(actorRefMessageFromBinary(bytes)) }, - RegisterProxyManifest -> { bytes ⇒ RegisterProxy(actorRefMessageFromBinary(bytes)) }, - RegisterAckManifest -> { bytes ⇒ RegisterAck(actorRefMessageFromBinary(bytes)) }, - GetShardHomeManifest -> { bytes ⇒ GetShardHome(shardIdMessageFromBinary(bytes)) }, - ShardHomeManifest -> shardHomeFromBinary, - HostShardManifest -> { bytes ⇒ HostShard(shardIdMessageFromBinary(bytes)) }, - ShardStartedManifest -> { bytes ⇒ ShardStarted(shardIdMessageFromBinary(bytes)) }, - BeginHandOffManifest -> { bytes ⇒ BeginHandOff(shardIdMessageFromBinary(bytes)) }, - BeginHandOffAckManifest -> { bytes ⇒ BeginHandOffAck(shardIdMessageFromBinary(bytes)) }, - HandOffManifest -> { bytes ⇒ HandOff(shardIdMessageFromBinary(bytes)) }, - ShardStoppedManifest -> { bytes ⇒ ShardStopped(shardIdMessageFromBinary(bytes)) }, - GracefulShutdownReqManifest -> { bytes ⇒ GracefulShutdownReq(actorRefMessageFromBinary(bytes)) }, + RegisterManifest → { bytes ⇒ Register(actorRefMessageFromBinary(bytes)) }, + RegisterProxyManifest → { bytes ⇒ RegisterProxy(actorRefMessageFromBinary(bytes)) }, + RegisterAckManifest → { bytes ⇒ RegisterAck(actorRefMessageFromBinary(bytes)) }, + GetShardHomeManifest → { bytes ⇒ GetShardHome(shardIdMessageFromBinary(bytes)) }, + ShardHomeManifest → shardHomeFromBinary, + HostShardManifest → { bytes ⇒ HostShard(shardIdMessageFromBinary(bytes)) }, + ShardStartedManifest → { bytes ⇒ ShardStarted(shardIdMessageFromBinary(bytes)) }, + BeginHandOffManifest → { bytes ⇒ BeginHandOff(shardIdMessageFromBinary(bytes)) }, + BeginHandOffAckManifest → { bytes ⇒ BeginHandOffAck(shardIdMessageFromBinary(bytes)) }, + HandOffManifest → { bytes ⇒ HandOff(shardIdMessageFromBinary(bytes)) }, + ShardStoppedManifest → { bytes ⇒ ShardStopped(shardIdMessageFromBinary(bytes)) }, + GracefulShutdownReqManifest → { bytes ⇒ GracefulShutdownReq(actorRefMessageFromBinary(bytes)) }, - GetShardStatsManifest -> { bytes ⇒ GetShardStats }, - ShardStatsManifest -> { bytes ⇒ shardStatsFromBinary(bytes) }) + GetShardStatsManifest → { bytes ⇒ GetShardStats }, + ShardStatsManifest → { bytes ⇒ shardStatsFromBinary(bytes) }) override def manifest(obj: AnyRef): String = obj match { case _: EntityState ⇒ EntityStateManifest @@ -194,11 +194,11 @@ private[akka] class ClusterShardingMessageSerializer(val system: ExtendedActorSy private def coordinatorStateFromProto(state: sm.CoordinatorState): State = { val shards: Map[String, ActorRef] = state.getShardsList.asScala.toVector.map { entry ⇒ - entry.getShardId -> resolveActorRef(entry.getRegionRef) + entry.getShardId → resolveActorRef(entry.getRegionRef) }(breakOut) val regionsZero: Map[ActorRef, Vector[String]] = - state.getRegionsList.asScala.toVector.map(resolveActorRef(_) -> Vector.empty[String])(breakOut) + state.getRegionsList.asScala.toVector.map(resolveActorRef(_) → Vector.empty[String])(breakOut) val regions: Map[ActorRef, Vector[String]] = shards.foldLeft(regionsZero) { case (acc, (shardId, regionRef)) ⇒ acc.updated(regionRef, acc(regionRef) :+ shardId) } diff --git a/akka-cluster-sharding/src/multi-jvm/scala/akka/cluster/sharding/ClusterShardingLeavingSpec.scala b/akka-cluster-sharding/src/multi-jvm/scala/akka/cluster/sharding/ClusterShardingLeavingSpec.scala index ff357a6484..fb88783782 100644 --- a/akka-cluster-sharding/src/multi-jvm/scala/akka/cluster/sharding/ClusterShardingLeavingSpec.scala +++ b/akka-cluster-sharding/src/multi-jvm/scala/akka/cluster/sharding/ClusterShardingLeavingSpec.scala @@ -177,7 +177,7 @@ abstract class ClusterShardingLeavingSpec(config: ClusterShardingLeavingSpecConf val locations = (for (n ← 1 to 10) yield { val id = n.toString region ! Ping(id) - id -> expectMsgType[ActorRef] + id → expectMsgType[ActorRef] }).toMap shardLocations ! Locations(locations) } diff --git a/akka-cluster-sharding/src/multi-jvm/scala/akka/cluster/sharding/ClusterShardingSpec.scala b/akka-cluster-sharding/src/multi-jvm/scala/akka/cluster/sharding/ClusterShardingSpec.scala index 8ebae74b5e..0788c895cb 100644 --- a/akka-cluster-sharding/src/multi-jvm/scala/akka/cluster/sharding/ClusterShardingSpec.scala +++ b/akka-cluster-sharding/src/multi-jvm/scala/akka/cluster/sharding/ClusterShardingSpec.scala @@ -256,10 +256,11 @@ abstract class ClusterShardingSpec(config: ClusterShardingSpecConfig) extends Mu minBackoff = 5.seconds, maxBackoff = 5.seconds, randomFactor = 0.1).withDeploy(Deploy.local) - system.actorOf(ClusterSingletonManager.props( - singletonProps, - terminationMessage = PoisonPill, - settings = ClusterSingletonManagerSettings(system)), + system.actorOf( + ClusterSingletonManager.props( + singletonProps, + terminationMessage = PoisonPill, + settings = ClusterSingletonManagerSettings(system)), name = typeName + "Coordinator") } } @@ -273,14 +274,15 @@ abstract class ClusterShardingSpec(config: ClusterShardingSpecConfig) extends Mu """).withFallback(system.settings.config.getConfig("akka.cluster.sharding")) val settings = ClusterShardingSettings(cfg) .withRememberEntities(rememberEntities) - system.actorOf(ShardRegion.props( - typeName = typeName, - entityProps = qualifiedCounterProps(typeName), - settings = settings, - coordinatorPath = "/user/" + typeName + "Coordinator/singleton/coordinator", - extractEntityId = extractEntityId, - extractShardId = extractShardId, - handOffStopMessage = PoisonPill), + system.actorOf( + ShardRegion.props( + typeName = typeName, + entityProps = qualifiedCounterProps(typeName), + settings = settings, + coordinatorPath = "/user/" + typeName + "Coordinator/singleton/coordinator", + extractEntityId = extractEntityId, + extractShardId = extractShardId, + handOffStopMessage = PoisonPill), name = typeName + "Region") } @@ -398,12 +400,13 @@ abstract class ClusterShardingSpec(config: ClusterShardingSpecConfig) extends Mu buffer-size = 1000 """).withFallback(system.settings.config.getConfig("akka.cluster.sharding")) val settings = ClusterShardingSettings(cfg) - val proxy = system.actorOf(ShardRegion.proxyProps( - typeName = "counter", - settings, - coordinatorPath = "/user/counterCoordinator/singleton/coordinator", - extractEntityId = extractEntityId, - extractShardId = extractShardId), + val proxy = system.actorOf( + ShardRegion.proxyProps( + typeName = "counter", + settings, + coordinatorPath = "/user/counterCoordinator/singleton/coordinator", + extractEntityId = extractEntityId, + extractShardId = extractShardId), name = "regionProxy") proxy ! Get(1) diff --git a/akka-cluster-sharding/src/test/scala/akka/cluster/sharding/LeastShardAllocationStrategySpec.scala b/akka-cluster-sharding/src/test/scala/akka/cluster/sharding/LeastShardAllocationStrategySpec.scala index ecb2fbc6a5..8717e9eb22 100644 --- a/akka-cluster-sharding/src/test/scala/akka/cluster/sharding/LeastShardAllocationStrategySpec.scala +++ b/akka-cluster-sharding/src/test/scala/akka/cluster/sharding/LeastShardAllocationStrategySpec.scala @@ -19,13 +19,13 @@ class LeastShardAllocationStrategySpec extends AkkaSpec { "LeastShardAllocationStrategy" must { "allocate to region with least number of shards" in { - val allocations = Map(regionA -> Vector("shard1"), regionB -> Vector("shard2"), regionC -> Vector.empty) + val allocations = Map(regionA → Vector("shard1"), regionB → Vector("shard2"), regionC → Vector.empty) Await.result(allocationStrategy.allocateShard(regionA, "shard3", allocations), 3.seconds) should ===(regionC) } "rebalance from region with most number of shards" in { - val allocations = Map(regionA -> Vector("shard1"), regionB -> Vector("shard2", "shard3"), - regionC -> Vector.empty) + val allocations = Map(regionA → Vector("shard1"), regionB → Vector("shard2", "shard3"), + regionC → Vector.empty) // so far regionB has 2 shards and regionC has 0 shards, but the diff is less than rebalanceThreshold Await.result(allocationStrategy.rebalance(allocations, Set.empty), 3.seconds) should ===(Set.empty[String]) @@ -39,8 +39,9 @@ class LeastShardAllocationStrategySpec extends AkkaSpec { } "must limit number of simultanious rebalance" in { - val allocations = Map(regionA -> Vector("shard1"), - regionB -> Vector("shard2", "shard3", "shard4", "shard5", "shard6"), regionC -> Vector.empty) + val allocations = Map( + regionA → Vector("shard1"), + regionB → Vector("shard2", "shard3", "shard4", "shard5", "shard6"), regionC → Vector.empty) Await.result(allocationStrategy.rebalance(allocations, Set("shard2")), 3.seconds) should ===(Set("shard3")) Await.result(allocationStrategy.rebalance(allocations, Set("shard2", "shard3")), 3.seconds) should ===(Set.empty[String]) diff --git a/akka-cluster-sharding/src/test/scala/akka/cluster/sharding/protobuf/ClusterShardingMessageSerializerSpec.scala b/akka-cluster-sharding/src/test/scala/akka/cluster/sharding/protobuf/ClusterShardingMessageSerializerSpec.scala index 45ef2b31d1..fc4b725481 100644 --- a/akka-cluster-sharding/src/test/scala/akka/cluster/sharding/protobuf/ClusterShardingMessageSerializerSpec.scala +++ b/akka-cluster-sharding/src/test/scala/akka/cluster/sharding/protobuf/ClusterShardingMessageSerializerSpec.scala @@ -30,8 +30,8 @@ class ClusterShardingMessageSerializerSpec extends AkkaSpec { "be able to serializable ShardCoordinator snapshot State" in { val state = State( - shards = Map("a" -> region1, "b" -> region2, "c" -> region2), - regions = Map(region1 -> Vector("a"), region2 -> Vector("b", "c"), region3 -> Vector.empty[String]), + shards = Map("a" → region1, "b" → region2, "c" → region2), + regions = Map(region1 → Vector("a"), region2 → Vector("b", "c"), region3 → Vector.empty[String]), regionProxies = Set(regionProxy1, regionProxy2), unallocatedShards = Set("d")) checkSerialization(state) diff --git a/akka-cluster-tools/src/main/scala/akka/cluster/client/ClusterClient.scala b/akka-cluster-tools/src/main/scala/akka/cluster/client/ClusterClient.scala index 54062f2846..17d7da0d17 100644 --- a/akka-cluster-tools/src/main/scala/akka/cluster/client/ClusterClient.scala +++ b/akka-cluster-tools/src/main/scala/akka/cluster/client/ClusterClient.scala @@ -108,13 +108,13 @@ object ClusterClientSettings { * external service registry */ final class ClusterClientSettings( - val initialContacts: Set[ActorPath], + val initialContacts: Set[ActorPath], val establishingGetContactsInterval: FiniteDuration, - val refreshContactsInterval: FiniteDuration, - val heartbeatInterval: FiniteDuration, - val acceptableHeartbeatPause: FiniteDuration, - val bufferSize: Int, - val reconnectTimeout: Option[FiniteDuration]) extends NoSerializationVerificationNeeded { + val refreshContactsInterval: FiniteDuration, + val heartbeatInterval: FiniteDuration, + val acceptableHeartbeatPause: FiniteDuration, + val bufferSize: Int, + val reconnectTimeout: Option[FiniteDuration]) extends NoSerializationVerificationNeeded { require(bufferSize >= 0 && bufferSize <= 10000, "bufferSize must be >= 0 and <= 10000") @@ -122,12 +122,12 @@ final class ClusterClientSettings( * For binary/source compatibility */ def this( - initialContacts: Set[ActorPath], + initialContacts: Set[ActorPath], establishingGetContactsInterval: FiniteDuration, - refreshContactsInterval: FiniteDuration, - heartbeatInterval: FiniteDuration, - acceptableHeartbeatPause: FiniteDuration, - bufferSize: Int) = + refreshContactsInterval: FiniteDuration, + heartbeatInterval: FiniteDuration, + acceptableHeartbeatPause: FiniteDuration, + bufferSize: Int) = this(initialContacts, establishingGetContactsInterval, refreshContactsInterval, heartbeatInterval, acceptableHeartbeatPause, bufferSize, None) @@ -163,13 +163,13 @@ final class ClusterClientSettings( copy(reconnectTimeout = reconnectTimeout) private def copy( - initialContacts: Set[ActorPath] = initialContacts, - establishingGetContactsInterval: FiniteDuration = establishingGetContactsInterval, - refreshContactsInterval: FiniteDuration = refreshContactsInterval, - heartbeatInterval: FiniteDuration = heartbeatInterval, - acceptableHeartbeatPause: FiniteDuration = acceptableHeartbeatPause, - bufferSize: Int = bufferSize, - reconnectTimeout: Option[FiniteDuration] = reconnectTimeout): ClusterClientSettings = + initialContacts: Set[ActorPath] = initialContacts, + establishingGetContactsInterval: FiniteDuration = establishingGetContactsInterval, + refreshContactsInterval: FiniteDuration = refreshContactsInterval, + heartbeatInterval: FiniteDuration = heartbeatInterval, + acceptableHeartbeatPause: FiniteDuration = acceptableHeartbeatPause, + bufferSize: Int = bufferSize, + reconnectTimeout: Option[FiniteDuration] = reconnectTimeout): ClusterClientSettings = new ClusterClientSettings(initialContacts, establishingGetContactsInterval, refreshContactsInterval, heartbeatInterval, acceptableHeartbeatPause, bufferSize, reconnectTimeout) } @@ -629,8 +629,8 @@ object ClusterReceptionistSettings { * client will be stopped after this time of inactivity. */ final class ClusterReceptionistSettings( - val role: Option[String], - val numberOfContacts: Int, + val role: Option[String], + val numberOfContacts: Int, val responseTunnelReceiveTimeout: FiniteDuration) extends NoSerializationVerificationNeeded { def withRole(role: String): ClusterReceptionistSettings = copy(role = ClusterReceptionistSettings.roleOption(role)) @@ -644,7 +644,7 @@ final class ClusterReceptionistSettings( copy(responseTunnelReceiveTimeout = responseTunnelReceiveTimeout) def withHeartbeat( - heartbeatInterval: FiniteDuration, + heartbeatInterval: FiniteDuration, acceptableHeartbeatPause: FiniteDuration, failureDetectionInterval: FiniteDuration): ClusterReceptionistSettings = copy( @@ -671,12 +671,12 @@ final class ClusterReceptionistSettings( private var _failureDetectionInterval: FiniteDuration = 2.second def this( - role: Option[String], - numberOfContacts: Int, + role: Option[String], + numberOfContacts: Int, responseTunnelReceiveTimeout: FiniteDuration, - heartbeatInterval: FiniteDuration, - acceptableHeartbeatPause: FiniteDuration, - failureDetectionInterval: FiniteDuration) = { + heartbeatInterval: FiniteDuration, + acceptableHeartbeatPause: FiniteDuration, + failureDetectionInterval: FiniteDuration) = { this(role, numberOfContacts, responseTunnelReceiveTimeout) this._heartbeatInterval = heartbeatInterval this._acceptableHeartbeatPause = acceptableHeartbeatPause @@ -686,12 +686,12 @@ final class ClusterReceptionistSettings( // END BINARY COMPATIBILITY private def copy( - role: Option[String] = role, - numberOfContacts: Int = numberOfContacts, + role: Option[String] = role, + numberOfContacts: Int = numberOfContacts, responseTunnelReceiveTimeout: FiniteDuration = responseTunnelReceiveTimeout, - heartbeatInterval: FiniteDuration = heartbeatInterval, - acceptableHeartbeatPause: FiniteDuration = acceptableHeartbeatPause, - failureDetectionInterval: FiniteDuration = failureDetectionInterval): ClusterReceptionistSettings = + heartbeatInterval: FiniteDuration = heartbeatInterval, + acceptableHeartbeatPause: FiniteDuration = acceptableHeartbeatPause, + failureDetectionInterval: FiniteDuration = failureDetectionInterval): ClusterReceptionistSettings = new ClusterReceptionistSettings( role, numberOfContacts, @@ -787,7 +787,7 @@ object ClusterReceptionist { */ def props( pubSubMediator: ActorRef, - settings: ClusterReceptionistSettings): Props = + settings: ClusterReceptionistSettings): Props = Props(new ClusterReceptionist(pubSubMediator, settings)).withDeploy(Deploy.local) /** @@ -858,7 +858,8 @@ final class ClusterReceptionist(pubSubMediator: ActorRef, settings: ClusterRecep val verboseHeartbeat = cluster.settings.Debug.VerboseHeartbeatLogging import cluster.selfAddress - require(role.forall(cluster.selfRoles.contains), + require( + role.forall(cluster.selfRoles.contains), s"This cluster member [$selfAddress] doesn't have the role [$role]") var nodes: immutable.SortedSet[Address] = { @@ -999,7 +1000,7 @@ final class ClusterReceptionist(pubSubMediator: ActorRef, settings: ClusterRecep case None ⇒ val failureDetector = new DeadlineFailureDetector(acceptableHeartbeatPause, heartbeatInterval) failureDetector.heartbeat() - clientInteractions = clientInteractions + (client -> failureDetector) + clientInteractions = clientInteractions + (client → failureDetector) log.debug("Received new contact from [{}]", client.path) val clusterClientUp = ClusterClientUp(client) subscribers.foreach(_ ! clusterClientUp) diff --git a/akka-cluster-tools/src/main/scala/akka/cluster/client/protobuf/ClusterClientMessageSerializer.scala b/akka-cluster-tools/src/main/scala/akka/cluster/client/protobuf/ClusterClientMessageSerializer.scala index ce9e743f24..1a2f2bb5ab 100644 --- a/akka-cluster-tools/src/main/scala/akka/cluster/client/protobuf/ClusterClientMessageSerializer.scala +++ b/akka-cluster-tools/src/main/scala/akka/cluster/client/protobuf/ClusterClientMessageSerializer.scala @@ -28,10 +28,10 @@ private[akka] class ClusterClientMessageSerializer(val system: ExtendedActorSyst private val emptyByteArray = Array.empty[Byte] private val fromBinaryMap = collection.immutable.HashMap[String, Array[Byte] ⇒ AnyRef]( - ContactsManifest -> contactsFromBinary, - GetContactsManifest -> { _ ⇒ GetContacts }, - HeartbeatManifest -> { _ ⇒ Heartbeat }, - HeartbeatRspManifest -> { _ ⇒ HeartbeatRsp }) + ContactsManifest → contactsFromBinary, + GetContactsManifest → { _ ⇒ GetContacts }, + HeartbeatManifest → { _ ⇒ Heartbeat }, + HeartbeatRspManifest → { _ ⇒ HeartbeatRsp }) override def manifest(obj: AnyRef): String = obj match { case _: Contacts ⇒ ContactsManifest diff --git a/akka-cluster-tools/src/main/scala/akka/cluster/pubsub/DistributedPubSubMediator.scala b/akka-cluster-tools/src/main/scala/akka/cluster/pubsub/DistributedPubSubMediator.scala index a56c5cef8d..9689a4206d 100644 --- a/akka-cluster-tools/src/main/scala/akka/cluster/pubsub/DistributedPubSubMediator.scala +++ b/akka-cluster-tools/src/main/scala/akka/cluster/pubsub/DistributedPubSubMediator.scala @@ -83,13 +83,14 @@ object DistributedPubSubSettings { * the registries. Next chunk will be transferred in next round of gossip. */ final class DistributedPubSubSettings( - val role: Option[String], - val routingLogic: RoutingLogic, - val gossipInterval: FiniteDuration, + val role: Option[String], + val routingLogic: RoutingLogic, + val gossipInterval: FiniteDuration, val removedTimeToLive: FiniteDuration, - val maxDeltaElements: Int) extends NoSerializationVerificationNeeded { + val maxDeltaElements: Int) extends NoSerializationVerificationNeeded { - require(!routingLogic.isInstanceOf[ConsistentHashingRoutingLogic], + require( + !routingLogic.isInstanceOf[ConsistentHashingRoutingLogic], "'ConsistentHashingRoutingLogic' can't be used by the pub-sub mediator") def withRole(role: String): DistributedPubSubSettings = copy(role = DistributedPubSubSettings.roleOption(role)) @@ -108,11 +109,12 @@ final class DistributedPubSubSettings( def withMaxDeltaElements(maxDeltaElements: Int): DistributedPubSubSettings = copy(maxDeltaElements = maxDeltaElements) - private def copy(role: Option[String] = role, - routingLogic: RoutingLogic = routingLogic, - gossipInterval: FiniteDuration = gossipInterval, - removedTimeToLive: FiniteDuration = removedTimeToLive, - maxDeltaElements: Int = maxDeltaElements): DistributedPubSubSettings = + private def copy( + role: Option[String] = role, + routingLogic: RoutingLogic = routingLogic, + gossipInterval: FiniteDuration = gossipInterval, + removedTimeToLive: FiniteDuration = removedTimeToLive, + maxDeltaElements: Int = maxDeltaElements): DistributedPubSubSettings = new DistributedPubSubSettings(role, routingLogic, gossipInterval, removedTimeToLive, maxDeltaElements) } @@ -209,7 +211,7 @@ object DistributedPubSubMediator { @SerialVersionUID(1L) final case class Bucket( - owner: Address, + owner: Address, version: Long, content: TreeMap[String, ValueHolder]) @@ -477,13 +479,15 @@ class DistributedPubSubMediator(settings: DistributedPubSubSettings) extends Act import DistributedPubSubMediator.Internal._ import settings._ - require(!routingLogic.isInstanceOf[ConsistentHashingRoutingLogic], + require( + !routingLogic.isInstanceOf[ConsistentHashingRoutingLogic], "'consistent-hashing' routing logic can't be used by the pub-sub mediator") val cluster = Cluster(context.system) import cluster.selfAddress - require(role.forall(cluster.selfRoles.contains), + require( + role.forall(cluster.selfRoles.contains), s"This cluster member [${selfAddress}] doesn't have the role [$role]") val removedTimeToLiveMillis = removedTimeToLive.toMillis @@ -629,7 +633,7 @@ class DistributedPubSubMediator(settings: DistributedPubSubSettings) extends Act if (nodes(b.owner)) { val myBucket = registry(b.owner) if (b.version > myBucket.version) { - registry += (b.owner -> myBucket.copy(version = b.version, content = myBucket.content ++ b.content)) + registry += (b.owner → myBucket.copy(version = b.version, content = myBucket.content ++ b.content)) } } } @@ -719,8 +723,9 @@ class DistributedPubSubMediator(settings: DistributedPubSubSettings) extends Act def put(key: String, valueOption: Option[ActorRef]): Unit = { val bucket = registry(selfAddress) val v = nextVersion() - registry += (selfAddress -> bucket.copy(version = v, - content = bucket.content + (key -> ValueHolder(v, valueOption)))) + registry += (selfAddress → bucket.copy( + version = v, + content = bucket.content + (key → ValueHolder(v, valueOption)))) } def getCurrentTopics(): Set[String] = { @@ -743,11 +748,11 @@ class DistributedPubSubMediator(settings: DistributedPubSubSettings) extends Act def mkKey(path: ActorPath): String = Internal.mkKey(path) - def myVersions: Map[Address, Long] = registry.map { case (owner, bucket) ⇒ (owner -> bucket.version) } + def myVersions: Map[Address, Long] = registry.map { case (owner, bucket) ⇒ (owner → bucket.version) } def collectDelta(otherVersions: Map[Address, Long]): immutable.Iterable[Bucket] = { // missing entries are represented by version 0 - val filledOtherVersions = myVersions.map { case (k, _) ⇒ k -> 0L } ++ otherVersions + val filledOtherVersions = myVersions.map { case (k, _) ⇒ k → 0L } ++ otherVersions var count = 0 filledOtherVersions.collect { case (owner, v) if registry(owner).version > v && count < maxDeltaElements ⇒ @@ -791,7 +796,7 @@ class DistributedPubSubMediator(settings: DistributedPubSubSettings) extends Act case (key, ValueHolder(version, None)) if (bucket.version - version > removedTimeToLiveMillis) ⇒ key } if (oldRemoved.nonEmpty) - registry += owner -> bucket.copy(content = bucket.content -- oldRemoved) + registry += owner → bucket.copy(content = bucket.content -- oldRemoved) } } diff --git a/akka-cluster-tools/src/main/scala/akka/cluster/pubsub/PerGroupingBuffer.scala b/akka-cluster-tools/src/main/scala/akka/cluster/pubsub/PerGroupingBuffer.scala index 43efd6caf0..41237ea674 100644 --- a/akka-cluster-tools/src/main/scala/akka/cluster/pubsub/PerGroupingBuffer.scala +++ b/akka-cluster-tools/src/main/scala/akka/cluster/pubsub/PerGroupingBuffer.scala @@ -44,5 +44,5 @@ private[pubsub] trait PerGroupingBuffer { } } - def initializeGrouping(grouping: String): Unit = buffers += grouping -> Vector.empty + def initializeGrouping(grouping: String): Unit = buffers += grouping → Vector.empty } diff --git a/akka-cluster-tools/src/main/scala/akka/cluster/pubsub/protobuf/DistributedPubSubMessageSerializer.scala b/akka-cluster-tools/src/main/scala/akka/cluster/pubsub/protobuf/DistributedPubSubMessageSerializer.scala index 9bfd99a166..6060746193 100644 --- a/akka-cluster-tools/src/main/scala/akka/cluster/pubsub/protobuf/DistributedPubSubMessageSerializer.scala +++ b/akka-cluster-tools/src/main/scala/akka/cluster/pubsub/protobuf/DistributedPubSubMessageSerializer.scala @@ -39,11 +39,11 @@ private[akka] class DistributedPubSubMessageSerializer(val system: ExtendedActor private val PublishManifest = "E" private val fromBinaryMap = collection.immutable.HashMap[String, Array[Byte] ⇒ AnyRef]( - StatusManifest -> statusFromBinary, - DeltaManifest -> deltaFromBinary, - SendManifest -> sendFromBinary, - SendToAllManifest -> sendToAllFromBinary, - PublishManifest -> publishFromBinary) + StatusManifest → statusFromBinary, + DeltaManifest → deltaFromBinary, + SendManifest → sendFromBinary, + SendToAllManifest → sendToAllFromBinary, + PublishManifest → publishFromBinary) override def manifest(obj: AnyRef): String = obj match { case _: Status ⇒ StatusManifest @@ -122,7 +122,7 @@ private[akka] class DistributedPubSubMessageSerializer(val system: ExtendedActor private def statusFromProto(status: dm.Status): Status = Status(status.getVersionsList.asScala.map(v ⇒ - addressFromProto(v.getAddress) -> v.getTimestamp)(breakOut)) + addressFromProto(v.getAddress) → v.getTimestamp)(breakOut)) private def deltaToProto(delta: Delta): dm.Delta = { val buckets = delta.buckets.map { b ⇒ @@ -148,7 +148,7 @@ private[akka] class DistributedPubSubMessageSerializer(val system: ExtendedActor private def deltaFromProto(delta: dm.Delta): Delta = Delta(delta.getBucketsList.asScala.toVector.map { b ⇒ val content: TreeMap[String, ValueHolder] = b.getContentList.asScala.map { entry ⇒ - entry.getKey -> ValueHolder(entry.getVersion, if (entry.hasRef) Some(resolveActorRef(entry.getRef)) else None) + entry.getKey → ValueHolder(entry.getVersion, if (entry.hasRef) Some(resolveActorRef(entry.getRef)) else None) }(breakOut) Bucket(addressFromProto(b.getOwner), b.getVersion, content) }) diff --git a/akka-cluster-tools/src/main/scala/akka/cluster/singleton/ClusterSingletonManager.scala b/akka-cluster-tools/src/main/scala/akka/cluster/singleton/ClusterSingletonManager.scala index 975c79083d..0383f294c3 100644 --- a/akka-cluster-tools/src/main/scala/akka/cluster/singleton/ClusterSingletonManager.scala +++ b/akka-cluster-tools/src/main/scala/akka/cluster/singleton/ClusterSingletonManager.scala @@ -86,9 +86,9 @@ object ClusterSingletonManagerSettings { * (+ `removalMargin`). */ final class ClusterSingletonManagerSettings( - val singletonName: String, - val role: Option[String], - val removalMargin: FiniteDuration, + val singletonName: String, + val role: Option[String], + val removalMargin: FiniteDuration, val handOverRetryInterval: FiniteDuration) extends NoSerializationVerificationNeeded { def withSingletonName(name: String): ClusterSingletonManagerSettings = copy(singletonName = name) @@ -103,10 +103,11 @@ final class ClusterSingletonManagerSettings( def withHandOverRetryInterval(retryInterval: FiniteDuration): ClusterSingletonManagerSettings = copy(handOverRetryInterval = retryInterval) - private def copy(singletonName: String = singletonName, - role: Option[String] = role, - removalMargin: FiniteDuration = removalMargin, - handOverRetryInterval: FiniteDuration = handOverRetryInterval): ClusterSingletonManagerSettings = + private def copy( + singletonName: String = singletonName, + role: Option[String] = role, + removalMargin: FiniteDuration = removalMargin, + handOverRetryInterval: FiniteDuration = handOverRetryInterval): ClusterSingletonManagerSettings = new ClusterSingletonManagerSettings(singletonName, role, removalMargin, handOverRetryInterval) } @@ -121,9 +122,9 @@ object ClusterSingletonManager { * Scala API: Factory method for `ClusterSingletonManager` [[akka.actor.Props]]. */ def props( - singletonProps: Props, + singletonProps: Props, terminationMessage: Any, - settings: ClusterSingletonManagerSettings): Props = + settings: ClusterSingletonManagerSettings): Props = Props(new ClusterSingletonManager(singletonProps, terminationMessage, settings)).withDeploy(Deploy.local) /** @@ -364,20 +365,22 @@ class ClusterSingletonManagerIsStuck(message: String) extends AkkaException(mess * @param settings see [[ClusterSingletonManagerSettings]] */ class ClusterSingletonManager( - singletonProps: Props, + singletonProps: Props, terminationMessage: Any, - settings: ClusterSingletonManagerSettings) + settings: ClusterSingletonManagerSettings) extends Actor with FSM[ClusterSingletonManager.State, ClusterSingletonManager.Data] { import ClusterSingletonManager.Internal._ import ClusterSingletonManager.Internal.OldestChangedBuffer._ import settings._ + import FSM.`→` val cluster = Cluster(context.system) val selfAddressOption = Some(cluster.selfAddress) import cluster.settings.LogInfo - require(role.forall(cluster.selfRoles.contains), + require( + role.forall(cluster.selfRoles.contains), s"This cluster member [${cluster.selfAddress}] doesn't have the role [$role]") val removalMargin = @@ -406,7 +409,7 @@ class ClusterSingletonManager( var removed = Map.empty[Address, Deadline] def addRemoved(address: Address): Unit = - removed += address -> (Deadline.now + 15.minutes) + removed += address → (Deadline.now + 15.minutes) def cleanupOverdueNotMemberAnyMore(): Unit = { removed = removed filter { case (address, deadline) ⇒ deadline.hasTimeLeft } @@ -514,7 +517,8 @@ class ClusterSingletonManager( if (sender().path.address == previousOldest) gotoOldest() else { - logInfo("Ignoring HandOverDone in BecomingOldest from [{}]. Expected previous oldest [{}]", + logInfo( + "Ignoring HandOverDone in BecomingOldest from [{}]. Expected previous oldest [{}]", sender().path.address, previousOldest) stay } @@ -538,7 +542,8 @@ class ClusterSingletonManager( case Event(TakeOverFromMe, BecomingOldestData(Some(previousOldest))) ⇒ if (previousOldest == sender().path.address) sender() ! HandOverToMe - else logInfo("Ignoring TakeOver request in BecomingOldest from [{}]. Expected previous oldest [{}]", + else logInfo( + "Ignoring TakeOver request in BecomingOldest from [{}]. Expected previous oldest [{}]", sender().path.address, previousOldest) stay @@ -698,24 +703,24 @@ class ClusterSingletonManager( } onTransition { - case from -> to ⇒ logInfo("ClusterSingletonManager state change [{} -> {}]", from, to) + case from → to ⇒ logInfo("ClusterSingletonManager state change [{} -> {}]", from, to) } onTransition { - case _ -> BecomingOldest ⇒ setTimer(HandOverRetryTimer, HandOverRetry(1), handOverRetryInterval, repeat = false) + case _ → BecomingOldest ⇒ setTimer(HandOverRetryTimer, HandOverRetry(1), handOverRetryInterval, repeat = false) } onTransition { - case BecomingOldest -> _ ⇒ cancelTimer(HandOverRetryTimer) - case WasOldest -> _ ⇒ cancelTimer(TakeOverRetryTimer) + case BecomingOldest → _ ⇒ cancelTimer(HandOverRetryTimer) + case WasOldest → _ ⇒ cancelTimer(TakeOverRetryTimer) } onTransition { - case _ -> (Younger | Oldest) ⇒ getNextOldestChanged() + case _ → (Younger | Oldest) ⇒ getNextOldestChanged() } onTransition { - case _ -> (Younger | End) if removed.contains(cluster.selfAddress) ⇒ + case _ → (Younger | End) if removed.contains(cluster.selfAddress) ⇒ logInfo("Self removed, stopping ClusterSingletonManager") // note that FSM.stop() can't be used in onTransition context.stop(self) diff --git a/akka-cluster-tools/src/main/scala/akka/cluster/singleton/ClusterSingletonProxy.scala b/akka-cluster-tools/src/main/scala/akka/cluster/singleton/ClusterSingletonProxy.scala index 8cd8599ebd..73a10983a0 100644 --- a/akka-cluster-tools/src/main/scala/akka/cluster/singleton/ClusterSingletonProxy.scala +++ b/akka-cluster-tools/src/main/scala/akka/cluster/singleton/ClusterSingletonProxy.scala @@ -69,10 +69,10 @@ object ClusterSingletonProxySettings { * immediately if the location of the singleton is unknown. */ final class ClusterSingletonProxySettings( - val singletonName: String, - val role: Option[String], + val singletonName: String, + val role: Option[String], val singletonIdentificationInterval: FiniteDuration, - val bufferSize: Int) extends NoSerializationVerificationNeeded { + val bufferSize: Int) extends NoSerializationVerificationNeeded { require(bufferSize >= 0 && bufferSize <= 10000, "bufferSize must be >= 0 and <= 10000") @@ -88,10 +88,11 @@ final class ClusterSingletonProxySettings( def withBufferSize(bufferSize: Int): ClusterSingletonProxySettings = copy(bufferSize = bufferSize) - private def copy(singletonName: String = singletonName, - role: Option[String] = role, - singletonIdentificationInterval: FiniteDuration = singletonIdentificationInterval, - bufferSize: Int = bufferSize): ClusterSingletonProxySettings = + private def copy( + singletonName: String = singletonName, + role: Option[String] = role, + singletonIdentificationInterval: FiniteDuration = singletonIdentificationInterval, + bufferSize: Int = bufferSize): ClusterSingletonProxySettings = new ClusterSingletonProxySettings(singletonName, role, singletonIdentificationInterval, bufferSize) } @@ -252,7 +253,8 @@ final class ClusterSingletonProxy(singletonManagerPath: String, settings: Cluste singleton match { case Some(s) ⇒ if (log.isDebugEnabled) - log.debug("Forwarding message of type [{}] to current singleton instance at [{}]: {}", + log.debug( + "Forwarding message of type [{}] to current singleton instance at [{}]: {}", Logging.simpleName(msg.getClass.getName), s.path) s forward msg case None ⇒ diff --git a/akka-cluster-tools/src/main/scala/akka/cluster/singleton/protobuf/ClusterSingletonMessageSerializer.scala b/akka-cluster-tools/src/main/scala/akka/cluster/singleton/protobuf/ClusterSingletonMessageSerializer.scala index 7a9ae66cb7..00e1233b75 100644 --- a/akka-cluster-tools/src/main/scala/akka/cluster/singleton/protobuf/ClusterSingletonMessageSerializer.scala +++ b/akka-cluster-tools/src/main/scala/akka/cluster/singleton/protobuf/ClusterSingletonMessageSerializer.scala @@ -30,10 +30,10 @@ private[akka] class ClusterSingletonMessageSerializer(val system: ExtendedActorS private val emptyByteArray = Array.empty[Byte] private val fromBinaryMap = collection.immutable.HashMap[String, Array[Byte] ⇒ AnyRef]( - HandOverToMeManifest -> { _ ⇒ HandOverToMe }, - HandOverInProgressManifest -> { _ ⇒ HandOverInProgress }, - HandOverDoneManifest -> { _ ⇒ HandOverDone }, - TakeOverFromMeManifest -> { _ ⇒ TakeOverFromMe }) + HandOverToMeManifest → { _ ⇒ HandOverToMe }, + HandOverInProgressManifest → { _ ⇒ HandOverInProgress }, + HandOverDoneManifest → { _ ⇒ HandOverDone }, + TakeOverFromMeManifest → { _ ⇒ TakeOverFromMe }) override def manifest(obj: AnyRef): String = obj match { case HandOverToMe ⇒ HandOverToMeManifest diff --git a/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/client/ClusterClientSpec.scala b/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/client/ClusterClientSpec.scala index 89c7554ead..f55cf493ee 100644 --- a/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/client/ClusterClientSpec.scala +++ b/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/client/ClusterClientSpec.scala @@ -430,7 +430,8 @@ class ClusterClientSpec extends MultiNodeSpec(ClusterClientSpec) with STMultiNod runOn(remainingServerRoleNames.toSeq: _*) { Await.ready(system.whenTerminated, 20.seconds) // start new system on same port - val sys2 = ActorSystem(system.name, + val sys2 = ActorSystem( + system.name, ConfigFactory.parseString("akka.remote.netty.tcp.port=" + Cluster(system).selfAddress.port.get) .withFallback(system.settings.config)) Cluster(sys2).join(Cluster(sys2).selfAddress) diff --git a/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/pubsub/DistributedPubSubMediatorSpec.scala b/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/pubsub/DistributedPubSubMediatorSpec.scala index 3feca95d2f..09a761863b 100644 --- a/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/pubsub/DistributedPubSubMediatorSpec.scala +++ b/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/pubsub/DistributedPubSubMediatorSpec.scala @@ -146,7 +146,7 @@ class DistributedPubSubMediatorSpec extends MultiNodeSpec(DistributedPubSubMedia def createChatUser(name: String): ActorRef = { var a = system.actorOf(Props(classOf[TestChatUser], mediator, testActor), name) - chatUsers += (name -> a) + chatUsers += (name → a) a } @@ -473,11 +473,11 @@ class DistributedPubSubMediatorSpec extends MultiNodeSpec(DistributedPubSubMedia val deltaBuckets1 = expectMsgType[Delta].buckets deltaBuckets1.map(_.content.size).sum should ===(500) - mediator ! Status(versions = deltaBuckets1.map(b ⇒ b.owner -> b.version).toMap) + mediator ! Status(versions = deltaBuckets1.map(b ⇒ b.owner → b.version).toMap) val deltaBuckets2 = expectMsgType[Delta].buckets deltaBuckets1.map(_.content.size).sum should ===(500) - mediator ! Status(versions = deltaBuckets2.map(b ⇒ b.owner -> b.version).toMap) + mediator ! Status(versions = deltaBuckets2.map(b ⇒ b.owner → b.version).toMap) val deltaBuckets3 = expectMsgType[Delta].buckets deltaBuckets3.map(_.content.size).sum should ===(10 + 9 + 2 + many - 500 - 500) diff --git a/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerChaosSpec.scala b/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerChaosSpec.scala index ec6889c482..c3fd74b90a 100644 --- a/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerChaosSpec.scala +++ b/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerChaosSpec.scala @@ -77,10 +77,11 @@ class ClusterSingletonManagerChaosSpec extends MultiNodeSpec(ClusterSingletonMan } def createSingleton(): ActorRef = { - system.actorOf(ClusterSingletonManager.props( - singletonProps = Props(classOf[Echo], testActor), - terminationMessage = PoisonPill, - settings = ClusterSingletonManagerSettings(system)), + system.actorOf( + ClusterSingletonManager.props( + singletonProps = Props(classOf[Echo], testActor), + terminationMessage = PoisonPill, + settings = ClusterSingletonManagerSettings(system)), name = "echo") } diff --git a/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerLeaveSpec.scala b/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerLeaveSpec.scala index 7ed25e9308..71652eee0f 100644 --- a/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerLeaveSpec.scala +++ b/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerLeaveSpec.scala @@ -75,17 +75,19 @@ class ClusterSingletonManagerLeaveSpec extends MultiNodeSpec(ClusterSingletonMan } def createSingleton(): ActorRef = { - system.actorOf(ClusterSingletonManager.props( - singletonProps = Props(classOf[Echo], testActor), - terminationMessage = PoisonPill, - settings = ClusterSingletonManagerSettings(system)), + system.actorOf( + ClusterSingletonManager.props( + singletonProps = Props(classOf[Echo], testActor), + terminationMessage = PoisonPill, + settings = ClusterSingletonManagerSettings(system)), name = "echo") } lazy val echoProxy: ActorRef = { - system.actorOf(ClusterSingletonProxy.props( - singletonManagerPath = "/user/echo", - settings = ClusterSingletonProxySettings(system)), + system.actorOf( + ClusterSingletonProxy.props( + singletonManagerPath = "/user/echo", + settings = ClusterSingletonProxySettings(system)), name = "echoProxy") } diff --git a/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerSpec.scala b/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerSpec.scala index 4085b6b96b..fe5ceab877 100644 --- a/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerSpec.scala +++ b/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerSpec.scala @@ -211,19 +211,21 @@ class ClusterSingletonManagerSpec extends MultiNodeSpec(ClusterSingletonManagerS def createSingleton(): ActorRef = { //#create-singleton-manager - system.actorOf(ClusterSingletonManager.props( - singletonProps = Props(classOf[Consumer], queue, testActor), - terminationMessage = End, - settings = ClusterSingletonManagerSettings(system).withRole("worker")), + system.actorOf( + ClusterSingletonManager.props( + singletonProps = Props(classOf[Consumer], queue, testActor), + terminationMessage = End, + settings = ClusterSingletonManagerSettings(system).withRole("worker")), name = "consumer") //#create-singleton-manager } def createSingletonProxy(): ActorRef = { //#create-singleton-proxy - system.actorOf(ClusterSingletonProxy.props( - singletonManagerPath = "/user/consumer", - settings = ClusterSingletonProxySettings(system).withRole("worker")), + system.actorOf( + ClusterSingletonProxy.props( + singletonManagerPath = "/user/consumer", + settings = ClusterSingletonProxySettings(system).withRole("worker")), name = "consumerProxy") //#create-singleton-proxy } diff --git a/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerStartupSpec.scala b/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerStartupSpec.scala index 4c9baf948f..0b0b42b7a8 100644 --- a/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerStartupSpec.scala +++ b/akka-cluster-tools/src/multi-jvm/scala/akka/cluster/singleton/ClusterSingletonManagerStartupSpec.scala @@ -69,17 +69,19 @@ class ClusterSingletonManagerStartupSpec extends MultiNodeSpec(ClusterSingletonM } def createSingleton(): ActorRef = { - system.actorOf(ClusterSingletonManager.props( - singletonProps = Props(classOf[Echo], testActor), - terminationMessage = PoisonPill, - settings = ClusterSingletonManagerSettings(system)), + system.actorOf( + ClusterSingletonManager.props( + singletonProps = Props(classOf[Echo], testActor), + terminationMessage = PoisonPill, + settings = ClusterSingletonManagerSettings(system)), name = "echo") } lazy val echoProxy: ActorRef = { - system.actorOf(ClusterSingletonProxy.props( - singletonManagerPath = "/user/echo", - settings = ClusterSingletonProxySettings(system)), + system.actorOf( + ClusterSingletonProxy.props( + singletonManagerPath = "/user/echo", + settings = ClusterSingletonProxySettings(system)), name = "echoProxy") } diff --git a/akka-cluster-tools/src/test/scala/akka/cluster/pubsub/protobuf/DistributedPubSubMessageSerializerSpec.scala b/akka-cluster-tools/src/test/scala/akka/cluster/pubsub/protobuf/DistributedPubSubMessageSerializerSpec.scala index f05f5cabf6..ad21d3779c 100644 --- a/akka-cluster-tools/src/test/scala/akka/cluster/pubsub/protobuf/DistributedPubSubMessageSerializerSpec.scala +++ b/akka-cluster-tools/src/test/scala/akka/cluster/pubsub/protobuf/DistributedPubSubMessageSerializerSpec.scala @@ -30,11 +30,11 @@ class DistributedPubSubMessageSerializerSpec extends AkkaSpec { val u2 = system.actorOf(Props.empty, "u2") val u3 = system.actorOf(Props.empty, "u3") val u4 = system.actorOf(Props.empty, "u4") - checkSerialization(Status(Map(address1 -> 3, address2 -> 17, address3 -> 5))) + checkSerialization(Status(Map(address1 → 3, address2 → 17, address3 → 5))) checkSerialization(Delta(List( - Bucket(address1, 3, TreeMap("/user/u1" -> ValueHolder(2, Some(u1)), "/user/u2" -> ValueHolder(3, Some(u2)))), - Bucket(address2, 17, TreeMap("/user/u3" -> ValueHolder(17, Some(u3)))), - Bucket(address3, 5, TreeMap("/user/u4" -> ValueHolder(4, Some(u4)), "/user/u5" -> ValueHolder(5, None)))))) + Bucket(address1, 3, TreeMap("/user/u1" → ValueHolder(2, Some(u1)), "/user/u2" → ValueHolder(3, Some(u2)))), + Bucket(address2, 17, TreeMap("/user/u3" → ValueHolder(17, Some(u3)))), + Bucket(address3, 5, TreeMap("/user/u4" → ValueHolder(4, Some(u4)), "/user/u5" → ValueHolder(5, None)))))) checkSerialization(Send("/user/u3", "hello", localAffinity = true)) checkSerialization(SendToAll("/user/u3", "hello", allButSelf = true)) checkSerialization(Publish("mytopic", "hello")) diff --git a/akka-cluster-tools/src/test/scala/akka/cluster/singleton/ClusterSingletonProxySpec.scala b/akka-cluster-tools/src/test/scala/akka/cluster/singleton/ClusterSingletonProxySpec.scala index 0f75307ba0..005f7b608d 100644 --- a/akka-cluster-tools/src/test/scala/akka/cluster/singleton/ClusterSingletonProxySpec.scala +++ b/akka-cluster-tools/src/test/scala/akka/cluster/singleton/ClusterSingletonProxySpec.scala @@ -38,14 +38,16 @@ object ClusterSingletonProxySpec { joinTo.foreach(address ⇒ cluster.join(address)) cluster.registerOnMemberUp { - system.actorOf(ClusterSingletonManager.props( - singletonProps = Props[Singleton], - terminationMessage = PoisonPill, - settings = ClusterSingletonManagerSettings(system).withRemovalMargin(5.seconds)), + system.actorOf( + ClusterSingletonManager.props( + singletonProps = Props[Singleton], + terminationMessage = PoisonPill, + settings = ClusterSingletonManagerSettings(system).withRemovalMargin(5.seconds)), name = "singletonManager") } - val proxy = system.actorOf(ClusterSingletonProxy.props("user/singletonManager", + val proxy = system.actorOf(ClusterSingletonProxy.props( + "user/singletonManager", settings = ClusterSingletonProxySettings(system)), s"singletonProxy-${cluster.selfAddress.port.getOrElse(0)}") def testProxy(msg: String) { diff --git a/akka-cluster/src/main/scala/akka/cluster/AutoDown.scala b/akka-cluster/src/main/scala/akka/cluster/AutoDown.scala index b06b4bfc14..6274ae8d3a 100644 --- a/akka-cluster/src/main/scala/akka/cluster/AutoDown.scala +++ b/akka-cluster/src/main/scala/akka/cluster/AutoDown.scala @@ -142,7 +142,7 @@ private[cluster] abstract class AutoDownBase(autoDownUnreachableAfter: FiniteDur downOrAddPending(node) } else { val task = scheduler.scheduleOnce(autoDownUnreachableAfter, self, UnreachableTimeout(node)) - scheduledUnreachable += (node -> task) + scheduledUnreachable += (node → task) } } diff --git a/akka-cluster/src/main/scala/akka/cluster/Cluster.scala b/akka-cluster/src/main/scala/akka/cluster/Cluster.scala index 013ce73485..d8ec2cd930 100644 --- a/akka-cluster/src/main/scala/akka/cluster/Cluster.scala +++ b/akka-cluster/src/main/scala/akka/cluster/Cluster.scala @@ -115,8 +115,9 @@ class Cluster(val system: ExtendedActorSystem) extends Extension { */ private[cluster] val scheduler: Scheduler = { if (system.scheduler.maxFrequency < 1.second / SchedulerTickDuration) { - logInfo("Using a dedicated scheduler for cluster. Default scheduler can be used if configured " + - "with 'akka.scheduler.tick-duration' [{} ms] <= 'akka.cluster.scheduler.tick-duration' [{} ms].", + logInfo( + "Using a dedicated scheduler for cluster. Default scheduler can be used if configured " + + "with 'akka.scheduler.tick-duration' [{} ms] <= 'akka.cluster.scheduler.tick-duration' [{} ms].", (1000 / system.scheduler.maxFrequency).toInt, SchedulerTickDuration.toMillis) val cfg = ConfigFactory.parseString( @@ -127,9 +128,9 @@ class Cluster(val system: ExtendedActorSystem) extends Extension { case tf ⇒ tf } system.dynamicAccess.createInstanceFor[Scheduler](system.settings.SchedulerClass, immutable.Seq( - classOf[Config] -> cfg, - classOf[LoggingAdapter] -> log, - classOf[ThreadFactory] -> threadFactory)).get + classOf[Config] → cfg, + classOf[LoggingAdapter] → log, + classOf[ThreadFactory] → threadFactory)).get } else { // delegate to system.scheduler, but don't close over system val systemScheduler = system.scheduler @@ -142,8 +143,9 @@ class Cluster(val system: ExtendedActorSystem) extends Extension { runnable: Runnable)(implicit executor: ExecutionContext): Cancellable = systemScheduler.schedule(initialDelay, interval, runnable) - override def scheduleOnce(delay: FiniteDuration, - runnable: Runnable)(implicit executor: ExecutionContext): Cancellable = + override def scheduleOnce( + delay: FiniteDuration, + runnable: Runnable)(implicit executor: ExecutionContext): Cancellable = systemScheduler.scheduleOnce(delay, runnable) } } @@ -228,7 +230,8 @@ class Cluster(val system: ExtendedActorSystem) extends Extension { */ @varargs def subscribe(subscriber: ActorRef, initialStateMode: SubscriptionInitialStateMode, to: Class[_]*): Unit = { require(to.length > 0, "at least one `ClusterDomainEvent` class is required") - require(to.forall(classOf[ClusterDomainEvent].isAssignableFrom), + require( + to.forall(classOf[ClusterDomainEvent].isAssignableFrom), s"subscribe to `akka.cluster.ClusterEvent.ClusterDomainEvent` or subclasses, was [${to.map(_.getName).mkString(", ")}]") clusterCore ! InternalClusterAction.Subscribe(subscriber, initialStateMode, to.toSet) } diff --git a/akka-cluster/src/main/scala/akka/cluster/ClusterActorRefProvider.scala b/akka-cluster/src/main/scala/akka/cluster/ClusterActorRefProvider.scala index b621cfcc46..382edd62bb 100644 --- a/akka-cluster/src/main/scala/akka/cluster/ClusterActorRefProvider.scala +++ b/akka-cluster/src/main/scala/akka/cluster/ClusterActorRefProvider.scala @@ -21,9 +21,9 @@ import com.typesafe.config.ConfigFactory * the `ClusterActorRefProvider` is used. */ private[akka] class ClusterActorRefProvider( - _systemName: String, - _settings: ActorSystem.Settings, - _eventStream: EventStream, + _systemName: String, + _settings: ActorSystem.Settings, + _eventStream: EventStream, _dynamicAccess: DynamicAccess) extends RemoteActorRefProvider( _systemName, _settings, _eventStream, _dynamicAccess) { diff --git a/akka-cluster/src/main/scala/akka/cluster/ClusterDaemon.scala b/akka-cluster/src/main/scala/akka/cluster/ClusterDaemon.scala index f9320ba74f..d8c613114a 100644 --- a/akka-cluster/src/main/scala/akka/cluster/ClusterDaemon.scala +++ b/akka-cluster/src/main/scala/akka/cluster/ClusterDaemon.scala @@ -274,15 +274,18 @@ private[cluster] class ClusterCoreDaemon(publisher: ActorRef) extends Actor with import context.dispatcher // start periodic gossip to random nodes in cluster - val gossipTask = scheduler.schedule(PeriodicTasksInitialDelay.max(GossipInterval), + val gossipTask = scheduler.schedule( + PeriodicTasksInitialDelay.max(GossipInterval), GossipInterval, self, GossipTick) // start periodic cluster failure detector reaping (moving nodes condemned by the failure detector to unreachable list) - val failureDetectorReaperTask = scheduler.schedule(PeriodicTasksInitialDelay.max(UnreachableNodesReaperInterval), + val failureDetectorReaperTask = scheduler.schedule( + PeriodicTasksInitialDelay.max(UnreachableNodesReaperInterval), UnreachableNodesReaperInterval, self, ReapUnreachableTick) // start periodic leader action management (only applies for the current leader) - val leaderActionsTask = scheduler.schedule(PeriodicTasksInitialDelay.max(LeaderActionsInterval), + val leaderActionsTask = scheduler.schedule( + PeriodicTasksInitialDelay.max(LeaderActionsInterval), LeaderActionsInterval, self, LeaderActionsTick) // start periodic publish of current stats @@ -377,7 +380,8 @@ private[cluster] class ClusterCoreDaemon(publisher: ActorRef) extends Actor with case ClusterUserAction.JoinTo(address) ⇒ logInfo("Trying to join [{}] when already part of a cluster, ignoring", address) case JoinSeedNodes(seedNodes) ⇒ - logInfo("Trying to join seed nodes [{}] when already part of a cluster, ignoring", + logInfo( + "Trying to join seed nodes [{}] when already part of a cluster, ignoring", seedNodes.mkString(", ")) } @@ -433,10 +437,12 @@ private[cluster] class ClusterCoreDaemon(publisher: ActorRef) extends Actor with */ def join(address: Address): Unit = { if (address.protocol != selfAddress.protocol) - log.warning("Trying to join member with wrong protocol, but was ignored, expected [{}] but was [{}]", + log.warning( + "Trying to join member with wrong protocol, but was ignored, expected [{}] but was [{}]", selfAddress.protocol, address.protocol) else if (address.system != selfAddress.system) - log.warning("Trying to join member with wrong ActorSystem name, but was ignored, expected [{}] but was [{}]", + log.warning( + "Trying to join member with wrong ActorSystem name, but was ignored, expected [{}] but was [{}]", selfAddress.system, address.system) else { require(latestGossip.members.isEmpty, "Join can only be done from empty state") @@ -476,10 +482,12 @@ private[cluster] class ClusterCoreDaemon(publisher: ActorRef) extends Actor with def joining(node: UniqueAddress, roles: Set[String]): Unit = { val selfStatus = latestGossip.member(selfUniqueAddress).status if (node.address.protocol != selfAddress.protocol) - log.warning("Member with wrong protocol tried to join, but was ignored, expected [{}] but was [{}]", + log.warning( + "Member with wrong protocol tried to join, but was ignored, expected [{}] but was [{}]", selfAddress.protocol, node.address.protocol) else if (node.address.system != selfAddress.system) - log.warning("Member with wrong ActorSystem name tried to join, but was ignored, expected [{}] but was [{}]", + log.warning( + "Member with wrong ActorSystem name tried to join, but was ignored, expected [{}] but was [{}]", selfAddress.system, node.address.system) else if (Gossip.removeUnreachableWithMemberStatus.contains(selfStatus)) logInfo("Trying to join [{}] to [{}] member, ignoring. Use a member that is Up instead.", node, selfStatus) @@ -613,7 +621,8 @@ private[cluster] class ClusterCoreDaemon(publisher: ActorRef) extends Actor with val newOverview = localGossip.overview copy (reachability = newReachability) val newGossip = localGossip copy (overview = newOverview) updateLatestGossip(newGossip) - log.warning("Cluster Node [{}] - Marking node as TERMINATED [{}], due to quarantine. Node roles [{}]", + log.warning( + "Cluster Node [{}] - Marking node as TERMINATED [{}], due to quarantine. Node roles [{}]", selfAddress, node.address, selfRoles.mkString(",")) publish(latestGossip) downing(node.address) @@ -840,7 +849,8 @@ private[cluster] class ClusterCoreDaemon(publisher: ActorRef) extends Actor with leaderActionCounter += 1 if (leaderActionCounter == firstNotice || leaderActionCounter % periodicNotice == 0) - logInfo("Leader can currently not perform its duties, reachability status: [{}], member status: [{}]", + logInfo( + "Leader can currently not perform its duties, reachability status: [{}], member status: [{}]", latestGossip.reachabilityExcludingDownedObservers, latestGossip.members.map(m ⇒ s"${m.address} ${m.status} seen=${latestGossip.seenByNode(m.uniqueAddress)}").mkString(", ")) @@ -1047,7 +1057,8 @@ private[cluster] class ClusterCoreDaemon(publisher: ActorRef) extends Actor with if (nonExiting.nonEmpty) log.warning("Cluster Node [{}] - Marking node(s) as UNREACHABLE [{}]. Node roles [{}]", selfAddress, nonExiting.mkString(", "), selfRoles.mkString(", ")) if (exiting.nonEmpty) - logInfo("Marking exiting node(s) as UNREACHABLE [{}]. This is expected and they will be removed.", + logInfo( + "Marking exiting node(s) as UNREACHABLE [{}]. This is expected and they will be removed.", exiting.mkString(", ")) if (newlyDetectedReachableMembers.nonEmpty) logInfo("Marking node(s) as REACHABLE [{}]. Node roles [{}]", newlyDetectedReachableMembers.mkString(", "), selfRoles.mkString(",")) @@ -1294,10 +1305,10 @@ private[cluster] class OnMemberStatusChangedListener(callback: Runnable, status: @SerialVersionUID(1L) private[cluster] final case class GossipStats( receivedGossipCount: Long = 0L, - mergeCount: Long = 0L, - sameCount: Long = 0L, - newerCount: Long = 0L, - olderCount: Long = 0L) { + mergeCount: Long = 0L, + sameCount: Long = 0L, + newerCount: Long = 0L, + olderCount: Long = 0L) { def incrementMergeCount(): GossipStats = copy(mergeCount = mergeCount + 1, receivedGossipCount = receivedGossipCount + 1) @@ -1337,5 +1348,5 @@ private[cluster] final case class GossipStats( @SerialVersionUID(1L) private[cluster] final case class VectorClockStats( versionSize: Int = 0, - seenLatest: Int = 0) + seenLatest: Int = 0) diff --git a/akka-cluster/src/main/scala/akka/cluster/ClusterEvent.scala b/akka-cluster/src/main/scala/akka/cluster/ClusterEvent.scala index ac93008d31..72852ad5fe 100644 --- a/akka-cluster/src/main/scala/akka/cluster/ClusterEvent.scala +++ b/akka-cluster/src/main/scala/akka/cluster/ClusterEvent.scala @@ -56,10 +56,10 @@ object ClusterEvent { * Current snapshot state of the cluster. Sent to new subscriber. */ final case class CurrentClusterState( - members: immutable.SortedSet[Member] = immutable.SortedSet.empty, - unreachable: Set[Member] = Set.empty, - seenBy: Set[Address] = Set.empty, - leader: Option[Address] = None, + members: immutable.SortedSet[Member] = immutable.SortedSet.empty, + unreachable: Set[Member] = Set.empty, + seenBy: Set[Address] = Set.empty, + leader: Option[Address] = None, roleLeaderMap: Map[String, Option[Address]] = Map.empty) { /** @@ -395,7 +395,7 @@ private[cluster] final class ClusterDomainEventPublisher extends Actor with Acto unreachable = unreachable, seenBy = latestGossip.seenBy.map(_.address), leader = latestGossip.leader(selfUniqueAddress).map(_.address), - roleLeaderMap = latestGossip.allRoles.map(r ⇒ r -> latestGossip.roleLeader(r, selfUniqueAddress) + roleLeaderMap = latestGossip.allRoles.map(r ⇒ r → latestGossip.roleLeader(r, selfUniqueAddress) .map(_.address))(collection.breakOut)) receiver ! state } diff --git a/akka-cluster/src/main/scala/akka/cluster/ClusterHeartbeat.scala b/akka-cluster/src/main/scala/akka/cluster/ClusterHeartbeat.scala index f192c9314b..6279e44928 100644 --- a/akka-cluster/src/main/scala/akka/cluster/ClusterHeartbeat.scala +++ b/akka-cluster/src/main/scala/akka/cluster/ClusterHeartbeat.scala @@ -76,7 +76,8 @@ private[cluster] final class ClusterHeartbeatSender extends Actor with ActorLogg failureDetector) // start periodic heartbeat to other nodes in cluster - val heartbeatTask = scheduler.schedule(PeriodicTasksInitialDelay max HeartbeatInterval, + val heartbeatTask = scheduler.schedule( + PeriodicTasksInitialDelay max HeartbeatInterval, HeartbeatInterval, self, HeartbeatTick) override def preStart(): Unit = { @@ -173,9 +174,9 @@ private[cluster] final class ClusterHeartbeatSender extends Actor with ActorLogg * It is immutable, but it updates the failureDetector. */ private[cluster] final case class ClusterHeartbeatSenderState( - ring: HeartbeatNodeRing, + ring: HeartbeatNodeRing, oldReceiversNowUnreachable: Set[UniqueAddress], - failureDetector: FailureDetectorRegistry[Address]) { + failureDetector: FailureDetectorRegistry[Address]) { val activeReceivers: Set[UniqueAddress] = ring.myReceivers union oldReceiversNowUnreachable @@ -241,9 +242,9 @@ private[cluster] final case class ClusterHeartbeatSenderState( * It is immutable, i.e. the methods return new instances. */ private[cluster] final case class HeartbeatNodeRing( - selfAddress: UniqueAddress, - nodes: Set[UniqueAddress], - unreachable: Set[UniqueAddress], + selfAddress: UniqueAddress, + nodes: Set[UniqueAddress], + unreachable: Set[UniqueAddress], monitoredByNrOfMembers: Int) { require(nodes contains selfAddress, s"nodes [${nodes.mkString(", ")}] must contain selfAddress [${selfAddress}]") diff --git a/akka-cluster/src/main/scala/akka/cluster/ClusterMetricsCollector.scala b/akka-cluster/src/main/scala/akka/cluster/ClusterMetricsCollector.scala index 941fdb8ba8..cc8cb30bf5 100644 --- a/akka-cluster/src/main/scala/akka/cluster/ClusterMetricsCollector.scala +++ b/akka-cluster/src/main/scala/akka/cluster/ClusterMetricsCollector.scala @@ -69,13 +69,15 @@ private[cluster] class ClusterMetricsCollector(publisher: ActorRef) extends Acto /** * Start periodic gossip to random nodes in cluster */ - val gossipTask = scheduler.schedule(PeriodicTasksInitialDelay max MetricsGossipInterval, + val gossipTask = scheduler.schedule( + PeriodicTasksInitialDelay max MetricsGossipInterval, MetricsGossipInterval, self, GossipTick) /** * Start periodic metrics collection */ - val metricsTask = scheduler.schedule(PeriodicTasksInitialDelay max MetricsInterval, + val metricsTask = scheduler.schedule( + PeriodicTasksInitialDelay max MetricsInterval, MetricsInterval, self, MetricsTick) override def preStart(): Unit = { @@ -535,11 +537,11 @@ object StandardMetrics { */ @SerialVersionUID(1L) final case class Cpu( - address: Address, - timestamp: Long, + address: Address, + timestamp: Long, systemLoadAverage: Option[Double], - cpuCombined: Option[Double], - processors: Int) { + cpuCombined: Option[Double], + processors: Int) { cpuCombined match { case Some(x) ⇒ require(0.0 <= x && x <= 1.0, s"cpuCombined must be between [0.0 - 1.0], was [$x]") @@ -607,7 +609,8 @@ class JmxMetricsCollector(address: Address, decayFactor: Double) extends Metrics import StandardMetrics._ private def this(cluster: Cluster) = - this(cluster.selfAddress, + this( + cluster.selfAddress, EWMA.alpha(cluster.settings.MetricsMovingAverageHalfLife, cluster.settings.MetricsInterval)) /** @@ -710,7 +713,8 @@ class SigarMetricsCollector(address: Address, decayFactor: Double, sigar: AnyRef import StandardMetrics._ private def this(cluster: Cluster) = - this(cluster.selfAddress, + this( + cluster.selfAddress, EWMA.alpha(cluster.settings.MetricsMovingAverageHalfLife, cluster.settings.MetricsInterval), cluster.system.dynamicAccess.createInstanceFor[AnyRef]("org.hyperic.sigar.Sigar", Nil).get) @@ -804,7 +808,7 @@ private[cluster] object MetricsCollector { } } else { - system.dynamicAccess.createInstanceFor[MetricsCollector](fqcn, List(classOf[ActorSystem] -> system)). + system.dynamicAccess.createInstanceFor[MetricsCollector](fqcn, List(classOf[ActorSystem] → system)). recover { case e ⇒ throw new ConfigurationException("Could not create custom metrics collector [" + fqcn + "] due to:" + e.toString) }.get diff --git a/akka-cluster/src/main/scala/akka/cluster/ClusterReadView.scala b/akka-cluster/src/main/scala/akka/cluster/ClusterReadView.scala index 0dc643a4d9..5db167ed24 100644 --- a/akka-cluster/src/main/scala/akka/cluster/ClusterReadView.scala +++ b/akka-cluster/src/main/scala/akka/cluster/ClusterReadView.scala @@ -69,12 +69,13 @@ private[akka] class ClusterReadView(cluster: Cluster) extends Closeable { val newUnreachable = if (_state.unreachable.contains(event.member)) _state.unreachable - event.member + event.member else _state.unreachable - _state = _state.copy(members = _state.members - event.member + event.member, + _state = _state.copy( + members = _state.members - event.member + event.member, unreachable = newUnreachable) case LeaderChanged(leader) ⇒ _state = _state.copy(leader = leader) case RoleLeaderChanged(role, leader) ⇒ - _state = _state.copy(roleLeaderMap = _state.roleLeaderMap + (role -> leader)) + _state = _state.copy(roleLeaderMap = _state.roleLeaderMap + (role → leader)) case stats: CurrentInternalStats ⇒ _latestStats = stats case ClusterMetricsChanged(nodes) ⇒ _clusterMetrics = nodes case ClusterShuttingDown ⇒ diff --git a/akka-cluster/src/main/scala/akka/cluster/ClusterRemoteWatcher.scala b/akka-cluster/src/main/scala/akka/cluster/ClusterRemoteWatcher.scala index 00d64a5eca..8fb729930a 100644 --- a/akka-cluster/src/main/scala/akka/cluster/ClusterRemoteWatcher.scala +++ b/akka-cluster/src/main/scala/akka/cluster/ClusterRemoteWatcher.scala @@ -21,9 +21,9 @@ private[cluster] object ClusterRemoteWatcher { * Factory method for `ClusterRemoteWatcher` [[akka.actor.Props]]. */ def props( - failureDetector: FailureDetectorRegistry[Address], - heartbeatInterval: FiniteDuration, - unreachableReaperInterval: FiniteDuration, + failureDetector: FailureDetectorRegistry[Address], + heartbeatInterval: FiniteDuration, + unreachableReaperInterval: FiniteDuration, heartbeatExpectedResponseAfter: FiniteDuration): Props = Props(classOf[ClusterRemoteWatcher], failureDetector, heartbeatInterval, unreachableReaperInterval, heartbeatExpectedResponseAfter).withDeploy(Deploy.local) @@ -41,9 +41,9 @@ private[cluster] object ClusterRemoteWatcher { * of the cluster and then later becomes cluster member. */ private[cluster] class ClusterRemoteWatcher( - failureDetector: FailureDetectorRegistry[Address], - heartbeatInterval: FiniteDuration, - unreachableReaperInterval: FiniteDuration, + failureDetector: FailureDetectorRegistry[Address], + heartbeatInterval: FiniteDuration, + unreachableReaperInterval: FiniteDuration, heartbeatExpectedResponseAfter: FiniteDuration) extends RemoteWatcher( failureDetector, diff --git a/akka-cluster/src/main/scala/akka/cluster/ClusterSettings.scala b/akka-cluster/src/main/scala/akka/cluster/ClusterSettings.scala index 0cb6686173..682a7cb849 100644 --- a/akka-cluster/src/main/scala/akka/cluster/ClusterSettings.scala +++ b/akka-cluster/src/main/scala/akka/cluster/ClusterSettings.scala @@ -97,7 +97,7 @@ final class ClusterSettings(val config: Config, val systemName: String) { val MinNrOfMembersOfRole: Map[String, Int] = { import scala.collection.JavaConverters._ cc.getConfig("role").root.asScala.collect { - case (key, value: ConfigObject) ⇒ key -> value.toConfig.getInt("min-nr-of-members") + case (key, value: ConfigObject) ⇒ key → value.toConfig.getInt("min-nr-of-members") }.toMap } val JmxEnabled: Boolean = cc.getBoolean("jmx.enabled") diff --git a/akka-cluster/src/main/scala/akka/cluster/Gossip.scala b/akka-cluster/src/main/scala/akka/cluster/Gossip.scala index 30df8e6e2d..404cdff676 100644 --- a/akka-cluster/src/main/scala/akka/cluster/Gossip.scala +++ b/akka-cluster/src/main/scala/akka/cluster/Gossip.scala @@ -60,9 +60,9 @@ private[cluster] object Gossip { */ @SerialVersionUID(1L) private[cluster] final case class Gossip( - members: immutable.SortedSet[Member], // sorted set of members with their status, sorted by address - overview: GossipOverview = GossipOverview(), - version: VectorClock = VectorClock()) { // vector clock version + members: immutable.SortedSet[Member], // sorted set of members with their status, sorted by address + overview: GossipOverview = GossipOverview(), + version: VectorClock = VectorClock()) { // vector clock version if (Cluster.isAssertInvariantsEnabled) assertInvariants() @@ -84,7 +84,7 @@ private[cluster] final case class Gossip( } @transient private lazy val membersMap: Map[UniqueAddress, Member] = - members.map(m ⇒ m.uniqueAddress -> m)(collection.breakOut) + members.map(m ⇒ m.uniqueAddress → m)(collection.breakOut) /** * Increments the version for this 'Node'. @@ -142,7 +142,8 @@ private[cluster] final case class Gossip( val mergedMembers = Gossip.emptyMembers union Member.pickHighestPriority(this.members, that.members) // 3. merge reachability table by picking records with highest version - val mergedReachability = this.overview.reachability.merge(mergedMembers.map(_.uniqueAddress), + val mergedReachability = this.overview.reachability.merge( + mergedMembers.map(_.uniqueAddress), that.overview.reachability) // 4. Nobody can have seen this new gossip yet @@ -200,7 +201,8 @@ private[cluster] final case class Gossip( def isSingletonCluster: Boolean = members.size == 1 def member(node: UniqueAddress): Member = { - membersMap.getOrElse(node, + membersMap.getOrElse( + node, Member.removed(node)) // placeholder for removed member } @@ -227,8 +229,8 @@ private[cluster] final case class Gossip( */ @SerialVersionUID(1L) private[cluster] final case class GossipOverview( - seen: Set[UniqueAddress] = Set.empty, - reachability: Reachability = Reachability.empty) { + seen: Set[UniqueAddress] = Set.empty, + reachability: Reachability = Reachability.empty) { override def toString = s"GossipOverview(reachability = [$reachability], seen = [${seen.mkString(", ")}])" @@ -252,11 +254,11 @@ object GossipEnvelope { */ @SerialVersionUID(2L) private[cluster] class GossipEnvelope private ( - val from: UniqueAddress, - val to: UniqueAddress, - @volatile var g: Gossip, - serDeadline: Deadline, - @transient @volatile var ser: () ⇒ Gossip) extends ClusterMessage { + val from: UniqueAddress, + val to: UniqueAddress, + @volatile var g: Gossip, + serDeadline: Deadline, + @transient @volatile var ser:() ⇒ Gossip) extends ClusterMessage { def gossip: Gossip = { deserialize() diff --git a/akka-cluster/src/main/scala/akka/cluster/Member.scala b/akka-cluster/src/main/scala/akka/cluster/Member.scala index 3f55ef5317..bd3f817587 100644 --- a/akka-cluster/src/main/scala/akka/cluster/Member.scala +++ b/akka-cluster/src/main/scala/akka/cluster/Member.scala @@ -15,10 +15,10 @@ import MemberStatus._ */ @SerialVersionUID(1L) class Member private[cluster] ( - val uniqueAddress: UniqueAddress, + val uniqueAddress: UniqueAddress, private[cluster] val upNumber: Int, // INTERNAL API - val status: MemberStatus, - val roles: Set[String]) extends Serializable { + val status: MemberStatus, + val roles: Set[String]) extends Serializable { def address: Address = uniqueAddress.address @@ -53,7 +53,8 @@ class Member private[cluster] ( val oldStatus = this.status if (status == oldStatus) this else { - require(allowedTransitions(oldStatus)(status), + require( + allowedTransitions(oldStatus)(status), s"Invalid member status transition [ ${this} -> ${status}]") new Member(uniqueAddress, upNumber, status, roles) } @@ -233,13 +234,13 @@ object MemberStatus { */ private[cluster] val allowedTransitions: Map[MemberStatus, Set[MemberStatus]] = Map( - Joining -> Set(WeaklyUp, Up, Down, Removed), - WeaklyUp -> Set(Up, Down, Removed), - Up -> Set(Leaving, Down, Removed), - Leaving -> Set(Exiting, Down, Removed), - Down -> Set(Removed), - Exiting -> Set(Removed, Down), - Removed -> Set.empty[MemberStatus]) + Joining → Set(WeaklyUp, Up, Down, Removed), + WeaklyUp → Set(Up, Down, Removed), + Up → Set(Leaving, Down, Removed), + Leaving → Set(Exiting, Down, Removed), + Down → Set(Removed), + Exiting → Set(Removed, Down), + Removed → Set.empty[MemberStatus]) } /** diff --git a/akka-cluster/src/main/scala/akka/cluster/Reachability.scala b/akka-cluster/src/main/scala/akka/cluster/Reachability.scala index 57ced59f72..c978cf8e74 100644 --- a/akka-cluster/src/main/scala/akka/cluster/Reachability.scala +++ b/akka-cluster/src/main/scala/akka/cluster/Reachability.scala @@ -47,7 +47,7 @@ private[cluster] object Reachability { */ @SerialVersionUID(1L) private[cluster] class Reachability private ( - val records: immutable.IndexedSeq[Reachability.Record], + val records: immutable.IndexedSeq[Reachability.Record], val versions: Map[UniqueAddress, Long]) extends Serializable { import Reachability._ @@ -67,10 +67,10 @@ private[cluster] class Reachability private ( records foreach { r ⇒ val m = mapBuilder.get(r.observer) match { - case None ⇒ Map(r.subject -> r) + case None ⇒ Map(r.subject → r) case Some(m) ⇒ m.updated(r.subject, r) } - mapBuilder += (r.observer -> m) + mapBuilder += (r.observer → m) if (r.status == Unreachable) unreachableBuilder += r.subject else if (r.status == Terminated) terminatedBuilder += r.subject @@ -167,7 +167,7 @@ private[cluster] class Reachability private ( } if (observerVersion2 > observerVersion1) - newVersions += (observer -> observerVersion2) + newVersions += (observer → observerVersion2) } newVersions = newVersions.filterNot { case (k, _) ⇒ !allowed(k) } @@ -242,7 +242,7 @@ private[cluster] class Reachability private ( case (subject, records) if records.exists(_.status == Unreachable) ⇒ val observers: Set[UniqueAddress] = records.collect { case r if r.status == Unreachable ⇒ r.observer }(breakOut) - (subject -> observers) + (subject → observers) } } diff --git a/akka-cluster/src/main/scala/akka/cluster/protobuf/ClusterMessageSerializer.scala b/akka-cluster/src/main/scala/akka/cluster/protobuf/ClusterMessageSerializer.scala index 8318e126ce..78921cc0f3 100644 --- a/akka-cluster/src/main/scala/akka/cluster/protobuf/ClusterMessageSerializer.scala +++ b/akka-cluster/src/main/scala/akka/cluster/protobuf/ClusterMessageSerializer.scala @@ -37,27 +37,28 @@ class ClusterMessageSerializer(val system: ExtendedActorSystem) extends BaseSeri private lazy val GossipTimeToLive = Cluster(system).settings.GossipTimeToLive private val fromBinaryMap = collection.immutable.HashMap[Class[_ <: ClusterMessage], Array[Byte] ⇒ AnyRef]( - classOf[InternalClusterAction.Join] -> { + classOf[InternalClusterAction.Join] → { case bytes ⇒ val m = cm.Join.parseFrom(bytes) - InternalClusterAction.Join(uniqueAddressFromProto(m.getNode), + InternalClusterAction.Join( + uniqueAddressFromProto(m.getNode), Set.empty[String] ++ m.getRolesList.asScala) }, - classOf[InternalClusterAction.Welcome] -> { + classOf[InternalClusterAction.Welcome] → { case bytes ⇒ val m = cm.Welcome.parseFrom(decompress(bytes)) InternalClusterAction.Welcome(uniqueAddressFromProto(m.getFrom), gossipFromProto(m.getGossip)) }, - classOf[ClusterUserAction.Leave] -> (bytes ⇒ ClusterUserAction.Leave(addressFromBinary(bytes))), - classOf[ClusterUserAction.Down] -> (bytes ⇒ ClusterUserAction.Down(addressFromBinary(bytes))), - InternalClusterAction.InitJoin.getClass -> (_ ⇒ InternalClusterAction.InitJoin), - classOf[InternalClusterAction.InitJoinAck] -> (bytes ⇒ InternalClusterAction.InitJoinAck(addressFromBinary(bytes))), - classOf[InternalClusterAction.InitJoinNack] -> (bytes ⇒ InternalClusterAction.InitJoinNack(addressFromBinary(bytes))), - classOf[ClusterHeartbeatSender.Heartbeat] -> (bytes ⇒ ClusterHeartbeatSender.Heartbeat(addressFromBinary(bytes))), - classOf[ClusterHeartbeatSender.HeartbeatRsp] -> (bytes ⇒ ClusterHeartbeatSender.HeartbeatRsp(uniqueAddressFromBinary(bytes))), - classOf[GossipStatus] -> gossipStatusFromBinary, - classOf[GossipEnvelope] -> gossipEnvelopeFromBinary, - classOf[MetricsGossipEnvelope] -> metricsGossipEnvelopeFromBinary) + classOf[ClusterUserAction.Leave] → (bytes ⇒ ClusterUserAction.Leave(addressFromBinary(bytes))), + classOf[ClusterUserAction.Down] → (bytes ⇒ ClusterUserAction.Down(addressFromBinary(bytes))), + InternalClusterAction.InitJoin.getClass → (_ ⇒ InternalClusterAction.InitJoin), + classOf[InternalClusterAction.InitJoinAck] → (bytes ⇒ InternalClusterAction.InitJoinAck(addressFromBinary(bytes))), + classOf[InternalClusterAction.InitJoinNack] → (bytes ⇒ InternalClusterAction.InitJoinNack(addressFromBinary(bytes))), + classOf[ClusterHeartbeatSender.Heartbeat] → (bytes ⇒ ClusterHeartbeatSender.Heartbeat(addressFromBinary(bytes))), + classOf[ClusterHeartbeatSender.HeartbeatRsp] → (bytes ⇒ ClusterHeartbeatSender.HeartbeatRsp(uniqueAddressFromBinary(bytes))), + classOf[GossipStatus] → gossipStatusFromBinary, + classOf[GossipEnvelope] → gossipEnvelopeFromBinary, + classOf[MetricsGossipEnvelope] → metricsGossipEnvelopeFromBinary) def includeManifest: Boolean = true @@ -164,20 +165,20 @@ class ClusterMessageSerializer(val system: ExtendedActorSystem) extends BaseSeri UniqueAddress(addressFromProto(uniqueAddress.getAddress), uniqueAddress.getUid) private val memberStatusToInt = scala.collection.immutable.HashMap[MemberStatus, Int]( - MemberStatus.Joining -> cm.MemberStatus.Joining_VALUE, - MemberStatus.Up -> cm.MemberStatus.Up_VALUE, - MemberStatus.Leaving -> cm.MemberStatus.Leaving_VALUE, - MemberStatus.Exiting -> cm.MemberStatus.Exiting_VALUE, - MemberStatus.Down -> cm.MemberStatus.Down_VALUE, - MemberStatus.Removed -> cm.MemberStatus.Removed_VALUE, - MemberStatus.WeaklyUp -> cm.MemberStatus.WeaklyUp_VALUE) + MemberStatus.Joining → cm.MemberStatus.Joining_VALUE, + MemberStatus.Up → cm.MemberStatus.Up_VALUE, + MemberStatus.Leaving → cm.MemberStatus.Leaving_VALUE, + MemberStatus.Exiting → cm.MemberStatus.Exiting_VALUE, + MemberStatus.Down → cm.MemberStatus.Down_VALUE, + MemberStatus.Removed → cm.MemberStatus.Removed_VALUE, + MemberStatus.WeaklyUp → cm.MemberStatus.WeaklyUp_VALUE) private val memberStatusFromInt = memberStatusToInt.map { case (a, b) ⇒ (b, a) } private val reachabilityStatusToInt = scala.collection.immutable.HashMap[Reachability.ReachabilityStatus, Int]( - Reachability.Reachable -> cm.ReachabilityStatus.Reachable_VALUE, - Reachability.Unreachable -> cm.ReachabilityStatus.Unreachable_VALUE, - Reachability.Terminated -> cm.ReachabilityStatus.Terminated_VALUE) + Reachability.Reachable → cm.ReachabilityStatus.Reachable_VALUE, + Reachability.Unreachable → cm.ReachabilityStatus.Unreachable_VALUE, + Reachability.Terminated → cm.ReachabilityStatus.Terminated_VALUE) private val reachabilityStatusFromInt = reachabilityStatusToInt.map { case (a, b) ⇒ (b, a) } @@ -310,7 +311,8 @@ class ClusterMessageSerializer(val system: ExtendedActorSystem) extends BaseSeri } private def gossipStatusFromProto(status: cm.GossipStatus): GossipStatus = - GossipStatus(uniqueAddressFromProto(status.getFrom), vectorClockFromProto(status.getVersion, + GossipStatus(uniqueAddressFromProto(status.getFrom), vectorClockFromProto( + status.getVersion, status.getAllHashesList.asScala.toVector)) private def metricsGossipEnvelopeToProto(envelope: MetricsGossipEnvelope): cm.MetricsGossipEnvelope = { @@ -381,7 +383,8 @@ class ClusterMessageSerializer(val system: ExtendedActorSystem) extends BaseSeri case NumberType.Float_VALUE ⇒ jl.Float.intBitsToFloat(number.getValue32) case NumberType.Integer_VALUE ⇒ number.getValue32 case NumberType.Serialized_VALUE ⇒ - val in = new ClassLoaderObjectInputStream(system.dynamicAccess.classLoader, + val in = new ClassLoaderObjectInputStream( + system.dynamicAccess.classLoader, new ByteArrayInputStream(number.getSerialized.toByteArray)) val obj = in.readObject in.close() diff --git a/akka-cluster/src/main/scala/akka/cluster/routing/AdaptiveLoadBalancing.scala b/akka-cluster/src/main/scala/akka/cluster/routing/AdaptiveLoadBalancing.scala index bc326938bc..eafe050647 100644 --- a/akka-cluster/src/main/scala/akka/cluster/routing/AdaptiveLoadBalancing.scala +++ b/akka-cluster/src/main/scala/akka/cluster/routing/AdaptiveLoadBalancing.scala @@ -131,15 +131,16 @@ final case class AdaptiveLoadBalancingRoutingLogic(system: ActorSystem, metricsS @SerialVersionUID(1L) @deprecated("Superseded by akka.cluster.metrics (in akka-cluster-metrics jar)", "2.4") final case class AdaptiveLoadBalancingPool( - metricsSelector: MetricsSelector = MixMetricsSelector, - override val nrOfInstances: Int = 0, + metricsSelector: MetricsSelector = MixMetricsSelector, + override val nrOfInstances: Int = 0, override val supervisorStrategy: SupervisorStrategy = Pool.defaultSupervisorStrategy, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, - override val usePoolDispatcher: Boolean = false) + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId, + override val usePoolDispatcher: Boolean = false) extends Pool { def this(config: Config, dynamicAccess: DynamicAccess) = - this(nrOfInstances = ClusterRouterSettingsBase.getMaxTotalNrOfInstances(config), + this( + nrOfInstances = ClusterRouterSettingsBase.getMaxTotalNrOfInstances(config), metricsSelector = MetricsSelector.fromConfig(config, dynamicAccess), usePoolDispatcher = config.hasPath("pool-dispatcher")) @@ -159,7 +160,8 @@ final case class AdaptiveLoadBalancingPool( new Router(AdaptiveLoadBalancingRoutingLogic(system, metricsSelector)) override def routingLogicController(routingLogic: RoutingLogic): Option[Props] = - Some(Props(classOf[AdaptiveLoadBalancingMetricsListener], + Some(Props( + classOf[AdaptiveLoadBalancingMetricsListener], routingLogic.asInstanceOf[AdaptiveLoadBalancingRoutingLogic])) /** @@ -212,13 +214,14 @@ final case class AdaptiveLoadBalancingPool( @SerialVersionUID(1L) @deprecated("Superseded by akka.cluster.metrics (in akka-cluster-metrics jar)", "2.4") final case class AdaptiveLoadBalancingGroup( - metricsSelector: MetricsSelector = MixMetricsSelector, - override val paths: immutable.Iterable[String] = Nil, - override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) + metricsSelector: MetricsSelector = MixMetricsSelector, + override val paths: immutable.Iterable[String] = Nil, + override val routerDispatcher: String = Dispatchers.DefaultDispatcherId) extends Group { def this(config: Config, dynamicAccess: DynamicAccess) = - this(metricsSelector = MetricsSelector.fromConfig(config, dynamicAccess), + this( + metricsSelector = MetricsSelector.fromConfig(config, dynamicAccess), paths = immutableSeq(config.getStringList("routees.paths"))) /** @@ -228,8 +231,9 @@ final case class AdaptiveLoadBalancingGroup( * @param routeesPaths string representation of the actor paths of the routees, messages are * sent with [[akka.actor.ActorSelection]] to these paths */ - def this(metricsSelector: MetricsSelector, - routeesPaths: java.lang.Iterable[String]) = this(paths = immutableSeq(routeesPaths)) + def this( + metricsSelector: MetricsSelector, + routeesPaths: java.lang.Iterable[String]) = this(paths = immutableSeq(routeesPaths)) override def paths(system: ActorSystem): immutable.Iterable[String] = this.paths @@ -237,7 +241,8 @@ final case class AdaptiveLoadBalancingGroup( new Router(AdaptiveLoadBalancingRoutingLogic(system, metricsSelector)) override def routingLogicController(routingLogic: RoutingLogic): Option[Props] = - Some(Props(classOf[AdaptiveLoadBalancingMetricsListener], + Some(Props( + classOf[AdaptiveLoadBalancingMetricsListener], routingLogic.asInstanceOf[AdaptiveLoadBalancingRoutingLogic])) /** @@ -363,9 +368,9 @@ abstract class MixMetricsSelectorBase(selectors: immutable.IndexedSeq[CapacityMe combined.foldLeft(Map.empty[Address, (Double, Int)].withDefaultValue((0.0, 0))) { case (acc, (address, capacity)) ⇒ val (sum, count) = acc(address) - acc + (address -> ((sum + capacity, count + 1))) + acc + (address → ((sum + capacity, count + 1))) }.map { - case (addr, (sum, count)) ⇒ (addr -> sum / count) + case (addr, (sum, count)) ⇒ addr → (sum / count) } } @@ -380,7 +385,7 @@ object MetricsSelector { case "cpu" ⇒ CpuMetricsSelector case "load" ⇒ SystemLoadAverageMetricsSelector case fqn ⇒ - val args = List(classOf[Config] -> config) + val args = List(classOf[Config] → config) dynamicAccess.createInstanceFor[MetricsSelector](fqn, args).recover({ case exception ⇒ throw new IllegalArgumentException( (s"Cannot instantiate metrics-selector [$fqn], " + @@ -430,7 +435,7 @@ abstract class CapacityMetricsSelector extends MetricsSelector { val (_, min) = capacity.minBy { case (_, c) ⇒ c } // lowest usable capacity is 1% (>= 0.5% will be rounded to weight 1), also avoids div by zero val divisor = math.max(0.01, min) - capacity map { case (addr, c) ⇒ (addr -> math.round((c) / divisor).toInt) } + capacity map { case (addr, c) ⇒ (addr → math.round((c) / divisor).toInt) } } } diff --git a/akka-cluster/src/main/scala/akka/cluster/routing/ClusterRouterConfig.scala b/akka-cluster/src/main/scala/akka/cluster/routing/ClusterRouterConfig.scala index 99e42cc056..4a1f556d13 100644 --- a/akka-cluster/src/main/scala/akka/cluster/routing/ClusterRouterConfig.scala +++ b/akka-cluster/src/main/scala/akka/cluster/routing/ClusterRouterConfig.scala @@ -43,10 +43,10 @@ object ClusterRouterGroupSettings { */ @SerialVersionUID(1L) final case class ClusterRouterGroupSettings( - totalInstances: Int, - routeesPaths: immutable.Seq[String], + totalInstances: Int, + routeesPaths: immutable.Seq[String], allowLocalRoutees: Boolean, - useRole: Option[String]) extends ClusterRouterSettingsBase { + useRole: Option[String]) extends ClusterRouterSettingsBase { /** * Java API @@ -82,10 +82,10 @@ object ClusterRouterPoolSettings { */ @SerialVersionUID(1L) final case class ClusterRouterPoolSettings( - totalInstances: Int, + totalInstances: Int, maxInstancesPerNode: Int, - allowLocalRoutees: Boolean, - useRole: Option[String]) extends ClusterRouterSettingsBase { + allowLocalRoutees: Boolean, + useRole: Option[String]) extends ClusterRouterSettingsBase { /** * Java API @@ -276,9 +276,9 @@ private[akka] class ClusterRouterPoolActor( } else { // find the node with least routees val numberOfRouteesPerNode: Map[Address, Int] = - currentRoutees.foldLeft(currentNodes.map(_ -> 0).toMap.withDefaultValue(0)) { (acc, x) ⇒ + currentRoutees.foldLeft(currentNodes.map(_ → 0).toMap.withDefaultValue(0)) { (acc, x) ⇒ val address = fullAddress(x) - acc + (address -> (acc(address) + 1)) + acc + (address → (acc(address) + 1)) } val (address, count) = numberOfRouteesPerNode.minBy(_._2) @@ -304,7 +304,7 @@ private[akka] class ClusterRouterGroupActor(val settings: ClusterRouterGroupSett var usedRouteePaths: Map[Address, Set[String]] = if (settings.allowLocalRoutees) - Map(cluster.selfAddress -> settings.routeesPaths.toSet) + Map(cluster.selfAddress → settings.routeesPaths.toSet) else Map.empty diff --git a/akka-cluster/src/multi-jvm/scala/akka/cluster/DeterministicOldestWhenJoiningSpec.scala b/akka-cluster/src/multi-jvm/scala/akka/cluster/DeterministicOldestWhenJoiningSpec.scala index 4a098f49a3..eb81ea9c77 100644 --- a/akka-cluster/src/multi-jvm/scala/akka/cluster/DeterministicOldestWhenJoiningSpec.scala +++ b/akka-cluster/src/multi-jvm/scala/akka/cluster/DeterministicOldestWhenJoiningSpec.scala @@ -39,7 +39,7 @@ abstract class DeterministicOldestWhenJoiningSpec // reverse order because that expose the bug in issue #18554 def seedNodes: immutable.IndexedSeq[Address] = Vector(address(seed1), address(seed2), address(seed3)).sorted(Member.addressOrdering).reverse - val roleByAddress = Map(address(seed1) -> seed1, address(seed2) -> seed2, address(seed3) -> seed3) + val roleByAddress = Map(address(seed1) → seed1, address(seed2) → seed2, address(seed3) → seed3) "Joining a cluster" must { "result in deterministic oldest node" taggedAs LongRunningTest in { diff --git a/akka-cluster/src/multi-jvm/scala/akka/cluster/MultiNodeClusterSpec.scala b/akka-cluster/src/multi-jvm/scala/akka/cluster/MultiNodeClusterSpec.scala index fd125879cb..064ec57774 100644 --- a/akka-cluster/src/multi-jvm/scala/akka/cluster/MultiNodeClusterSpec.scala +++ b/akka-cluster/src/multi-jvm/scala/akka/cluster/MultiNodeClusterSpec.scala @@ -96,7 +96,8 @@ trait MultiNodeClusterSpec extends Suite with STMultiNodeSpec with WatchedByCoro def muteLog(sys: ActorSystem = system): Unit = { if (!sys.log.isDebugEnabled) { - Seq(".*Metrics collection has started successfully.*", + Seq( + ".*Metrics collection has started successfully.*", ".*Metrics will be retreived from MBeans.*", ".*Cluster Node.* - registered cluster JMX MBean.*", ".*Cluster Node.* - is starting up.*", @@ -272,7 +273,8 @@ trait MultiNodeClusterSpec extends Suite with STMultiNodeSpec with WatchedByCoro val expectedLeader = roleOfLeader(nodesInCluster) val leader = clusterView.leader val isLeader = leader == Some(clusterView.selfAddress) - assert(isLeader == isNode(expectedLeader), + assert( + isLeader == isNode(expectedLeader), "expectedLeader [%s], got leader [%s], members [%s]".format(expectedLeader, leader, clusterView.members)) clusterView.status should (be(MemberStatus.Up) or be(MemberStatus.Leaving)) } @@ -282,9 +284,9 @@ trait MultiNodeClusterSpec extends Suite with STMultiNodeSpec with WatchedByCoro * Also asserts that nodes in the 'canNotBePartOfMemberRing' are *not* part of the cluster ring. */ def awaitMembersUp( - numberOfMembers: Int, - canNotBePartOfMemberRing: Set[Address] = Set.empty, - timeout: FiniteDuration = 25.seconds): Unit = { + numberOfMembers: Int, + canNotBePartOfMemberRing: Set[Address] = Set.empty, + timeout: FiniteDuration = 25.seconds): Unit = { within(timeout) { if (!canNotBePartOfMemberRing.isEmpty) // don't run this on an empty set awaitAssert(canNotBePartOfMemberRing foreach (a ⇒ clusterView.members.map(_.address) should not contain (a))) diff --git a/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartFirstSeedNodeSpec.scala b/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartFirstSeedNodeSpec.scala index 9ba4b6828d..14ecede33a 100644 --- a/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartFirstSeedNodeSpec.scala +++ b/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartFirstSeedNodeSpec.scala @@ -50,7 +50,8 @@ abstract class RestartFirstSeedNodeSpec def missingSeed = address(seed3).copy(port = Some(61313)) def seedNodes: immutable.IndexedSeq[Address] = Vector(seedNode1Address, seed2, seed3, missingSeed) - lazy val restartedSeed1System = ActorSystem(system.name, + lazy val restartedSeed1System = ActorSystem( + system.name, ConfigFactory.parseString("akka.remote.netty.tcp.port=" + seedNodes.head.port.get). withFallback(system.settings.config)) diff --git a/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartNode2Spec.scala b/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartNode2Spec.scala index b01d2507cd..6489a9abd4 100644 --- a/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartNode2Spec.scala +++ b/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartNode2Spec.scala @@ -52,7 +52,8 @@ abstract class RestartNode2SpecSpec def seedNodes: immutable.IndexedSeq[Address] = Vector(seedNode1Address, seed2) // this is the node that will attempt to re-join, keep gate times low so it can retry quickly - lazy val restartedSeed1System = ActorSystem(system.name, + lazy val restartedSeed1System = ActorSystem( + system.name, ConfigFactory.parseString( s""" akka.remote.netty.tcp.port= ${seedNodes.head.port.get} diff --git a/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartNode3Spec.scala b/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartNode3Spec.scala index 7d4b4930b2..58e8a42fbc 100644 --- a/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartNode3Spec.scala +++ b/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartNode3Spec.scala @@ -48,7 +48,8 @@ abstract class RestartNode3Spec def seedNodes: immutable.IndexedSeq[Address] = Vector(first) - lazy val restartedSecondSystem = ActorSystem(system.name, + lazy val restartedSecondSystem = ActorSystem( + system.name, ConfigFactory.parseString("akka.remote.netty.tcp.port=" + secondUniqueAddress.address.port.get). withFallback(system.settings.config)) diff --git a/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartNodeSpec.scala b/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartNodeSpec.scala index c6f3efe285..17cad3e2b6 100644 --- a/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartNodeSpec.scala +++ b/akka-cluster/src/multi-jvm/scala/akka/cluster/RestartNodeSpec.scala @@ -69,7 +69,8 @@ abstract class RestartNodeSpec def seedNodes: immutable.IndexedSeq[Address] = Vector(first, secondUniqueAddress.address, third) - lazy val restartedSecondSystem = ActorSystem(system.name, + lazy val restartedSecondSystem = ActorSystem( + system.name, ConfigFactory.parseString("akka.remote.netty.tcp.port=" + secondUniqueAddress.address.port.get). withFallback(system.settings.config)) diff --git a/akka-cluster/src/multi-jvm/scala/akka/cluster/StressSpec.scala b/akka-cluster/src/multi-jvm/scala/akka/cluster/StressSpec.scala index ac0539c2e7..1551253ed0 100644 --- a/akka-cluster/src/multi-jvm/scala/akka/cluster/StressSpec.scala +++ b/akka-cluster/src/multi-jvm/scala/akka/cluster/StressSpec.scala @@ -208,13 +208,15 @@ private[cluster] object StressMultiJvmSpec extends MultiNodeConfig { val convergenceWithinFactor = getDouble("convergence-within-factor") val exerciseActors = getBoolean("exercise-actors") - require(numberOfSeedNodes + numberOfNodesJoiningToSeedNodesInitially + numberOfNodesJoiningOneByOneSmall + - numberOfNodesJoiningOneByOneLarge + numberOfNodesJoiningToOneNode + numberOfNodesJoiningToSeedNodes <= totalNumberOfNodes, + require( + numberOfSeedNodes + numberOfNodesJoiningToSeedNodesInitially + numberOfNodesJoiningOneByOneSmall + + numberOfNodesJoiningOneByOneLarge + numberOfNodesJoiningToOneNode + numberOfNodesJoiningToSeedNodes <= totalNumberOfNodes, s"specified number of joining nodes <= ${totalNumberOfNodes}") // don't shutdown the 3 nodes hosting the master actors - require(numberOfNodesLeavingOneByOneSmall + numberOfNodesLeavingOneByOneLarge + numberOfNodesLeaving + - numberOfNodesShutdownOneByOneSmall + numberOfNodesShutdownOneByOneLarge + numberOfNodesShutdown <= totalNumberOfNodes - 3, + require( + numberOfNodesLeavingOneByOneSmall + numberOfNodesLeavingOneByOneLarge + numberOfNodesLeaving + + numberOfNodesShutdownOneByOneSmall + numberOfNodesShutdownOneByOneLarge + numberOfNodesShutdown <= totalNumberOfNodes - 3, s"specified number of leaving/shutdown nodes <= ${totalNumberOfNodes - 3}") require(numberOfNodesJoinRemove <= totalNumberOfNodes, s"nr-of-nodes-join-remove should be <= ${totalNumberOfNodes}") @@ -229,8 +231,8 @@ private[cluster] object StressMultiJvmSpec extends MultiNodeConfig { } final case class ClusterResult( - address: Address, - duration: Duration, + address: Address, + duration: Duration, clusterStats: GossipStats) final case class AggregatedClusterResult(title: String, duration: Duration, clusterStats: GossipStats) @@ -271,8 +273,8 @@ private[cluster] object StressMultiJvmSpec extends MultiNodeConfig { def receive = { case ClusterMetricsChanged(clusterMetrics) ⇒ nodeMetrics = clusterMetrics - case PhiResult(from, phiValues) ⇒ phiValuesObservedByNode += from -> phiValues - case StatsResult(from, stats) ⇒ clusterStatsObservedByNode += from -> stats + case PhiResult(from, phiValues) ⇒ phiValuesObservedByNode += from → phiValues + case StatsResult(from, stats) ⇒ clusterStatsObservedByNode += from → stats case ReportTick ⇒ if (infolog) log.info(s"[${title}] in progress\n${formatMetrics}\n\n${formatPhi}\n\n${formatStats}") @@ -412,7 +414,7 @@ private[cluster] object StressMultiJvmSpec extends MultiNodeConfig { val φ = phi(node) if (φ > 0 || cluster.failureDetector.isMonitoring(node)) { val aboveOne = if (!φ.isInfinite && φ > 1.0) 1 else 0 - phiByNode += node -> PhiValue(node, previous.countAboveOne + aboveOne, previous.count + 1, + phiByNode += node → PhiValue(node, previous.countAboveOne + aboveOne, previous.count + 1, math.max(previous.max, φ)) } } @@ -561,7 +563,7 @@ private[cluster] object StressMultiJvmSpec extends MultiNodeConfig { } def send(job: Job): Unit = { - outstanding += job.id -> JobState(Deadline.now + retryTimeout, job) + outstanding += job.id → JobState(Deadline.now + retryTimeout, job) sendCounter += 1 workers ! job } @@ -576,7 +578,8 @@ private[cluster] object StressMultiJvmSpec extends MultiNodeConfig { case TreeJob(id, payload, idx, levels, width) ⇒ // create the actors when first TreeJob message is received val totalActors = ((width * math.pow(width, levels) - 1) / (width - 1)).toInt - log.debug("Creating [{}] actors in a tree structure of [{}] levels and each actor has [{}] children", + log.debug( + "Creating [{}] actors in a tree structure of [{}] levels and each actor has [{}] children", totalActors, levels, width) val tree = context.actorOf(Props(classOf[TreeNode], levels, width), "tree") tree forward ((idx, SimpleJob(id, payload))) @@ -633,7 +636,8 @@ private[cluster] object StressMultiJvmSpec extends MultiNodeConfig { case e: Exception ⇒ context.children foreach { _ ! e } case GetChildrenCount ⇒ sender() ! ChildrenCount(context.children.size, restartCount) case Reset ⇒ - require(context.children.isEmpty, + require( + context.children.isEmpty, s"ResetChildrenCount not allowed when children exists, [${context.children.size}]") restartCount = 0 } @@ -772,7 +776,8 @@ abstract class StressSpec def createResultAggregator(title: String, expectedResults: Int, includeInHistory: Boolean): Unit = { runOn(roles.head) { - val aggregator = system.actorOf(Props(classOf[ClusterResultAggregator], title, expectedResults, settings).withDeploy(Deploy.local), + val aggregator = system.actorOf( + Props(classOf[ClusterResultAggregator], title, expectedResults, settings).withDeploy(Deploy.local), name = "result" + step) if (includeInHistory && infolog) aggregator ! ReportTo(Some(clusterResultHistory)) else aggregator ! ReportTo(None) @@ -1027,7 +1032,8 @@ abstract class StressSpec val (masterRoles, otherRoles) = roles.take(nbrUsedRoles).splitAt(3) runOn(masterRoles: _*) { reportResult { - val m = system.actorOf(Props(classOf[Master], settings, batchInterval, tree).withDeploy(Deploy.local), + val m = system.actorOf( + Props(classOf[Master], settings, batchInterval, tree).withDeploy(Deploy.local), name = masterName) m ! Begin import system.dispatcher @@ -1155,7 +1161,8 @@ abstract class StressSpec "start routers that are running while nodes are joining" taggedAs LongRunningTest in { runOn(roles.take(3): _*) { - system.actorOf(Props(classOf[Master], settings, settings.workBatchInterval, false).withDeploy(Deploy.local), + system.actorOf( + Props(classOf[Master], settings, settings.workBatchInterval, false).withDeploy(Deploy.local), name = masterName) ! Begin } } @@ -1253,7 +1260,8 @@ abstract class StressSpec "start routers that are running while nodes are removed" taggedAs LongRunningTest in { if (exerciseActors) { runOn(roles.take(3): _*) { - system.actorOf(Props(classOf[Master], settings, settings.workBatchInterval, false).withDeploy(Deploy.local), + system.actorOf( + Props(classOf[Master], settings, settings.workBatchInterval, false).withDeploy(Deploy.local), name = masterName) ! Begin } } diff --git a/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/AdaptiveLoadBalancingRouterSpec.scala b/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/AdaptiveLoadBalancingRouterSpec.scala index aae1a13dc2..5584b89b49 100644 --- a/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/AdaptiveLoadBalancingRouterSpec.scala +++ b/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/AdaptiveLoadBalancingRouterSpec.scala @@ -99,11 +99,11 @@ abstract class AdaptiveLoadBalancingRouterSpec extends MultiNodeSpec(AdaptiveLoa Await.result(router ? GetRoutees, timeout.duration).asInstanceOf[Routees].routees def receiveReplies(expectedReplies: Int): Map[Address, Int] = { - val zero = Map.empty[Address, Int] ++ roles.map(address(_) -> 0) + val zero = Map.empty[Address, Int] ++ roles.map(address(_) → 0) (receiveWhile(5 seconds, messages = expectedReplies) { case Reply(address) ⇒ address }).foldLeft(zero) { - case (replyMap, address) ⇒ replyMap + (address -> (replyMap(address) + 1)) + case (replyMap, address) ⇒ replyMap + (address → (replyMap(address) + 1)) } } @@ -116,10 +116,11 @@ abstract class AdaptiveLoadBalancingRouterSpec extends MultiNodeSpec(AdaptiveLoa } def startRouter(name: String): ActorRef = { - val router = system.actorOf(ClusterRouterPool( - local = AdaptiveLoadBalancingPool(HeapMetricsSelector), - settings = ClusterRouterPoolSettings(totalInstances = 10, maxInstancesPerNode = 1, allowLocalRoutees = true, useRole = None)). - props(Props[Echo]), + val router = system.actorOf( + ClusterRouterPool( + local = AdaptiveLoadBalancingPool(HeapMetricsSelector), + settings = ClusterRouterPoolSettings(totalInstances = 10, maxInstancesPerNode = 1, allowLocalRoutees = true, useRole = None)). + props(Props[Echo]), name) // it may take some time until router receives cluster member events awaitAssert { currentRoutees(router).size should ===(roles.size) } diff --git a/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/ClusterConsistentHashingGroupSpec.scala b/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/ClusterConsistentHashingGroupSpec.scala index 2d54c6e176..5425f4d2ce 100644 --- a/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/ClusterConsistentHashingGroupSpec.scala +++ b/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/ClusterConsistentHashingGroupSpec.scala @@ -73,8 +73,10 @@ abstract class ClusterConsistentHashingGroupSpec extends MultiNodeSpec(ClusterCo case s: String ⇒ s } val paths = List("/user/dest") - val router = system.actorOf(ClusterRouterGroup(local = ConsistentHashingGroup(paths, hashMapping = hashMapping), - settings = ClusterRouterGroupSettings(totalInstances = 10, paths, allowLocalRoutees = true, useRole = None)).props(), + val router = system.actorOf( + ClusterRouterGroup( + local = ConsistentHashingGroup(paths, hashMapping = hashMapping), + settings = ClusterRouterGroupSettings(totalInstances = 10, paths, allowLocalRoutees = true, useRole = None)).props(), "router") // it may take some time until router receives cluster member events awaitAssert { currentRoutees(router).size should ===(3) } diff --git a/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/ClusterConsistentHashingRouterSpec.scala b/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/ClusterConsistentHashingRouterSpec.scala index d68a50d581..e26e2e5ba9 100644 --- a/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/ClusterConsistentHashingRouterSpec.scala +++ b/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/ClusterConsistentHashingRouterSpec.scala @@ -121,9 +121,11 @@ abstract class ClusterConsistentHashingRouterSpec extends MultiNodeSpec(ClusterC "deploy programatically defined routees to the member nodes in the cluster" taggedAs LongRunningTest in { runOn(first) { - val router2 = system.actorOf(ClusterRouterPool(local = ConsistentHashingPool(nrOfInstances = 0), - settings = ClusterRouterPoolSettings(totalInstances = 10, maxInstancesPerNode = 2, allowLocalRoutees = true, useRole = None)). - props(Props[Echo]), + val router2 = system.actorOf( + ClusterRouterPool( + local = ConsistentHashingPool(nrOfInstances = 0), + settings = ClusterRouterPoolSettings(totalInstances = 10, maxInstancesPerNode = 2, allowLocalRoutees = true, useRole = None)). + props(Props[Echo]), "router2") // it may take some time until router receives cluster member events awaitAssert { currentRoutees(router2).size should ===(6) } @@ -154,10 +156,11 @@ abstract class ClusterConsistentHashingRouterSpec extends MultiNodeSpec(ClusterC case s: String ⇒ s } - val router4 = system.actorOf(ClusterRouterPool( - local = ConsistentHashingPool(nrOfInstances = 0, hashMapping = hashMapping), - settings = ClusterRouterPoolSettings(totalInstances = 10, maxInstancesPerNode = 1, allowLocalRoutees = true, useRole = None)). - props(Props[Echo]), + val router4 = system.actorOf( + ClusterRouterPool( + local = ConsistentHashingPool(nrOfInstances = 0, hashMapping = hashMapping), + settings = ClusterRouterPoolSettings(totalInstances = 10, maxInstancesPerNode = 1, allowLocalRoutees = true, useRole = None)). + props(Props[Echo]), "router4") assertHashMapping(router4) diff --git a/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/ClusterRoundRobinSpec.scala b/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/ClusterRoundRobinSpec.scala index bebd5ce25f..b11f96d531 100644 --- a/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/ClusterRoundRobinSpec.scala +++ b/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/ClusterRoundRobinSpec.scala @@ -103,20 +103,22 @@ abstract class ClusterRoundRobinSpec extends MultiNodeSpec(ClusterRoundRobinMult import ClusterRoundRobinMultiJvmSpec._ lazy val router1 = system.actorOf(FromConfig.props(Props[SomeActor]), "router1") - lazy val router2 = system.actorOf(ClusterRouterPool(RoundRobinPool(nrOfInstances = 0), - ClusterRouterPoolSettings(totalInstances = 3, maxInstancesPerNode = 1, allowLocalRoutees = true, useRole = None)). - props(Props[SomeActor]), + lazy val router2 = system.actorOf( + ClusterRouterPool( + RoundRobinPool(nrOfInstances = 0), + ClusterRouterPoolSettings(totalInstances = 3, maxInstancesPerNode = 1, allowLocalRoutees = true, useRole = None)). + props(Props[SomeActor]), "router2") lazy val router3 = system.actorOf(FromConfig.props(Props[SomeActor]), "router3") lazy val router4 = system.actorOf(FromConfig.props(), "router4") lazy val router5 = system.actorOf(RoundRobinPool(nrOfInstances = 0).props(Props[SomeActor]), "router5") def receiveReplies(routeeType: RouteeType, expectedReplies: Int): Map[Address, Int] = { - val zero = Map.empty[Address, Int] ++ roles.map(address(_) -> 0) + val zero = Map.empty[Address, Int] ++ roles.map(address(_) → 0) (receiveWhile(5 seconds, messages = expectedReplies) { case Reply(`routeeType`, ref) ⇒ fullAddress(ref) }).foldLeft(zero) { - case (replyMap, address) ⇒ replyMap + (address -> (replyMap(address) + 1)) + case (replyMap, address) ⇒ replyMap + (address → (replyMap(address) + 1)) } } diff --git a/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/UseRoleIgnoredSpec.scala b/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/UseRoleIgnoredSpec.scala index f7732e6bf7..a96c8f51a3 100644 --- a/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/UseRoleIgnoredSpec.scala +++ b/akka-cluster/src/multi-jvm/scala/akka/cluster/routing/UseRoleIgnoredSpec.scala @@ -63,11 +63,11 @@ abstract class UseRoleIgnoredSpec extends MultiNodeSpec(UseRoleIgnoredMultiJvmSp import akka.cluster.routing.UseRoleIgnoredMultiJvmSpec._ def receiveReplies(routeeType: RouteeType, expectedReplies: Int): Map[Address, Int] = { - val zero = Map.empty[Address, Int] ++ roles.map(address(_) -> 0) + val zero = Map.empty[Address, Int] ++ roles.map(address(_) → 0) (receiveWhile(5 seconds, messages = expectedReplies) { case Reply(`routeeType`, ref) ⇒ fullAddress(ref) }).foldLeft(zero) { - case (replyMap, address) ⇒ replyMap + (address -> (replyMap(address) + 1)) + case (replyMap, address) ⇒ replyMap + (address → (replyMap(address) + 1)) } } @@ -101,10 +101,11 @@ abstract class UseRoleIgnoredSpec extends MultiNodeSpec(UseRoleIgnoredMultiJvmSp runOn(first) { val role = Some("b") - val router = system.actorOf(ClusterRouterPool( - RoundRobinPool(nrOfInstances = 6), - ClusterRouterPoolSettings(totalInstances = 6, maxInstancesPerNode = 2, allowLocalRoutees = false, useRole = role)). - props(Props[SomeActor]), + val router = system.actorOf( + ClusterRouterPool( + RoundRobinPool(nrOfInstances = 6), + ClusterRouterPoolSettings(totalInstances = 6, maxInstancesPerNode = 2, allowLocalRoutees = false, useRole = role)). + props(Props[SomeActor]), "router-2") awaitAssert(currentRoutees(router).size should ===(4)) @@ -130,7 +131,8 @@ abstract class UseRoleIgnoredSpec extends MultiNodeSpec(UseRoleIgnoredMultiJvmSp runOn(first) { val role = Some("b") - val router = system.actorOf(ClusterRouterGroup( + val router = system.actorOf( + ClusterRouterGroup( RoundRobinGroup(paths = Nil), ClusterRouterGroupSettings(totalInstances = 6, routeesPaths = List("/user/foo", "/user/bar"), allowLocalRoutees = false, useRole = role)).props, @@ -159,10 +161,11 @@ abstract class UseRoleIgnoredSpec extends MultiNodeSpec(UseRoleIgnoredMultiJvmSp runOn(first) { val role = Some("b") - val router = system.actorOf(ClusterRouterPool( - RoundRobinPool(nrOfInstances = 6), - ClusterRouterPoolSettings(totalInstances = 6, maxInstancesPerNode = 2, allowLocalRoutees = true, useRole = role)). - props(Props[SomeActor]), + val router = system.actorOf( + ClusterRouterPool( + RoundRobinPool(nrOfInstances = 6), + ClusterRouterPoolSettings(totalInstances = 6, maxInstancesPerNode = 2, allowLocalRoutees = true, useRole = role)). + props(Props[SomeActor]), "router-3") awaitAssert(currentRoutees(router).size should ===(4)) @@ -188,7 +191,8 @@ abstract class UseRoleIgnoredSpec extends MultiNodeSpec(UseRoleIgnoredMultiJvmSp runOn(first) { val role = Some("b") - val router = system.actorOf(ClusterRouterGroup( + val router = system.actorOf( + ClusterRouterGroup( RoundRobinGroup(paths = Nil), ClusterRouterGroupSettings(totalInstances = 6, routeesPaths = List("/user/foo", "/user/bar"), allowLocalRoutees = true, useRole = role)).props, @@ -217,10 +221,11 @@ abstract class UseRoleIgnoredSpec extends MultiNodeSpec(UseRoleIgnoredMultiJvmSp runOn(first) { val role = Some("a") - val router = system.actorOf(ClusterRouterPool( - RoundRobinPool(nrOfInstances = 6), - ClusterRouterPoolSettings(totalInstances = 6, maxInstancesPerNode = 2, allowLocalRoutees = true, useRole = role)). - props(Props[SomeActor]), + val router = system.actorOf( + ClusterRouterPool( + RoundRobinPool(nrOfInstances = 6), + ClusterRouterPoolSettings(totalInstances = 6, maxInstancesPerNode = 2, allowLocalRoutees = true, useRole = role)). + props(Props[SomeActor]), "router-4") awaitAssert(currentRoutees(router).size should ===(2)) @@ -246,7 +251,8 @@ abstract class UseRoleIgnoredSpec extends MultiNodeSpec(UseRoleIgnoredMultiJvmSp runOn(first) { val role = Some("a") - val router = system.actorOf(ClusterRouterGroup( + val router = system.actorOf( + ClusterRouterGroup( RoundRobinGroup(paths = Nil), ClusterRouterGroupSettings(totalInstances = 6, routeesPaths = List("/user/foo", "/user/bar"), allowLocalRoutees = true, useRole = role)).props, @@ -275,10 +281,11 @@ abstract class UseRoleIgnoredSpec extends MultiNodeSpec(UseRoleIgnoredMultiJvmSp runOn(first) { val role = Some("c") - val router = system.actorOf(ClusterRouterPool( - RoundRobinPool(nrOfInstances = 6), - ClusterRouterPoolSettings(totalInstances = 6, maxInstancesPerNode = 2, allowLocalRoutees = true, useRole = role)). - props(Props[SomeActor]), + val router = system.actorOf( + ClusterRouterPool( + RoundRobinPool(nrOfInstances = 6), + ClusterRouterPoolSettings(totalInstances = 6, maxInstancesPerNode = 2, allowLocalRoutees = true, useRole = role)). + props(Props[SomeActor]), "router-5") awaitAssert(currentRoutees(router).size should ===(6)) @@ -304,7 +311,8 @@ abstract class UseRoleIgnoredSpec extends MultiNodeSpec(UseRoleIgnoredMultiJvmSp runOn(first) { val role = Some("c") - val router = system.actorOf(ClusterRouterGroup( + val router = system.actorOf( + ClusterRouterGroup( RoundRobinGroup(paths = Nil), ClusterRouterGroupSettings(totalInstances = 6, routeesPaths = List("/user/foo", "/user/bar"), allowLocalRoutees = true, useRole = role)).props, diff --git a/akka-cluster/src/test/scala/akka/cluster/AutoDownSpec.scala b/akka-cluster/src/test/scala/akka/cluster/AutoDownSpec.scala index fb2a9c9359..f9bea50285 100644 --- a/akka-cluster/src/test/scala/akka/cluster/AutoDownSpec.scala +++ b/akka-cluster/src/test/scala/akka/cluster/AutoDownSpec.scala @@ -22,7 +22,7 @@ object AutoDownSpec { class AutoDownTestActor( autoDownUnreachableAfter: FiniteDuration, - probe: ActorRef) + probe: ActorRef) extends AutoDownBase(autoDownUnreachableAfter) { override def selfAddress = memberA.address diff --git a/akka-cluster/src/test/scala/akka/cluster/ClusterDomainEventSpec.scala b/akka-cluster/src/test/scala/akka/cluster/ClusterDomainEventSpec.scala index f8072dcd98..0a0db52a6f 100644 --- a/akka-cluster/src/test/scala/akka/cluster/ClusterDomainEventSpec.scala +++ b/akka-cluster/src/test/scala/akka/cluster/ClusterDomainEventSpec.scala @@ -134,14 +134,16 @@ class ClusterDomainEventSpec extends WordSpec with Matchers { val g1 = Gossip(members = SortedSet(aUp, bUp, cUp, dLeaving, eJoining)) val g2 = Gossip(members = SortedSet(bUp, cUp, dExiting, eJoining)) diffRolesLeader(g0, g1, selfDummyAddress) should ===( - Set(RoleLeaderChanged("AA", Some(aUp.address)), + Set( + RoleLeaderChanged("AA", Some(aUp.address)), RoleLeaderChanged("AB", Some(aUp.address)), RoleLeaderChanged("BB", Some(bUp.address)), RoleLeaderChanged("DD", Some(dLeaving.address)), RoleLeaderChanged("DE", Some(dLeaving.address)), RoleLeaderChanged("EE", Some(eUp.address)))) diffRolesLeader(g1, g2, selfDummyAddress) should ===( - Set(RoleLeaderChanged("AA", None), + Set( + RoleLeaderChanged("AA", None), RoleLeaderChanged("AB", Some(bUp.address)), RoleLeaderChanged("DE", Some(eJoining.address)))) } diff --git a/akka-cluster/src/test/scala/akka/cluster/EWMASpec.scala b/akka-cluster/src/test/scala/akka/cluster/EWMASpec.scala index 8d02ea0867..3c30f72232 100644 --- a/akka-cluster/src/test/scala/akka/cluster/EWMASpec.scala +++ b/akka-cluster/src/test/scala/akka/cluster/EWMASpec.scala @@ -93,7 +93,7 @@ class EWMASpec extends AkkaSpec(MetricsEnabledSpec.config) with MetricsCollector } else None } } - streamingDataSet ++= changes.map(m ⇒ m.name -> m) + streamingDataSet ++= changes.map(m ⇒ m.name → m) } } } diff --git a/akka-cluster/src/test/scala/akka/cluster/ReachabilitySpec.scala b/akka-cluster/src/test/scala/akka/cluster/ReachabilitySpec.scala index e83da0971e..8414f91824 100644 --- a/akka-cluster/src/test/scala/akka/cluster/ReachabilitySpec.scala +++ b/akka-cluster/src/test/scala/akka/cluster/ReachabilitySpec.scala @@ -98,7 +98,7 @@ class ReachabilitySpec extends WordSpec with Matchers { Reachability.Record(nodeC, nodeB, Unreachable, 2), Reachability.Record(nodeA, nodeD, Unreachable, 3), Reachability.Record(nodeD, nodeB, Terminated, 4)) - val versions = Map(nodeA -> 3L, nodeC -> 3L, nodeD -> 4L) + val versions = Map(nodeA → 3L, nodeC → 3L, nodeD → 4L) val r = Reachability(records, versions) r.status(nodeA) should ===(Reachable) r.status(nodeB) should ===(Terminated) @@ -136,9 +136,9 @@ class ReachabilitySpec extends WordSpec with Matchers { r.allUnreachableFrom(nodeD) should ===(Set(nodeA, nodeB)) r.observersGroupedByUnreachable should ===(Map( - nodeA -> Set(nodeB, nodeC, nodeD), - nodeB -> Set(nodeD), - nodeE -> Set(nodeA))) + nodeA → Set(nodeB, nodeC, nodeD), + nodeB → Set(nodeD), + nodeE → Set(nodeA))) } "merge by picking latest version of each record" in { @@ -199,11 +199,11 @@ class ReachabilitySpec extends WordSpec with Matchers { } "merge versions correctly" in { - val r1 = Reachability(Vector.empty, Map(nodeA -> 3L, nodeB -> 5L, nodeC -> 7L)) - val r2 = Reachability(Vector.empty, Map(nodeA -> 6L, nodeB -> 2L, nodeD -> 1L)) + val r1 = Reachability(Vector.empty, Map(nodeA → 3L, nodeB → 5L, nodeC → 7L)) + val r2 = Reachability(Vector.empty, Map(nodeA → 6L, nodeB → 2L, nodeD → 1L)) val merged = r1.merge(Set(nodeA, nodeB, nodeC, nodeD, nodeE), r2) - val expected = Map(nodeA -> 6L, nodeB -> 5L, nodeC -> 7L, nodeD -> 1L) + val expected = Map(nodeA → 6L, nodeB → 5L, nodeC → 7L, nodeD → 1L) merged.versions should ===(expected) val merged2 = r2.merge(Set(nodeA, nodeB, nodeC, nodeD, nodeE), r1) diff --git a/akka-cluster/src/test/scala/akka/cluster/protobuf/ClusterMessageSerializerSpec.scala b/akka-cluster/src/test/scala/akka/cluster/protobuf/ClusterMessageSerializerSpec.scala index a3daa63d7e..8ef6d7e938 100644 --- a/akka-cluster/src/test/scala/akka/cluster/protobuf/ClusterMessageSerializerSpec.scala +++ b/akka-cluster/src/test/scala/akka/cluster/protobuf/ClusterMessageSerializerSpec.scala @@ -73,8 +73,10 @@ class ClusterMessageSerializerSpec extends AkkaSpec( checkSerialization(InternalClusterAction.Welcome(uniqueAddress, g2)) - val mg = MetricsGossip(Set(NodeMetrics(a1.address, 4711, Set(Metric("foo", 1.2, None))), - NodeMetrics(b1.address, 4712, Set(Metric("foo", 2.1, Some(EWMA(value = 100.0, alpha = 0.18))), + val mg = MetricsGossip(Set( + NodeMetrics(a1.address, 4711, Set(Metric("foo", 1.2, None))), + NodeMetrics(b1.address, 4712, Set( + Metric("foo", 2.1, Some(EWMA(value = 100.0, alpha = 0.18))), Metric("bar1", Double.MinPositiveValue, None), Metric("bar2", Float.MaxValue, None), Metric("bar3", Int.MaxValue, None), diff --git a/akka-cluster/src/test/scala/akka/cluster/routing/MetricsSelectorSpec.scala b/akka-cluster/src/test/scala/akka/cluster/routing/MetricsSelectorSpec.scala index f08c69e511..235958db52 100644 --- a/akka-cluster/src/test/scala/akka/cluster/routing/MetricsSelectorSpec.scala +++ b/akka-cluster/src/test/scala/akka/cluster/routing/MetricsSelectorSpec.scala @@ -62,15 +62,15 @@ class MetricsSelectorSpec extends WordSpec with Matchers { "CapacityMetricsSelector" must { "calculate weights from capacity" in { - val capacity = Map(a1 -> 0.6, b1 -> 0.3, c1 -> 0.1) + val capacity = Map(a1 → 0.6, b1 → 0.3, c1 → 0.1) val weights = abstractSelector.weights(capacity) - weights should ===(Map(c1 -> 1, b1 -> 3, a1 -> 6)) + weights should ===(Map(c1 → 1, b1 → 3, a1 → 6)) } "handle low and zero capacity" in { - val capacity = Map(a1 -> 0.0, b1 -> 1.0, c1 -> 0.005, d1 -> 0.004) + val capacity = Map(a1 → 0.0, b1 → 1.0, c1 → 0.005, d1 → 0.004) val weights = abstractSelector.weights(capacity) - weights should ===(Map(a1 -> 0, b1 -> 100, c1 -> 1, d1 -> 0)) + weights should ===(Map(a1 → 0, b1 → 100, c1 → 1, d1 → 0)) } } diff --git a/akka-cluster/src/test/scala/akka/cluster/routing/WeightedRouteesSpec.scala b/akka-cluster/src/test/scala/akka/cluster/routing/WeightedRouteesSpec.scala index e09923323c..224394fdae 100644 --- a/akka-cluster/src/test/scala/akka/cluster/routing/WeightedRouteesSpec.scala +++ b/akka-cluster/src/test/scala/akka/cluster/routing/WeightedRouteesSpec.scala @@ -30,7 +30,7 @@ class WeightedRouteesSpec extends AkkaSpec(ConfigFactory.parseString(""" "WeightedRoutees" must { "allocate weighted routees" in { - val weights = Map(a1 -> 1, b1 -> 3, c1 -> 10) + val weights = Map(a1 → 1, b1 → 3, c1 → 10) val weighted = new WeightedRoutees(routees, a1, weights) weighted(1) should ===(routeeA) @@ -46,7 +46,7 @@ class WeightedRouteesSpec extends AkkaSpec(ConfigFactory.parseString(""" empty.total } - val empty2 = new WeightedRoutees(Vector(routeeA), a1, Map(a1 -> 0)) + val empty2 = new WeightedRoutees(Vector(routeeA), a1, Map(a1 → 0)) empty2.isEmpty should ===(true) intercept[IllegalArgumentException] { empty2.total @@ -66,7 +66,7 @@ class WeightedRouteesSpec extends AkkaSpec(ConfigFactory.parseString(""" } "allocate routees for undefined weight" in { - val weights = Map(a1 -> 1, b1 -> 7) + val weights = Map(a1 → 1, b1 → 7) val weighted = new WeightedRoutees(routees, a1, weights) weighted(1) should ===(routeeA) @@ -77,7 +77,7 @@ class WeightedRouteesSpec extends AkkaSpec(ConfigFactory.parseString(""" } "allocate weighted local routees" in { - val weights = Map(a1 -> 2, b1 -> 1, c1 -> 10) + val weights = Map(a1 → 2, b1 → 1, c1 → 10) val routees2 = Vector(testActorRoutee, routeeB, routeeC) val weighted = new WeightedRoutees(routees2, a1, weights) @@ -86,7 +86,7 @@ class WeightedRouteesSpec extends AkkaSpec(ConfigFactory.parseString(""" } "not allocate ref with weight zero" in { - val weights = Map(a1 -> 0, b1 -> 2, c1 -> 10) + val weights = Map(a1 → 0, b1 → 2, c1 → 10) val weighted = new WeightedRoutees(routees, a1, weights) 1 to weighted.total foreach { weighted(_) should not be (routeeA) } diff --git a/akka-contrib/src/main/scala/akka/contrib/circuitbreaker/CircuitBreakerProxy.scala b/akka-contrib/src/main/scala/akka/contrib/circuitbreaker/CircuitBreakerProxy.scala index 64e24e2054..9cd348c7a1 100644 --- a/akka-contrib/src/main/scala/akka/contrib/circuitbreaker/CircuitBreakerProxy.scala +++ b/akka-contrib/src/main/scala/akka/contrib/circuitbreaker/CircuitBreakerProxy.scala @@ -39,13 +39,14 @@ object CircuitBreakerProxy { * @param failureMap function to map a failure into a response message. The failing response message is wrapped * into a [[akka.contrib.circuitbreaker.CircuitBreakerProxy.CircuitOpenFailure]] object */ - def props(target: ActorRef, - maxFailures: Int, - callTimeout: Timeout, - resetTimeout: Timeout, - circuitEventListener: Option[ActorRef], - failureDetector: Any ⇒ Boolean, - failureMap: CircuitOpenFailure ⇒ Any) = + def props( + target: ActorRef, + maxFailures: Int, + callTimeout: Timeout, + resetTimeout: Timeout, + circuitEventListener: Option[ActorRef], + failureDetector: Any ⇒ Boolean, + failureMap: CircuitOpenFailure ⇒ Any) = Props(new CircuitBreakerProxy(target, maxFailures, callTimeout, resetTimeout, circuitEventListener, failureDetector, failureMap)) sealed trait CircuitBreakerCommand @@ -70,8 +71,8 @@ object CircuitBreakerProxy { final case class CircuitBreakerPropsBuilder( maxFailures: Int, callTimeout: Timeout, resetTimeout: Timeout, - circuitEventListener: Option[ActorRef] = None, - failureDetector: Any ⇒ Boolean = { _ ⇒ false }, + circuitEventListener: Option[ActorRef] = None, + failureDetector: Any ⇒ Boolean = { _ ⇒ false }, openCircuitFailureConverter: CircuitOpenFailure ⇒ Any = identity) { def withMaxFailures(value: Int) = copy(maxFailures = value) @@ -100,15 +101,16 @@ object CircuitBreakerProxy { import akka.contrib.circuitbreaker.CircuitBreakerProxy._ final class CircuitBreakerProxy( - target: ActorRef, - maxFailures: Int, - callTimeout: Timeout, - resetTimeout: Timeout, + target: ActorRef, + maxFailures: Int, + callTimeout: Timeout, + resetTimeout: Timeout, circuitEventListener: Option[ActorRef], - failureDetector: Any ⇒ Boolean, - failureMap: CircuitOpenFailure ⇒ Any) extends Actor with ActorLogging with FSM[CircuitBreakerState, CircuitBreakerStateData] { + failureDetector: Any ⇒ Boolean, + failureMap: CircuitOpenFailure ⇒ Any) extends Actor with ActorLogging with FSM[CircuitBreakerState, CircuitBreakerStateData] { import CircuitBreakerInternalEvents._ + import FSM.`→` context watch target @@ -222,20 +224,23 @@ final class CircuitBreakerProxy( val isFailure = failureDetector(response) if (isFailure) { - log.debug("Response '{}' is considered as failure sending self-message to ask incrementing failure count (origin state was {})", + log.debug( + "Response '{}' is considered as failure sending self-message to ask incrementing failure count (origin state was {})", response, state) self ! CallFailed } else { - log.debug("Request '{}' succeeded with response {}, returning response to sender {} and sending message to ask to reset failure count (origin state was {})", + log.debug( + "Request '{}' succeeded with response {}, returning response to sender {} and sending message to ask to reset failure count (origin state was {})", message, response, currentSender, state) self ! CallSucceeded } case Failure(reason) ⇒ - log.debug("Request '{}' to target {} failed with exception {}, sending self-message to ask incrementing failure count (origin state was {})", + log.debug( + "Request '{}' to target {} failed with exception {}, sending self-message to ask incrementing failure count (origin state was {})", message, target, reason, state) self ! CallFailed @@ -243,15 +248,15 @@ final class CircuitBreakerProxy( } onTransition { - case from -> Closed ⇒ + case from → Closed ⇒ log.debug("Moving from state {} to state CLOSED", from) circuitEventListener foreach { _ ! CircuitClosed(self) } - case from -> HalfOpen ⇒ + case from → HalfOpen ⇒ log.debug("Moving from state {} to state HALF OPEN", from) circuitEventListener foreach { _ ! CircuitHalfOpen(self) } - case from -> Open ⇒ + case from → Open ⇒ log.debug("Moving from state {} to state OPEN", from) circuitEventListener foreach { _ ! CircuitOpen(self) } } diff --git a/akka-contrib/src/main/scala/akka/contrib/pattern/ReliableProxy.scala b/akka-contrib/src/main/scala/akka/contrib/pattern/ReliableProxy.scala index dea049e2e4..963a5d1eb0 100644 --- a/akka-contrib/src/main/scala/akka/contrib/pattern/ReliableProxy.scala +++ b/akka-contrib/src/main/scala/akka/contrib/pattern/ReliableProxy.scala @@ -227,6 +227,7 @@ import ReliableProxy._ class ReliableProxy(targetPath: ActorPath, retryAfter: FiniteDuration, reconnectAfter: Option[FiniteDuration], maxConnectAttempts: Option[Int]) extends Actor with LoggingFSM[State, Vector[Message]] with ReliableProxyDebugLogging { + import FSM.`→` var tunnel: ActorRef = _ var currentSerial: Int = 0 @@ -284,9 +285,9 @@ class ReliableProxy(targetPath: ActorPath, retryAfter: FiniteDuration, } onTransition { - case _ -> Active ⇒ scheduleTick() - case Active -> Idle ⇒ cancelTimer(resendTimer) - case _ -> Connecting ⇒ scheduleReconnectTick() + case _ → Active ⇒ scheduleTick() + case Active → Idle ⇒ cancelTimer(resendTimer) + case _ → Connecting ⇒ scheduleReconnectTick() } when(Active) { diff --git a/akka-contrib/src/main/scala/akka/contrib/throttle/TimerBasedThrottler.scala b/akka-contrib/src/main/scala/akka/contrib/throttle/TimerBasedThrottler.scala index 51b204b765..5ef9e3c70a 100644 --- a/akka-contrib/src/main/scala/akka/contrib/throttle/TimerBasedThrottler.scala +++ b/akka-contrib/src/main/scala/akka/contrib/throttle/TimerBasedThrottler.scala @@ -109,9 +109,10 @@ private[throttle] object TimerBasedThrottler { final case class Message(message: Any, sender: ActorRef) // The data of the FSM - final case class Data(target: Option[ActorRef], - callsLeftInThisPeriod: Int, - queue: Q[Message]) + final case class Data( + target: Option[ActorRef], + callsLeftInThisPeriod: Int, + queue: Q[Message]) } /** @@ -214,6 +215,8 @@ private[throttle] object TimerBasedThrottler { * @see [[akka.contrib.throttle.Throttler]] */ class TimerBasedThrottler(var rate: Rate) extends Actor with FSM[State, Data] { + import FSM.`→` + startWith(Idle, Data(None, rate.numberOfCalls, Q())) // Idle: no messages, or target not set @@ -277,8 +280,8 @@ class TimerBasedThrottler(var rate: Rate) extends Actor with FSM[State, Data] { } onTransition { - case Idle -> Active ⇒ startTimer(rate) - case Active -> Idle ⇒ stopTimer() + case Idle → Active ⇒ startTimer(rate) + case Active → Idle ⇒ stopTimer() } initialize() diff --git a/akka-contrib/src/test/scala/akka/contrib/circuitbreaker/CircuitBreakerProxySpec.scala b/akka-contrib/src/test/scala/akka/contrib/circuitbreaker/CircuitBreakerProxySpec.scala index 8ba86e42df..b98ee01f77 100644 --- a/akka-contrib/src/test/scala/akka/contrib/circuitbreaker/CircuitBreakerProxySpec.scala +++ b/akka-contrib/src/test/scala/akka/contrib/circuitbreaker/CircuitBreakerProxySpec.scala @@ -21,8 +21,8 @@ class CircuitBreakerProxySpec extends AkkaSpec() with GivenWhenThen { callTimeout = 200 millis, resetTimeout = 1 second, failureDetector = { - _ == "FAILURE" - }) + _ == "FAILURE" + }) trait CircuitBreakerScenario { val sender = TestProbe() diff --git a/akka-contrib/src/test/scala/akka/contrib/circuitbreaker/sample/CircuitBreaker.scala b/akka-contrib/src/test/scala/akka/contrib/circuitbreaker/sample/CircuitBreaker.scala index 8e5dc3aac3..7edea90210 100644 --- a/akka-contrib/src/test/scala/akka/contrib/circuitbreaker/sample/CircuitBreaker.scala +++ b/akka-contrib/src/test/scala/akka/contrib/circuitbreaker/sample/CircuitBreaker.scala @@ -64,11 +64,11 @@ class CircuitBreaker(potentiallyFailingService: ActorRef) extends Actor with Act CircuitBreakerPropsBuilder(maxFailures = 3, callTimeout = 2.seconds, resetTimeout = 30.seconds) .copy( failureDetector = { - _ match { - case Response(Left(_)) ⇒ true - case _ ⇒ false - } - }) + _ match { + case Response(Left(_)) ⇒ true + case _ ⇒ false + } + }) .props(potentiallyFailingService), "serviceCircuitBreaker") @@ -106,15 +106,15 @@ class CircuitBreakerAsk(potentiallyFailingService: ActorRef) extends Actor with CircuitBreakerPropsBuilder(maxFailures = 3, callTimeout = askTimeout, resetTimeout = 30.seconds) .copy( failureDetector = { - _ match { - case Response(Left(_)) ⇒ true - case _ ⇒ false - } - }) + _ match { + case Response(Left(_)) ⇒ true + case _ ⇒ false + } + }) .copy( openCircuitFailureConverter = { failure ⇒ - Left(s"Circuit open when processing ${failure.failedMsg}") - }) + Left(s"Circuit open when processing ${failure.failedMsg}") + }) .props(potentiallyFailingService), "serviceCircuitBreaker") diff --git a/akka-contrib/src/test/scala/akka/contrib/mailbox/PeekMailboxSpec.scala b/akka-contrib/src/test/scala/akka/contrib/mailbox/PeekMailboxSpec.scala index 2fdbcc5c6e..065480f9b1 100644 --- a/akka-contrib/src/test/scala/akka/contrib/mailbox/PeekMailboxSpec.scala +++ b/akka-contrib/src/test/scala/akka/contrib/mailbox/PeekMailboxSpec.scala @@ -121,7 +121,8 @@ object MyApp extends App { } """)) - val myActor = system.actorOf(Props[MyActor].withDispatcher("peek-dispatcher"), + val myActor = system.actorOf( + Props[MyActor].withDispatcher("peek-dispatcher"), name = "myActor") myActor ! "Hello" diff --git a/akka-contrib/src/test/scala/akka/contrib/pattern/AggregatorSpec.scala b/akka-contrib/src/test/scala/akka/contrib/pattern/AggregatorSpec.scala index 31a826f587..0e7b968da4 100644 --- a/akka-contrib/src/test/scala/akka/contrib/pattern/AggregatorSpec.scala +++ b/akka-contrib/src/test/scala/akka/contrib/pattern/AggregatorSpec.scala @@ -26,8 +26,9 @@ case object MoneyMarket extends AccountType final case class GetCustomerAccountBalances(id: Long, accountTypes: Set[AccountType]) final case class GetAccountBalances(id: Long) -final case class AccountBalances(accountType: AccountType, - balance: Option[List[(Long, BigDecimal)]]) +final case class AccountBalances( + accountType: AccountType, + balance: Option[List[(Long, BigDecimal)]]) final case class CheckingAccountBalances(balances: Option[List[(Long, BigDecimal)]]) final case class SavingsAccountBalances(balances: Option[List[(Long, BigDecimal)]]) @@ -69,8 +70,9 @@ class AccountBalanceRetriever extends Actor with Aggregator { } //#initial-expect - class AccountAggregator(originalSender: ActorRef, - id: Long, types: Set[AccountType]) { + class AccountAggregator( + originalSender: ActorRef, + id: Long, types: Set[AccountType]) { val results = mutable.ArrayBuffer.empty[(AccountType, Option[List[(Long, BigDecimal)]])] @@ -95,7 +97,7 @@ class AccountBalanceRetriever extends Actor with Aggregator { context.actorOf(Props[CheckingAccountProxy]) ! GetAccountBalances(id) expectOnce { case CheckingAccountBalances(balances) ⇒ - results += (Checking -> balances) + results += (Checking → balances) collectBalances() } } @@ -105,7 +107,7 @@ class AccountBalanceRetriever extends Actor with Aggregator { context.actorOf(Props[SavingsAccountProxy]) ! GetAccountBalances(id) expectOnce { case SavingsAccountBalances(balances) ⇒ - results += (Savings -> balances) + results += (Savings → balances) collectBalances() } } @@ -114,7 +116,7 @@ class AccountBalanceRetriever extends Actor with Aggregator { context.actorOf(Props[MoneyMarketAccountProxy]) ! GetAccountBalances(id) expectOnce { case MoneyMarketAccountBalances(balances) ⇒ - results += (MoneyMarket -> balances) + results += (MoneyMarket → balances) collectBalances() } } diff --git a/akka-contrib/src/test/scala/akka/contrib/pattern/ReceivePipelineSpec.scala b/akka-contrib/src/test/scala/akka/contrib/pattern/ReceivePipelineSpec.scala index 6035755862..77b2a2ff4c 100644 --- a/akka-contrib/src/test/scala/akka/contrib/pattern/ReceivePipelineSpec.scala +++ b/akka-contrib/src/test/scala/akka/contrib/pattern/ReceivePipelineSpec.scala @@ -409,10 +409,10 @@ object MixinSample extends App { //#mixin-model val texts = Map( - "that.rug_EN" -> "That rug really tied the room together.", - "your.opinion_EN" -> "Yeah, well, you know, that's just, like, your opinion, man.", - "that.rug_ES" -> "Esa alfombra realmente completaba la sala.", - "your.opinion_ES" -> "Sí, bueno, ya sabes, eso es solo, como, tu opinion, amigo.") + "that.rug_EN" → "That rug really tied the room together.", + "your.opinion_EN" → "Yeah, well, you know, that's just, like, your opinion, man.", + "that.rug_ES" → "Esa alfombra realmente completaba la sala.", + "your.opinion_ES" → "Sí, bueno, ya sabes, eso es solo, como, tu opinion, amigo.") case class I18nText(locale: String, key: String) case class Message(author: Option[String], text: Any) diff --git a/akka-contrib/src/test/scala/akka/contrib/throttle/TimerBasedThrottlerSpec.scala b/akka-contrib/src/test/scala/akka/contrib/throttle/TimerBasedThrottlerSpec.scala index 6b6f7a0800..2242f26462 100644 --- a/akka-contrib/src/test/scala/akka/contrib/throttle/TimerBasedThrottlerSpec.scala +++ b/akka-contrib/src/test/scala/akka/contrib/throttle/TimerBasedThrottlerSpec.scala @@ -46,7 +46,8 @@ class TimerBasedThrottlerSpec extends TestKit(ActorSystem("TimerBasedThrottlerSp //#demo-code val printer = system.actorOf(Props[PrintActor]) // The throttler for this example, setting the rate - val throttler = system.actorOf(Props(classOf[TimerBasedThrottler], + val throttler = system.actorOf(Props( + classOf[TimerBasedThrottler], 3 msgsPer 1.second)) // Set the target throttler ! SetTarget(Some(printer)) diff --git a/akka-distributed-data/src/main/scala/akka/cluster/ddata/GCounter.scala b/akka-distributed-data/src/main/scala/akka/cluster/ddata/GCounter.scala index 2b135780ab..df8d3460e0 100644 --- a/akka-distributed-data/src/main/scala/akka/cluster/ddata/GCounter.scala +++ b/akka-distributed-data/src/main/scala/akka/cluster/ddata/GCounter.scala @@ -83,8 +83,8 @@ final class GCounter private[akka] ( else state.get(key) match { case Some(v) ⇒ val tot = v + delta - assignAncestor(new GCounter(state + (key -> tot))) - case None ⇒ assignAncestor(new GCounter(state + (key -> delta))) + assignAncestor(new GCounter(state + (key → tot))) + case None ⇒ assignAncestor(new GCounter(state + (key → delta))) } } diff --git a/akka-distributed-data/src/main/scala/akka/cluster/ddata/LWWMap.scala b/akka-distributed-data/src/main/scala/akka/cluster/ddata/LWWMap.scala index 6ca4c8824d..86ee1f5c11 100644 --- a/akka-distributed-data/src/main/scala/akka/cluster/ddata/LWWMap.scala +++ b/akka-distributed-data/src/main/scala/akka/cluster/ddata/LWWMap.scala @@ -47,7 +47,7 @@ final class LWWMap[A] private[akka] ( /** * Scala API: All entries of the map. */ - def entries: Map[String, A] = underlying.entries.map { case (k, r) ⇒ k -> r.value } + def entries: Map[String, A] = underlying.entries.map { case (k, r) ⇒ k → r.value } /** * Java API: All entries of the map. diff --git a/akka-distributed-data/src/main/scala/akka/cluster/ddata/LWWRegister.scala b/akka-distributed-data/src/main/scala/akka/cluster/ddata/LWWRegister.scala index a4bf881ea1..77eca287f5 100644 --- a/akka-distributed-data/src/main/scala/akka/cluster/ddata/LWWRegister.scala +++ b/akka-distributed-data/src/main/scala/akka/cluster/ddata/LWWRegister.scala @@ -93,8 +93,8 @@ object LWWRegister { @SerialVersionUID(1L) final class LWWRegister[A] private[akka] ( private[akka] val node: UniqueAddress, - val value: A, - val timestamp: Long) + val value: A, + val timestamp: Long) extends ReplicatedData with ReplicatedDataSerialization { import LWWRegister.{ Clock, defaultClock } diff --git a/akka-distributed-data/src/main/scala/akka/cluster/ddata/ORMap.scala b/akka-distributed-data/src/main/scala/akka/cluster/ddata/ORMap.scala index 66bc02d31c..2280ff2456 100644 --- a/akka-distributed-data/src/main/scala/akka/cluster/ddata/ORMap.scala +++ b/akka-distributed-data/src/main/scala/akka/cluster/ddata/ORMap.scala @@ -33,7 +33,7 @@ object ORMap { */ @SerialVersionUID(1L) final class ORMap[A <: ReplicatedData] private[akka] ( - private[akka] val keys: ORSet[String], + private[akka] val keys: ORSet[String], private[akka] val values: Map[String, A]) extends ReplicatedData with ReplicatedDataSerialization with RemovedNodePruning { diff --git a/akka-distributed-data/src/main/scala/akka/cluster/ddata/ORMultiMap.scala b/akka-distributed-data/src/main/scala/akka/cluster/ddata/ORMultiMap.scala index 8f49a63dfb..a74240217d 100644 --- a/akka-distributed-data/src/main/scala/akka/cluster/ddata/ORMultiMap.scala +++ b/akka-distributed-data/src/main/scala/akka/cluster/ddata/ORMultiMap.scala @@ -52,7 +52,7 @@ final class ORMultiMap[A] private[akka] (private[akka] val underlying: ORMap[ORS * Scala API: All entries of a multimap where keys are strings and values are sets. */ def entries: Map[String, Set[A]] = - underlying.entries.map { case (k, v) ⇒ k -> v.elements } + underlying.entries.map { case (k, v) ⇒ k → v.elements } /** * Java API: All entries of a multimap where keys are strings and values are sets. diff --git a/akka-distributed-data/src/main/scala/akka/cluster/ddata/ORSet.scala b/akka-distributed-data/src/main/scala/akka/cluster/ddata/ORSet.scala index 89fe4edcf5..6ed208ece9 100644 --- a/akka-distributed-data/src/main/scala/akka/cluster/ddata/ORSet.scala +++ b/akka-distributed-data/src/main/scala/akka/cluster/ddata/ORSet.scala @@ -201,7 +201,7 @@ object ORSet { @SerialVersionUID(1L) final class ORSet[A] private[akka] ( private[akka] val elementsMap: Map[A, ORSet.Dot], - private[akka] val vvector: VersionVector) + private[akka] val vvector: VersionVector) extends ReplicatedData with ReplicatedDataSerialization with RemovedNodePruning with FastMerge { type T = ORSet[A] diff --git a/akka-distributed-data/src/main/scala/akka/cluster/ddata/PNCounter.scala b/akka-distributed-data/src/main/scala/akka/cluster/ddata/PNCounter.scala index e53c501443..5cf0d440b9 100644 --- a/akka-distributed-data/src/main/scala/akka/cluster/ddata/PNCounter.scala +++ b/akka-distributed-data/src/main/scala/akka/cluster/ddata/PNCounter.scala @@ -90,18 +90,21 @@ final class PNCounter private[akka] ( else this override def merge(that: PNCounter): PNCounter = - copy(increments = that.increments.merge(this.increments), + copy( + increments = that.increments.merge(this.increments), decrements = that.decrements.merge(this.decrements)) override def needPruningFrom(removedNode: UniqueAddress): Boolean = increments.needPruningFrom(removedNode) || decrements.needPruningFrom(removedNode) override def prune(removedNode: UniqueAddress, collapseInto: UniqueAddress): PNCounter = - copy(increments = increments.prune(removedNode, collapseInto), + copy( + increments = increments.prune(removedNode, collapseInto), decrements = decrements.prune(removedNode, collapseInto)) override def pruningCleanup(removedNode: UniqueAddress): PNCounter = - copy(increments = increments.pruningCleanup(removedNode), + copy( + increments = increments.pruningCleanup(removedNode), decrements = decrements.pruningCleanup(removedNode)) private def copy(increments: GCounter = this.increments, decrements: GCounter = this.decrements): PNCounter = diff --git a/akka-distributed-data/src/main/scala/akka/cluster/ddata/PNCounterMap.scala b/akka-distributed-data/src/main/scala/akka/cluster/ddata/PNCounterMap.scala index 999ce0c659..fe90897ad7 100644 --- a/akka-distributed-data/src/main/scala/akka/cluster/ddata/PNCounterMap.scala +++ b/akka-distributed-data/src/main/scala/akka/cluster/ddata/PNCounterMap.scala @@ -34,12 +34,12 @@ final class PNCounterMap private[akka] ( type T = PNCounterMap /** Scala API */ - def entries: Map[String, BigInt] = underlying.entries.map { case (k, c) ⇒ k -> c.value } + def entries: Map[String, BigInt] = underlying.entries.map { case (k, c) ⇒ k → c.value } /** Java API */ def getEntries: java.util.Map[String, BigInteger] = { import scala.collection.JavaConverters._ - underlying.entries.map { case (k, c) ⇒ k -> c.value.bigInteger }.asJava + underlying.entries.map { case (k, c) ⇒ k → c.value.bigInteger }.asJava } /** diff --git a/akka-distributed-data/src/main/scala/akka/cluster/ddata/Replicator.scala b/akka-distributed-data/src/main/scala/akka/cluster/ddata/Replicator.scala index 8bc67711db..5a067d0090 100644 --- a/akka-distributed-data/src/main/scala/akka/cluster/ddata/Replicator.scala +++ b/akka-distributed-data/src/main/scala/akka/cluster/ddata/Replicator.scala @@ -93,13 +93,13 @@ object ReplicatorSettings { * be configured to worst case in a healthy cluster. */ final class ReplicatorSettings( - val role: Option[String], - val gossipInterval: FiniteDuration, + val role: Option[String], + val gossipInterval: FiniteDuration, val notifySubscribersInterval: FiniteDuration, - val maxDeltaElements: Int, - val dispatcher: String, - val pruningInterval: FiniteDuration, - val maxPruningDissemination: FiniteDuration) { + val maxDeltaElements: Int, + val dispatcher: String, + val pruningInterval: FiniteDuration, + val maxPruningDissemination: FiniteDuration) { def withRole(role: String): ReplicatorSettings = copy(role = ReplicatorSettings.roleOption(role)) @@ -126,13 +126,13 @@ final class ReplicatorSettings( copy(pruningInterval = pruningInterval, maxPruningDissemination = maxPruningDissemination) private def copy( - role: Option[String] = role, - gossipInterval: FiniteDuration = gossipInterval, + role: Option[String] = role, + gossipInterval: FiniteDuration = gossipInterval, notifySubscribersInterval: FiniteDuration = notifySubscribersInterval, - maxDeltaElements: Int = maxDeltaElements, - dispatcher: String = dispatcher, - pruningInterval: FiniteDuration = pruningInterval, - maxPruningDissemination: FiniteDuration = maxPruningDissemination): ReplicatorSettings = + maxDeltaElements: Int = maxDeltaElements, + dispatcher: String = dispatcher, + pruningInterval: FiniteDuration = pruningInterval, + maxPruningDissemination: FiniteDuration = maxPruningDissemination): ReplicatorSettings = new ReplicatorSettings(role, gossipInterval, notifySubscribersInterval, maxDeltaElements, dispatcher, pruningInterval, maxPruningDissemination) } @@ -471,7 +471,7 @@ object Replicator { val NotFoundDigest: Digest = ByteString(-1) final case class DataEnvelope( - data: ReplicatedData, + data: ReplicatedData, pruning: Map[UniqueAddress, PruningState] = Map.empty) extends ReplicatorMessage { @@ -735,7 +735,8 @@ final class Replicator(settings: ReplicatorSettings) extends Actor with ActorLog val selfUniqueAddress = cluster.selfUniqueAddress require(!cluster.isTerminated, "Cluster node must not be terminated") - require(role.forall(cluster.selfRoles.contains), + require( + role.forall(cluster.selfRoles.contains), s"This cluster member [${selfAddress}] doesn't have the role [$role]") //Start periodic gossip to random nodes in cluster @@ -899,7 +900,8 @@ final class Replicator(settings: ReplicatorSettings) extends Actor with ActorLog val merged = envelope.merge(pruningCleanupTombstoned(writeEnvelope)).addSeen(selfAddress) setData(key, merged) } else { - log.warning("Wrong type for writing [{}], existing type [{}], got [{}]", + log.warning( + "Wrong type for writing [{}], existing type [{}], got [{}]", key, existing.getClass.getName, writeEnvelope.data.getClass.getName) } case None ⇒ @@ -1048,14 +1050,14 @@ final class Replicator(settings: ReplicatorSettings) extends Actor with ActorLog if (keys.nonEmpty) { if (log.isDebugEnabled) log.debug("Sending gossip to [{}], containing [{}]", sender().path.address, keys.mkString(", ")) - val g = Gossip(keys.map(k ⇒ k -> getData(k).get)(collection.breakOut), sendBack = otherDifferentKeys.nonEmpty) + val g = Gossip(keys.map(k ⇒ k → getData(k).get)(collection.breakOut), sendBack = otherDifferentKeys.nonEmpty) sender() ! g } val myMissingKeys = otherKeys diff myKeys if (myMissingKeys.nonEmpty) { if (log.isDebugEnabled) log.debug("Sending gossip status to [{}], requesting missing [{}]", sender().path.address, myMissingKeys.mkString(", ")) - val status = Status(myMissingKeys.map(k ⇒ k -> NotFoundDigest)(collection.breakOut), chunk, totChunks) + val status = Status(myMissingKeys.map(k ⇒ k → NotFoundDigest)(collection.breakOut), chunk, totChunks) sender() ! status } } @@ -1305,12 +1307,12 @@ private[akka] abstract class ReadWriteAggregator extends Actor { */ private[akka] object WriteAggregator { def props( - key: KeyR, - envelope: Replicator.Internal.DataEnvelope, + key: KeyR, + envelope: Replicator.Internal.DataEnvelope, consistency: Replicator.WriteConsistency, - req: Option[Any], - nodes: Set[Address], - replyTo: ActorRef): Props = + req: Option[Any], + nodes: Set[Address], + replyTo: ActorRef): Props = Props(new WriteAggregator(key, envelope, consistency, req, nodes, replyTo)) .withDeploy(Deploy.local) } @@ -1319,12 +1321,12 @@ private[akka] object WriteAggregator { * INTERNAL API */ private[akka] class WriteAggregator( - key: KeyR, - envelope: Replicator.Internal.DataEnvelope, - consistency: Replicator.WriteConsistency, - req: Option[Any], + key: KeyR, + envelope: Replicator.Internal.DataEnvelope, + consistency: Replicator.WriteConsistency, + req: Option[Any], override val nodes: Set[Address], - replyTo: ActorRef) extends ReadWriteAggregator { + replyTo: ActorRef) extends ReadWriteAggregator { import Replicator._ import Replicator.Internal._ @@ -1384,12 +1386,12 @@ private[akka] class WriteAggregator( */ private[akka] object ReadAggregator { def props( - key: KeyR, + key: KeyR, consistency: Replicator.ReadConsistency, - req: Option[Any], - nodes: Set[Address], - localValue: Option[Replicator.Internal.DataEnvelope], - replyTo: ActorRef): Props = + req: Option[Any], + nodes: Set[Address], + localValue: Option[Replicator.Internal.DataEnvelope], + replyTo: ActorRef): Props = Props(new ReadAggregator(key, consistency, req, nodes, localValue, replyTo)) .withDeploy(Deploy.local) @@ -1399,12 +1401,12 @@ private[akka] object ReadAggregator { * INTERNAL API */ private[akka] class ReadAggregator( - key: KeyR, - consistency: Replicator.ReadConsistency, - req: Option[Any], + key: KeyR, + consistency: Replicator.ReadConsistency, + req: Option[Any], override val nodes: Set[Address], - localValue: Option[Replicator.Internal.DataEnvelope], - replyTo: ActorRef) extends ReadWriteAggregator { + localValue: Option[Replicator.Internal.DataEnvelope], + replyTo: ActorRef) extends ReadWriteAggregator { import Replicator._ import Replicator.Internal._ diff --git a/akka-distributed-data/src/main/scala/akka/cluster/ddata/VersionVector.scala b/akka-distributed-data/src/main/scala/akka/cluster/ddata/VersionVector.scala index 99ee99b68f..e0a150ca11 100644 --- a/akka-distributed-data/src/main/scala/akka/cluster/ddata/VersionVector.scala +++ b/akka-distributed-data/src/main/scala/akka/cluster/ddata/VersionVector.scala @@ -262,7 +262,7 @@ final case class OneVersionVector private[akka] (node: UniqueAddress, version: L private[akka] override def increment(n: UniqueAddress): VersionVector = { val v = Timestamp.counter.getAndIncrement() if (n == node) copy(version = v) - else ManyVersionVector(TreeMap(node -> version, n -> v)) + else ManyVersionVector(TreeMap(node → version, n → v)) } /** INTERNAL API */ @@ -282,7 +282,7 @@ final case class OneVersionVector private[akka] (node: UniqueAddress, version: L that match { case OneVersionVector(n2, v2) ⇒ if (node == n2) if (version >= v2) this else OneVersionVector(n2, v2) - else ManyVersionVector(TreeMap(node -> version, n2 -> v2)) + else ManyVersionVector(TreeMap(node → version, n2 → v2)) case ManyVersionVector(vs2) ⇒ val v2 = vs2.getOrElse(node, Timestamp.Zero) val mergedVersions = diff --git a/akka-distributed-data/src/main/scala/akka/cluster/ddata/protobuf/ReplicatedDataSerializer.scala b/akka-distributed-data/src/main/scala/akka/cluster/ddata/protobuf/ReplicatedDataSerializer.scala index 41f9d31557..eaf2b61692 100644 --- a/akka-distributed-data/src/main/scala/akka/cluster/ddata/protobuf/ReplicatedDataSerializer.scala +++ b/akka-distributed-data/src/main/scala/akka/cluster/ddata/protobuf/ReplicatedDataSerializer.scala @@ -52,29 +52,29 @@ class ReplicatedDataSerializer(val system: ExtendedActorSystem) private val VersionVectorManifest = "L" private val fromBinaryMap = collection.immutable.HashMap[String, Array[Byte] ⇒ AnyRef]( - GSetManifest -> gsetFromBinary, - ORSetManifest -> orsetFromBinary, - FlagManifest -> flagFromBinary, - LWWRegisterManifest -> lwwRegisterFromBinary, - GCounterManifest -> gcounterFromBinary, - PNCounterManifest -> pncounterFromBinary, - ORMapManifest -> ormapFromBinary, - LWWMapManifest -> lwwmapFromBinary, - PNCounterMapManifest -> pncountermapFromBinary, - ORMultiMapManifest -> multimapFromBinary, - DeletedDataManifest -> (_ ⇒ DeletedData), - VersionVectorManifest -> versionVectorFromBinary, + GSetManifest → gsetFromBinary, + ORSetManifest → orsetFromBinary, + FlagManifest → flagFromBinary, + LWWRegisterManifest → lwwRegisterFromBinary, + GCounterManifest → gcounterFromBinary, + PNCounterManifest → pncounterFromBinary, + ORMapManifest → ormapFromBinary, + LWWMapManifest → lwwmapFromBinary, + PNCounterMapManifest → pncountermapFromBinary, + ORMultiMapManifest → multimapFromBinary, + DeletedDataManifest → (_ ⇒ DeletedData), + VersionVectorManifest → versionVectorFromBinary, - GSetKeyManifest -> (bytes ⇒ GSetKey(keyIdFromBinary(bytes))), - ORSetKeyManifest -> (bytes ⇒ ORSetKey(keyIdFromBinary(bytes))), - FlagKeyManifest -> (bytes ⇒ FlagKey(keyIdFromBinary(bytes))), - LWWRegisterKeyManifest -> (bytes ⇒ LWWRegisterKey(keyIdFromBinary(bytes))), - GCounterKeyManifest -> (bytes ⇒ GCounterKey(keyIdFromBinary(bytes))), - PNCounterKeyManifest -> (bytes ⇒ PNCounterKey(keyIdFromBinary(bytes))), - ORMapKeyManifest -> (bytes ⇒ ORMapKey(keyIdFromBinary(bytes))), - LWWMapKeyManifest -> (bytes ⇒ LWWMapKey(keyIdFromBinary(bytes))), - PNCounterMapKeyManifest -> (bytes ⇒ PNCounterMapKey(keyIdFromBinary(bytes))), - ORMultiMapKeyManifest -> (bytes ⇒ ORMultiMapKey(keyIdFromBinary(bytes)))) + GSetKeyManifest → (bytes ⇒ GSetKey(keyIdFromBinary(bytes))), + ORSetKeyManifest → (bytes ⇒ ORSetKey(keyIdFromBinary(bytes))), + FlagKeyManifest → (bytes ⇒ FlagKey(keyIdFromBinary(bytes))), + LWWRegisterKeyManifest → (bytes ⇒ LWWRegisterKey(keyIdFromBinary(bytes))), + GCounterKeyManifest → (bytes ⇒ GCounterKey(keyIdFromBinary(bytes))), + PNCounterKeyManifest → (bytes ⇒ PNCounterKey(keyIdFromBinary(bytes))), + ORMapKeyManifest → (bytes ⇒ ORMapKey(keyIdFromBinary(bytes))), + LWWMapKeyManifest → (bytes ⇒ LWWMapKey(keyIdFromBinary(bytes))), + PNCounterMapKeyManifest → (bytes ⇒ PNCounterMapKey(keyIdFromBinary(bytes))), + ORMultiMapKeyManifest → (bytes ⇒ ORMultiMapKey(keyIdFromBinary(bytes)))) override def manifest(obj: AnyRef): String = obj match { case _: ORSet[_] ⇒ ORSetManifest @@ -284,7 +284,7 @@ class ReplicatedDataSerializer(val system: ExtendedActorSystem) def gcounterFromProto(gcounter: rd.GCounter): GCounter = { new GCounter(state = gcounter.getEntriesList.asScala.map(entry ⇒ - uniqueAddressFromProto(entry.getNode) -> BigInt(entry.getValue.toByteArray))(breakOut)) + uniqueAddressFromProto(entry.getNode) → BigInt(entry.getValue.toByteArray))(breakOut)) } def pncounterToProto(pncounter: PNCounter): rd.PNCounter = @@ -322,7 +322,7 @@ class ReplicatedDataSerializer(val system: ExtendedActorSystem) VersionVector(uniqueAddressFromProto(entries.get(0).getNode), entries.get(0).getVersion) else { val versions: TreeMap[UniqueAddress, Long] = versionVector.getEntriesList.asScala.map(entry ⇒ - uniqueAddressFromProto(entry.getNode) -> entry.getVersion)(breakOut) + uniqueAddressFromProto(entry.getNode) → entry.getVersion)(breakOut) VersionVector(versions) } } @@ -341,7 +341,7 @@ class ReplicatedDataSerializer(val system: ExtendedActorSystem) def ormapFromProto(ormap: rd.ORMap): ORMap[ReplicatedData] = { val entries = ormap.getEntriesList.asScala.map(entry ⇒ - entry.getKey -> otherMessageFromProto(entry.getValue).asInstanceOf[ReplicatedData]).toMap + entry.getKey → otherMessageFromProto(entry.getValue).asInstanceOf[ReplicatedData]).toMap new ORMap( keys = orsetFromProto(ormap.getKeys).asInstanceOf[ORSet[String]], entries) @@ -361,7 +361,7 @@ class ReplicatedDataSerializer(val system: ExtendedActorSystem) def lwwmapFromProto(lwwmap: rd.LWWMap): LWWMap[Any] = { val entries = lwwmap.getEntriesList.asScala.map(entry ⇒ - entry.getKey -> lwwRegisterFromProto(entry.getValue)).toMap + entry.getKey → lwwRegisterFromProto(entry.getValue)).toMap new LWWMap(new ORMap( keys = orsetFromProto(lwwmap.getKeys).asInstanceOf[ORSet[String]], entries)) @@ -381,7 +381,7 @@ class ReplicatedDataSerializer(val system: ExtendedActorSystem) def pncountermapFromProto(pncountermap: rd.PNCounterMap): PNCounterMap = { val entries = pncountermap.getEntriesList.asScala.map(entry ⇒ - entry.getKey -> pncounterFromProto(entry.getValue)).toMap + entry.getKey → pncounterFromProto(entry.getValue)).toMap new PNCounterMap(new ORMap( keys = orsetFromProto(pncountermap.getKeys).asInstanceOf[ORSet[String]], entries)) @@ -401,7 +401,7 @@ class ReplicatedDataSerializer(val system: ExtendedActorSystem) def multimapFromProto(multimap: rd.ORMultiMap): ORMultiMap[Any] = { val entries = multimap.getEntriesList.asScala.map(entry ⇒ - entry.getKey -> orsetFromProto(entry.getValue)).toMap + entry.getKey → orsetFromProto(entry.getValue)).toMap new ORMultiMap(new ORMap( keys = orsetFromProto(multimap.getKeys).asInstanceOf[ORSet[String]], entries)) diff --git a/akka-distributed-data/src/main/scala/akka/cluster/ddata/protobuf/ReplicatorMessageSerializer.scala b/akka-distributed-data/src/main/scala/akka/cluster/ddata/protobuf/ReplicatorMessageSerializer.scala index 42f46ec7c7..4df002af7b 100644 --- a/akka-distributed-data/src/main/scala/akka/cluster/ddata/protobuf/ReplicatorMessageSerializer.scala +++ b/akka-distributed-data/src/main/scala/akka/cluster/ddata/protobuf/ReplicatorMessageSerializer.scala @@ -169,20 +169,20 @@ class ReplicatorMessageSerializer(val system: ExtendedActorSystem) val GossipManifest = "N" private val fromBinaryMap = collection.immutable.HashMap[String, Array[Byte] ⇒ AnyRef]( - GetManifest -> getFromBinary, - GetSuccessManifest -> getSuccessFromBinary, - NotFoundManifest -> notFoundFromBinary, - GetFailureManifest -> getFailureFromBinary, - SubscribeManifest -> subscribeFromBinary, - UnsubscribeManifest -> unsubscribeFromBinary, - ChangedManifest -> changedFromBinary, - DataEnvelopeManifest -> dataEnvelopeFromBinary, - WriteManifest -> writeFromBinary, - WriteAckManifest -> (_ ⇒ WriteAck), - ReadManifest -> readFromBinary, - ReadResultManifest -> readResultFromBinary, - StatusManifest -> statusFromBinary, - GossipManifest -> gossipFromBinary) + GetManifest → getFromBinary, + GetSuccessManifest → getSuccessFromBinary, + NotFoundManifest → notFoundFromBinary, + GetFailureManifest → getFailureFromBinary, + SubscribeManifest → subscribeFromBinary, + UnsubscribeManifest → unsubscribeFromBinary, + ChangedManifest → changedFromBinary, + DataEnvelopeManifest → dataEnvelopeFromBinary, + WriteManifest → writeFromBinary, + WriteAckManifest → (_ ⇒ WriteAck), + ReadManifest → readFromBinary, + ReadResultManifest → readResultFromBinary, + StatusManifest → statusFromBinary, + GossipManifest → gossipFromBinary) override def manifest(obj: AnyRef): String = obj match { case _: DataEnvelope ⇒ DataEnvelopeManifest @@ -243,8 +243,9 @@ class ReplicatorMessageSerializer(val system: ExtendedActorSystem) private def statusFromBinary(bytes: Array[Byte]): Status = { val status = dm.Status.parseFrom(bytes) - Status(status.getEntriesList.asScala.map(e ⇒ - e.getKey -> AkkaByteString(e.getDigest.toByteArray()))(breakOut), + Status( + status.getEntriesList.asScala.map(e ⇒ + e.getKey → AkkaByteString(e.getDigest.toByteArray()))(breakOut), status.getChunk, status.getTotChunks) } @@ -261,8 +262,9 @@ class ReplicatorMessageSerializer(val system: ExtendedActorSystem) private def gossipFromBinary(bytes: Array[Byte]): Gossip = { val gossip = dm.Gossip.parseFrom(decompress(bytes)) - Gossip(gossip.getEntriesList.asScala.map(e ⇒ - e.getKey -> dataEnvelopeFromProto(e.getEnvelope))(breakOut), + Gossip( + gossip.getEntriesList.asScala.map(e ⇒ + e.getKey → dataEnvelopeFromProto(e.getEnvelope))(breakOut), sendBack = gossip.getSendBack) } @@ -408,7 +410,7 @@ class ReplicatorMessageSerializer(val system: ExtendedActorSystem) else PruningState.PruningInitialized(pruningEntry.getSeenList.asScala.map(addressFromProto)(breakOut)) val state = PruningState(uniqueAddressFromProto(pruningEntry.getOwnerAddress), phase) val removed = uniqueAddressFromProto(pruningEntry.getRemovedAddress) - removed -> state + removed → state }(breakOut) val data = otherMessageFromProto(dataEnvelope.getData).asInstanceOf[ReplicatedData] DataEnvelope(data, pruning) diff --git a/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/JepsenInspiredInsertSpec.scala b/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/JepsenInspiredInsertSpec.scala index 50d02ead79..b7a70f86b4 100644 --- a/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/JepsenInspiredInsertSpec.scala +++ b/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/JepsenInspiredInsertSpec.scala @@ -59,7 +59,7 @@ class JepsenInspiredInsertSpec extends MultiNodeSpec(JepsenInspiredInsertSpec) w // val totalCount = 2000 val expectedData = (0 until totalCount).toSet val data: Map[RoleName, Seq[Int]] = { - val nodeIndex = nodes.zipWithIndex.map { case (n, i) ⇒ i -> n }.toMap + val nodeIndex = nodes.zipWithIndex.map { case (n, i) ⇒ i → n }.toMap (0 until totalCount).groupBy(i ⇒ nodeIndex(i % nodeCount)) } lazy val myData: Seq[Int] = data(myself) diff --git a/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/ReplicatorChaosSpec.scala b/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/ReplicatorChaosSpec.scala index 59ab03b85e..7fe8e31c73 100644 --- a/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/ReplicatorChaosSpec.scala +++ b/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/ReplicatorChaosSpec.scala @@ -115,7 +115,8 @@ class ReplicatorChaosSpec extends MultiNodeSpec(ReplicatorChaosSpec) with STMult replicator ! Update(KeyA, GCounter(), WriteLocal)(_ + 20) replicator ! Update(KeyB, PNCounter(), WriteTo(2, timeout))(_ + 20) replicator ! Update(KeyC, GCounter(), WriteAll(timeout))(_ + 20) - receiveN(3).toSet should be(Set(UpdateSuccess(KeyA, None), + receiveN(3).toSet should be(Set( + UpdateSuccess(KeyA, None), UpdateSuccess(KeyB, None), UpdateSuccess(KeyC, None))) replicator ! Update(KeyE, GSet(), WriteLocal)(_ + "e1" + "e2") diff --git a/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/ReplicatorPruningSpec.scala b/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/ReplicatorPruningSpec.scala index 6954199ace..b24b185779 100644 --- a/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/ReplicatorPruningSpec.scala +++ b/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/ReplicatorPruningSpec.scala @@ -146,7 +146,7 @@ class ReplicatorPruningSpec extends MultiNodeSpec(ReplicatorPruningSpec) with ST replicator ! Get(KeyC, ReadLocal) expectMsgPF() { case g @ GetSuccess(KeyC, _) ⇒ - g.get(KeyC).entries should be(Map("x" -> 3L, "y" -> 3L)) + g.get(KeyC).entries should be(Map("x" → 3L, "y" → 3L)) g.get(KeyC).needPruningFrom(thirdUniqueAddress) should be(false) } } diff --git a/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/ReplicatorSpec.scala b/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/ReplicatorSpec.scala index f37b7ee24e..2c72c3cf0c 100644 --- a/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/ReplicatorSpec.scala +++ b/akka-distributed-data/src/multi-jvm/scala/akka/cluster/ddata/ReplicatorSpec.scala @@ -526,22 +526,22 @@ class ReplicatorSpec extends MultiNodeSpec(ReplicatorSpec) with STMultiNodeSpec runOn(second) { replicator ! Subscribe(KeyH, changedProbe.ref) - replicator ! Update(KeyH, ORMap.empty[Flag], writeTwo)(_ + ("a" -> Flag(enabled = false))) - changedProbe.expectMsgPF() { case c @ Changed(KeyH) ⇒ c.get(KeyH).entries } should be(Map("a" -> Flag(enabled = false))) + replicator ! Update(KeyH, ORMap.empty[Flag], writeTwo)(_ + ("a" → Flag(enabled = false))) + changedProbe.expectMsgPF() { case c @ Changed(KeyH) ⇒ c.get(KeyH).entries } should be(Map("a" → Flag(enabled = false))) } enterBarrier("update-h1") runOn(first) { - replicator ! Update(KeyH, ORMap.empty[Flag], writeTwo)(_ + ("a" -> Flag(enabled = true))) + replicator ! Update(KeyH, ORMap.empty[Flag], writeTwo)(_ + ("a" → Flag(enabled = true))) } runOn(second) { - changedProbe.expectMsgPF() { case c @ Changed(KeyH) ⇒ c.get(KeyH).entries } should be(Map("a" -> Flag(enabled = true))) + changedProbe.expectMsgPF() { case c @ Changed(KeyH) ⇒ c.get(KeyH).entries } should be(Map("a" → Flag(enabled = true))) - replicator ! Update(KeyH, ORMap.empty[Flag], writeTwo)(_ + ("b" -> Flag(enabled = true))) + replicator ! Update(KeyH, ORMap.empty[Flag], writeTwo)(_ + ("b" → Flag(enabled = true))) changedProbe.expectMsgPF() { case c @ Changed(KeyH) ⇒ c.get(KeyH).entries } should be( - Map("a" -> Flag(enabled = true), "b" -> Flag(enabled = true))) + Map("a" → Flag(enabled = true), "b" → Flag(enabled = true))) } enterBarrierAfterTestStep() diff --git a/akka-distributed-data/src/test/scala/akka/cluster/ddata/LWWMapSpec.scala b/akka-distributed-data/src/test/scala/akka/cluster/ddata/LWWMapSpec.scala index 5ca79a37ef..d5e70cf3ef 100644 --- a/akka-distributed-data/src/test/scala/akka/cluster/ddata/LWWMapSpec.scala +++ b/akka-distributed-data/src/test/scala/akka/cluster/ddata/LWWMapSpec.scala @@ -20,7 +20,7 @@ class LWWMapSpec extends WordSpec with Matchers { "be able to set entries" in { val m = LWWMap.empty[Int].put(node1, "a", 1, defaultClock[Int]).put(node2, "b", 2, defaultClock[Int]) - m.entries should be(Map("a" -> 1, "b" -> 2)) + m.entries should be(Map("a" → 1, "b" → 2)) } "be able to have its entries correctly merged with another LWWMap with other entries" in { @@ -28,7 +28,7 @@ class LWWMapSpec extends WordSpec with Matchers { val m2 = LWWMap.empty.put(node2, "c", 3, defaultClock[Int]) // merge both ways - val expected = Map("a" -> 1, "b" -> 2, "c" -> 3) + val expected = Map("a" → 1, "b" → 2, "c" → 3) (m1 merge m2).entries should be(expected) (m2 merge m1).entries should be(expected) } @@ -40,11 +40,11 @@ class LWWMapSpec extends WordSpec with Matchers { val merged1 = m1 merge m2 val m3 = merged1.remove(node1, "b") - (merged1 merge m3).entries should be(Map("a" -> 1, "c" -> 3)) + (merged1 merge m3).entries should be(Map("a" → 1, "c" → 3)) // but if there is a conflicting update the entry is not removed val m4 = merged1.put(node2, "b", 22, defaultClock[Int]) - (m3 merge m4).entries should be(Map("a" -> 1, "b" -> 22, "c" -> 3)) + (m3 merge m4).entries should be(Map("a" → 1, "b" → 22, "c" → 3)) } "have unapply extractor" in { @@ -55,7 +55,7 @@ class LWWMapSpec extends WordSpec with Matchers { case c @ Changed(LWWMapKey("key")) ⇒ val LWWMap(entries3) = c.dataValue val entries4: Map[String, Long] = entries3 - entries4 should be(Map("a" -> 1L)) + entries4 should be(Map("a" → 1L)) } } diff --git a/akka-distributed-data/src/test/scala/akka/cluster/ddata/LocalConcurrencySpec.scala b/akka-distributed-data/src/test/scala/akka/cluster/ddata/LocalConcurrencySpec.scala index f2c2c22734..ccc2a2f7eb 100644 --- a/akka-distributed-data/src/test/scala/akka/cluster/ddata/LocalConcurrencySpec.scala +++ b/akka-distributed-data/src/test/scala/akka/cluster/ddata/LocalConcurrencySpec.scala @@ -41,7 +41,8 @@ class LocalConcurrencySpec(_system: ActorSystem) extends TestKit(_system) import LocalConcurrencySpec._ def this() { - this(ActorSystem("LocalConcurrencySpec", + this(ActorSystem( + "LocalConcurrencySpec", ConfigFactory.parseString(""" akka.actor.provider = "akka.cluster.ClusterActorRefProvider" akka.remote.netty.tcp.port=0 diff --git a/akka-distributed-data/src/test/scala/akka/cluster/ddata/ORMapSpec.scala b/akka-distributed-data/src/test/scala/akka/cluster/ddata/ORMapSpec.scala index 7b96a1c6ce..8fb29220a0 100644 --- a/akka-distributed-data/src/test/scala/akka/cluster/ddata/ORMapSpec.scala +++ b/akka-distributed-data/src/test/scala/akka/cluster/ddata/ORMapSpec.scala @@ -197,7 +197,7 @@ class ORMapSpec extends WordSpec with Matchers { case c @ Changed(ORMapKey("key")) ⇒ val ORMap(entries3) = c.dataValue val entries4: Map[String, ReplicatedData] = entries3 - entries4 should be(Map("a" -> Flag(true), "b" -> Flag(false))) + entries4 should be(Map("a" → Flag(true), "b" → Flag(false))) } } diff --git a/akka-distributed-data/src/test/scala/akka/cluster/ddata/ORMultiMapSpec.scala b/akka-distributed-data/src/test/scala/akka/cluster/ddata/ORMultiMapSpec.scala index 38b6e930a6..e0d027e0dc 100644 --- a/akka-distributed-data/src/test/scala/akka/cluster/ddata/ORMultiMapSpec.scala +++ b/akka-distributed-data/src/test/scala/akka/cluster/ddata/ORMultiMapSpec.scala @@ -17,20 +17,20 @@ class ORMultiMapSpec extends WordSpec with Matchers { "be able to add entries" in { val m = ORMultiMap().addBinding(node1, "a", "A").addBinding(node1, "b", "B") - m.entries should be(Map("a" -> Set("A"), "b" -> Set("B"))) + m.entries should be(Map("a" → Set("A"), "b" → Set("B"))) val m2 = m.addBinding(node1, "a", "C") - m2.entries should be(Map("a" -> Set("A", "C"), "b" -> Set("B"))) + m2.entries should be(Map("a" → Set("A", "C"), "b" → Set("B"))) } "be able to remove entry" in { val m = ORMultiMap().addBinding(node1, "a", "A").addBinding(node1, "b", "B").removeBinding(node1, "a", "A") - m.entries should be(Map("b" -> Set("B"))) + m.entries should be(Map("b" → Set("B"))) } "be able to replace an entry" in { val m = ORMultiMap().addBinding(node1, "a", "A").replaceBinding(node1, "a", "A", "B") - m.entries should be(Map("a" -> Set("B"))) + m.entries should be(Map("a" → Set("B"))) } "be able to have its entries correctly merged with another ORMultiMap with other entries" in { @@ -40,9 +40,9 @@ class ORMultiMapSpec extends WordSpec with Matchers { // merge both ways val expectedMerge = Map( - "a" -> Set("A"), - "b" -> Set("B"), - "c" -> Set("C")) + "a" → Set("A"), + "b" → Set("B"), + "c" → Set("C")) val merged1 = m1 merge m2 merged1.entries should be(expectedMerge) @@ -67,10 +67,10 @@ class ORMultiMapSpec extends WordSpec with Matchers { // merge both ways val expectedMerged = Map( - "a" -> Set("A2"), - "b" -> Set("B1"), - "c" -> Set("C2"), - "d" -> Set("D1", "D2")) + "a" → Set("A2"), + "b" → Set("B1"), + "c" → Set("C2"), + "d" → Set("D1", "D2")) val merged1 = m1 merge m2 merged1.entries should be(expectedMerged) @@ -89,8 +89,8 @@ class ORMultiMapSpec extends WordSpec with Matchers { val m2 = m.put(node1, "a", a - "A1") val expectedMerged = Map( - "a" -> Set("A2"), - "b" -> Set("B1")) + "a" → Set("A2"), + "b" → Set("B1")) m2.entries should be(expectedMerged) } @@ -104,7 +104,7 @@ class ORMultiMapSpec extends WordSpec with Matchers { "remove all bindings for a given key" in { val m = ORMultiMap().addBinding(node1, "a", "A1").addBinding(node1, "a", "A2").addBinding(node1, "b", "B1") val m2 = m.remove(node1, "a") - m2.entries should be(Map("b" -> Set("B1"))) + m2.entries should be(Map("b" → Set("B1"))) } "have unapply extractor" in { @@ -116,7 +116,7 @@ class ORMultiMapSpec extends WordSpec with Matchers { case c @ Changed(ORMultiMapKey("key")) ⇒ val ORMultiMap(entries3) = c.dataValue val entries4: Map[String, Set[Long]] = entries3 - entries4 should be(Map("a" -> Set(1L, 2L), "b" -> Set(3L))) + entries4 should be(Map("a" → Set(1L, 2L), "b" → Set(3L))) } } } diff --git a/akka-distributed-data/src/test/scala/akka/cluster/ddata/ORSetSpec.scala b/akka-distributed-data/src/test/scala/akka/cluster/ddata/ORSetSpec.scala index 5d83500f6c..1e8188c07e 100644 --- a/akka-distributed-data/src/test/scala/akka/cluster/ddata/ORSetSpec.scala +++ b/akka-distributed-data/src/test/scala/akka/cluster/ddata/ORSetSpec.scala @@ -228,30 +228,30 @@ class ORSetSpec extends WordSpec with Matchers { "ORSet unit test" must { "verify subtractDots" in { - val dot = VersionVector(TreeMap(nodeA -> 3L, nodeB -> 2L, nodeD -> 14L, nodeG -> 22L)) - val vvector = VersionVector(TreeMap(nodeA -> 4L, nodeB -> 1L, nodeC -> 1L, nodeD -> 14L, nodeE -> 5L, nodeF -> 2L)) - val expected = VersionVector(TreeMap(nodeB -> 2L, nodeG -> 22L)) + val dot = VersionVector(TreeMap(nodeA → 3L, nodeB → 2L, nodeD → 14L, nodeG → 22L)) + val vvector = VersionVector(TreeMap(nodeA → 4L, nodeB → 1L, nodeC → 1L, nodeD → 14L, nodeE → 5L, nodeF → 2L)) + val expected = VersionVector(TreeMap(nodeB → 2L, nodeG → 22L)) ORSet.subtractDots(dot, vvector) should be(expected) } "verify mergeCommonKeys" in { val commonKeys: Set[String] = Set("K1", "K2") - val thisDot1 = VersionVector(TreeMap(nodeA -> 3L, nodeD -> 7L)) - val thisDot2 = VersionVector(TreeMap(nodeB -> 5L, nodeC -> 2L)) - val thisVvector = VersionVector(TreeMap(nodeA -> 3L, nodeB -> 5L, nodeC -> 2L, nodeD -> 7L)) + val thisDot1 = VersionVector(TreeMap(nodeA → 3L, nodeD → 7L)) + val thisDot2 = VersionVector(TreeMap(nodeB → 5L, nodeC → 2L)) + val thisVvector = VersionVector(TreeMap(nodeA → 3L, nodeB → 5L, nodeC → 2L, nodeD → 7L)) val thisSet = new ORSet( - elementsMap = Map("K1" -> thisDot1, "K2" -> thisDot2), + elementsMap = Map("K1" → thisDot1, "K2" → thisDot2), vvector = thisVvector) val thatDot1 = VersionVector(nodeA, 3L) val thatDot2 = VersionVector(nodeB, 6L) - val thatVvector = VersionVector(TreeMap(nodeA -> 3L, nodeB -> 6L, nodeC -> 1L, nodeD -> 8L)) + val thatVvector = VersionVector(TreeMap(nodeA → 3L, nodeB → 6L, nodeC → 1L, nodeD → 8L)) val thatSet = new ORSet( - elementsMap = Map("K1" -> thatDot1, "K2" -> thatDot2), + elementsMap = Map("K1" → thatDot1, "K2" → thatDot2), vvector = thatVvector) val expectedDots = Map( - "K1" -> VersionVector(nodeA, 3L), - "K2" -> VersionVector(TreeMap(nodeB -> 6L, nodeC -> 2L))) + "K1" → VersionVector(nodeA, 3L), + "K2" → VersionVector(TreeMap(nodeB → 6L, nodeC → 2L))) ORSet.mergeCommonKeys(commonKeys, thisSet, thatSet) should be(expectedDots) } @@ -259,14 +259,14 @@ class ORSetSpec extends WordSpec with Matchers { "verify mergeDisjointKeys" in { val keys: Set[Any] = Set("K3", "K4", "K5") val elements: Map[Any, VersionVector] = Map( - "K3" -> VersionVector(nodeA, 4L), - "K4" -> VersionVector(TreeMap(nodeA -> 3L, nodeD -> 8L)), - "K5" -> VersionVector(nodeA, 2L)) - val vvector = VersionVector(TreeMap(nodeA -> 3L, nodeD -> 7L)) - val acc: Map[Any, VersionVector] = Map("K1" -> VersionVector(nodeA, 3L)) + "K3" → VersionVector(nodeA, 4L), + "K4" → VersionVector(TreeMap(nodeA → 3L, nodeD → 8L)), + "K5" → VersionVector(nodeA, 2L)) + val vvector = VersionVector(TreeMap(nodeA → 3L, nodeD → 7L)) + val acc: Map[Any, VersionVector] = Map("K1" → VersionVector(nodeA, 3L)) val expectedDots = acc ++ Map( - "K3" -> VersionVector(nodeA, 4L), - "K4" -> VersionVector(nodeD, 8L)) // "a" -> 3 removed, optimized to include only those unseen + "K3" → VersionVector(nodeA, 4L), + "K4" → VersionVector(nodeD, 8L)) // "a" -> 3 removed, optimized to include only those unseen ORSet.mergeDisjointKeys(keys, elements, vvector, acc) should be(expectedDots) } diff --git a/akka-distributed-data/src/test/scala/akka/cluster/ddata/PNCounterMapSpec.scala b/akka-distributed-data/src/test/scala/akka/cluster/ddata/PNCounterMapSpec.scala index 3b621f120c..fc5234a342 100644 --- a/akka-distributed-data/src/test/scala/akka/cluster/ddata/PNCounterMapSpec.scala +++ b/akka-distributed-data/src/test/scala/akka/cluster/ddata/PNCounterMapSpec.scala @@ -19,7 +19,7 @@ class PNCounterMapSpec extends WordSpec with Matchers { "be able to increment and decrement entries" in { val m = PNCounterMap().increment(node1, "a", 2).increment(node1, "b", 3).decrement(node2, "a", 1) - m.entries should be(Map("a" -> 1, "b" -> 3)) + m.entries should be(Map("a" → 1, "b" → 3)) } "be able to have its entries correctly merged with another ORMap with other entries" in { @@ -27,7 +27,7 @@ class PNCounterMapSpec extends WordSpec with Matchers { val m2 = PNCounterMap().increment(node2, "c", 5) // merge both ways - val expected = Map("a" -> 1, "b" -> 3, "c" -> 7) + val expected = Map("a" → 1, "b" → 3, "c" → 7) (m1 merge m2).entries should be(expected) (m2 merge m1).entries should be(expected) } @@ -39,11 +39,11 @@ class PNCounterMapSpec extends WordSpec with Matchers { val merged1 = m1 merge m2 val m3 = merged1.remove(node1, "b") - (merged1 merge m3).entries should be(Map("a" -> 1, "c" -> 7)) + (merged1 merge m3).entries should be(Map("a" → 1, "c" → 7)) // but if there is a conflicting update the entry is not removed val m4 = merged1.increment(node2, "b", 10) - (m3 merge m4).entries should be(Map("a" -> 1, "b" -> 13, "c" -> 7)) + (m3 merge m4).entries should be(Map("a" → 1, "b" → 13, "c" → 7)) } "have unapply extractor" in { @@ -54,7 +54,7 @@ class PNCounterMapSpec extends WordSpec with Matchers { case c @ Changed(PNCounterMapKey("key")) ⇒ val PNCounterMap(entries3) = c.dataValue val entries4: Map[String, BigInt] = entries3 - entries4 should be(Map("a" -> 1L, "b" -> 2L)) + entries4 should be(Map("a" → 1L, "b" → 2L)) } } diff --git a/akka-distributed-data/src/test/scala/akka/cluster/ddata/WriteAggregatorSpec.scala b/akka-distributed-data/src/test/scala/akka/cluster/ddata/WriteAggregatorSpec.scala index 98e0776563..5ce047ddcf 100644 --- a/akka-distributed-data/src/test/scala/akka/cluster/ddata/WriteAggregatorSpec.scala +++ b/akka-distributed-data/src/test/scala/akka/cluster/ddata/WriteAggregatorSpec.scala @@ -68,7 +68,7 @@ class WriteAggregatorSpec extends AkkaSpec(""" val writeMajority = WriteMajority(timeout) def probes(probe: ActorRef): Map[Address, ActorRef] = - nodes.toSeq.map(_ -> system.actorOf(WriteAggregatorSpec.writeAckAdapterProps(probe))).toMap + nodes.toSeq.map(_ → system.actorOf(WriteAggregatorSpec.writeAckAdapterProps(probe))).toMap "WriteAggregator" must { "send to at least N/2+1 replicas when WriteMajority" in { diff --git a/akka-distributed-data/src/test/scala/akka/cluster/ddata/protobuf/ReplicatedDataSerializerSpec.scala b/akka-distributed-data/src/test/scala/akka/cluster/ddata/protobuf/ReplicatedDataSerializerSpec.scala index 8f338f7aff..3512224da2 100644 --- a/akka-distributed-data/src/test/scala/akka/cluster/ddata/protobuf/ReplicatedDataSerializerSpec.scala +++ b/akka-distributed-data/src/test/scala/akka/cluster/ddata/protobuf/ReplicatedDataSerializerSpec.scala @@ -25,7 +25,8 @@ import akka.testkit.TestKit import akka.cluster.UniqueAddress import com.typesafe.config.ConfigFactory -class ReplicatedDataSerializerSpec extends TestKit(ActorSystem("ReplicatedDataSerializerSpec", +class ReplicatedDataSerializerSpec extends TestKit(ActorSystem( + "ReplicatedDataSerializerSpec", ConfigFactory.parseString(""" akka.actor.provider=akka.cluster.ClusterActorRefProvider akka.remote.netty.tcp.port=0 diff --git a/akka-distributed-data/src/test/scala/akka/cluster/ddata/protobuf/ReplicatorMessageSerializerSpec.scala b/akka-distributed-data/src/test/scala/akka/cluster/ddata/protobuf/ReplicatorMessageSerializerSpec.scala index a622d6a756..7206a7d11f 100644 --- a/akka-distributed-data/src/test/scala/akka/cluster/ddata/protobuf/ReplicatorMessageSerializerSpec.scala +++ b/akka-distributed-data/src/test/scala/akka/cluster/ddata/protobuf/ReplicatorMessageSerializerSpec.scala @@ -23,7 +23,8 @@ import akka.util.ByteString import akka.cluster.UniqueAddress import com.typesafe.config.ConfigFactory -class ReplicatorMessageSerializerSpec extends TestKit(ActorSystem("ReplicatorMessageSerializerSpec", +class ReplicatorMessageSerializerSpec extends TestKit(ActorSystem( + "ReplicatorMessageSerializerSpec", ConfigFactory.parseString(""" akka.actor.provider=akka.cluster.ClusterActorRefProvider akka.remote.netty.tcp.port=0 @@ -64,17 +65,19 @@ class ReplicatorMessageSerializerSpec extends TestKit(ActorSystem("ReplicatorMes checkSerialization(Changed(keyA)(data1)) checkSerialization(DataEnvelope(data1)) checkSerialization(DataEnvelope(data1, pruning = Map( - address1 -> PruningState(address2, PruningPerformed), - address3 -> PruningState(address2, PruningInitialized(Set(address1.address)))))) + address1 → PruningState(address2, PruningPerformed), + address3 → PruningState(address2, PruningInitialized(Set(address1.address)))))) checkSerialization(Write("A", DataEnvelope(data1))) checkSerialization(WriteAck) checkSerialization(Read("A")) checkSerialization(ReadResult(Some(DataEnvelope(data1)))) checkSerialization(ReadResult(None)) - checkSerialization(Status(Map("A" -> ByteString.fromString("a"), - "B" -> ByteString.fromString("b")), chunk = 3, totChunks = 10)) - checkSerialization(Gossip(Map("A" -> DataEnvelope(data1), - "B" -> DataEnvelope(GSet() + "b" + "c")), sendBack = true)) + checkSerialization(Status(Map( + "A" → ByteString.fromString("a"), + "B" → ByteString.fromString("b")), chunk = 3, totChunks = 10)) + checkSerialization(Gossip(Map( + "A" → DataEnvelope(data1), + "B" → DataEnvelope(GSet() + "b" + "c")), sendBack = true)) } } @@ -141,7 +144,7 @@ class ReplicatorMessageSerializerSpec extends TestKit(ActorSystem("ReplicatorMes "handle Int wrap around" ignore { // ignored because it takes 20 seconds (but it works) val cache = new SmallCache[Read, String](2, 5.seconds, _ ⇒ null) val a = Read("a") - val x = a -> "A" + val x = a → "A" var n = 0 while (n <= Int.MaxValue - 3) { cache.add(x) diff --git a/akka-docs/rst/common/code/docs/circuitbreaker/CircuitBreakerDocSpec.scala b/akka-docs/rst/common/code/docs/circuitbreaker/CircuitBreakerDocSpec.scala index 2e1d6d9d19..97d5fbc6e1 100644 --- a/akka-docs/rst/common/code/docs/circuitbreaker/CircuitBreakerDocSpec.scala +++ b/akka-docs/rst/common/code/docs/circuitbreaker/CircuitBreakerDocSpec.scala @@ -22,7 +22,8 @@ class DangerousActor extends Actor with ActorLogging { import context.dispatcher val breaker = - new CircuitBreaker(context.system.scheduler, + new CircuitBreaker( + context.system.scheduler, maxFailures = 5, callTimeout = 10.seconds, resetTimeout = 1.minute).onOpen(notifyMeOnOpen()) diff --git a/akka-docs/rst/scala/code/docs/actor/FaultHandlingDocSample.scala b/akka-docs/rst/scala/code/docs/actor/FaultHandlingDocSample.scala index 8e180f1da0..4e3be19626 100644 --- a/akka-docs/rst/scala/code/docs/actor/FaultHandlingDocSample.scala +++ b/akka-docs/rst/scala/code/docs/actor/FaultHandlingDocSample.scala @@ -134,10 +134,11 @@ class CounterService extends Actor { // Restart the storage child when StorageException is thrown. // After 3 restarts within 5 seconds it will be stopped. - override val supervisorStrategy = OneForOneStrategy(maxNrOfRetries = 3, + override val supervisorStrategy = OneForOneStrategy( + maxNrOfRetries = 3, withinTimeRange = 5 seconds) { - case _: Storage.StorageException => Restart - } + case _: Storage.StorageException => Restart + } val key = self.path.name var storage: Option[ActorRef] = None diff --git a/akka-docs/rst/scala/code/docs/actor/FaultHandlingDocSpec.scala b/akka-docs/rst/scala/code/docs/actor/FaultHandlingDocSpec.scala index 09f2f6c6a9..f72ca4290a 100644 --- a/akka-docs/rst/scala/code/docs/actor/FaultHandlingDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/actor/FaultHandlingDocSpec.scala @@ -102,7 +102,8 @@ object FaultHandlingDocSpec { class FaultHandlingDocSpec(_system: ActorSystem) extends TestKit(_system) with ImplicitSender with FlatSpecLike with Matchers with BeforeAndAfterAll { - def this() = this(ActorSystem("FaultHandlingDocSpec", + def this() = this(ActorSystem( + "FaultHandlingDocSpec", ConfigFactory.parseString(""" akka { loggers = ["akka.testkit.TestEventListener"] diff --git a/akka-docs/rst/scala/code/docs/actor/SchedulerDocSpec.scala b/akka-docs/rst/scala/code/docs/actor/SchedulerDocSpec.scala index 1ddf165dbf..38c44ef534 100644 --- a/akka-docs/rst/scala/code/docs/actor/SchedulerDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/actor/SchedulerDocSpec.scala @@ -53,7 +53,8 @@ class SchedulerDocSpec extends AkkaSpec(Map("akka.loglevel" -> "INFO")) { //This will schedule to send the Tick-message //to the tickActor after 0ms repeating every 50ms val cancellable = - system.scheduler.schedule(0 milliseconds, + system.scheduler.schedule( + 0 milliseconds, 50 milliseconds, tickActor, Tick) diff --git a/akka-docs/rst/scala/code/docs/actor/TypedActorDocSpec.scala b/akka-docs/rst/scala/code/docs/actor/TypedActorDocSpec.scala index 3c6376af0d..e374cc5318 100644 --- a/akka-docs/rst/scala/code/docs/actor/TypedActorDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/actor/TypedActorDocSpec.scala @@ -121,7 +121,8 @@ class TypedActorDocSpec extends AkkaSpec(Map("akka.loglevel" -> "INFO")) { //#typed-actor-create1 //#typed-actor-create2 val otherSquarer: Squarer = - TypedActor(system).typedActorOf(TypedProps(classOf[Squarer], + TypedActor(system).typedActorOf(TypedProps( + classOf[Squarer], new SquarerImpl("foo")), "name") //#typed-actor-create2 diff --git a/akka-docs/rst/scala/code/docs/akka/typed/IntroSpec.scala b/akka-docs/rst/scala/code/docs/akka/typed/IntroSpec.scala index c8d4bce10c..ec9a14ed9d 100644 --- a/akka-docs/rst/scala/code/docs/akka/typed/IntroSpec.scala +++ b/akka-docs/rst/scala/code/docs/akka/typed/IntroSpec.scala @@ -21,7 +21,7 @@ object IntroSpec { final case class Greet(whom: String, replyTo: ActorRef[Greeted]) final case class Greeted(whom: String) - val greeter = Static[Greet] { msg ⇒ + val greeter = Static[Greet] { msg => println(s"Hello ${msg.whom}!") msg.replyTo ! Greeted(msg.whom) } @@ -51,17 +51,17 @@ object IntroSpec { //#chatroom-behavior val behavior: Behavior[GetSession] = - ContextAware[Command] { ctx ⇒ + ContextAware[Command] { ctx => var sessions = List.empty[ActorRef[SessionEvent]] Static { - case GetSession(screenName, client) ⇒ + case GetSession(screenName, client) => sessions ::= client val wrapper = ctx.spawnAdapter { - p: PostMessage ⇒ PostSessionMessage(screenName, p.message) + p: PostMessage => PostSessionMessage(screenName, p.message) } client ! SessionGranted(wrapper) - case PostSessionMessage(screenName, message) ⇒ + case PostSessionMessage(screenName, message) => val mp = MessagePosted(screenName, message) sessions foreach (_ ! mp) } @@ -98,13 +98,13 @@ class IntroSpec extends TypedSpec { val gabbler: Behavior[SessionEvent] = Total { - case SessionDenied(reason) ⇒ + case SessionDenied(reason) => println(s"cannot start chat room session: $reason") Stopped - case SessionGranted(handle) ⇒ + case SessionGranted(handle) => handle ! PostMessage("Hello World!") Same - case MessagePosted(screenName, message) ⇒ + case MessagePosted(screenName, message) => println(s"message has been posted by '$screenName': $message") Stopped } @@ -113,13 +113,13 @@ class IntroSpec extends TypedSpec { //#chatroom-main val main: Behavior[Unit] = Full { - case Sig(ctx, PreStart) ⇒ + case Sig(ctx, PreStart) => val chatRoom = ctx.spawn(Props(ChatRoom.behavior), "chatroom") val gabblerRef = ctx.spawn(Props(gabbler), "gabbler") ctx.watch(gabblerRef) chatRoom ! GetSession("ol’ Gabbler", gabblerRef) Same - case Sig(_, Terminated(ref)) ⇒ + case Sig(_, Terminated(ref)) => Stopped } diff --git a/akka-docs/rst/scala/code/docs/camel/Introduction.scala b/akka-docs/rst/scala/code/docs/camel/Introduction.scala index 68918ffcbd..ed5e6f7383 100644 --- a/akka-docs/rst/scala/code/docs/camel/Introduction.scala +++ b/akka-docs/rst/scala/code/docs/camel/Introduction.scala @@ -93,13 +93,15 @@ object Introduction { val camel = CamelExtension(system) val actorRef = system.actorOf(Props[MyEndpoint]) // get a future reference to the activation of the endpoint of the Consumer Actor - val activationFuture = camel.activationFutureFor(actorRef)(timeout = 10 seconds, + val activationFuture = camel.activationFutureFor(actorRef)( + timeout = 10 seconds, executor = system.dispatcher) //#CamelActivation //#CamelDeactivation system.stop(actorRef) // get a future reference to the deactivation of the endpoint of the Consumer Actor - val deactivationFuture = camel.deactivationFutureFor(actorRef)(timeout = 10 seconds, + val deactivationFuture = camel.deactivationFutureFor(actorRef)( + timeout = 10 seconds, executor = system.dispatcher) //#CamelDeactivation } diff --git a/akka-docs/rst/scala/code/docs/ddata/TwoPhaseSet.scala b/akka-docs/rst/scala/code/docs/ddata/TwoPhaseSet.scala index 8f331485b1..cd5658f4f1 100644 --- a/akka-docs/rst/scala/code/docs/ddata/TwoPhaseSet.scala +++ b/akka-docs/rst/scala/code/docs/ddata/TwoPhaseSet.scala @@ -8,7 +8,7 @@ import akka.cluster.ddata.GSet //#twophaseset case class TwoPhaseSet( - adds: GSet[String] = GSet.empty, + adds: GSet[String] = GSet.empty, removals: GSet[String] = GSet.empty) extends ReplicatedData { type T = TwoPhaseSet diff --git a/akka-docs/rst/scala/code/docs/ddata/protobuf/TwoPhaseSetSerializer.scala b/akka-docs/rst/scala/code/docs/ddata/protobuf/TwoPhaseSetSerializer.scala index e3366e6752..7d2b4ff062 100644 --- a/akka-docs/rst/scala/code/docs/ddata/protobuf/TwoPhaseSetSerializer.scala +++ b/akka-docs/rst/scala/code/docs/ddata/protobuf/TwoPhaseSetSerializer.scala @@ -22,8 +22,8 @@ class TwoPhaseSetSerializer(val system: ExtendedActorSystem) override def identifier = 99999 override def toBinary(obj: AnyRef): Array[Byte] = obj match { - case m: TwoPhaseSet ⇒ twoPhaseSetToProto(m).toByteArray - case _ ⇒ throw new IllegalArgumentException( + case m: TwoPhaseSet => twoPhaseSetToProto(m).toByteArray + case _ => throw new IllegalArgumentException( s"Can't serialize object of type ${obj.getClass}") } @@ -62,8 +62,8 @@ class TwoPhaseSetSerializerWithCompression(system: ExtendedActorSystem) extends TwoPhaseSetSerializer(system) { //#compression override def toBinary(obj: AnyRef): Array[Byte] = obj match { - case m: TwoPhaseSet ⇒ compress(twoPhaseSetToProto(m)) - case _ ⇒ throw new IllegalArgumentException( + case m: TwoPhaseSet => compress(twoPhaseSetToProto(m)) + case _ => throw new IllegalArgumentException( s"Can't serialize object of type ${obj.getClass}") } diff --git a/akka-docs/rst/scala/code/docs/ddata/protobuf/TwoPhaseSetSerializer2.scala b/akka-docs/rst/scala/code/docs/ddata/protobuf/TwoPhaseSetSerializer2.scala index 266782917c..d6cbd4c07e 100644 --- a/akka-docs/rst/scala/code/docs/ddata/protobuf/TwoPhaseSetSerializer2.scala +++ b/akka-docs/rst/scala/code/docs/ddata/protobuf/TwoPhaseSetSerializer2.scala @@ -22,8 +22,8 @@ class TwoPhaseSetSerializer2(val system: ExtendedActorSystem) val replicatedDataSerializer = new ReplicatedDataSerializer(system) override def toBinary(obj: AnyRef): Array[Byte] = obj match { - case m: TwoPhaseSet ⇒ twoPhaseSetToProto(m).toByteArray - case _ ⇒ throw new IllegalArgumentException( + case m: TwoPhaseSet => twoPhaseSetToProto(m).toByteArray + case _ => throw new IllegalArgumentException( s"Can't serialize object of type ${obj.getClass}") } diff --git a/akka-docs/rst/scala/code/docs/dispatcher/MyUnboundedMailbox.scala b/akka-docs/rst/scala/code/docs/dispatcher/MyUnboundedMailbox.scala index 33ff7bc59f..02c1acd77a 100644 --- a/akka-docs/rst/scala/code/docs/dispatcher/MyUnboundedMailbox.scala +++ b/akka-docs/rst/scala/code/docs/dispatcher/MyUnboundedMailbox.scala @@ -52,8 +52,9 @@ class MyUnboundedMailbox extends MailboxType } // The create method is called to create the MessageQueue - final override def create(owner: Option[ActorRef], - system: Option[ActorSystem]): MessageQueue = + final override def create( + owner: Option[ActorRef], + system: Option[ActorSystem]): MessageQueue = new MyMessageQueue() } //#mailbox-implementation-example diff --git a/akka-docs/rst/scala/code/docs/extension/SettingsExtensionDocSpec.scala b/akka-docs/rst/scala/code/docs/extension/SettingsExtensionDocSpec.scala index 2e01e6cbb7..cb5605b6a9 100644 --- a/akka-docs/rst/scala/code/docs/extension/SettingsExtensionDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/extension/SettingsExtensionDocSpec.scala @@ -22,7 +22,8 @@ import akka.testkit.AkkaSpec class SettingsImpl(config: Config) extends Extension { val DbUri: String = config.getString("myapp.db.uri") val CircuitBreakerTimeout: Duration = - Duration(config.getMilliseconds("myapp.circuit-breaker.timeout"), + Duration( + config.getMilliseconds("myapp.circuit-breaker.timeout"), TimeUnit.MILLISECONDS) } //#extension diff --git a/akka-docs/rst/scala/code/docs/http/scaladsl/HttpServerExampleSpec.scala b/akka-docs/rst/scala/code/docs/http/scaladsl/HttpServerExampleSpec.scala index 369b1a2c2a..9514448a70 100644 --- a/akka-docs/rst/scala/code/docs/http/scaladsl/HttpServerExampleSpec.scala +++ b/akka-docs/rst/scala/code/docs/http/scaladsl/HttpServerExampleSpec.scala @@ -178,7 +178,8 @@ class HttpServerExampleSpec extends WordSpec with Matchers val requestHandler: HttpRequest => HttpResponse = { case HttpRequest(GET, Uri.Path("/"), _, _, _) => - HttpResponse(entity = HttpEntity(ContentTypes.`text/html(UTF-8)`, + HttpResponse(entity = HttpEntity( + ContentTypes.`text/html(UTF-8)`, "Hello world!")) case HttpRequest(GET, Uri.Path("/ping"), _, _, _) => @@ -218,7 +219,8 @@ class HttpServerExampleSpec extends WordSpec with Matchers val requestHandler: HttpRequest => HttpResponse = { case HttpRequest(GET, Uri.Path("/"), _, _, _) => - HttpResponse(entity = HttpEntity(ContentTypes.`text/html(UTF-8)`, + HttpResponse(entity = HttpEntity( + ContentTypes.`text/html(UTF-8)`, "Hello world!")) case HttpRequest(GET, Uri.Path("/ping"), _, _, _) => @@ -236,7 +238,7 @@ class HttpServerExampleSpec extends WordSpec with Matchers StdIn.readLine() // let it run until user presses return bindingFuture .flatMap(_.unbind()) // trigger unbinding from the port - .onComplete(_ ⇒ system.terminate()) // and shutdown when done + .onComplete(_ => system.terminate()) // and shutdown when done } } @@ -278,7 +280,7 @@ class HttpServerExampleSpec extends WordSpec with Matchers StdIn.readLine() // let it run until user presses return bindingFuture .flatMap(_.unbind()) // trigger unbinding from the port - .onComplete(_ ⇒ system.terminate()) // and shutdown when done + .onComplete(_ => system.terminate()) // and shutdown when done } } } @@ -310,7 +312,7 @@ class HttpServerExampleSpec extends WordSpec with Matchers StdIn.readLine() // let it run until user presses return bindingFuture .flatMap(_.unbind()) // trigger unbinding from the port - .onComplete(_ ⇒ system.terminate()) // and shutdown when done + .onComplete(_ => system.terminate()) // and shutdown when done } } } @@ -466,7 +468,7 @@ class HttpServerExampleSpec extends WordSpec with Matchers StdIn.readLine() // let it run until user presses return bindingFuture .flatMap(_.unbind()) // trigger unbinding from the port - .onComplete(_ ⇒ system.terminate()) // and shutdown when done + .onComplete(_ => system.terminate()) // and shutdown when done } } //#stream-random-numbers @@ -533,7 +535,7 @@ class HttpServerExampleSpec extends WordSpec with Matchers StdIn.readLine() // let it run until user presses return bindingFuture .flatMap(_.unbind()) // trigger unbinding from the port - .onComplete(_ ⇒ system.terminate()) // and shutdown when done + .onComplete(_ => system.terminate()) // and shutdown when done } } diff --git a/akka-docs/rst/scala/code/docs/http/scaladsl/server/RejectionHandlerExamplesSpec.scala b/akka-docs/rst/scala/code/docs/http/scaladsl/server/RejectionHandlerExamplesSpec.scala index 8ef948c529..587106986f 100644 --- a/akka-docs/rst/scala/code/docs/http/scaladsl/server/RejectionHandlerExamplesSpec.scala +++ b/akka-docs/rst/scala/code/docs/http/scaladsl/server/RejectionHandlerExamplesSpec.scala @@ -22,13 +22,13 @@ object MyRejectionHandler { .handle { case MissingCookieRejection(cookieName) => complete(HttpResponse(BadRequest, entity = "No cookies, no service!!!")) } - .handle { case AuthorizationFailedRejection ⇒ + .handle { case AuthorizationFailedRejection => complete((Forbidden, "You're out of your depth!")) } - .handle { case ValidationRejection(msg, _) ⇒ + .handle { case ValidationRejection(msg, _) => complete((InternalServerError, "That wasn't valid! " + msg)) } - .handleAll[MethodRejection] { methodRejections ⇒ + .handleAll[MethodRejection] { methodRejections => val names = methodRejections.map(_.supported.name) complete((MethodNotAllowed, s"Can't do that! Supported: ${names mkString " or "}!")) } diff --git a/akka-docs/rst/scala/code/docs/http/scaladsl/server/WebSocketExampleSpec.scala b/akka-docs/rst/scala/code/docs/http/scaladsl/server/WebSocketExampleSpec.scala index 4b5a276129..a1c4541ba0 100644 --- a/akka-docs/rst/scala/code/docs/http/scaladsl/server/WebSocketExampleSpec.scala +++ b/akka-docs/rst/scala/code/docs/http/scaladsl/server/WebSocketExampleSpec.scala @@ -34,7 +34,7 @@ class WebSocketExampleSpec extends WordSpec with Matchers { // rather we simply stream it back as the tail of the response // this means we might start sending the response even before the // end of the incoming message has been received - case tm: TextMessage ⇒ TextMessage(Source.single("Hello ") ++ tm.textStream) :: Nil + case tm: TextMessage => TextMessage(Source.single("Hello ") ++ tm.textStream) :: Nil case bm: BinaryMessage => // ignore binary messages but drain content to avoid the stream being clogged bm.dataStream.runWith(Sink.ignore) @@ -43,13 +43,13 @@ class WebSocketExampleSpec extends WordSpec with Matchers { //#websocket-handler //#websocket-request-handling - val requestHandler: HttpRequest ⇒ HttpResponse = { - case req @ HttpRequest(GET, Uri.Path("/greeter"), _, _, _) ⇒ + val requestHandler: HttpRequest => HttpResponse = { + case req @ HttpRequest(GET, Uri.Path("/greeter"), _, _, _) => req.header[UpgradeToWebSocket] match { - case Some(upgrade) ⇒ upgrade.handleMessages(greeterWebSocketService) - case None ⇒ HttpResponse(400, entity = "Not a valid websocket request!") + case Some(upgrade) => upgrade.handleMessages(greeterWebSocketService) + case None => HttpResponse(400, entity = "Not a valid websocket request!") } - case _: HttpRequest ⇒ HttpResponse(404, entity = "Unknown resource!") + case _: HttpRequest => HttpResponse(404, entity = "Unknown resource!") } //#websocket-request-handling @@ -62,7 +62,7 @@ class WebSocketExampleSpec extends WordSpec with Matchers { import system.dispatcher // for the future transformations bindingFuture .flatMap(_.unbind()) // trigger unbinding from the port - .onComplete(_ ⇒ system.terminate()) // and shutdown when done + .onComplete(_ => system.terminate()) // and shutdown when done } "routing-example" in { pending // compile-time only test @@ -83,7 +83,7 @@ class WebSocketExampleSpec extends WordSpec with Matchers { val greeterWebSocketService = Flow[Message] .collect { - case tm: TextMessage ⇒ TextMessage(Source.single("Hello ") ++ tm.textStream) + case tm: TextMessage => TextMessage(Source.single("Hello ") ++ tm.textStream) // ignore binary messages } @@ -104,6 +104,6 @@ class WebSocketExampleSpec extends WordSpec with Matchers { import system.dispatcher // for the future transformations bindingFuture .flatMap(_.unbind()) // trigger unbinding from the port - .onComplete(_ ⇒ system.terminate()) // and shutdown when done + .onComplete(_ => system.terminate()) // and shutdown when done } } diff --git a/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/BasicDirectivesExamplesSpec.scala b/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/BasicDirectivesExamplesSpec.scala index 656387967c..64b292a3a5 100644 --- a/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/BasicDirectivesExamplesSpec.scala +++ b/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/BasicDirectivesExamplesSpec.scala @@ -267,14 +267,14 @@ class BasicDirectivesExamplesSpec extends RoutingSpec { private def nonSuccessToEmptyJsonEntity(response: HttpResponse): HttpResponse = response.status match { - case code if code.isSuccess ⇒ response - case code ⇒ + case code if code.isSuccess => response + case code => log.warning("Dropping response entity since response status code was: {}", code) response.copy(entity = NullJsonEntity) } /** Wrapper for all of our JSON API routes */ - def apiRoute(innerRoutes: ⇒ Route): Route = + def apiRoute(innerRoutes: => Route): Route = mapResponse(nonSuccessToEmptyJsonEntity)(innerRoutes) } //# @@ -388,13 +388,12 @@ class BasicDirectivesExamplesSpec extends RoutingSpec { "mapInnerRoute" in { //#mapInnerRoute val completeWithInnerException = - mapInnerRoute { route => - ctx => - try { - route(ctx) - } catch { - case NonFatal(e) => ctx.complete(s"Got ${e.getClass.getSimpleName} '${e.getMessage}'") - } + mapInnerRoute { route => ctx => + try { + route(ctx) + } catch { + case NonFatal(e) => ctx.complete(s"Got ${e.getClass.getSimpleName} '${e.getMessage}'") + } } val route = @@ -801,4 +800,4 @@ class BasicDirectivesExamplesSpec extends RoutingSpec { //# } -} \ No newline at end of file +} diff --git a/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/HeaderDirectivesExamplesSpec.scala b/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/HeaderDirectivesExamplesSpec.scala index 714273846b..695f23dcf8 100644 --- a/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/HeaderDirectivesExamplesSpec.scala +++ b/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/HeaderDirectivesExamplesSpec.scala @@ -147,7 +147,7 @@ class HeaderDirectivesExamplesSpec extends RoutingSpec with Inside { } "headerValueByType-0" in { val route = - headerValueByType[Origin]() { origin ⇒ + headerValueByType[Origin]() { origin => complete(s"The first origin was ${origin.origins.head}") } @@ -161,14 +161,14 @@ class HeaderDirectivesExamplesSpec extends RoutingSpec with Inside { // reject a request if no header of the given type is present Get("abc") ~> route ~> check { - inside(rejection) { case MissingHeaderRejection("Origin") ⇒ } + inside(rejection) { case MissingHeaderRejection("Origin") => } } } "optionalHeaderValueByType-0" in { val route = optionalHeaderValueByType[Origin]() { - case Some(origin) ⇒ complete(s"The first origin was ${origin.origins.head}") - case None ⇒ complete("No Origin header found.") + case Some(origin) => complete(s"The first origin was ${origin.origins.head}") + case None => complete("No Origin header found.") } val originHeader = Origin(HttpOrigin("http://localhost:8080")) diff --git a/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/MiscDirectivesExamplesSpec.scala b/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/MiscDirectivesExamplesSpec.scala index ad75799097..dfa22e6eca 100644 --- a/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/MiscDirectivesExamplesSpec.scala +++ b/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/MiscDirectivesExamplesSpec.scala @@ -67,13 +67,13 @@ class MiscDirectivesExamplesSpec extends RoutingSpec { Language("de") withQValue 0.5f) request ~> { - selectPreferredLanguage("en", "en-US") { lang ⇒ + selectPreferredLanguage("en", "en-US") { lang => complete(lang.toString) } } ~> check { responseAs[String] shouldEqual "en-US" } request ~> { - selectPreferredLanguage("de-DE", "hu") { lang ⇒ + selectPreferredLanguage("de-DE", "hu") { lang => complete(lang.toString) } } ~> check { responseAs[String] shouldEqual "de-DE" } diff --git a/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/SchemeDirectivesExamplesSpec.scala b/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/SchemeDirectivesExamplesSpec.scala index 42cdf2b502..9d495a1b96 100644 --- a/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/SchemeDirectivesExamplesSpec.scala +++ b/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/SchemeDirectivesExamplesSpec.scala @@ -25,7 +25,7 @@ class SchemeDirectivesExamplesSpec extends RoutingSpec { val route = scheme("http") { - extract(_.request.uri) { uri ⇒ + extract(_.request.uri) { uri => redirect(uri.copy(scheme = "https"), MovedPermanently) } } ~ diff --git a/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/TimeoutDirectivesExamplesSpec.scala b/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/TimeoutDirectivesExamplesSpec.scala index 5536e96d99..f0bda7181a 100644 --- a/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/TimeoutDirectivesExamplesSpec.scala +++ b/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/TimeoutDirectivesExamplesSpec.scala @@ -39,7 +39,8 @@ class TimeoutDirectivesExamplesSpec extends RoutingSpec with CompileOnlySpec { "allow mapping the response while setting the timeout" in compileOnlySpec { //#withRequestTimeout-with-handler - val timeoutResponse = HttpResponse(StatusCodes.EnhanceYourCalm, + val timeoutResponse = HttpResponse( + StatusCodes.EnhanceYourCalm, entity = "Unable to serve response within time limit, please enchance your calm.") val route = @@ -57,7 +58,8 @@ class TimeoutDirectivesExamplesSpec extends RoutingSpec with CompileOnlySpec { pending // compile only spec since requires actuall Http server to be run //#withRequestTimeoutResponse - val timeoutResponse = HttpResponse(StatusCodes.EnhanceYourCalm, + val timeoutResponse = HttpResponse( + StatusCodes.EnhanceYourCalm, entity = "Unable to serve response within time limit, please enchance your calm.") val route = diff --git a/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/WebSocketDirectivesExamplesSpec.scala b/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/WebSocketDirectivesExamplesSpec.scala index cb5912e855..3f8aabdc54 100644 --- a/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/WebSocketDirectivesExamplesSpec.scala +++ b/akka-docs/rst/scala/code/docs/http/scaladsl/server/directives/WebSocketDirectivesExamplesSpec.scala @@ -19,9 +19,9 @@ class WebSocketDirectivesExamplesSpec extends RoutingSpec { "greeter-service" in { def greeter: Flow[Message, Message, Any] = Flow[Message].mapConcat { - case tm: TextMessage ⇒ + case tm: TextMessage => TextMessage(Source.single("Hello ") ++ tm.textStream ++ Source.single("!")) :: Nil - case bm: BinaryMessage ⇒ + case bm: BinaryMessage => // ignore binary messages but drain content to avoid the stream being clogged bm.dataStream.runWith(Sink.ignore) Nil @@ -59,9 +59,9 @@ class WebSocketDirectivesExamplesSpec extends RoutingSpec { "handle-multiple-protocols" in { def greeterService: Flow[Message, Message, Any] = Flow[Message].mapConcat { - case tm: TextMessage ⇒ + case tm: TextMessage => TextMessage(Source.single("Hello ") ++ tm.textStream ++ Source.single("!")) :: Nil - case bm: BinaryMessage ⇒ + case bm: BinaryMessage => // ignore binary messages but drain content to avoid the stream being clogged bm.dataStream.runWith(Sink.ignore) Nil @@ -85,7 +85,7 @@ class WebSocketDirectivesExamplesSpec extends RoutingSpec { WS("/services", wsClient.flow, List("other", "echo")) ~> websocketMultipleProtocolRoute ~> check { - expectWebSocketUpgradeWithProtocol { protocol ⇒ + expectWebSocketUpgradeWithProtocol { protocol => protocol shouldEqual "echo" wsClient.sendMessage("Peter") diff --git a/akka-docs/rst/scala/code/docs/pattern/BackoffSupervisorDocSpec.scala b/akka-docs/rst/scala/code/docs/pattern/BackoffSupervisorDocSpec.scala index 366ce8bc4f..3d747f387b 100644 --- a/akka-docs/rst/scala/code/docs/pattern/BackoffSupervisorDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/pattern/BackoffSupervisorDocSpec.scala @@ -24,7 +24,7 @@ class BackoffSupervisorDocSpec { minBackoff = 3.seconds, maxBackoff = 30.seconds, randomFactor = 0.2 // adds 20% "noise" to vary the intervals slightly - )) + )) system.actorOf(supervisor, name = "echoSupervisor") //#backoff-stop @@ -44,7 +44,7 @@ class BackoffSupervisorDocSpec { minBackoff = 3.seconds, maxBackoff = 30.seconds, randomFactor = 0.2 // adds 20% "noise" to vary the intervals slightly - )) + )) system.actorOf(supervisor, name = "echoSupervisor") //#backoff-fail @@ -59,14 +59,14 @@ class BackoffSupervisorDocSpec { //#backoff-custom-stop val supervisor = BackoffSupervisor.props( Backoff.onStop( - childProps, - childName = "myEcho", - minBackoff = 3.seconds, - maxBackoff = 30.seconds, - randomFactor = 0.2 // adds 20% "noise" to vary the intervals slightly - ).withManualReset // the child must send BackoffSupervisor.Reset to its parent - .withDefaultStoppingStrategy // Stop at any Exception thrown - ) + childProps, + childName = "myEcho", + minBackoff = 3.seconds, + maxBackoff = 30.seconds, + randomFactor = 0.2 // adds 20% "noise" to vary the intervals slightly + ).withManualReset // the child must send BackoffSupervisor.Reset to its parent + .withDefaultStoppingStrategy // Stop at any Exception thrown + ) //#backoff-custom-stop system.actorOf(supervisor, name = "echoSupervisor") @@ -86,11 +86,11 @@ class BackoffSupervisorDocSpec { minBackoff = 3.seconds, maxBackoff = 30.seconds, randomFactor = 0.2 // adds 20% "noise" to vary the intervals slightly - ).withAutoReset(10.seconds) // the child must send BackoffSupervisor.Reset to its parent + ).withAutoReset(10.seconds) // the child must send BackoffSupervisor.Reset to its parent .withSupervisorStrategy( OneForOneStrategy() { - case _: MyException ⇒ SupervisorStrategy.Restart - case _ ⇒ SupervisorStrategy.Escalate + case _: MyException => SupervisorStrategy.Restart + case _ => SupervisorStrategy.Escalate })) //#backoff-custom-fail diff --git a/akka-docs/rst/scala/code/docs/pattern/SchedulerPatternSpec.scala b/akka-docs/rst/scala/code/docs/pattern/SchedulerPatternSpec.scala index 15b377c32e..caac3a3012 100644 --- a/akka-docs/rst/scala/code/docs/pattern/SchedulerPatternSpec.scala +++ b/akka-docs/rst/scala/code/docs/pattern/SchedulerPatternSpec.scala @@ -88,12 +88,14 @@ class SchedulerPatternSpec extends AkkaSpec { } "send periodic ticks from the constructor" taggedAs TimingTest in { - testSchedule(system.actorOf(Props(classOf[ScheduleInConstructor], testActor)), + testSchedule( + system.actorOf(Props(classOf[ScheduleInConstructor], testActor)), 3000 millis, 2000 millis) } "send ticks from the preStart and receive" taggedAs TimingTest in { - testSchedule(system.actorOf(Props(classOf[ScheduleInConstructor], testActor)), + testSchedule( + system.actorOf(Props(classOf[ScheduleInConstructor], testActor)), 3000 millis, 2500 millis) } } diff --git a/akka-docs/rst/scala/code/docs/persistence/PersistenceDocSpec.scala b/akka-docs/rst/scala/code/docs/persistence/PersistenceDocSpec.scala index 6eba1805d1..19d2c3946c 100644 --- a/akka-docs/rst/scala/code/docs/persistence/PersistenceDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/persistence/PersistenceDocSpec.scala @@ -326,13 +326,13 @@ object PersistenceDocSpec { override def receiveCommand: Receive = { case c: String => sender() ! c - persistAsync(c + "-outer-1") { outer ⇒ + persistAsync(c + "-outer-1") { outer => sender() ! outer - persistAsync(c + "-inner-1") { inner ⇒ sender() ! inner } + persistAsync(c + "-inner-1") { inner => sender() ! inner } } - persistAsync(c + "-outer-2") { outer ⇒ + persistAsync(c + "-outer-2") { outer => sender() ! outer - persistAsync(c + "-inner-2") { inner ⇒ sender() ! inner } + persistAsync(c + "-inner-2") { inner => sender() ! inner } } } //#nested-persistAsync-persistAsync diff --git a/akka-docs/rst/scala/code/docs/persistence/PersistencePluginDocSpec.scala b/akka-docs/rst/scala/code/docs/persistence/PersistencePluginDocSpec.scala index 1097121ac7..9bd651a58c 100644 --- a/akka-docs/rst/scala/code/docs/persistence/PersistencePluginDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/persistence/PersistencePluginDocSpec.scala @@ -149,17 +149,19 @@ class MyJournal extends AsyncWriteJournal { def asyncDeleteMessagesTo(persistenceId: String, toSequenceNr: Long): Future[Unit] = ??? def asyncReplayMessages(persistenceId: String, fromSequenceNr: Long, toSequenceNr: Long, max: Long)( - replayCallback: (PersistentRepr) => Unit): Future[Unit] = ??? - def asyncReadHighestSequenceNr(persistenceId: String, - fromSequenceNr: Long): Future[Long] = ??? + replayCallback: (PersistentRepr) => Unit): Future[Unit] = ??? + def asyncReadHighestSequenceNr( + persistenceId: String, + fromSequenceNr: Long): Future[Long] = ??? // optionally override: override def receivePluginInternal: Receive = super.receivePluginInternal } class MySnapshotStore extends SnapshotStore { - def loadAsync(persistenceId: String, - criteria: SnapshotSelectionCriteria): Future[Option[SelectedSnapshot]] = ??? + def loadAsync( + persistenceId: String, + criteria: SnapshotSelectionCriteria): Future[Option[SelectedSnapshot]] = ??? def saveAsync(metadata: SnapshotMetadata, snapshot: Any): Future[Unit] = ??? def deleteAsync(metadata: SnapshotMetadata): Future[Unit] = ??? def deleteAsync(persistenceId: String, criteria: SnapshotSelectionCriteria): Future[Unit] = ??? diff --git a/akka-docs/rst/scala/code/docs/persistence/PersistenceSchemaEvolutionDocSpec.scala b/akka-docs/rst/scala/code/docs/persistence/PersistenceSchemaEvolutionDocSpec.scala index 73ae91c6a3..1eea46f24b 100644 --- a/akka-docs/rst/scala/code/docs/persistence/PersistenceSchemaEvolutionDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/persistence/PersistenceSchemaEvolutionDocSpec.scala @@ -247,7 +247,8 @@ class UserEventsAdapter extends EventAdapter { case UserDetailsChanged(null, address) => EventSeq(UserAddressChanged(address)) case UserDetailsChanged(name, null) => EventSeq(UserNameChanged(name)) case UserDetailsChanged(name, address) => - EventSeq(UserNameChanged(name), + EventSeq( + UserNameChanged(name), UserAddressChanged(address)) case event: V2 => EventSeq(event) } @@ -267,7 +268,7 @@ class RemovedEventsAwareSerializer extends SerializerWithStringManifest { val SkipEventManifestsEvents = Set( "docs.persistence.CustomerBlinked" // ... - ) + ) override def manifest(o: AnyRef): String = o.getClass.getName diff --git a/akka-docs/rst/scala/code/docs/persistence/query/LeveldbPersistenceQueryDocSpec.scala b/akka-docs/rst/scala/code/docs/persistence/query/LeveldbPersistenceQueryDocSpec.scala index 6634ef4941..35206b7cd8 100644 --- a/akka-docs/rst/scala/code/docs/persistence/query/LeveldbPersistenceQueryDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/persistence/query/LeveldbPersistenceQueryDocSpec.scala @@ -22,13 +22,13 @@ object LeveldbPersistenceQueryDocSpec { class MyTaggingEventAdapter extends WriteEventAdapter { val colors = Set("green", "black", "blue") override def toJournal(event: Any): Any = event match { - case s: String ⇒ - var tags = colors.foldLeft(Set.empty[String]) { (acc, c) ⇒ + case s: String => + var tags = colors.foldLeft(Set.empty[String]) { (acc, c) => if (s.contains(c)) acc + c else acc } if (tags.isEmpty) event else Tagged(event, tags) - case _ ⇒ event + case _ => event } override def manifest(event: Any): String = "" diff --git a/akka-docs/rst/scala/code/docs/persistence/query/MyEventsByTagPublisher.scala b/akka-docs/rst/scala/code/docs/persistence/query/MyEventsByTagPublisher.scala index f5aaa30e96..a0f972e95c 100644 --- a/akka-docs/rst/scala/code/docs/persistence/query/MyEventsByTagPublisher.scala +++ b/akka-docs/rst/scala/code/docs/persistence/query/MyEventsByTagPublisher.scala @@ -39,11 +39,11 @@ class MyEventsByTagPublisher(tag: String, offset: Long, refreshInterval: FiniteD } def receive = { - case _: Request | Continue ⇒ + case _: Request | Continue => query() deliverBuf() - case Cancel ⇒ + case Cancel => context.stop(self) } @@ -79,12 +79,12 @@ class MyEventsByTagPublisher(tag: String, offset: Long, refreshInterval: FiniteD val serialization = SerializationExtension(context.system) buf = result.map { - case (id, bytes) ⇒ + case (id, bytes) => val p = serialization.deserialize(bytes, classOf[PersistentRepr]).get EventEnvelope(offset = id, p.persistenceId, p.sequenceNr, p.payload) } } catch { - case e: Exception ⇒ + case e: Exception => onErrorThenStop(e) } } @@ -101,4 +101,4 @@ class MyEventsByTagPublisher(tag: String, offset: Long, refreshInterval: FiniteD } } } -//#events-by-tag-publisher \ No newline at end of file +//#events-by-tag-publisher diff --git a/akka-docs/rst/scala/code/docs/persistence/query/PersistenceQueryDocSpec.scala b/akka-docs/rst/scala/code/docs/persistence/query/PersistenceQueryDocSpec.scala index 9d7084a097..bc915b886d 100644 --- a/akka-docs/rst/scala/code/docs/persistence/query/PersistenceQueryDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/persistence/query/PersistenceQueryDocSpec.scala @@ -57,7 +57,7 @@ object PersistenceQueryDocSpec { tag: String, offset: Long = 0L): Source[EventEnvelope, NotUsed] = { val props = MyEventsByTagPublisher.props(tag, offset, refreshInterval) Source.actorPublisher[EventEnvelope](props) - .mapMaterializedValue(_ ⇒ NotUsed) + .mapMaterializedValue(_ => NotUsed) } override def eventsByPersistenceId( diff --git a/akka-docs/rst/scala/code/docs/routing/CustomRouterDocSpec.scala b/akka-docs/rst/scala/code/docs/routing/CustomRouterDocSpec.scala index 9442abe106..a9245e4e1a 100644 --- a/akka-docs/rst/scala/code/docs/routing/CustomRouterDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/routing/CustomRouterDocSpec.scala @@ -124,7 +124,8 @@ class CustomRouterDocSpec extends AkkaSpec(CustomRouterDocSpec.config) with Impl val paths = for (n <- 1 to 10) yield ("/user/s" + n) val redundancy1: ActorRef = - system.actorOf(RedundancyGroup(paths, nbrCopies = 3).props(), + system.actorOf( + RedundancyGroup(paths, nbrCopies = 3).props(), name = "redundancy1") redundancy1 ! "important" //#usage-1 @@ -132,7 +133,8 @@ class CustomRouterDocSpec extends AkkaSpec(CustomRouterDocSpec.config) with Impl for (_ <- 1 to 3) expectMsg("important") //#usage-2 - val redundancy2: ActorRef = system.actorOf(FromConfig.props(), + val redundancy2: ActorRef = system.actorOf( + FromConfig.props(), name = "redundancy2") redundancy2 ! "very important" //#usage-2 diff --git a/akka-docs/rst/scala/code/docs/routing/RouterDocSpec.scala b/akka-docs/rst/scala/code/docs/routing/RouterDocSpec.scala index a53740eb1c..29b13a85ba 100644 --- a/akka-docs/rst/scala/code/docs/routing/RouterDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/routing/RouterDocSpec.scala @@ -415,7 +415,8 @@ router-dispatcher {} //#scatter-gather-group-2 val router20: ActorRef = - context.actorOf(ScatterGatherFirstCompletedGroup(paths, + context.actorOf(ScatterGatherFirstCompletedGroup( + paths, within = 10.seconds).props(), "router20") //#scatter-gather-group-2 @@ -437,7 +438,8 @@ router-dispatcher {} //#tail-chopping-group-2 val router24: ActorRef = - context.actorOf(TailChoppingGroup(paths, + context.actorOf(TailChoppingGroup( + paths, within = 10.seconds, interval = 20.millis).props(), "router24") //#tail-chopping-group-2 @@ -448,7 +450,8 @@ router-dispatcher {} //#consistent-hashing-pool-2 val router26: ActorRef = - context.actorOf(ConsistentHashingPool(5).props(Props[Worker]), + context.actorOf( + ConsistentHashingPool(5).props(Props[Worker]), "router26") //#consistent-hashing-pool-2 @@ -470,7 +473,8 @@ router-dispatcher {} //#resize-pool-2 val resizer = DefaultResizer(lowerBound = 2, upperBound = 15) val router30: ActorRef = - context.actorOf(RoundRobinPool(5, Some(resizer)).props(Props[Worker]), + context.actorOf( + RoundRobinPool(5, Some(resizer)).props(Props[Worker]), "router30") //#resize-pool-2 diff --git a/akka-docs/rst/scala/code/docs/serialization/SerializationDocSpec.scala b/akka-docs/rst/scala/code/docs/serialization/SerializationDocSpec.scala index 5a144dc719..f810790756 100644 --- a/akka-docs/rst/scala/code/docs/serialization/SerializationDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/serialization/SerializationDocSpec.scala @@ -38,8 +38,9 @@ package docs.serialization { // "fromBinary" deserializes the given array, // using the type hint (if any, see "includeManifest" above) - def fromBinary(bytes: Array[Byte], - clazz: Option[Class[_]]): AnyRef = { + def fromBinary( + bytes: Array[Byte], + clazz: Option[Class[_]]): AnyRef = { // Put your code that deserializes here //#... null diff --git a/akka-docs/rst/scala/code/docs/stream/CompositionDocSpec.scala b/akka-docs/rst/scala/code/docs/stream/CompositionDocSpec.scala index 645409110a..6e0363fc93 100644 --- a/akka-docs/rst/scala/code/docs/stream/CompositionDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/stream/CompositionDocSpec.scala @@ -216,8 +216,9 @@ class CompositionDocSpec extends AkkaSpec { def close() = p.trySuccess(None) } - def f(p: Promise[Option[Int]], - rest: (Future[OutgoingConnection], Future[String])): Future[MyClass] = { + def f( + p: Promise[Option[Int]], + rest: (Future[OutgoingConnection], Future[String])): Future[MyClass] = { val connFuture = rest._1 connFuture.map(MyClass(p, _)) diff --git a/akka-docs/rst/scala/code/docs/stream/FlowDocSpec.scala b/akka-docs/rst/scala/code/docs/stream/FlowDocSpec.scala index ad1e135555..a54f63d644 100644 --- a/akka-docs/rst/scala/code/docs/stream/FlowDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/stream/FlowDocSpec.scala @@ -149,12 +149,11 @@ class FlowDocSpec extends AkkaSpec { "various ways of transforming materialized values" in { import scala.concurrent.duration._ - val throttler = Flow.fromGraph(GraphDSL.create(Source.tick(1.second, 1.second, "test")) { implicit builder => - tickSource => - import GraphDSL.Implicits._ - val zip = builder.add(ZipWith[String, Int, Int](Keep.right)) - tickSource ~> zip.in0 - FlowShape(zip.in1, zip.out) + val throttler = Flow.fromGraph(GraphDSL.create(Source.tick(1.second, 1.second, "test")) { implicit builder => tickSource => + import GraphDSL.Implicits._ + val zip = builder.add(ZipWith[String, Int, Int](Keep.right)) + tickSource ~> zip.in0 + FlowShape(zip.in1, zip.out) }) //#flow-mat-combine @@ -212,11 +211,10 @@ class FlowDocSpec extends AkkaSpec { // The result of r11 can be also achieved by using the Graph API val r12: RunnableGraph[(Promise[Option[Int]], Cancellable, Future[Int])] = - RunnableGraph.fromGraph(GraphDSL.create(source, flow, sink)((_, _, _)) { implicit builder => - (src, f, dst) => - import GraphDSL.Implicits._ - src ~> f ~> dst - ClosedShape + RunnableGraph.fromGraph(GraphDSL.create(source, flow, sink)((_, _, _)) { implicit builder => (src, f, dst) => + import GraphDSL.Implicits._ + src ~> f ~> dst + ClosedShape }) //#flow-mat-combine diff --git a/akka-docs/rst/scala/code/docs/stream/GraphDSLDocSpec.scala b/akka-docs/rst/scala/code/docs/stream/GraphDSLDocSpec.scala index 6aa668352b..40e91146bf 100644 --- a/akka-docs/rst/scala/code/docs/stream/GraphDSLDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/stream/GraphDSLDocSpec.scala @@ -97,9 +97,9 @@ class GraphDSLDocSpec extends AkkaSpec { // A shape represents the input and output ports of a reusable // processing module case class PriorityWorkerPoolShape[In, Out]( - jobsIn: Inlet[In], + jobsIn: Inlet[In], priorityJobsIn: Inlet[In], - resultsOut: Outlet[Out]) extends Shape { + resultsOut: Outlet[Out]) extends Shape { // It is important to provide the list of all input and output // ports with a stable order. Duplicates are not allowed. @@ -117,7 +117,7 @@ class GraphDSLDocSpec extends AkkaSpec { // A Shape must also be able to create itself from existing ports override def copyFromPorts( - inlets: immutable.Seq[Inlet[_]], + inlets: immutable.Seq[Inlet[_]], outlets: immutable.Seq[Outlet[_]]) = { assert(inlets.size == this.inlets.size) assert(outlets.size == this.outlets.size) @@ -130,10 +130,10 @@ class GraphDSLDocSpec extends AkkaSpec { //#graph-dsl-components-create object PriorityWorkerPool { def apply[In, Out]( - worker: Flow[In, Out, Any], + worker: Flow[In, Out, Any], workerCount: Int): Graph[PriorityWorkerPoolShape[In, Out], NotUsed] = { - GraphDSL.create() { implicit b ⇒ + GraphDSL.create() { implicit b => import GraphDSL.Implicits._ val priorityMerge = b.add(MergePreferred[In](1)) @@ -203,10 +203,8 @@ class GraphDSLDocSpec extends AkkaSpec { "access to materialized value" in { //#graph-dsl-matvalue import GraphDSL.Implicits._ - val foldFlow: Flow[Int, Int, Future[Int]] = Flow.fromGraph(GraphDSL.create(Sink.fold[Int, Int](0)(_ + _)) { - implicit builder ⇒ - fold ⇒ - FlowShape(fold.in, builder.materializedValue.mapAsync(4)(identity).outlet) + val foldFlow: Flow[Int, Int, Future[Int]] = Flow.fromGraph(GraphDSL.create(Sink.fold[Int, Int](0)(_ + _)) { implicit builder => fold => + FlowShape(fold.in, builder.materializedValue.mapAsync(4)(identity).outlet) }) //#graph-dsl-matvalue @@ -215,16 +213,14 @@ class GraphDSLDocSpec extends AkkaSpec { //#graph-dsl-matvalue-cycle import GraphDSL.Implicits._ // This cannot produce any value: - val cyclicFold: Source[Int, Future[Int]] = Source.fromGraph(GraphDSL.create(Sink.fold[Int, Int](0)(_ + _)) { - implicit builder => - fold => - // - Fold cannot complete until its upstream mapAsync completes - // - mapAsync cannot complete until the materialized Future produced by - // fold completes - // As a result this Source will never emit anything, and its materialited - // Future will never complete - builder.materializedValue.mapAsync(4)(identity) ~> fold - SourceShape(builder.materializedValue.mapAsync(4)(identity).outlet) + val cyclicFold: Source[Int, Future[Int]] = Source.fromGraph(GraphDSL.create(Sink.fold[Int, Int](0)(_ + _)) { implicit builder => fold => + // - Fold cannot complete until its upstream mapAsync completes + // - mapAsync cannot complete until the materialized Future produced by + // fold completes + // As a result this Source will never emit anything, and its materialited + // Future will never complete + builder.materializedValue.mapAsync(4)(identity) ~> fold + SourceShape(builder.materializedValue.mapAsync(4)(identity).outlet) }) //#graph-dsl-matvalue-cycle } diff --git a/akka-docs/rst/scala/code/docs/stream/StreamPartialGraphDSLDocSpec.scala b/akka-docs/rst/scala/code/docs/stream/StreamPartialGraphDSLDocSpec.scala index ba18bcaced..19a1806d53 100644 --- a/akka-docs/rst/scala/code/docs/stream/StreamPartialGraphDSLDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/stream/StreamPartialGraphDSLDocSpec.scala @@ -31,18 +31,17 @@ class StreamPartialGraphDSLDocSpec extends AkkaSpec { val resultSink = Sink.head[Int] - val g = RunnableGraph.fromGraph(GraphDSL.create(resultSink) { implicit b => - sink => - import GraphDSL.Implicits._ + val g = RunnableGraph.fromGraph(GraphDSL.create(resultSink) { implicit b => sink => + import GraphDSL.Implicits._ - // importing the partial graph will return its shape (inlets & outlets) - val pm3 = b.add(pickMaxOfThree) + // importing the partial graph will return its shape (inlets & outlets) + val pm3 = b.add(pickMaxOfThree) - Source.single(1) ~> pm3.in(0) - Source.single(2) ~> pm3.in(1) - Source.single(3) ~> pm3.in(2) - pm3.out ~> sink.in - ClosedShape + Source.single(1) ~> pm3.in(0) + Source.single(2) ~> pm3.in(1) + Source.single(3) ~> pm3.in(2) + pm3.out ~> sink.in + ClosedShape }) val max: Future[Int] = g.run() diff --git a/akka-docs/rst/scala/code/docs/stream/cookbook/RecipeDroppyBroadcast.scala b/akka-docs/rst/scala/code/docs/stream/cookbook/RecipeDroppyBroadcast.scala index 704309629d..72cf648c2e 100644 --- a/akka-docs/rst/scala/code/docs/stream/cookbook/RecipeDroppyBroadcast.scala +++ b/akka-docs/rst/scala/code/docs/stream/cookbook/RecipeDroppyBroadcast.scala @@ -23,17 +23,16 @@ class RecipeDroppyBroadcast extends RecipeSpec { val mySink3 = Sink.fromSubscriber(sub3) //#droppy-bcast - val graph = RunnableGraph.fromGraph(GraphDSL.create(mySink1, mySink2, mySink3)((_, _, _)) { implicit b => - (sink1, sink2, sink3) => - import GraphDSL.Implicits._ + val graph = RunnableGraph.fromGraph(GraphDSL.create(mySink1, mySink2, mySink3)((_, _, _)) { implicit b => (sink1, sink2, sink3) => + import GraphDSL.Implicits._ - val bcast = b.add(Broadcast[Int](3)) - myElements ~> bcast + val bcast = b.add(Broadcast[Int](3)) + myElements ~> bcast - bcast.buffer(10, OverflowStrategy.dropHead) ~> sink1 - bcast.buffer(10, OverflowStrategy.dropHead) ~> sink2 - bcast.buffer(10, OverflowStrategy.dropHead) ~> sink3 - ClosedShape + bcast.buffer(10, OverflowStrategy.dropHead) ~> sink1 + bcast.buffer(10, OverflowStrategy.dropHead) ~> sink2 + bcast.buffer(10, OverflowStrategy.dropHead) ~> sink3 + ClosedShape }) //#droppy-bcast diff --git a/akka-docs/rst/scala/code/docs/stream/cookbook/RecipeReduceByKey.scala b/akka-docs/rst/scala/code/docs/stream/cookbook/RecipeReduceByKey.scala index 15c07825e9..908dd7d797 100644 --- a/akka-docs/rst/scala/code/docs/stream/cookbook/RecipeReduceByKey.scala +++ b/akka-docs/rst/scala/code/docs/stream/cookbook/RecipeReduceByKey.scala @@ -45,8 +45,8 @@ class RecipeReduceByKey extends RecipeSpec { //#reduce-by-key-general def reduceByKey[In, K, Out]( maximumGroupSize: Int, - groupKey: (In) => K, - map: (In) => Out)(reduce: (Out, Out) => Out): Flow[In, (K, Out), NotUsed] = { + groupKey: (In) => K, + map: (In) => Out)(reduce: (Out, Out) => Out): Flow[In, (K, Out), NotUsed] = { Flow[In] .groupBy[K](maximumGroupSize, groupKey) @@ -56,7 +56,8 @@ class RecipeReduceByKey extends RecipeSpec { } val wordCounts = words.via( - reduceByKey(MaximumDistinctWords, + reduceByKey( + MaximumDistinctWords, groupKey = (word: String) => word, map = (word: String) => 1)((left: Int, right: Int) => left + right)) //#reduce-by-key-general diff --git a/akka-docs/rst/scala/code/docs/stream/io/StreamTcpDocSpec.scala b/akka-docs/rst/scala/code/docs/stream/io/StreamTcpDocSpec.scala index 790e2377dd..366a21c69a 100644 --- a/akka-docs/rst/scala/code/docs/stream/io/StreamTcpDocSpec.scala +++ b/akka-docs/rst/scala/code/docs/stream/io/StreamTcpDocSpec.scala @@ -85,7 +85,7 @@ class StreamTcpDocSpec extends AkkaSpec { allowTruncation = true)) .map(_.utf8String) //#welcome-banner-chat-server - .map { command ⇒ serverProbe.ref ! command; command } + .map { command => serverProbe.ref ! command; command } //#welcome-banner-chat-server .via(commandParser) // merge in the initial banner after parser @@ -102,8 +102,8 @@ class StreamTcpDocSpec extends AkkaSpec { val input = new AtomicReference("Hello world" :: "What a lovely day" :: Nil) def readLine(prompt: String): String = { input.get() match { - case all @ cmd :: tail if input.compareAndSet(all, tail) ⇒ cmd - case _ ⇒ "q" + case all @ cmd :: tail if input.compareAndSet(all, tail) => cmd + case _ => "q" } } diff --git a/akka-docs/rst/scala/code/docs/testkit/TestKitUsageSpec.scala b/akka-docs/rst/scala/code/docs/testkit/TestKitUsageSpec.scala index c8124fc1aa..3cae559c51 100644 --- a/akka-docs/rst/scala/code/docs/testkit/TestKitUsageSpec.scala +++ b/akka-docs/rst/scala/code/docs/testkit/TestKitUsageSpec.scala @@ -26,7 +26,8 @@ import scala.collection.immutable * a Test to show some TestKit examples */ class TestKitUsageSpec - extends TestKit(ActorSystem("TestKitUsageSpec", + extends TestKit(ActorSystem( + "TestKitUsageSpec", ConfigFactory.parseString(TestKitUsageSpec.config))) with DefaultTimeout with ImplicitSender with WordSpecLike with Matchers with BeforeAndAfterAll { diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/client/OutgoingConnectionBlueprint.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/client/OutgoingConnectionBlueprint.scala index c0c2779c06..3b61836874 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/client/OutgoingConnectionBlueprint.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/client/OutgoingConnectionBlueprint.scala @@ -50,9 +50,10 @@ private[http] object OutgoingConnectionBlueprint { | Merge |<------------------------------------------ V +------------+ */ - def apply(hostHeader: headers.Host, - settings: ClientConnectionSettings, - log: LoggingAdapter): Http.ClientLayer = { + def apply( + hostHeader: headers.Host, + settings: ClientConnectionSettings, + log: LoggingAdapter): Http.ClientLayer = { import settings._ val core = BidiFlow.fromGraph(GraphDSL.create() { implicit b ⇒ diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolConductor.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolConductor.scala index be4ccb15ca..98f7ab171c 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolConductor.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolConductor.scala @@ -21,9 +21,9 @@ private object PoolConductor { import PoolSlot.{ RawSlotEvent, SlotEvent } case class Ports( - requestIn: Inlet[RequestContext], + requestIn: Inlet[RequestContext], slotEventIn: Inlet[RawSlotEvent], - slotOuts: immutable.Seq[Outlet[RequestContext]]) extends Shape { + slotOuts: immutable.Seq[Outlet[RequestContext]]) extends Shape { override val inlets = requestIn :: slotEventIn :: Nil override def outlets = slotOuts @@ -194,7 +194,7 @@ private object PoolConductor { @tailrec def bestSlot(ix: Int = 0, bestIx: Int = -1, bestState: SlotState = Busy): Int = if (ix < slotStates.length) { val pl = pipeliningLimit - slotStates(ix) -> bestState match { + slotStates(ix) → bestState match { case (Idle, _) ⇒ ix case (Unconnected, Loaded(_) | Busy) ⇒ bestSlot(ix + 1, ix, Unconnected) case (x @ Loaded(a), Loaded(b)) if a < b ⇒ bestSlot(ix + 1, ix, x) diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolFlow.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolFlow.scala index 1bf95ebb42..56799a1a98 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolFlow.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolFlow.scala @@ -67,9 +67,11 @@ private object PoolFlow { - Simple merge of the Connection Slots' outputs */ - def apply(connectionFlow: Flow[HttpRequest, HttpResponse, Future[Http.OutgoingConnection]], - settings: ConnectionPoolSettings, log: LoggingAdapter)( - implicit system: ActorSystem, fm: Materializer): Flow[RequestContext, ResponseContext, NotUsed] = + def apply( + connectionFlow: Flow[HttpRequest, HttpResponse, Future[Http.OutgoingConnection]], + settings: ConnectionPoolSettings, log: LoggingAdapter)( + implicit + system: ActorSystem, fm: Materializer): Flow[RequestContext, ResponseContext, NotUsed] = Flow.fromGraph(GraphDSL.create[FlowShape[RequestContext, ResponseContext]]() { implicit b ⇒ import settings._ import GraphDSL.Implicits._ diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolMasterActor.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolMasterActor.scala index e9de06d473..44b4de5859 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolMasterActor.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolMasterActor.scala @@ -53,8 +53,8 @@ private[http] final class PoolMasterActor extends Actor with ActorLogging { } val props = Props(new PoolInterfaceActor(gateway)).withDeploy(Deploy.local) val ref = context.actorOf(props, PoolInterfaceActor.name.next()) - poolStatus += gateway -> PoolInterfaceRunning(ref) - poolInterfaces += ref -> gateway + poolStatus += gateway → PoolInterfaceRunning(ref) + poolInterfaces += ref → gateway context.watch(ref) } @@ -93,7 +93,7 @@ private[http] final class PoolMasterActor extends Actor with ActorLogging { // to this actor by the pool actor, they will be retried once the shutdown // has completed. ref ! PoolInterfaceActor.Shutdown - poolStatus += gateway -> PoolInterfaceShuttingDown(shutdownCompletedPromise) + poolStatus += gateway → PoolInterfaceShuttingDown(shutdownCompletedPromise) case PoolInterfaceShuttingDown(formerPromise) ⇒ // Pool is already shutting down, mirror the existing promise. shutdownCompletedPromise.tryCompleteWith(formerPromise.future) diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolSlot.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolSlot.scala index b712f17b6d..191ee07112 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolSlot.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/client/PoolSlot.scala @@ -48,7 +48,8 @@ private object PoolSlot { v */ def apply(slotIx: Int, connectionFlow: Flow[HttpRequest, HttpResponse, Any], - settings: ConnectionPoolSettings)(implicit system: ActorSystem, + settings: ConnectionPoolSettings)(implicit + system: ActorSystem, fm: Materializer): Graph[FanOutShape2[RequestContext, ResponseContext, RawSlotEvent], Any] = GraphDSL.create() { implicit b ⇒ import GraphDSL.Implicits._ @@ -57,7 +58,8 @@ private object PoolSlot { val name = slotProcessorActorName.next() val slotProcessor = b.add { Flow.fromProcessor { () ⇒ - val actor = system.actorOf(Props(new SlotProcessor(slotIx, connectionFlow, settings)).withDeploy(Deploy.local), + val actor = system.actorOf( + Props(new SlotProcessor(slotIx, connectionFlow, settings)).withDeploy(Deploy.local), name) ActorProcessor[RequestContext, List[ProcessorOut]](actor) }.mapConcat(ConstantFun.scalaIdentityFunction) @@ -66,7 +68,8 @@ private object PoolSlot { slotProcessor ~> split.in - new FanOutShape2(slotProcessor.in, + new FanOutShape2( + slotProcessor.in, split.out(0).collect { case ResponseDelivery(r) ⇒ r }.outlet, split.out(1).collect { case r: RawSlotEvent ⇒ r }.outlet) } diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/BodyPartParser.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/BodyPartParser.scala index 342e5183e8..19ac33da07 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/BodyPartParser.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/BodyPartParser.scala @@ -25,17 +25,19 @@ import akka.stream.impl.fusing.SubSource * * see: http://tools.ietf.org/html/rfc2046#section-5.1.1 */ -private[http] final class BodyPartParser(defaultContentType: ContentType, - boundary: String, - log: LoggingAdapter, - settings: BodyPartParser.Settings) +private[http] final class BodyPartParser( + defaultContentType: ContentType, + boundary: String, + log: LoggingAdapter, + settings: BodyPartParser.Settings) extends GraphStage[FlowShape[ByteString, BodyPartParser.Output]] { import BodyPartParser._ import settings._ require(boundary.nonEmpty, "'boundary' parameter of multipart Content-Type must be non-empty") require(boundary.charAt(boundary.length - 1) != ' ', "'boundary' parameter of multipart Content-Type must not end with a space char") - require(boundaryChar matchesAll boundary, + require( + boundaryChar matchesAll boundary, s"'boundary' parameter of multipart Content-Type contains illegal character '${boundaryChar.firstMismatch(boundary).get}'") sealed trait StateResult // phantom type for ensuring soundness of our parsing method setup @@ -68,7 +70,7 @@ private[http] final class BodyPartParser(defaultContentType: ContentType, override def createLogic(attributes: Attributes): GraphStageLogic = new GraphStageLogic(shape) with InHandler with OutHandler { private var output = collection.immutable.Queue.empty[Output] // FIXME this probably is too wasteful - private var state: ByteString => StateResult = tryParseInitialBoundary + private var state: ByteString ⇒ StateResult = tryParseInitialBoundary private var shouldTerminate = false override def onPush(): Unit = { @@ -76,8 +78,8 @@ private[http] final class BodyPartParser(defaultContentType: ContentType, val elem = grab(in) try state(elem) catch { - case e: ParsingException => fail(e.info) - case NotEnoughDataException => + case e: ParsingException ⇒ fail(e.info) + case NotEnoughDataException ⇒ // we are missing a try/catch{continue} wrapper somewhere throw new IllegalStateException("unexpected NotEnoughDataException", NotEnoughDataException) } @@ -105,8 +107,8 @@ private[http] final class BodyPartParser(defaultContentType: ContentType, if (illegalHeaderWarnings) log.warning(errorInfo.withSummaryPrepended("Illegal multipart header").formatPretty) def tryParseInitialBoundary(input: ByteString): StateResult = - // we don't use boyerMoore here because we are testing for the boundary *without* a - // preceding CRLF and at a known location (the very beginning of the entity) + // we don't use boyerMoore here because we are testing for the boundary *without* a + // preceding CRLF and at a known location (the very beginning of the entity) try { if (boundary(input, 0)) { val ix = boundaryLength @@ -136,7 +138,7 @@ private[http] final class BodyPartParser(defaultContentType: ContentType, def contentType = cth match { case Some(x) ⇒ x.contentType - case None ⇒ defaultContentType + case None ⇒ defaultContentType } var lineEnd = 0 @@ -181,7 +183,8 @@ private[http] final class BodyPartParser(defaultContentType: ContentType, def parseEntity(headers: List[HttpHeader], contentType: ContentType, emitPartChunk: (List[HttpHeader], ContentType, ByteString) ⇒ Unit = { (headers, ct, bytes) ⇒ - emit(BodyPartStart(headers, entityParts ⇒ HttpEntity.IndefiniteLength(ct, + emit(BodyPartStart(headers, entityParts ⇒ HttpEntity.IndefiniteLength( + ct, entityParts.collect { case EntityPart(data) ⇒ data }))) emit(bytes) }, diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpHeaderParser.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpHeaderParser.scala index 8b0cd00339..fa4b23637a 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpHeaderParser.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpHeaderParser.scala @@ -59,15 +59,15 @@ import akka.http.impl.model.parser.CharacterClasses._ * cannot hold more then 255 items, so this array has a fixed size of 255. */ private[engine] final class HttpHeaderParser private ( - val settings: HttpHeaderParser.Settings, - onIllegalHeader: ErrorInfo ⇒ Unit, - private[this] var nodes: Array[Char] = new Array(512), // initial size, can grow as needed - private[this] var nodeCount: Int = 0, - private[this] var branchData: Array[Short] = new Array(254 * 3), - private[this] var branchDataCount: Int = 0, - private[this] var values: Array[AnyRef] = new Array(255), // fixed size of 255 - private[this] var valueCount: Int = 0, - private[this] var trieIsPrivate: Boolean = false) { // signals the trie data can be mutated w/o having to copy first + val settings: HttpHeaderParser.Settings, + onIllegalHeader: ErrorInfo ⇒ Unit, + private[this] var nodes: Array[Char] = new Array(512), // initial size, can grow as needed + private[this] var nodeCount: Int = 0, + private[this] var branchData: Array[Short] = new Array(254 * 3), + private[this] var branchDataCount: Int = 0, + private[this] var values: Array[AnyRef] = new Array(255), // fixed size of 255 + private[this] var valueCount: Int = 0, + private[this] var trieIsPrivate: Boolean = false) { // signals the trie data can be mutated w/o having to copy first // TODO: evaluate whether switching to a value-class-based approach allows us to improve code readability without sacrificing performance @@ -300,7 +300,7 @@ private[engine] final class HttpHeaderParser private ( val prefixedLines = lines.zipWithIndex map { case (line, ix) ⇒ (if (ix < mainIx) p1 else if (ix > mainIx) p3 else p2) :: line } - prefixedLines -> mainIx + prefixedLines → mainIx } def branchLines(dataIx: Int, p1: String, p2: String, p3: String) = branchData(dataIx) match { case 0 ⇒ Seq.empty @@ -315,9 +315,9 @@ private[engine] final class HttpHeaderParser private ( case ValueBranch(_, valueParser, branchRootNodeIx, _) ⇒ val pad = " " * (valueParser.headerName.length + 3) recurseAndPrefixLines(branchRootNodeIx, pad, "(" + valueParser.headerName + ")-", pad) - case vp: HeaderValueParser ⇒ Seq(" (" :: vp.headerName :: ")" :: Nil) -> 0 - case value: RawHeader ⇒ Seq(" *" :: value.toString :: Nil) -> 0 - case value ⇒ Seq(" " :: value.toString :: Nil) -> 0 + case vp: HeaderValueParser ⇒ Seq(" (" :: vp.headerName :: ")" :: Nil) → 0 + case value: RawHeader ⇒ Seq(" *" :: value.toString :: Nil) → 0 + case value ⇒ Seq(" " :: value.toString :: Nil) → 0 } case nodeChar ⇒ val rix = rowIx(msb) @@ -350,7 +350,7 @@ private[engine] final class HttpHeaderParser private ( node >>> 8 match { case 0 ⇒ build(nodeIx + 1) case msb if (node & 0xFF) == 0 ⇒ values(msb - 1) match { - case ValueBranch(_, parser, _, count) ⇒ Map(parser.headerName -> count) + case ValueBranch(_, parser, _, count) ⇒ Map(parser.headerName → count) case _ ⇒ Map.empty } case msb ⇒ @@ -482,7 +482,7 @@ private[http] object HttpHeaderParser { onIllegalHeader(error.withSummaryPrepended(s"Illegal '$headerName' header")) RawHeader(headerName, trimmedHeaderValue) } - header -> endIx + header → endIx } } @@ -490,7 +490,7 @@ private[http] object HttpHeaderParser { extends HeaderValueParser(headerName, maxValueCount) { def apply(hhp: HttpHeaderParser, input: ByteString, valueStart: Int, onIllegalHeader: ErrorInfo ⇒ Unit): (HttpHeader, Int) = { val (headerValue, endIx) = scanHeaderValue(hhp, input, valueStart, valueStart + maxHeaderValueLength + 2)() - RawHeader(headerName, headerValue.trim) -> endIx + RawHeader(headerName, headerValue.trim) → endIx } } diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpMessageParser.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpMessageParser.scala index 831bec2474..781873cdfb 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpMessageParser.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpMessageParser.scala @@ -19,13 +19,14 @@ import akka.http.scaladsl.model._ import headers._ import HttpProtocols._ import ParserOutput._ -import akka.stream.{Attributes, FlowShape, Inlet, Outlet} +import akka.stream.{ Attributes, FlowShape, Inlet, Outlet } /** * INTERNAL API */ -private[http] abstract class HttpMessageParser[Output >: MessageOutput <: ParserOutput](val settings: ParserSettings, - val headerParser: HttpHeaderParser) { self ⇒ +private[http] abstract class HttpMessageParser[Output >: MessageOutput <: ParserOutput]( + val settings: ParserSettings, + val headerParser: HttpHeaderParser) { self ⇒ import HttpMessageParser._ import settings._ @@ -191,8 +192,9 @@ private[http] abstract class HttpMessageParser[Output >: MessageOutput <: Parser clh: Option[`Content-Length`], cth: Option[`Content-Type`], teh: Option[`Transfer-Encoding`], expect100continue: Boolean, hostHeaderPresent: Boolean, closeAfterResponseCompletion: Boolean): StateResult - def parseFixedLengthBody(remainingBodyBytes: Long, - isLastMessage: Boolean)(input: ByteString, bodyStart: Int): StateResult = { + def parseFixedLengthBody( + remainingBodyBytes: Long, + isLastMessage: Boolean)(input: ByteString, bodyStart: Int): StateResult = { val remainingInputBytes = input.length - bodyStart if (remainingInputBytes > 0) { if (remainingInputBytes < remainingBodyBytes) { diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpRequestParser.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpRequestParser.scala index 4ca75b3922..3fe26250ac 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpRequestParser.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpRequestParser.scala @@ -18,9 +18,10 @@ import ParserOutput._ /** * INTERNAL API */ -private[http] class HttpRequestParser(_settings: ParserSettings, - rawRequestUriHeader: Boolean, - _headerParser: HttpHeaderParser) +private[http] class HttpRequestParser( + _settings: ParserSettings, + rawRequestUriHeader: Boolean, + _headerParser: HttpHeaderParser) extends HttpMessageParser[RequestOutput](_settings, _headerParser) { import HttpMessageParser._ import settings._ @@ -54,7 +55,8 @@ private[http] class HttpRequestParser(_settings: ParserSettings, } case c ⇒ parseCustomMethod(ix + 1, sb.append(c)) } - } else throw new ParsingException(BadRequest, + } else throw new ParsingException( + BadRequest, ErrorInfo("Unsupported HTTP method", s"HTTP method too long (started with '${sb.toString}'). " + "Increase `akka.http.server.parsing.max-method-length` to support HTTP methods with more characters.")) @@ -93,7 +95,8 @@ private[http] class HttpRequestParser(_settings: ParserSettings, if (ix == input.length) throw NotEnoughDataException else if (CharacterClasses.WSPCRLF(input(ix).toChar)) ix else if (ix < uriEndLimit) findUriEnd(ix + 1) - else throw new ParsingException(RequestUriTooLong, + else throw new ParsingException( + RequestUriTooLong, s"URI length exceeds the configured limit of $maxUriLength characters") val uriEnd = findUriEnd() @@ -113,8 +116,9 @@ private[http] class HttpRequestParser(_settings: ParserSettings, clh: Option[`Content-Length`], cth: Option[`Content-Type`], teh: Option[`Transfer-Encoding`], expect100continue: Boolean, hostHeaderPresent: Boolean, closeAfterResponseCompletion: Boolean): StateResult = if (hostHeaderPresent || protocol == HttpProtocols.`HTTP/1.0`) { - def emitRequestStart(createEntity: EntityCreator[RequestOutput, RequestEntity], - headers: List[HttpHeader] = headers) = { + def emitRequestStart( + createEntity: EntityCreator[RequestOutput, RequestEntity], + headers: List[HttpHeader] = headers) = { val allHeaders0 = if (rawRequestUriHeader) `Raw-Request-URI`(new String(uriBytes, HttpCharsets.`US-ASCII`.nioCharset)) :: headers else headers diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpResponseParser.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpResponseParser.scala index cf0c829c64..2d65fe6c2d 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpResponseParser.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/HttpResponseParser.scala @@ -88,8 +88,9 @@ private[http] class HttpResponseParser(_settings: ParserSettings, _headerParser: clh: Option[`Content-Length`], cth: Option[`Content-Type`], teh: Option[`Transfer-Encoding`], expect100continue: Boolean, hostHeaderPresent: Boolean, closeAfterResponseCompletion: Boolean): StateResult = { - def emitResponseStart(createEntity: EntityCreator[ResponseOutput, ResponseEntity], - headers: List[HttpHeader] = headers) = { + def emitResponseStart( + createEntity: EntityCreator[ResponseOutput, ResponseEntity], + headers: List[HttpHeader] = headers) = { val close = contextForCurrentResponse.get.oneHundredContinueTrigger match { case None ⇒ closeAfterResponseCompletion @@ -175,8 +176,9 @@ private[http] object HttpResponseParser { * a promise whose completion either triggers the sending of the (suspended) * request entity or the closing of the connection (for error completion) */ - private[http] final case class ResponseContext(requestMethod: HttpMethod, - oneHundredContinueTrigger: Option[Promise[Unit]]) + private[http] final case class ResponseContext( + requestMethod: HttpMethod, + oneHundredContinueTrigger: Option[Promise[Unit]]) private[http] object OneHundredContinueError extends RuntimeException("Received error response for request with `Expect: 100-continue` header") diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/ParserOutput.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/ParserOutput.scala index 0530010e32..278c71203f 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/ParserOutput.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/ParserOutput.scala @@ -26,19 +26,19 @@ private[http] object ParserOutput { sealed trait ErrorOutput extends MessageOutput final case class RequestStart( - method: HttpMethod, - uri: Uri, - protocol: HttpProtocol, - headers: List[HttpHeader], - createEntity: EntityCreator[RequestOutput, RequestEntity], + method: HttpMethod, + uri: Uri, + protocol: HttpProtocol, + headers: List[HttpHeader], + createEntity: EntityCreator[RequestOutput, RequestEntity], expect100Continue: Boolean, - closeRequested: Boolean) extends MessageStart with RequestOutput + closeRequested: Boolean) extends MessageStart with RequestOutput final case class ResponseStart( - statusCode: StatusCode, - protocol: HttpProtocol, - headers: List[HttpHeader], - createEntity: EntityCreator[ResponseOutput, ResponseEntity], + statusCode: StatusCode, + protocol: HttpProtocol, + headers: List[HttpHeader], + createEntity: EntityCreator[ResponseOutput, ResponseEntity], closeRequested: Boolean) extends MessageStart with ResponseOutput case object MessageEnd extends MessageOutput diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/package.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/package.scala index 449f7784dd..6fe8fb6d90 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/package.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/parsing/package.scala @@ -51,8 +51,9 @@ package parsing { /** * INTERNAL API */ - private[parsing] class ParsingException(val status: StatusCode, - val info: ErrorInfo) extends RuntimeException(info.formatPretty) { + private[parsing] class ParsingException( + val status: StatusCode, + val info: ErrorInfo) extends RuntimeException(info.formatPretty) { def this(status: StatusCode, summary: String = "") = this(status, ErrorInfo(if (summary.isEmpty) status.defaultMessage else summary)) def this(summary: String) = diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/BodyPartRenderer.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/BodyPartRenderer.scala index 7f341060c4..4cfae5850d 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/BodyPartRenderer.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/BodyPartRenderer.scala @@ -25,10 +25,11 @@ import scala.concurrent.forkjoin.ThreadLocalRandom */ private[http] object BodyPartRenderer { - def streamed(boundary: String, - nioCharset: Charset, - partHeadersSizeHint: Int, - log: LoggingAdapter): PushPullStage[Multipart.BodyPart, Source[ChunkStreamPart, Any]] = + def streamed( + boundary: String, + nioCharset: Charset, + partHeadersSizeHint: Int, + log: LoggingAdapter): PushPullStage[Multipart.BodyPart, Source[ChunkStreamPart, Any]] = new PushPullStage[Multipart.BodyPart, Source[ChunkStreamPart, Any]] { var firstBoundaryRendered = false diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/HttpRequestRendererFactory.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/HttpRequestRendererFactory.scala index 18c6d610b9..ea797d9906 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/HttpRequestRendererFactory.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/HttpRequestRendererFactory.scala @@ -22,9 +22,10 @@ import headers._ /** * INTERNAL API */ -private[http] class HttpRequestRendererFactory(userAgentHeader: Option[headers.`User-Agent`], - requestHeaderSizeHint: Int, - log: LoggingAdapter) { +private[http] class HttpRequestRendererFactory( + userAgentHeader: Option[headers.`User-Agent`], + requestHeaderSizeHint: Int, + log: LoggingAdapter) { import HttpRequestRendererFactory.RequestRenderingOutput def renderToSource(ctx: RequestRenderingContext): Source[ByteString, Any] = render(ctx).byteStream @@ -175,6 +176,6 @@ private[http] object HttpRequestRendererFactory { * if the future is completed with an error the connection is to be closed. */ private[http] final case class RequestRenderingContext( - request: HttpRequest, - hostHeader: Host, + request: HttpRequest, + hostHeader: Host, sendEntityTrigger: Option[Future[NotUsed]] = None) diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/HttpResponseRendererFactory.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/HttpResponseRendererFactory.scala index e3e46eb734..8a7ca48e72 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/HttpResponseRendererFactory.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/HttpResponseRendererFactory.scala @@ -23,9 +23,10 @@ import headers._ /** * INTERNAL API */ -private[http] class HttpResponseRendererFactory(serverHeader: Option[headers.Server], - responseHeaderSizeHint: Int, - log: LoggingAdapter) { +private[http] class HttpResponseRendererFactory( + serverHeader: Option[headers.Server], + responseHeaderSizeHint: Int, + log: LoggingAdapter) { private val renderDefaultServerHeader: Rendering ⇒ Unit = serverHeader match { @@ -46,7 +47,7 @@ private[http] class HttpResponseRendererFactory(serverHeader: Option[headers.Ser val r = new ByteArrayRendering(48) DateTime(now).renderRfc1123DateTimeString(r ~~ headers.Date) ~~ CrLf cachedBytes = r.get - cachedDateHeader = cachedSeconds -> cachedBytes + cachedDateHeader = cachedSeconds → cachedBytes } cachedBytes } @@ -275,10 +276,10 @@ private[http] class HttpResponseRendererFactory(serverHeader: Option[headers.Ser * INTERNAL API */ private[http] final case class ResponseRenderingContext( - response: HttpResponse, - requestMethod: HttpMethod = HttpMethods.GET, + response: HttpResponse, + requestMethod: HttpMethod = HttpMethods.GET, requestProtocol: HttpProtocol = HttpProtocols.`HTTP/1.1`, - closeRequested: Boolean = false) + closeRequested: Boolean = false) /** INTERNAL API */ private[http] sealed trait ResponseRenderingOutput diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/RenderSupport.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/RenderSupport.scala index 6529d5f8a9..23895ada3a 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/RenderSupport.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/rendering/RenderSupport.scala @@ -32,11 +32,10 @@ private object RenderSupport { val defaultLastChunkBytes: ByteString = renderChunk(HttpEntity.LastChunk) def CancelSecond[T, Mat](first: Source[T, Mat], second: Source[T, Any]): Source[T, Mat] = { - Source.fromGraph(GraphDSL.create(first) { implicit b ⇒ - frst ⇒ - import GraphDSL.Implicits._ - second ~> Sink.cancelled - SourceShape(frst.out) + Source.fromGraph(GraphDSL.create(first) { implicit b ⇒ frst ⇒ + import GraphDSL.Implicits._ + second ~> Sink.cancelled + SourceShape(frst.out) }) } diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/server/HttpServerBluePrint.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/server/HttpServerBluePrint.scala index 1a58b291cc..dc8f453c56 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/server/HttpServerBluePrint.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/server/HttpServerBluePrint.scala @@ -156,7 +156,7 @@ private[http] object HttpServerBluePrint { case StreamedEntityCreator(creator) ⇒ streamRequestEntity(creator) } - def streamRequestEntity(creator: (Source[ParserOutput.RequestOutput, NotUsed]) => RequestEntity): RequestEntity = { + def streamRequestEntity(creator: (Source[ParserOutput.RequestOutput, NotUsed]) ⇒ RequestEntity): RequestEntity = { // stream incoming chunks into the request entity until we reach the end of it // and then toggle back to "idle" @@ -242,8 +242,9 @@ private[http] object HttpServerBluePrint { val errorHandler: PartialFunction[Throwable, Throwable] = { // idle timeouts should not result in errors in the log. See 19058. - case timeout: HttpConnectionTimeoutException ⇒ log.debug(s"Closing HttpConnection due to timeout: ${timeout.getMessage}"); timeout - case t ⇒ log.error(t, "Outgoing response stream error"); t + case timeout: HttpConnectionTimeoutException ⇒ + log.debug(s"Closing HttpConnection due to timeout: ${timeout.getMessage}"); timeout + case t ⇒ log.error(t, "Outgoing response stream error"); t } Flow[ResponseRenderingContext] @@ -252,7 +253,7 @@ private[http] object HttpServerBluePrint { } class RequestTimeoutSupport(initialTimeout: FiniteDuration) - extends GraphStage[BidiShape[HttpRequest, HttpRequest, HttpResponse, HttpResponse]] { + extends GraphStage[BidiShape[HttpRequest, HttpRequest, HttpResponse, HttpResponse]] { private val requestIn = Inlet[HttpRequest]("requestIn") private val requestOut = Outlet[HttpRequest]("requestOut") private val responseIn = Inlet[HttpResponse]("responseIn") @@ -303,14 +304,15 @@ private[http] object HttpServerBluePrint { } } - private class TimeoutSetup(val timeoutBase: Deadline, - val scheduledTask: Cancellable, - val timeout: Duration, - val handler: HttpRequest ⇒ HttpResponse) + private class TimeoutSetup( + val timeoutBase: Deadline, + val scheduledTask: Cancellable, + val timeout: Duration, + val handler: HttpRequest ⇒ HttpResponse) private class TimeoutAccessImpl(request: HttpRequest, initialTimeout: FiniteDuration, requestEnd: Future[Unit], trigger: AsyncCallback[(TimeoutAccess, HttpResponse)], materializer: Materializer) - extends AtomicReference[Future[TimeoutSetup]] with TimeoutAccess with (HttpRequest ⇒ HttpResponse) { self ⇒ + extends AtomicReference[Future[TimeoutSetup]] with TimeoutAccess with (HttpRequest ⇒ HttpResponse) { self ⇒ import materializer.executionContext set { @@ -320,8 +322,8 @@ private[http] object HttpServerBluePrint { override def apply(request: HttpRequest) = //#default-request-timeout-httpresponse HttpResponse(StatusCodes.ServiceUnavailable, entity = "The server was not able " + - "to produce a timely response to your request.\r\nPlease try again in a short while!") - //# + "to produce a timely response to your request.\r\nPlease try again in a short while!") + //# def clear(): Unit = // best effort timeout cancellation get.fast.foreach(setup ⇒ if (setup.scheduledTask ne null) setup.scheduledTask.cancel()) @@ -355,7 +357,7 @@ private[http] object HttpServerBluePrint { } class ControllerStage(settings: ServerSettings, log: LoggingAdapter) - extends GraphStage[BidiShape[RequestOutput, RequestOutput, HttpResponse, ResponseRenderingContext]] { + extends GraphStage[BidiShape[RequestOutput, RequestOutput, HttpResponse, ResponseRenderingContext]] { private val requestParsingIn = Inlet[RequestOutput]("requestParsingIn") private val requestPrepOut = Outlet[RequestOutput]("requestPrepOut") private val httpResponseIn = Inlet[HttpResponse]("httpResponseIn") @@ -387,7 +389,7 @@ private[http] object HttpServerBluePrint { messageEndPending = false push(requestPrepOut, MessageEnd) case MessageStartError(status, info) ⇒ finishWithIllegalRequestError(status, info) - case x: EntityStreamError if messageEndPending && openRequests.isEmpty => + case x: EntityStreamError if messageEndPending && openRequests.isEmpty ⇒ // client terminated the connection after receiving an early response to 100-continue completeStage() case x ⇒ push(requestPrepOut, x) @@ -463,7 +465,8 @@ private[http] object HttpServerBluePrint { }) def finishWithIllegalRequestError(status: StatusCode, info: ErrorInfo): Unit = { - logParsingError(info withSummaryPrepended s"Illegal request, responding with status '$status'", + logParsingError( + info withSummaryPrepended s"Illegal request, responding with status '$status'", log, settings.parserSettings.errorLoggingVerbosity) val msg = if (settings.verboseErrorMessages) info.formatPretty else info.summary emitErrorResponse(HttpResponse(status, entity = msg)) @@ -557,7 +560,7 @@ private[http] object HttpServerBluePrint { One2OneBidiFlow[HttpRequest, HttpResponse](pipeliningLimit).reversed private class ProtocolSwitchStage(settings: ServerSettings, log: LoggingAdapter) - extends GraphStage[BidiShape[ResponseRenderingOutput, ByteString, SessionBytes, SessionBytes]] { + extends GraphStage[BidiShape[ResponseRenderingOutput, ByteString, SessionBytes, SessionBytes]] { private val fromNet = Inlet[SessionBytes]("fromNet") private val toNet = Outlet[ByteString]("toNet") diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/ws/FrameEvent.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/ws/FrameEvent.scala index 6282cd8c87..6146056cff 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/ws/FrameEvent.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/ws/FrameEvent.scala @@ -41,23 +41,25 @@ private[http] final case class FrameData(data: ByteString, lastPart: Boolean) ex } /** Model of the frame header */ -private[http] final case class FrameHeader(opcode: Protocol.Opcode, - mask: Option[Int], - length: Long, - fin: Boolean, - rsv1: Boolean = false, - rsv2: Boolean = false, - rsv3: Boolean = false) +private[http] final case class FrameHeader( + opcode: Protocol.Opcode, + mask: Option[Int], + length: Long, + fin: Boolean, + rsv1: Boolean = false, + rsv2: Boolean = false, + rsv3: Boolean = false) private[http] object FrameEvent { - def empty(opcode: Protocol.Opcode, - fin: Boolean, - rsv1: Boolean = false, - rsv2: Boolean = false, - rsv3: Boolean = false): FrameStart = + def empty( + opcode: Protocol.Opcode, + fin: Boolean, + rsv1: Boolean = false, + rsv2: Boolean = false, + rsv3: Boolean = false): FrameStart = fullFrame(opcode, None, ByteString.empty, fin, rsv1, rsv2, rsv3) def fullFrame(opcode: Protocol.Opcode, mask: Option[Int], data: ByteString, - fin: Boolean, + fin: Boolean, rsv1: Boolean = false, rsv2: Boolean = false, rsv3: Boolean = false): FrameStart = diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/ws/FrameEventParser.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/ws/FrameEventParser.scala index 5f02ea22d3..3fea4f3ab8 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/ws/FrameEventParser.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/ws/FrameEventParser.scala @@ -73,7 +73,8 @@ private[http] object FrameEventParser extends ByteStringParser[FrameEvent] { def isFlagSet(mask: Int): Boolean = (flags & mask) != 0 val header = - FrameHeader(Opcode.forCode(op.toByte), + FrameHeader( + Opcode.forCode(op.toByte), mask, length, fin = isFlagSet(FIN_MASK), diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/ws/Handshake.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/ws/Handshake.scala index 885392262f..c207b7c27e 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/ws/Handshake.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/ws/Handshake.scala @@ -92,7 +92,8 @@ private[http] object Handshake { def requestedProtocols: Seq[String] = clientSupportedSubprotocols def handle(handler: Either[Graph[FlowShape[FrameEvent, FrameEvent], Any], Graph[FlowShape[Message, Message], Any]], subprotocol: Option[String]): HttpResponse = { - require(subprotocol.forall(chosen ⇒ clientSupportedSubprotocols.contains(chosen)), + require( + subprotocol.forall(chosen ⇒ clientSupportedSubprotocols.contains(chosen)), s"Tried to choose invalid subprotocol '$subprotocol' which wasn't offered by the client: [${requestedProtocols.mkString(", ")}]") buildResponse(key.get, handler, subprotocol) } diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/ws/WebSocket.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/ws/WebSocket.scala index 3ab7d4eb71..1abe009a30 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/ws/WebSocket.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/ws/WebSocket.scala @@ -26,10 +26,11 @@ private[http] object WebSocket { /** * A stack of all the higher WS layers between raw frames and the user API. */ - def stack(serverSide: Boolean, - maskingRandomFactory: () ⇒ Random, - closeTimeout: FiniteDuration = 3.seconds, - log: LoggingAdapter): BidiFlow[FrameEvent, Message, Message, FrameEvent, NotUsed] = + def stack( + serverSide: Boolean, + maskingRandomFactory: () ⇒ Random, + closeTimeout: FiniteDuration = 3.seconds, + log: LoggingAdapter): BidiFlow[FrameEvent, Message, Message, FrameEvent, NotUsed] = masking(serverSide, maskingRandomFactory) atop frameHandling(serverSide, closeTimeout, log) atop messageAPI(serverSide, closeTimeout) @@ -50,9 +51,10 @@ private[http] object WebSocket { * The layer that implements all low-level frame handling, like handling control frames, collecting messages * from frames, decoding text messages, close handling, etc. */ - def frameHandling(serverSide: Boolean = true, - closeTimeout: FiniteDuration, - log: LoggingAdapter): BidiFlow[FrameEventOrError, FrameHandler.Output, FrameOutHandler.Input, FrameStart, NotUsed] = + def frameHandling( + serverSide: Boolean = true, + closeTimeout: FiniteDuration, + log: LoggingAdapter): BidiFlow[FrameEventOrError, FrameHandler.Output, FrameOutHandler.Input, FrameStart, NotUsed] = BidiFlow.fromFlows( FrameHandler.create(server = serverSide), FrameOutHandler.create(serverSide, closeTimeout, log)) @@ -67,7 +69,7 @@ private[http] object WebSocket { override def createLogic(inheritedAttributes: Attributes): GraphStageLogic = new GraphStageLogic(shape) with InHandler with OutHandler { var inMessage = false - override def onPush():Unit = grab(in) match { + override def onPush(): Unit = grab(in) match { case PeerClosed(code, reason) ⇒ if (code.exists(Protocol.CloseCodes.isError)) failStage(new PeerClosedConnectionException(code.get, reason)) else if (inMessage) failStage(new ProtocolException(s"Truncated message, peer closed connection in the middle of message.")) @@ -77,8 +79,8 @@ private[http] object WebSocket { else failStage(new IllegalStateException("Regular close from FrameHandler is unexpected")) case x: MessageDataPart ⇒ inMessage = !x.last - push(out,x) - case x ⇒ push(out,x) + push(out, x) + case x ⇒ push(out, x) } override def onPull(): Unit = pull(in) setHandlers(in, out, this) @@ -88,8 +90,9 @@ private[http] object WebSocket { /** * The layer that provides the high-level user facing API on top of frame handling. */ - def messageAPI(serverSide: Boolean, - closeTimeout: FiniteDuration): BidiFlow[FrameHandler.Output, Message, Message, FrameOutHandler.Input, NotUsed] = { + def messageAPI( + serverSide: Boolean, + closeTimeout: FiniteDuration): BidiFlow[FrameHandler.Output, Message, Message, FrameOutHandler.Input, NotUsed] = { /* Collects user-level API messages from MessageDataParts */ val collectMessage: Flow[MessageDataPart, Message, NotUsed] = Flow[MessageDataPart] diff --git a/akka-http-core/src/main/scala/akka/http/impl/engine/ws/WebSocketClientBlueprint.scala b/akka-http-core/src/main/scala/akka/http/impl/engine/ws/WebSocketClientBlueprint.scala index 9986b88eb9..001932af61 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/engine/ws/WebSocketClientBlueprint.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/engine/ws/WebSocketClientBlueprint.scala @@ -33,9 +33,10 @@ object WebSocketClientBlueprint { /** * Returns a WebSocketClientLayer that can be materialized once. */ - def apply(request: WebSocketRequest, - settings: ClientConnectionSettings, - log: LoggingAdapter): Http.WebSocketClientLayer = + def apply( + request: WebSocketRequest, + settings: ClientConnectionSettings, + log: LoggingAdapter): Http.WebSocketClientLayer = (simpleTls.atopMat(handshake(request, settings, log))(Keep.right) atop WebSocket.framing atop WebSocket.stack(serverSide = false, maskingRandomFactory = settings.websocketRandomFactory, log = log)).reversed @@ -44,9 +45,10 @@ object WebSocketClientBlueprint { * A bidi flow that injects and inspects the WS handshake and then goes out of the way. This BidiFlow * can only be materialized once. */ - def handshake(request: WebSocketRequest, - settings: ClientConnectionSettings, - log: LoggingAdapter): BidiFlow[ByteString, ByteString, ByteString, ByteString, Future[WebSocketUpgradeResponse]] = { + def handshake( + request: WebSocketRequest, + settings: ClientConnectionSettings, + log: LoggingAdapter): BidiFlow[ByteString, ByteString, ByteString, ByteString, Future[WebSocketUpgradeResponse]] = { import request._ val result = Promise[WebSocketUpgradeResponse]() diff --git a/akka-http-core/src/main/scala/akka/http/impl/model/parser/CommonRules.scala b/akka-http-core/src/main/scala/akka/http/impl/model/parser/CommonRules.scala index d000081242..1176c33133 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/model/parser/CommonRules.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/model/parser/CommonRules.scala @@ -180,8 +180,8 @@ private[parser] trait CommonRules { this: Parser with StringBuilding ⇒ def `challenge-or-credentials`: Rule2[String, Seq[(String, String)]] = rule { `auth-scheme` ~ ( - oneOrMore(`auth-param` ~> (_ -> _)).separatedBy(listSep) - | `token68` ~> (x ⇒ ("" -> x) :: Nil) + oneOrMore(`auth-param` ~> (_ → _)).separatedBy(listSep) + | `token68` ~> (x ⇒ ("" → x) :: Nil) | push(Nil)) } @@ -397,7 +397,7 @@ private[parser] trait CommonRules { this: Parser with StringBuilding ⇒ token ~ zeroOrMore(ws(';') ~ `transfer-parameter`) ~> (_.toMap) ~> (TransferEncodings.Extension(_, _)) } - def `transfer-parameter` = rule { token ~ ws('=') ~ word ~> (_ -> _) } + def `transfer-parameter` = rule { token ~ ws('=') ~ word ~> (_ → _) } // ****************************************************************************************** // helpers diff --git a/akka-http-core/src/main/scala/akka/http/impl/model/parser/ContentDispositionHeader.scala b/akka-http-core/src/main/scala/akka/http/impl/model/parser/ContentDispositionHeader.scala index 41df467a4b..6c11098f87 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/model/parser/ContentDispositionHeader.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/model/parser/ContentDispositionHeader.scala @@ -22,7 +22,7 @@ private[parser] trait ContentDispositionHeader { this: Parser with CommonRules w def `disp-ext-type` = rule { token } - def `disposition-parm` = rule { (`filename-parm` | `disp-ext-parm`) ~> (_ -> _) } + def `disposition-parm` = rule { (`filename-parm` | `disp-ext-parm`) ~> (_ → _) } def `filename-parm` = rule( ignoreCase("filename") ~ OWS ~ ws('=') ~ push("filename") ~ word diff --git a/akka-http-core/src/main/scala/akka/http/impl/model/parser/ContentTypeHeader.scala b/akka-http-core/src/main/scala/akka/http/impl/model/parser/ContentTypeHeader.scala index b54990c8cc..4df602a98c 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/model/parser/ContentTypeHeader.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/model/parser/ContentTypeHeader.scala @@ -15,11 +15,12 @@ private[parser] trait ContentTypeHeader { this: Parser with CommonRules with Com `media-type` ~ EOI ~> ((main, sub, params) ⇒ headers.`Content-Type`(contentType(main, sub, params))) } - @tailrec private def contentType(main: String, - sub: String, - params: Seq[(String, String)], - charset: Option[HttpCharset] = None, - builder: StringMapBuilder = null): ContentType = + @tailrec private def contentType( + main: String, + sub: String, + params: Seq[(String, String)], + charset: Option[HttpCharset] = None, + builder: StringMapBuilder = null): ContentType = params match { case Nil ⇒ val parameters = if (builder eq null) Map.empty[String, String] else builder.result() diff --git a/akka-http-core/src/main/scala/akka/http/impl/model/parser/HeaderParser.scala b/akka-http-core/src/main/scala/akka/http/impl/model/parser/HeaderParser.scala index 9c77e9fba9..1d95e2f0b6 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/model/parser/HeaderParser.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/model/parser/HeaderParser.scala @@ -19,7 +19,7 @@ import akka.http.scaladsl.model._ */ private[http] class HeaderParser( val input: ParserInput, - settings: HeaderParser.Settings = HeaderParser.DefaultSettings) + settings: HeaderParser.Settings = HeaderParser.DefaultSettings) extends Parser with DynamicRuleHandler[HeaderParser, HttpHeader :: HNil] with CommonRules with AcceptCharsetHeader @@ -99,7 +99,8 @@ private[http] object HeaderParser { dispatch(parser, headerName) match { case r @ Right(_) if parser.cursor == v.length ⇒ r case r @ Right(_) ⇒ - Left(ErrorInfo("Header parsing error", + Left(ErrorInfo( + "Header parsing error", s"Rule for $headerName accepted trailing garbage. Is the parser missing a trailing EOI?")) case Left(e) ⇒ Left(e.copy(summary = e.summary.filterNot(_ == EOI), detail = e.detail.filterNot(_ == EOI))) } @@ -169,9 +170,10 @@ private[http] object HeaderParser { def cookieParsingMode: ParserSettings.CookieParsingMode def customMediaTypes: MediaTypes.FindCustom } - def Settings(uriParsingMode: Uri.ParsingMode = Uri.ParsingMode.Relaxed, - cookieParsingMode: ParserSettings.CookieParsingMode = ParserSettings.CookieParsingMode.RFC6265, - customMediaTypes: MediaTypes.FindCustom = ConstantFun.scalaAnyTwoToNone): Settings = { + def Settings( + uriParsingMode: Uri.ParsingMode = Uri.ParsingMode.Relaxed, + cookieParsingMode: ParserSettings.CookieParsingMode = ParserSettings.CookieParsingMode.RFC6265, + customMediaTypes: MediaTypes.FindCustom = ConstantFun.scalaAnyTwoToNone): Settings = { val _uriParsingMode = uriParsingMode val _cookieParsingMode = cookieParsingMode val _customMediaTypes = customMediaTypes diff --git a/akka-http-core/src/main/scala/akka/http/impl/settings/ClientConnectionSettingsImpl.scala b/akka-http-core/src/main/scala/akka/http/impl/settings/ClientConnectionSettingsImpl.scala index 1f8e4d40b1..fbe942717e 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/settings/ClientConnectionSettingsImpl.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/settings/ClientConnectionSettingsImpl.scala @@ -18,13 +18,13 @@ import scala.concurrent.duration.{ Duration, FiniteDuration } /** INTERNAL API */ private[akka] final case class ClientConnectionSettingsImpl( - userAgentHeader: Option[`User-Agent`], - connectingTimeout: FiniteDuration, - idleTimeout: Duration, - requestHeaderSizeHint: Int, + userAgentHeader: Option[`User-Agent`], + connectingTimeout: FiniteDuration, + idleTimeout: Duration, + requestHeaderSizeHint: Int, websocketRandomFactory: () ⇒ Random, - socketOptions: immutable.Seq[SocketOption], - parserSettings: ParserSettings) + socketOptions: immutable.Seq[SocketOption], + parserSettings: ParserSettings) extends akka.http.scaladsl.settings.ClientConnectionSettings { require(connectingTimeout >= Duration.Zero, "connectingTimeout must be >= 0") diff --git a/akka-http-core/src/main/scala/akka/http/impl/settings/ConnectionPoolSettingsImpl.scala b/akka-http-core/src/main/scala/akka/http/impl/settings/ConnectionPoolSettingsImpl.scala index dfa0a63f0c..dc4411093f 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/settings/ConnectionPoolSettingsImpl.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/settings/ConnectionPoolSettingsImpl.scala @@ -12,11 +12,11 @@ import scala.concurrent.duration.Duration /** INTERNAL API */ private[akka] final case class ConnectionPoolSettingsImpl( - val maxConnections: Int, - val maxRetries: Int, - val maxOpenRequests: Int, - val pipeliningLimit: Int, - val idleTimeout: Duration, + val maxConnections: Int, + val maxRetries: Int, + val maxOpenRequests: Int, + val pipeliningLimit: Int, + val idleTimeout: Duration, val connectionSettings: ClientConnectionSettings) extends ConnectionPoolSettings { diff --git a/akka-http-core/src/main/scala/akka/http/impl/settings/ConnectionPoolSetup.scala b/akka-http-core/src/main/scala/akka/http/impl/settings/ConnectionPoolSetup.scala index 6eed86dbee..a7ad0c8c19 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/settings/ConnectionPoolSetup.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/settings/ConnectionPoolSetup.scala @@ -10,6 +10,6 @@ import akka.http.scaladsl.settings.ConnectionPoolSettings /** INTERNAL API */ private[akka] final case class ConnectionPoolSetup( - settings: ConnectionPoolSettings, - connectionContext: ConnectionContext = ConnectionContext.noEncryption(), - log: LoggingAdapter) \ No newline at end of file + settings: ConnectionPoolSettings, + connectionContext: ConnectionContext = ConnectionContext.noEncryption(), + log: LoggingAdapter) \ No newline at end of file diff --git a/akka-http-core/src/main/scala/akka/http/impl/settings/ParserSettingsImpl.scala b/akka-http-core/src/main/scala/akka/http/impl/settings/ParserSettingsImpl.scala index 021f774480..4214065af4 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/settings/ParserSettingsImpl.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/settings/ParserSettingsImpl.scala @@ -14,24 +14,24 @@ import akka.http.impl.util._ /** INTERNAL API */ private[akka] final case class ParserSettingsImpl( - maxUriLength: Int, - maxMethodLength: Int, - maxResponseReasonLength: Int, - maxHeaderNameLength: Int, - maxHeaderValueLength: Int, - maxHeaderCount: Int, - maxContentLength: Long, - maxChunkExtLength: Int, - maxChunkSize: Int, - uriParsingMode: Uri.ParsingMode, - cookieParsingMode: CookieParsingMode, - illegalHeaderWarnings: Boolean, - errorLoggingVerbosity: ParserSettings.ErrorLoggingVerbosity, - headerValueCacheLimits: Map[String, Int], + maxUriLength: Int, + maxMethodLength: Int, + maxResponseReasonLength: Int, + maxHeaderNameLength: Int, + maxHeaderValueLength: Int, + maxHeaderCount: Int, + maxContentLength: Long, + maxChunkExtLength: Int, + maxChunkSize: Int, + uriParsingMode: Uri.ParsingMode, + cookieParsingMode: CookieParsingMode, + illegalHeaderWarnings: Boolean, + errorLoggingVerbosity: ParserSettings.ErrorLoggingVerbosity, + headerValueCacheLimits: Map[String, Int], includeTlsSessionInfoHeader: Boolean, - customMethods: String ⇒ Option[HttpMethod], - customStatusCodes: Int ⇒ Option[StatusCode], - customMediaTypes: MediaTypes.FindCustom) + customMethods: String ⇒ Option[HttpMethod], + customStatusCodes: Int ⇒ Option[StatusCode], + customMediaTypes: MediaTypes.FindCustom) extends akka.http.scaladsl.settings.ParserSettings { require(maxUriLength > 0, "max-uri-length must be > 0") @@ -76,7 +76,7 @@ object ParserSettingsImpl extends SettingsCompanion[ParserSettingsImpl]("akka.ht CookieParsingMode(c getString "cookie-parsing-mode"), c getBoolean "illegal-header-warnings", ErrorLoggingVerbosity(c getString "error-logging-verbosity"), - cacheConfig.entrySet.asScala.map(kvp ⇒ kvp.getKey -> cacheConfig.getInt(kvp.getKey))(collection.breakOut), + cacheConfig.entrySet.asScala.map(kvp ⇒ kvp.getKey → cacheConfig.getInt(kvp.getKey))(collection.breakOut), c getBoolean "tls-session-info-header", noCustomMethods, noCustomStatusCodes, diff --git a/akka-http-core/src/main/scala/akka/http/impl/settings/RoutingSettingsImpl.scala b/akka-http-core/src/main/scala/akka/http/impl/settings/RoutingSettingsImpl.scala index de55b0c675..8abd0ea50a 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/settings/RoutingSettingsImpl.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/settings/RoutingSettingsImpl.scala @@ -9,13 +9,13 @@ import com.typesafe.config.Config /** INTERNAL API */ final case class RoutingSettingsImpl( - verboseErrorMessages: Boolean, - fileGetConditional: Boolean, - renderVanityFooter: Boolean, - rangeCountLimit: Int, + verboseErrorMessages: Boolean, + fileGetConditional: Boolean, + renderVanityFooter: Boolean, + rangeCountLimit: Int, rangeCoalescingThreshold: Long, - decodeMaxBytesPerChunk: Int, - fileIODispatcher: String) extends akka.http.scaladsl.settings.RoutingSettings { + decodeMaxBytesPerChunk: Int, + fileIODispatcher: String) extends akka.http.scaladsl.settings.RoutingSettings { override def productPrefix = "RoutingSettings" } diff --git a/akka-http-core/src/main/scala/akka/http/impl/settings/ServerSettingsImpl.scala b/akka-http-core/src/main/scala/akka/http/impl/settings/ServerSettingsImpl.scala index fb74c3f72b..32ee36b9ae 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/settings/ServerSettingsImpl.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/settings/ServerSettingsImpl.scala @@ -25,20 +25,20 @@ import akka.http.scaladsl.model.headers.{ Host, Server } /** INTERNAL API */ private[akka] final case class ServerSettingsImpl( - serverHeader: Option[Server], - timeouts: ServerSettings.Timeouts, - maxConnections: Int, - pipeliningLimit: Int, - remoteAddressHeader: Boolean, - rawRequestUriHeader: Boolean, + serverHeader: Option[Server], + timeouts: ServerSettings.Timeouts, + maxConnections: Int, + pipeliningLimit: Int, + remoteAddressHeader: Boolean, + rawRequestUriHeader: Boolean, transparentHeadRequests: Boolean, - verboseErrorMessages: Boolean, - responseHeaderSizeHint: Int, - backlog: Int, - socketOptions: immutable.Seq[SocketOption], - defaultHostHeader: Host, - websocketRandomFactory: () ⇒ Random, - parserSettings: ParserSettings) extends ServerSettings { + verboseErrorMessages: Boolean, + responseHeaderSizeHint: Int, + backlog: Int, + socketOptions: immutable.Seq[SocketOption], + defaultHostHeader: Host, + websocketRandomFactory: () ⇒ Random, + parserSettings: ParserSettings) extends ServerSettings { require(0 < maxConnections, "max-connections must be > 0") require(0 < pipeliningLimit && pipeliningLimit <= 1024, "pipelining-limit must be > 0 and <= 1024") @@ -53,9 +53,9 @@ object ServerSettingsImpl extends SettingsCompanion[ServerSettingsImpl]("akka.ht /** INTERNAL API */ final case class Timeouts( - idleTimeout: Duration, + idleTimeout: Duration, requestTimeout: Duration, - bindTimeout: FiniteDuration) extends ServerSettings.Timeouts { + bindTimeout: FiniteDuration) extends ServerSettings.Timeouts { require(idleTimeout > Duration.Zero, "idleTimeout must be infinite or > 0") require(requestTimeout > Duration.Zero, "requestTimeout must be infinite or > 0") require(bindTimeout > Duration.Zero, "bindTimeout must be > 0") diff --git a/akka-http-core/src/main/scala/akka/http/impl/util/SettingsCompanion.scala b/akka-http-core/src/main/scala/akka/http/impl/util/SettingsCompanion.scala index e125dce8a1..df8b5f2b01 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/util/SettingsCompanion.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/util/SettingsCompanion.scala @@ -54,6 +54,6 @@ private[http] object SettingsCompanion { val localHostName = try new InetSocketAddress(InetAddress.getLocalHost, 80).getHostString catch { case NonFatal(_) ⇒ "" } - ConfigFactory.parseMap(Map("akka.http.hostname" -> localHostName).asJava) + ConfigFactory.parseMap(Map("akka.http.hostname" → localHostName).asJava) } } \ No newline at end of file diff --git a/akka-http-core/src/main/scala/akka/http/impl/util/StreamUtils.scala b/akka-http-core/src/main/scala/akka/http/impl/util/StreamUtils.scala index aabfaa4d8b..b2cea22a33 100644 --- a/akka-http-core/src/main/scala/akka/http/impl/util/StreamUtils.scala +++ b/akka-http-core/src/main/scala/akka/http/impl/util/StreamUtils.scala @@ -70,7 +70,7 @@ private[http] object StreamUtils { setHandlers(in, out, this) } } - source.via(transformer) -> promise.future + source.via(transformer) → promise.future } def sliceBytesTransformer(start: Long, length: Long): Flow[ByteString, ByteString, NotUsed] = { @@ -163,7 +163,7 @@ private[http] object StreamUtils { /** A copy of PublisherSink that allows access to the publisher through the cell but can only materialized once */ private class OneTimePublisherSink[In](attributes: Attributes, shape: SinkShape[In], cell: OneTimeWriteCell[Publisher[In]]) - extends PublisherSink[In](attributes, shape) { + extends PublisherSink[In](attributes, shape) { override def create(context: MaterializationContext): (AnyRef, Publisher[In]) = { val results = super.create(context) cell.set(results._2) @@ -177,7 +177,7 @@ private[http] object StreamUtils { } /** A copy of SubscriberSource that allows access to the subscriber through the cell but can only materialized once */ private class OneTimeSubscriberSource[Out](val attributes: Attributes, shape: SourceShape[Out], cell: OneTimeWriteCell[Subscriber[Out]]) - extends SourceModule[Out, Subscriber[Out]](shape) { + extends SourceModule[Out, Subscriber[Out]](shape) { override def create(context: MaterializationContext): (Publisher[Out], Subscriber[Out]) = { val processor = new Processor[Out, Out] { diff --git a/akka-http-core/src/main/scala/akka/http/javadsl/ConnectionContext.scala b/akka-http-core/src/main/scala/akka/http/javadsl/ConnectionContext.scala index 73f089ed18..ff76145bf4 100644 --- a/akka-http-core/src/main/scala/akka/http/javadsl/ConnectionContext.scala +++ b/akka-http-core/src/main/scala/akka/http/javadsl/ConnectionContext.scala @@ -22,12 +22,13 @@ object ConnectionContext { scaladsl.ConnectionContext.https(sslContext) /** Used to serve HTTPS traffic. */ - def https(sslContext: SSLContext, - sslConfig: Optional[AkkaSSLConfig], - enabledCipherSuites: Optional[JCollection[String]], - enabledProtocols: Optional[JCollection[String]], - clientAuth: Optional[TLSClientAuth], - sslParameters: Optional[SSLParameters]) = + def https( + sslContext: SSLContext, + sslConfig: Optional[AkkaSSLConfig], + enabledCipherSuites: Optional[JCollection[String]], + enabledProtocols: Optional[JCollection[String]], + clientAuth: Optional[TLSClientAuth], + sslParameters: Optional[SSLParameters]) = scaladsl.ConnectionContext.https( sslContext, OptionConverters.toScala(sslConfig), @@ -39,11 +40,12 @@ object ConnectionContext { /** Used to serve HTTPS traffic. */ // for binary-compatibility, since 2.4.7 - def https(sslContext: SSLContext, - enabledCipherSuites: Optional[JCollection[String]], - enabledProtocols: Optional[JCollection[String]], - clientAuth: Optional[TLSClientAuth], - sslParameters: Optional[SSLParameters]) = + def https( + sslContext: SSLContext, + enabledCipherSuites: Optional[JCollection[String]], + enabledProtocols: Optional[JCollection[String]], + clientAuth: Optional[TLSClientAuth], + sslParameters: Optional[SSLParameters]) = scaladsl.ConnectionContext.https( sslContext, OptionConverters.toScala(enabledCipherSuites).map(Util.immutableSeq(_)), diff --git a/akka-http-core/src/main/scala/akka/http/javadsl/Http.scala b/akka-http-core/src/main/scala/akka/http/javadsl/Http.scala index 5575137ad4..6bb2e1511c 100644 --- a/akka-http-core/src/main/scala/akka/http/javadsl/Http.scala +++ b/akka-http-core/src/main/scala/akka/http/javadsl/Http.scala @@ -55,8 +55,9 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * Constructs a server layer stage using the given [[akka.http.javadsl.settings.ServerSettings]]. The returned [[BidiFlow]] isn't reusable and * can only be materialized once. */ - def serverLayer(settings: ServerSettings, - materializer: Materializer): BidiFlow[HttpResponse, SslTlsOutbound, SslTlsInbound, HttpRequest, NotUsed] = + def serverLayer( + settings: ServerSettings, + materializer: Materializer): BidiFlow[HttpResponse, SslTlsOutbound, SslTlsInbound, HttpRequest, NotUsed] = adaptServerLayer(delegate.serverLayer(settings.asScala)(materializer)) /** @@ -64,9 +65,10 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * can only be materialized once. The `remoteAddress`, if provided, will be added as a header to each [[HttpRequest]] * this layer produces if the `akka.http.server.remote-address-header` configuration option is enabled. */ - def serverLayer(settings: ServerSettings, - remoteAddress: Optional[InetSocketAddress], - materializer: Materializer): BidiFlow[HttpResponse, SslTlsOutbound, SslTlsInbound, HttpRequest, NotUsed] = + def serverLayer( + settings: ServerSettings, + remoteAddress: Optional[InetSocketAddress], + materializer: Materializer): BidiFlow[HttpResponse, SslTlsOutbound, SslTlsInbound, HttpRequest, NotUsed] = adaptServerLayer(delegate.serverLayer(settings.asScala, remoteAddress.asScala)(materializer)) /** @@ -74,10 +76,11 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * can only be materialized once. The remoteAddress, if provided, will be added as a header to each [[HttpRequest]] * this layer produces if the `akka.http.server.remote-address-header` configuration option is enabled. */ - def serverLayer(settings: ServerSettings, - remoteAddress: Optional[InetSocketAddress], - log: LoggingAdapter, - materializer: Materializer): BidiFlow[HttpResponse, SslTlsOutbound, SslTlsInbound, HttpRequest, NotUsed] = + def serverLayer( + settings: ServerSettings, + remoteAddress: Optional[InetSocketAddress], + log: LoggingAdapter, + materializer: Materializer): BidiFlow[HttpResponse, SslTlsOutbound, SslTlsInbound, HttpRequest, NotUsed] = adaptServerLayer(delegate.serverLayer(settings.asScala, remoteAddress.asScala, log)(materializer)) /** @@ -117,9 +120,10 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * The server will be bound using HTTPS if the [[ConnectHttp]] object is configured with an [[HttpsConnectionContext]], * or the [[defaultServerHttpContext]] has been configured to be an [[HttpsConnectionContext]]. */ - def bind(connect: ConnectHttp, - settings: ServerSettings, - materializer: Materializer): Source[IncomingConnection, CompletionStage[ServerBinding]] = { + def bind( + connect: ConnectHttp, + settings: ServerSettings, + materializer: Materializer): Source[IncomingConnection, CompletionStage[ServerBinding]] = { val connectionContext = connect.effectiveConnectionContext(defaultServerHttpContext).asScala new Source(delegate.bind(connect.host, connect.port, settings = settings.asScala, connectionContext = connectionContext)(materializer) .map(new IncomingConnection(_)) @@ -141,10 +145,11 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * The server will be bound using HTTPS if the [[ConnectHttp]] object is configured with an [[HttpsConnectionContext]], * or the [[defaultServerHttpContext]] has been configured to be an [[HttpsConnectionContext]]. */ - def bind(connect: ConnectHttp, - settings: ServerSettings, - log: LoggingAdapter, - materializer: Materializer): Source[IncomingConnection, CompletionStage[ServerBinding]] = { + def bind( + connect: ConnectHttp, + settings: ServerSettings, + log: LoggingAdapter, + materializer: Materializer): Source[IncomingConnection, CompletionStage[ServerBinding]] = { val connectionContext = connect.effectiveConnectionContext(defaultServerHttpContext).asScala new Source(delegate.bind(connect.host, connect.port, connectionContext, settings.asScala, log)(materializer) .map(new IncomingConnection(_)) @@ -161,11 +166,13 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * The server will be bound using HTTPS if the [[ConnectHttp]] object is configured with an [[HttpsConnectionContext]], * or the [[defaultServerHttpContext]] has been configured to be an [[HttpsConnectionContext]]. */ - def bindAndHandle(handler: Flow[HttpRequest, HttpResponse, _], - connect: ConnectHttp, - materializer: Materializer): CompletionStage[ServerBinding] = { + def bindAndHandle( + handler: Flow[HttpRequest, HttpResponse, _], + connect: ConnectHttp, + materializer: Materializer): CompletionStage[ServerBinding] = { val connectionContext = connect.effectiveConnectionContext(defaultServerHttpContext).asScala - delegate.bindAndHandle(handler.asInstanceOf[Flow[sm.HttpRequest, sm.HttpResponse, _]].asScala, + delegate.bindAndHandle( + handler.asInstanceOf[Flow[sm.HttpRequest, sm.HttpResponse, _]].asScala, connect.host, connect.port, connectionContext)(materializer) .map(new ServerBinding(_))(ec).toJava } @@ -180,13 +187,15 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * The server will be bound using HTTPS if the [[ConnectHttp]] object is configured with an [[HttpsConnectionContext]], * or the [[defaultServerHttpContext]] has been configured to be an [[HttpsConnectionContext]]. */ - def bindAndHandle(handler: Flow[HttpRequest, HttpResponse, _], - connect: ConnectHttp, - settings: ServerSettings, - log: LoggingAdapter, - materializer: Materializer): CompletionStage[ServerBinding] = { + def bindAndHandle( + handler: Flow[HttpRequest, HttpResponse, _], + connect: ConnectHttp, + settings: ServerSettings, + log: LoggingAdapter, + materializer: Materializer): CompletionStage[ServerBinding] = { val connectionContext = connect.effectiveConnectionContext(defaultServerHttpContext).asScala - delegate.bindAndHandle(handler.asInstanceOf[Flow[sm.HttpRequest, sm.HttpResponse, _]].asScala, + delegate.bindAndHandle( + handler.asInstanceOf[Flow[sm.HttpRequest, sm.HttpResponse, _]].asScala, connect.host, connect.port, connectionContext, settings.asScala, log)(materializer) .map(new ServerBinding(_))(ec).toJava } @@ -201,9 +210,10 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * The server will be bound using HTTPS if the [[ConnectHttp]] object is configured with an [[HttpsConnectionContext]], * or the [[defaultServerHttpContext]] has been configured to be an [[HttpsConnectionContext]]. */ - def bindAndHandleSync(handler: Function[HttpRequest, HttpResponse], - connect: ConnectHttp, - materializer: Materializer): CompletionStage[ServerBinding] = { + def bindAndHandleSync( + handler: Function[HttpRequest, HttpResponse], + connect: ConnectHttp, + materializer: Materializer): CompletionStage[ServerBinding] = { val connectionContext = connect.effectiveConnectionContext(defaultServerHttpContext).asScala delegate.bindAndHandleSync(handler.apply(_).asScala, connect.host, connect.port, connectionContext)(materializer) .map(new ServerBinding(_))(ec).toJava @@ -219,13 +229,15 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * The server will be bound using HTTPS if the [[ConnectHttp]] object is configured with an [[HttpsConnectionContext]], * or the [[defaultServerHttpContext]] has been configured to be an [[HttpsConnectionContext]]. */ - def bindAndHandleSync(handler: Function[HttpRequest, HttpResponse], - connect: ConnectHttp, - settings: ServerSettings, - log: LoggingAdapter, - materializer: Materializer): CompletionStage[ServerBinding] = { + def bindAndHandleSync( + handler: Function[HttpRequest, HttpResponse], + connect: ConnectHttp, + settings: ServerSettings, + log: LoggingAdapter, + materializer: Materializer): CompletionStage[ServerBinding] = { val connectionContext = connect.effectiveConnectionContext(defaultServerHttpContext).asScala - delegate.bindAndHandleSync(handler.apply(_).asScala, + delegate.bindAndHandleSync( + handler.apply(_).asScala, connect.host, connect.port, connectionContext, settings.asScala, log)(materializer) .map(new ServerBinding(_))(ec).toJava } @@ -240,9 +252,10 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * The server will be bound using HTTPS if the [[ConnectHttp]] object is configured with an [[HttpsConnectionContext]], * or the [[defaultServerHttpContext]] has been configured to be an [[HttpsConnectionContext]]. */ - def bindAndHandleAsync(handler: Function[HttpRequest, CompletionStage[HttpResponse]], - connect: ConnectHttp, - materializer: Materializer): CompletionStage[ServerBinding] = { + def bindAndHandleAsync( + handler: Function[HttpRequest, CompletionStage[HttpResponse]], + connect: ConnectHttp, + materializer: Materializer): CompletionStage[ServerBinding] = { val connectionContext = connect.effectiveConnectionContext(defaultServerHttpContext).asScala delegate.bindAndHandleAsync(handler.apply(_).toScala, connect.host, connect.port, connectionContext)(materializer) .map(new ServerBinding(_))(ec).toJava @@ -258,13 +271,15 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * The server will be bound using HTTPS if the [[ConnectHttp]] object is configured with an [[HttpsConnectionContext]], * or the [[defaultServerHttpContext]] has been configured to be an [[HttpsConnectionContext]]. */ - def bindAndHandleAsync(handler: Function[HttpRequest, CompletionStage[HttpResponse]], - connect: ConnectHttp, - settings: ServerSettings, - parallelism: Int, log: LoggingAdapter, - materializer: Materializer): CompletionStage[ServerBinding] = { + def bindAndHandleAsync( + handler: Function[HttpRequest, CompletionStage[HttpResponse]], + connect: ConnectHttp, + settings: ServerSettings, + parallelism: Int, log: LoggingAdapter, + materializer: Materializer): CompletionStage[ServerBinding] = { val connectionContext = connect.effectiveConnectionContext(defaultServerHttpContext).asScala - delegate.bindAndHandleAsync(handler.apply(_).toScala, + delegate.bindAndHandleAsync( + handler.apply(_).toScala, connect.host, connect.port, connectionContext, settings.asScala, parallelism, log)(materializer) .map(new ServerBinding(_))(ec).toJava } @@ -278,16 +293,18 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { /** * Constructs a client layer stage using the given [[akka.http.javadsl.settings.ClientConnectionSettings]]. */ - def clientLayer(hostHeader: headers.Host, - settings: ClientConnectionSettings): BidiFlow[HttpRequest, SslTlsOutbound, SslTlsInbound, HttpResponse, NotUsed] = + def clientLayer( + hostHeader: headers.Host, + settings: ClientConnectionSettings): BidiFlow[HttpRequest, SslTlsOutbound, SslTlsInbound, HttpResponse, NotUsed] = adaptClientLayer(delegate.clientLayer(JavaMapping.toScala(hostHeader), settings.asScala)) /** * Constructs a client layer stage using the given [[ClientConnectionSettings]]. */ - def clientLayer(hostHeader: headers.Host, - settings: ClientConnectionSettings, - log: LoggingAdapter): BidiFlow[HttpRequest, SslTlsOutbound, SslTlsInbound, HttpResponse, NotUsed] = + def clientLayer( + hostHeader: headers.Host, + settings: ClientConnectionSettings, + log: LoggingAdapter): BidiFlow[HttpRequest, SslTlsOutbound, SslTlsInbound, HttpResponse, NotUsed] = adaptClientLayer(delegate.clientLayer(JavaMapping.toScala(hostHeader), settings.asScala, log)) /** @@ -315,10 +332,11 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * Creates a [[Flow]] representing a prospective HTTP client connection to the given endpoint. * Every materialization of the produced flow will attempt to establish a new outgoing connection. */ - def outgoingConnection(to: ConnectHttp, - localAddress: Optional[InetSocketAddress], - settings: ClientConnectionSettings, - log: LoggingAdapter): Flow[HttpRequest, HttpResponse, CompletionStage[OutgoingConnection]] = + def outgoingConnection( + to: ConnectHttp, + localAddress: Optional[InetSocketAddress], + settings: ClientConnectionSettings, + log: LoggingAdapter): Flow[HttpRequest, HttpResponse, CompletionStage[OutgoingConnection]] = adaptOutgoingFlow { if (to.isHttps) delegate.outgoingConnectionHttps(to.host, to.port, to.effectiveConnectionContext(defaultClientHttpsContext).asInstanceOf[HttpsConnectionContext].asScala, localAddress.asScala, settings.asScala, log) @@ -365,9 +383,10 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * * The given [[ConnectionContext]] will be used for encryption on the connection. */ - def newHostConnectionPool[T](to: ConnectHttp, - settings: ConnectionPoolSettings, - log: LoggingAdapter, materializer: Materializer): Flow[Pair[HttpRequest, T], Pair[Try[HttpResponse], T], HostConnectionPool] = + def newHostConnectionPool[T]( + to: ConnectHttp, + settings: ConnectionPoolSettings, + log: LoggingAdapter, materializer: Materializer): Flow[Pair[HttpRequest, T], Pair[Try[HttpResponse], T], HostConnectionPool] = adaptTupleFlow { to.effectiveHttpsConnectionContext(defaultClientHttpsContext) match { case https: HttpsConnectionContext ⇒ @@ -424,9 +443,10 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * * The given [[ConnectionContext]] will be used for encryption on the connection. */ - def cachedHostConnectionPool[T](to: ConnectHttp, - settings: ConnectionPoolSettings, - log: LoggingAdapter, materializer: Materializer): Flow[Pair[HttpRequest, T], Pair[Try[HttpResponse], T], HostConnectionPool] = + def cachedHostConnectionPool[T]( + to: ConnectHttp, + settings: ConnectionPoolSettings, + log: LoggingAdapter, materializer: Materializer): Flow[Pair[HttpRequest, T], Pair[Try[HttpResponse], T], HostConnectionPool] = adaptTupleFlow(delegate.cachedHostConnectionPoolHttps[T](to.host, to.port, to.effectiveHttpsConnectionContext(defaultClientHttpsContext).asScala, settings.asScala, log)(materializer) .mapMaterializedValue(_.toJava)) @@ -460,9 +480,10 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * In order to allow for easy response-to-request association the flow takes in a custom, opaque context * object of type `T` from the application which is emitted together with the corresponding response. */ - def superPool[T](settings: ConnectionPoolSettings, - connectionContext: HttpsConnectionContext, - log: LoggingAdapter, materializer: Materializer): Flow[Pair[HttpRequest, T], Pair[Try[HttpResponse], T], NotUsed] = + def superPool[T]( + settings: ConnectionPoolSettings, + connectionContext: HttpsConnectionContext, + log: LoggingAdapter, materializer: Materializer): Flow[Pair[HttpRequest, T], Pair[Try[HttpResponse], T], NotUsed] = adaptTupleFlow(delegate.superPool[T](connectionContext.asScala, settings.asScala, log)(materializer)) /** @@ -480,8 +501,9 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * In order to allow for easy response-to-request association the flow takes in a custom, opaque context * object of type `T` from the application which is emitted together with the corresponding response. */ - def superPool[T](settings: ConnectionPoolSettings, - log: LoggingAdapter, materializer: Materializer): Flow[Pair[HttpRequest, T], Pair[Try[HttpResponse], T], NotUsed] = + def superPool[T]( + settings: ConnectionPoolSettings, + log: LoggingAdapter, materializer: Materializer): Flow[Pair[HttpRequest, T], Pair[Try[HttpResponse], T], NotUsed] = adaptTupleFlow(delegate.superPool[T](defaultClientHttpsContext.asScala, settings.asScala, log)(materializer)) /** @@ -517,10 +539,11 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * Note that the request must have either an absolute URI or a valid `Host` header, otherwise * the future will be completed with an error. */ - def singleRequest(request: HttpRequest, - connectionContext: HttpsConnectionContext, - settings: ConnectionPoolSettings, - log: LoggingAdapter, materializer: Materializer): CompletionStage[HttpResponse] = + def singleRequest( + request: HttpRequest, + connectionContext: HttpsConnectionContext, + settings: ConnectionPoolSettings, + log: LoggingAdapter, materializer: Materializer): CompletionStage[HttpResponse] = delegate.singleRequest(request.asScala, connectionContext.asScala, settings.asScala, log)(materializer).toJava /** @@ -537,8 +560,9 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * * The layer is not reusable and must only be materialized once. */ - def webSocketClientLayer(request: WebSocketRequest, - settings: ClientConnectionSettings): BidiFlow[Message, SslTlsOutbound, SslTlsInbound, Message, CompletionStage[WebSocketUpgradeResponse]] = + def webSocketClientLayer( + request: WebSocketRequest, + settings: ClientConnectionSettings): BidiFlow[Message, SslTlsOutbound, SslTlsInbound, Message, CompletionStage[WebSocketUpgradeResponse]] = adaptWsBidiFlow(delegate.webSocketClientLayer(request.asScala, settings.asScala)) /** @@ -547,9 +571,10 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * * The layer is not reusable and must only be materialized once. */ - def webSocketClientLayer(request: WebSocketRequest, - settings: ClientConnectionSettings, - log: LoggingAdapter): BidiFlow[Message, SslTlsOutbound, SslTlsInbound, Message, CompletionStage[WebSocketUpgradeResponse]] = + def webSocketClientLayer( + request: WebSocketRequest, + settings: ClientConnectionSettings, + log: LoggingAdapter): BidiFlow[Message, SslTlsOutbound, SslTlsInbound, Message, CompletionStage[WebSocketUpgradeResponse]] = adaptWsBidiFlow(delegate.webSocketClientLayer(request.asScala, settings.asScala, log)) /** @@ -567,11 +592,12 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * * The layer is not reusable and must only be materialized once. */ - def webSocketClientFlow(request: WebSocketRequest, - connectionContext: ConnectionContext, - localAddress: Optional[InetSocketAddress], - settings: ClientConnectionSettings, - log: LoggingAdapter): Flow[Message, Message, CompletionStage[WebSocketUpgradeResponse]] = + def webSocketClientFlow( + request: WebSocketRequest, + connectionContext: ConnectionContext, + localAddress: Optional[InetSocketAddress], + settings: ClientConnectionSettings, + log: LoggingAdapter): Flow[Message, Message, CompletionStage[WebSocketUpgradeResponse]] = adaptWsFlow { delegate.webSocketClientFlow(request.asScala, connectionContext.asScala, localAddress.asScala, settings.asScala, log) } @@ -582,9 +608,10 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * * The [[defaultClientHttpsContext]] is used to configure TLS for the connection. */ - def singleWebSocketRequest[T](request: WebSocketRequest, - clientFlow: Flow[Message, Message, T], - materializer: Materializer): Pair[CompletionStage[WebSocketUpgradeResponse], T] = + def singleWebSocketRequest[T]( + request: WebSocketRequest, + clientFlow: Flow[Message, Message, T], + materializer: Materializer): Pair[CompletionStage[WebSocketUpgradeResponse], T] = adaptWsResultTuple { delegate.singleWebSocketRequest( request.asScala, @@ -597,10 +624,11 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * * The [[defaultClientHttpsContext]] is used to configure TLS for the connection. */ - def singleWebSocketRequest[T](request: WebSocketRequest, - clientFlow: Flow[Message, Message, T], - connectionContext: ConnectionContext, - materializer: Materializer): Pair[CompletionStage[WebSocketUpgradeResponse], T] = + def singleWebSocketRequest[T]( + request: WebSocketRequest, + clientFlow: Flow[Message, Message, T], + connectionContext: ConnectionContext, + materializer: Materializer): Pair[CompletionStage[WebSocketUpgradeResponse], T] = adaptWsResultTuple { delegate.singleWebSocketRequest( request.asScala, @@ -612,13 +640,14 @@ class Http(system: ExtendedActorSystem) extends akka.actor.Extension { * Runs a single WebSocket conversation given a Uri and a flow that represents the client side of the * WebSocket conversation. */ - def singleWebSocketRequest[T](request: WebSocketRequest, - clientFlow: Flow[Message, Message, T], - connectionContext: ConnectionContext, - localAddress: Optional[InetSocketAddress], - settings: ClientConnectionSettings, - log: LoggingAdapter, - materializer: Materializer): Pair[CompletionStage[WebSocketUpgradeResponse], T] = + def singleWebSocketRequest[T]( + request: WebSocketRequest, + clientFlow: Flow[Message, Message, T], + connectionContext: ConnectionContext, + localAddress: Optional[InetSocketAddress], + settings: ClientConnectionSettings, + log: LoggingAdapter, + materializer: Materializer): Pair[CompletionStage[WebSocketUpgradeResponse], T] = adaptWsResultTuple { delegate.singleWebSocketRequest( request.asScala, diff --git a/akka-http-core/src/main/scala/akka/http/javadsl/settings/ParserSettings.scala b/akka-http-core/src/main/scala/akka/http/javadsl/settings/ParserSettings.scala index dd43a48845..8eec14babf 100644 --- a/akka-http-core/src/main/scala/akka/http/javadsl/settings/ParserSettings.scala +++ b/akka-http-core/src/main/scala/akka/http/javadsl/settings/ParserSettings.scala @@ -61,18 +61,18 @@ abstract class ParserSettings private[akka] () extends BodyPartParser.Settings { @varargs def withCustomMethods(methods: HttpMethod*): ParserSettings = { - val map = methods.map(m ⇒ m.name -> m.asScala).toMap + val map = methods.map(m ⇒ m.name → m.asScala).toMap self.copy(customMethods = map.get) } @varargs def withCustomStatusCodes(codes: StatusCode*): ParserSettings = { - val map = codes.map(c ⇒ c.intValue -> c.asScala).toMap + val map = codes.map(c ⇒ c.intValue → c.asScala).toMap self.copy(customStatusCodes = map.get) } @varargs def withCustomMediaTypes(mediaTypes: MediaType*): ParserSettings = { - val map = mediaTypes.map(c ⇒ (c.mainType, c.subType) -> c.asScala).toMap - self.copy(customMediaTypes = (main, sub) ⇒ map.get(main -> sub)) + val map = mediaTypes.map(c ⇒ (c.mainType, c.subType) → c.asScala).toMap + self.copy(customMediaTypes = (main, sub) ⇒ map.get(main → sub)) } } diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/ConnectionContext.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/ConnectionContext.scala index 1ae03b5083..b29c0a3ac8 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/ConnectionContext.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/ConnectionContext.scala @@ -22,42 +22,44 @@ trait ConnectionContext extends akka.http.javadsl.ConnectionContext { object ConnectionContext { //#https-context-creation // ConnectionContext - def https(sslContext: SSLContext, - sslConfig: Option[AkkaSSLConfig] = None, - enabledCipherSuites: Option[immutable.Seq[String]] = None, - enabledProtocols: Option[immutable.Seq[String]] = None, - clientAuth: Option[TLSClientAuth] = None, - sslParameters: Option[SSLParameters] = None) = + def https( + sslContext: SSLContext, + sslConfig: Option[AkkaSSLConfig] = None, + enabledCipherSuites: Option[immutable.Seq[String]] = None, + enabledProtocols: Option[immutable.Seq[String]] = None, + clientAuth: Option[TLSClientAuth] = None, + sslParameters: Option[SSLParameters] = None) = new HttpsConnectionContext(sslContext, sslConfig, enabledCipherSuites, enabledProtocols, clientAuth, sslParameters) //#https-context-creation // for binary-compatibility, since 2.4.7 - def https(sslContext: SSLContext, - enabledCipherSuites: Option[immutable.Seq[String]], - enabledProtocols: Option[immutable.Seq[String]], - clientAuth: Option[TLSClientAuth], - sslParameters: Option[SSLParameters]) = + def https( + sslContext: SSLContext, + enabledCipherSuites: Option[immutable.Seq[String]], + enabledProtocols: Option[immutable.Seq[String]], + clientAuth: Option[TLSClientAuth], + sslParameters: Option[SSLParameters]) = new HttpsConnectionContext(sslContext, None, enabledCipherSuites, enabledProtocols, clientAuth, sslParameters) def noEncryption() = HttpConnectionContext } final class HttpsConnectionContext( - val sslContext: SSLContext, - val sslConfig: Option[AkkaSSLConfig] = None, + val sslContext: SSLContext, + val sslConfig: Option[AkkaSSLConfig] = None, val enabledCipherSuites: Option[immutable.Seq[String]] = None, - val enabledProtocols: Option[immutable.Seq[String]] = None, - val clientAuth: Option[TLSClientAuth] = None, - val sslParameters: Option[SSLParameters] = None) + val enabledProtocols: Option[immutable.Seq[String]] = None, + val clientAuth: Option[TLSClientAuth] = None, + val sslParameters: Option[SSLParameters] = None) extends akka.http.javadsl.HttpsConnectionContext with ConnectionContext { // for binary-compatibility, since 2.4.7 def this( - sslContext: SSLContext, + sslContext: SSLContext, enabledCipherSuites: Option[immutable.Seq[String]], - enabledProtocols: Option[immutable.Seq[String]], - clientAuth: Option[TLSClientAuth], - sslParameters: Option[SSLParameters]) = + enabledProtocols: Option[immutable.Seq[String]], + clientAuth: Option[TLSClientAuth], + sslParameters: Option[SSLParameters]) = this(sslContext, None, enabledCipherSuites, enabledProtocols, clientAuth, sslParameters) def firstSession = NegotiateNewSession(enabledCipherSuites, enabledProtocols, clientAuth, sslParameters) diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/Http.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/Http.scala index 76ac3f949f..4be23b9f8a 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/Http.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/Http.scala @@ -78,8 +78,8 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte */ def bind(interface: String, port: Int = DefaultPortForProtocol, connectionContext: ConnectionContext = defaultServerHttpContext, - settings: ServerSettings = ServerSettings(system), - log: LoggingAdapter = system.log)(implicit fm: Materializer): Source[IncomingConnection, Future[ServerBinding]] = { + settings: ServerSettings = ServerSettings(system), + log: LoggingAdapter = system.log)(implicit fm: Materializer): Source[IncomingConnection, Future[ServerBinding]] = { val effectivePort = if (port >= 0) port else connectionContext.defaultPort val tlsStage = sslTlsStage(connectionContext, Server) val connections: Source[Tcp.IncomingConnection, Future[Tcp.ServerBinding]] = @@ -104,11 +104,12 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte * To configure additional settings for a server started using this method, * use the `akka.http.server` config section or pass in a [[akka.http.scaladsl.settings.ServerSettings]] explicitly. */ - def bindAndHandle(handler: Flow[HttpRequest, HttpResponse, Any], - interface: String, port: Int = DefaultPortForProtocol, - connectionContext: ConnectionContext = defaultServerHttpContext, - settings: ServerSettings = ServerSettings(system), - log: LoggingAdapter = system.log)(implicit fm: Materializer): Future[ServerBinding] = { + def bindAndHandle( + handler: Flow[HttpRequest, HttpResponse, Any], + interface: String, port: Int = DefaultPortForProtocol, + connectionContext: ConnectionContext = defaultServerHttpContext, + settings: ServerSettings = ServerSettings(system), + log: LoggingAdapter = system.log)(implicit fm: Materializer): Future[ServerBinding] = { def handleOneConnection(incomingConnection: IncomingConnection): Future[Done] = try incomingConnection.flow @@ -145,11 +146,12 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte * To configure additional settings for a server started using this method, * use the `akka.http.server` config section or pass in a [[akka.http.scaladsl.settings.ServerSettings]] explicitly. */ - def bindAndHandleSync(handler: HttpRequest ⇒ HttpResponse, - interface: String, port: Int = DefaultPortForProtocol, - connectionContext: ConnectionContext = defaultServerHttpContext, - settings: ServerSettings = ServerSettings(system), - log: LoggingAdapter = system.log)(implicit fm: Materializer): Future[ServerBinding] = + def bindAndHandleSync( + handler: HttpRequest ⇒ HttpResponse, + interface: String, port: Int = DefaultPortForProtocol, + connectionContext: ConnectionContext = defaultServerHttpContext, + settings: ServerSettings = ServerSettings(system), + log: LoggingAdapter = system.log)(implicit fm: Materializer): Future[ServerBinding] = bindAndHandle(Flow[HttpRequest].map(handler), interface, port, connectionContext, settings, log) /** @@ -162,12 +164,13 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte * To configure additional settings for a server started using this method, * use the `akka.http.server` config section or pass in a [[akka.http.scaladsl.settings.ServerSettings]] explicitly. */ - def bindAndHandleAsync(handler: HttpRequest ⇒ Future[HttpResponse], - interface: String, port: Int = DefaultPortForProtocol, - connectionContext: ConnectionContext = defaultServerHttpContext, - settings: ServerSettings = ServerSettings(system), - parallelism: Int = 1, - log: LoggingAdapter = system.log)(implicit fm: Materializer): Future[ServerBinding] = + def bindAndHandleAsync( + handler: HttpRequest ⇒ Future[HttpResponse], + interface: String, port: Int = DefaultPortForProtocol, + connectionContext: ConnectionContext = defaultServerHttpContext, + settings: ServerSettings = ServerSettings(system), + parallelism: Int = 1, + log: LoggingAdapter = system.log)(implicit fm: Materializer): Future[ServerBinding] = bindAndHandle(Flow[HttpRequest].mapAsync(parallelism)(handler), interface, port, connectionContext, settings, log) type ServerLayer = Http.ServerLayer @@ -185,9 +188,10 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte * can only be materialized once. The `remoteAddress`, if provided, will be added as a header to each [[akka.http.scaladsl.model.HttpRequest]] * this layer produces if the `akka.http.server.remote-address-header` configuration option is enabled. */ - def serverLayer(settings: ServerSettings, - remoteAddress: Option[InetSocketAddress] = None, - log: LoggingAdapter = system.log)(implicit mat: Materializer): ServerLayer = + def serverLayer( + settings: ServerSettings, + remoteAddress: Option[InetSocketAddress] = None, + log: LoggingAdapter = system.log)(implicit mat: Materializer): ServerLayer = HttpServerBluePrint(settings, remoteAddress, log) // ** CLIENT ** // @@ -204,8 +208,8 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte */ def outgoingConnection(host: String, port: Int = 80, localAddress: Option[InetSocketAddress] = None, - settings: ClientConnectionSettings = ClientConnectionSettings(system), - log: LoggingAdapter = system.log): Flow[HttpRequest, HttpResponse, Future[OutgoingConnection]] = + settings: ClientConnectionSettings = ClientConnectionSettings(system), + log: LoggingAdapter = system.log): Flow[HttpRequest, HttpResponse, Future[OutgoingConnection]] = _outgoingConnection(host, port, localAddress, settings, ConnectionContext.noEncryption(), log) /** @@ -218,18 +222,19 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte * use the `akka.http.client` config section or pass in a [[akka.http.scaladsl.settings.ClientConnectionSettings]] explicitly. */ def outgoingConnectionHttps(host: String, port: Int = 443, - connectionContext: HttpsConnectionContext = defaultClientHttpsContext, - localAddress: Option[InetSocketAddress] = None, - settings: ClientConnectionSettings = ClientConnectionSettings(system), - log: LoggingAdapter = system.log): Flow[HttpRequest, HttpResponse, Future[OutgoingConnection]] = + connectionContext: HttpsConnectionContext = defaultClientHttpsContext, + localAddress: Option[InetSocketAddress] = None, + settings: ClientConnectionSettings = ClientConnectionSettings(system), + log: LoggingAdapter = system.log): Flow[HttpRequest, HttpResponse, Future[OutgoingConnection]] = _outgoingConnection(host, port, localAddress, settings, connectionContext, log) - private def _outgoingConnection(host: String, - port: Int, - localAddress: Option[InetSocketAddress], - settings: ClientConnectionSettings, - connectionContext: ConnectionContext, - log: LoggingAdapter): Flow[HttpRequest, HttpResponse, Future[OutgoingConnection]] = { + private def _outgoingConnection( + host: String, + port: Int, + localAddress: Option[InetSocketAddress], + settings: ClientConnectionSettings, + connectionContext: ConnectionContext, + log: LoggingAdapter): Flow[HttpRequest, HttpResponse, Future[OutgoingConnection]] = { val hostHeader = if (port == connectionContext.defaultPort) Host(host) else Host(host, port) val layer = clientLayer(hostHeader, settings, log) layer.joinMat(_outgoingTlsConnectionLayer(host, port, localAddress, settings, connectionContext, log))(Keep.right) @@ -238,7 +243,7 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte private def _outgoingTlsConnectionLayer(host: String, port: Int, localAddress: Option[InetSocketAddress], settings: ClientConnectionSettings, connectionContext: ConnectionContext, log: LoggingAdapter): Flow[SslTlsOutbound, SslTlsInbound, Future[OutgoingConnection]] = { - val tlsStage = sslTlsStage(connectionContext, Client, Some(host -> port)) + val tlsStage = sslTlsStage(connectionContext, Client, Some(host → port)) val transportFlow = Tcp().outgoingConnection(new InetSocketAddress(host, port), localAddress, settings.socketOptions, halfClose = true, settings.connectingTimeout, settings.idleTimeout) @@ -260,9 +265,10 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte /** * Constructs a [[akka.http.scaladsl.Http.ClientLayer]] stage using the given [[akka.http.scaladsl.settings.ClientConnectionSettings]]. */ - def clientLayer(hostHeader: Host, - settings: ClientConnectionSettings, - log: LoggingAdapter = system.log): ClientLayer = + def clientLayer( + hostHeader: Host, + settings: ClientConnectionSettings, + log: LoggingAdapter = system.log): ClientLayer = OutgoingConnectionBlueprint(hostHeader, settings, log) // ** CONNECTION POOL ** // @@ -286,7 +292,7 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte */ def newHostConnectionPool[T](host: String, port: Int = 80, settings: ConnectionPoolSettings = defaultConnectionPoolSettings, - log: LoggingAdapter = system.log)(implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = { + log: LoggingAdapter = system.log)(implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = { val cps = ConnectionPoolSetup(settings, ConnectionContext.noEncryption(), log) newHostConnectionPool(HostConnectionPoolSetup(host, port, cps)) } @@ -302,8 +308,8 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte */ def newHostConnectionPoolHttps[T](host: String, port: Int = 443, connectionContext: HttpsConnectionContext = defaultClientHttpsContext, - settings: ConnectionPoolSettings = defaultConnectionPoolSettings, - log: LoggingAdapter = system.log)(implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = { + settings: ConnectionPoolSettings = defaultConnectionPoolSettings, + log: LoggingAdapter = system.log)(implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = { val cps = ConnectionPoolSetup(settings, connectionContext, log) newHostConnectionPool(HostConnectionPoolSetup(host, port, cps)) } @@ -325,7 +331,8 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte * object of type `T` from the application which is emitted together with the corresponding response. */ private[akka] def newHostConnectionPool[T](setup: HostConnectionPoolSetup)( - implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = { + implicit + fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = { val gateway = new PoolGateway(poolMasterActorRef, setup, PoolGateway.newUniqueGatewayIdentifier) gatewayClientFlow(setup, gateway.startPool()) } @@ -352,7 +359,7 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte */ def cachedHostConnectionPool[T](host: String, port: Int = 80, settings: ConnectionPoolSettings = defaultConnectionPoolSettings, - log: LoggingAdapter = system.log)(implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = { + log: LoggingAdapter = system.log)(implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = { val cps = ConnectionPoolSetup(settings, ConnectionContext.noEncryption(), log) val setup = HostConnectionPoolSetup(host, port, cps) cachedHostConnectionPool(setup) @@ -369,8 +376,8 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte */ def cachedHostConnectionPoolHttps[T](host: String, port: Int = 443, connectionContext: HttpsConnectionContext = defaultClientHttpsContext, - settings: ConnectionPoolSettings = defaultConnectionPoolSettings, - log: LoggingAdapter = system.log)(implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = { + settings: ConnectionPoolSettings = defaultConnectionPoolSettings, + log: LoggingAdapter = system.log)(implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = { val cps = ConnectionPoolSetup(settings, connectionContext, log) val setup = HostConnectionPoolSetup(host, port, cps) cachedHostConnectionPool(setup) @@ -394,7 +401,8 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte * object of type `T` from the application which is emitted together with the corresponding response. */ private def cachedHostConnectionPool[T](setup: HostConnectionPoolSetup)( - implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = { + implicit + fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = { gatewayClientFlow(setup, sharedGateway(setup).startPool()) } @@ -415,10 +423,11 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte * To configure additional settings for the pool (and requests made using it), * use the `akka.http.host-connection-pool` config section or pass in a [[ConnectionPoolSettings]] explicitly. */ - def superPool[T](connectionContext: HttpsConnectionContext = defaultClientHttpsContext, - settings: ConnectionPoolSettings = defaultConnectionPoolSettings, - log: LoggingAdapter = system.log)(implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), NotUsed] = - clientFlow[T](settings) { request ⇒ request -> sharedGateway(request, settings, connectionContext, log) } + def superPool[T]( + connectionContext: HttpsConnectionContext = defaultClientHttpsContext, + settings: ConnectionPoolSettings = defaultConnectionPoolSettings, + log: LoggingAdapter = system.log)(implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), NotUsed] = + clientFlow[T](settings) { request ⇒ request → sharedGateway(request, settings, connectionContext, log) } /** * Fires a single [[akka.http.scaladsl.model.HttpRequest]] across the (cached) host connection pool for the request's @@ -429,10 +438,11 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte * * Note that the request must have an absolute URI, otherwise the future will be completed with an error. */ - def singleRequest(request: HttpRequest, - connectionContext: HttpsConnectionContext = defaultClientHttpsContext, - settings: ConnectionPoolSettings = defaultConnectionPoolSettings, - log: LoggingAdapter = system.log)(implicit fm: Materializer): Future[HttpResponse] = + def singleRequest( + request: HttpRequest, + connectionContext: HttpsConnectionContext = defaultClientHttpsContext, + settings: ConnectionPoolSettings = defaultConnectionPoolSettings, + log: LoggingAdapter = system.log)(implicit fm: Materializer): Future[HttpResponse] = try { val gateway = sharedGateway(request, settings, connectionContext, log) gateway(request) @@ -446,9 +456,10 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte * * The layer is not reusable and must only be materialized once. */ - def webSocketClientLayer(request: WebSocketRequest, - settings: ClientConnectionSettings = ClientConnectionSettings(system), - log: LoggingAdapter = system.log): Http.WebSocketClientLayer = + def webSocketClientLayer( + request: WebSocketRequest, + settings: ClientConnectionSettings = ClientConnectionSettings(system), + log: LoggingAdapter = system.log): Http.WebSocketClientLayer = WebSocketClientBlueprint(request, settings, log) /** @@ -456,11 +467,12 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte * * The layer is not reusable and must only be materialized once. */ - def webSocketClientFlow(request: WebSocketRequest, - connectionContext: ConnectionContext = defaultClientHttpsContext, - localAddress: Option[InetSocketAddress] = None, - settings: ClientConnectionSettings = ClientConnectionSettings(system), - log: LoggingAdapter = system.log): Flow[Message, Message, Future[WebSocketUpgradeResponse]] = { + def webSocketClientFlow( + request: WebSocketRequest, + connectionContext: ConnectionContext = defaultClientHttpsContext, + localAddress: Option[InetSocketAddress] = None, + settings: ClientConnectionSettings = ClientConnectionSettings(system), + log: LoggingAdapter = system.log): Flow[Message, Message, Future[WebSocketUpgradeResponse]] = { import request.uri require(uri.isAbsolute, s"WebSocket request URI must be absolute but was '$uri'") @@ -483,12 +495,13 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte * Runs a single WebSocket conversation given a Uri and a flow that represents the client side of the * WebSocket conversation. */ - def singleWebSocketRequest[T](request: WebSocketRequest, - clientFlow: Flow[Message, Message, T], - connectionContext: ConnectionContext = defaultClientHttpsContext, - localAddress: Option[InetSocketAddress] = None, - settings: ClientConnectionSettings = ClientConnectionSettings(system), - log: LoggingAdapter = system.log)(implicit mat: Materializer): (Future[WebSocketUpgradeResponse], T) = + def singleWebSocketRequest[T]( + request: WebSocketRequest, + clientFlow: Flow[Message, Message, T], + connectionContext: ConnectionContext = defaultClientHttpsContext, + localAddress: Option[InetSocketAddress] = None, + settings: ClientConnectionSettings = ClientConnectionSettings(system), + log: LoggingAdapter = system.log)(implicit mat: Materializer): (Future[WebSocketUpgradeResponse], T) = webSocketClientFlow(request, connectionContext, localAddress, settings, log) .joinMat(clientFlow)(Keep.both).run() @@ -565,21 +578,24 @@ class HttpExt(private val config: Config)(implicit val system: ActorSystem) exte private def sharedGateway(hcps: HostConnectionPoolSetup): PoolGateway = new PoolGateway(poolMasterActorRef, hcps, PoolGateway.SharedGateway)(systemMaterializer) - private def gatewayClientFlow[T](hcps: HostConnectionPoolSetup, - gateway: PoolGateway)( - implicit fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = - clientFlow[T](hcps.setup.settings)(_ -> gateway) + private def gatewayClientFlow[T]( + hcps: HostConnectionPoolSetup, + gateway: PoolGateway)( + implicit + fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), HostConnectionPool] = + clientFlow[T](hcps.setup.settings)(_ → gateway) .mapMaterializedValue(_ ⇒ HostConnectionPool(hcps)(gateway)) private def clientFlow[T](settings: ConnectionPoolSettings)(f: HttpRequest ⇒ (HttpRequest, PoolGateway))( - implicit system: ActorSystem, fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), NotUsed] = { + implicit + system: ActorSystem, fm: Materializer): Flow[(HttpRequest, T), (Try[HttpResponse], T), NotUsed] = { // a connection pool can never have more than pipeliningLimit * maxConnections requests in flight at any point val parallelism = settings.pipeliningLimit * settings.maxConnections Flow[(HttpRequest, T)].mapAsyncUnordered(parallelism) { case (request, userContext) ⇒ val (effectiveRequest, gateway) = f(request) val result = Promise[(Try[HttpResponse], T)]() // TODO: simplify to `transformWith` when on Scala 2.12 - gateway(effectiveRequest).onComplete(responseTry ⇒ result.success(responseTry -> userContext))(fm.executionContext) + gateway(effectiveRequest).onComplete(responseTry ⇒ result.success(responseTry → userContext))(fm.executionContext) result.future } } @@ -672,9 +688,9 @@ object Http extends ExtensionId[HttpExt] with ExtensionIdProvider { * Represents one accepted incoming HTTP connection. */ final case class IncomingConnection( - localAddress: InetSocketAddress, + localAddress: InetSocketAddress, remoteAddress: InetSocketAddress, - flow: Flow[HttpResponse, HttpRequest, NotUsed]) { + flow: Flow[HttpResponse, HttpRequest, NotUsed]) { /** * Handles the connection with the given flow, which is materialized exactly once diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/model/DateTime.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/model/DateTime.scala index 90b4d4a376..f70316b5e3 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/model/DateTime.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/model/DateTime.scala @@ -11,15 +11,16 @@ import akka.http.impl.util._ * Does not support TimeZones, all DateTime values are always GMT based. * Note that this implementation discards milliseconds (i.e. rounds down to full seconds). */ -final case class DateTime private (year: Int, // the year - month: Int, // the month of the year. January is 1. - day: Int, // the day of the month. The first day is 1. - hour: Int, // the hour of the day. The first hour is 0. - minute: Int, // the minute of the hour. The first minute is 0. - second: Int, // the second of the minute. The first second is 0. - weekday: Int, // the day of the week. Sunday is 0. - clicks: Long, // milliseconds since January 1, 1970, 00:00:00 GMT - isLeapYear: Boolean) extends akka.http.javadsl.model.DateTime with Ordered[DateTime] with Renderable { +final case class DateTime private ( + year: Int, // the year + month: Int, // the month of the year. January is 1. + day: Int, // the day of the month. The first day is 1. + hour: Int, // the hour of the day. The first hour is 0. + minute: Int, // the minute of the hour. The first minute is 0. + second: Int, // the second of the minute. The first second is 0. + weekday: Int, // the day of the week. Sunday is 0. + clicks: Long, // milliseconds since January 1, 1970, 00:00:00 GMT + isLeapYear: Boolean) extends akka.http.javadsl.model.DateTime with Ordered[DateTime] with Renderable { /** * The day of the week as a 3 letter abbreviation: * `Sun`, `Mon`, `Tue`, `Wed`, `Thu`, `Fri` or `Sat` @@ -42,7 +43,6 @@ final case class DateTime private (year: Int, // the year */ def -(millis: Long): DateTime = DateTime(clicks - millis) - /** * Creates a new `DateTime` that represents the point in time the given number of ms earlier. */ @@ -172,7 +172,8 @@ object DateTime { * Note that this implementation discards milliseconds (i.e. rounds down to full seconds). */ def apply(clicks: Long): DateTime = { - require(DateTime.MinValue.clicks <= clicks && clicks <= DateTime.MaxValue.clicks, + require( + DateTime.MinValue.clicks <= clicks && clicks <= DateTime.MaxValue.clicks, "DateTime value must be >= " + DateTime.MinValue + " and <= " + DateTime.MaxValue) // based on a fast RFC1123 implementation (C) 2000 by Tim Kientzle diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/model/HttpEntity.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/model/HttpEntity.scala index 8d9cb297f9..c07ccd8db5 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/model/HttpEntity.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/model/HttpEntity.scala @@ -11,7 +11,7 @@ import akka.http.impl.model.JavaInitialization import language.implicitConversions import java.io.File import java.nio.file.{ Path, Files } -import java.lang.{ Iterable ⇒ JIterable} +import java.lang.{ Iterable ⇒ JIterable } import scala.util.control.NonFatal import scala.concurrent.Future import scala.concurrent.duration._ @@ -24,7 +24,7 @@ import akka.{ NotUsed, stream } import akka.http.scaladsl.model.ContentType.{ NonBinary, Binary } import akka.http.scaladsl.util.FastFuture import akka.http.javadsl.{ model ⇒ jm } -import akka.http.impl.util.{JavaMapping, StreamUtils} +import akka.http.impl.util.{ JavaMapping, StreamUtils } import akka.http.impl.util.JavaMapping.Implicits._ import scala.compat.java8.OptionConverters._ @@ -341,9 +341,10 @@ object HttpEntity { /** * The model for the entity of a "regular" unchunked HTTP message with a known non-zero length. */ - final case class Default(contentType: ContentType, - contentLength: Long, - data: Source[ByteString, Any]) + final case class Default( + contentType: ContentType, + contentLength: Long, + data: Source[ByteString, Any]) extends jm.HttpEntity.Default with UniversalEntity { require(contentLength > 0, "contentLength must be positive (use `HttpEntity.empty(contentType)` for empty entities)") def isKnownEmpty = false @@ -592,18 +593,18 @@ object HttpEntity { */ private[http] def captureTermination[T <: HttpEntity](entity: T): (T, Future[Unit]) = entity match { - case x: HttpEntity.Strict ⇒ x.asInstanceOf[T] -> FastFuture.successful(()) + case x: HttpEntity.Strict ⇒ x.asInstanceOf[T] → FastFuture.successful(()) case x: HttpEntity.Default ⇒ val (newData, whenCompleted) = StreamUtils.captureTermination(x.data) - x.copy(data = newData).asInstanceOf[T] -> whenCompleted + x.copy(data = newData).asInstanceOf[T] → whenCompleted case x: HttpEntity.Chunked ⇒ val (newChunks, whenCompleted) = StreamUtils.captureTermination(x.chunks) - x.copy(chunks = newChunks).asInstanceOf[T] -> whenCompleted + x.copy(chunks = newChunks).asInstanceOf[T] → whenCompleted case x: HttpEntity.CloseDelimited ⇒ val (newData, whenCompleted) = StreamUtils.captureTermination(x.data) - x.copy(data = newData).asInstanceOf[T] -> whenCompleted + x.copy(data = newData).asInstanceOf[T] → whenCompleted case x: HttpEntity.IndefiniteLength ⇒ val (newData, whenCompleted) = StreamUtils.captureTermination(x.data) - x.copy(data = newData).asInstanceOf[T] -> whenCompleted + x.copy(data = newData).asInstanceOf[T] → whenCompleted } } diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/model/HttpMessage.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/model/HttpMessage.scala index 827a7a6551..65347d068d 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/model/HttpMessage.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/model/HttpMessage.scala @@ -16,7 +16,7 @@ import scala.compat.java8.OptionConverters._ import scala.reflect.{ classTag, ClassTag } import akka.parboiled2.CharUtils import akka.stream.Materializer -import akka.util.{HashCode, ByteString} +import akka.util.{ HashCode, ByteString } import akka.http.impl.util._ import akka.http.javadsl.{ model ⇒ jm } import akka.http.scaladsl.util.FastFuture._ @@ -85,9 +85,9 @@ sealed trait HttpMessage extends jm.HttpMessage { def header[T <: jm.HttpHeader: ClassTag]: Option[T] = { val erasure = classTag[T].runtimeClass headers.find(erasure.isInstance).asInstanceOf[Option[T]] match { - case header: Some[T] => header - case _ if erasure == classOf[`Content-Type`] => Some(entity.contentType).asInstanceOf[Option[T]] - case _ => None + case header: Some[T] ⇒ header + case _ if erasure == classOf[`Content-Type`] ⇒ Some(entity.contentType).asInstanceOf[Option[T]] + case _ ⇒ None } } @@ -145,16 +145,17 @@ object HttpMessage { * The immutable model HTTP request model. */ final class HttpRequest( - val method: HttpMethod, - val uri: Uri, - val headers: immutable.Seq[HttpHeader], - val entity: RequestEntity, - val protocol: HttpProtocol) + val method: HttpMethod, + val uri: Uri, + val headers: immutable.Seq[HttpHeader], + val entity: RequestEntity, + val protocol: HttpProtocol) extends jm.HttpRequest with HttpMessage { HttpRequest.verifyUri(uri) require(entity.isKnownEmpty || method.isEntityAccepted, s"Requests with method '${method.value}' must have an empty entity") - require(protocol != HttpProtocols.`HTTP/1.0` || !entity.isInstanceOf[HttpEntity.Chunked], + require( + protocol != HttpProtocols.`HTTP/1.0` || !entity.isInstanceOf[HttpEntity.Chunked], "HTTP/1.0 requests must not have a chunked entity") type Self = HttpRequest @@ -212,13 +213,12 @@ final class HttpRequest( /* Manual Case Class things, to easen bin-compat */ - def copy(method: HttpMethod = method, - uri: Uri = uri, - headers: immutable.Seq[HttpHeader] = headers, - entity: RequestEntity = entity, - protocol: HttpProtocol = protocol) = new HttpRequest(method, uri, headers, entity, protocol) - - + def copy( + method: HttpMethod = method, + uri: Uri = uri, + headers: immutable.Seq[HttpHeader] = headers, + entity: RequestEntity = entity, + protocol: HttpProtocol = protocol) = new HttpRequest(method, uri, headers, entity, protocol) override def hashCode(): Int = { var result = HashCode.SEED @@ -231,13 +231,13 @@ final class HttpRequest( } override def equals(obj: scala.Any): Boolean = obj match { - case HttpRequest(_method, _uri, _headers, _entity, _protocol) => + case HttpRequest(_method, _uri, _headers, _entity, _protocol) ⇒ method == _method && uri == _uri && headers == _headers && entity == _entity && protocol == _protocol - case _ => false + case _ ⇒ false } override def toString = s"""HttpRequest(${_1},${_2},${_3},${_4},${_5})""" @@ -273,7 +273,8 @@ object HttpRequest { } else // http://tools.ietf.org/html/rfc7230#section-5.4 if (hostHeader.isEmpty || uri.authority.isEmpty && hostHeader.get.isEmpty || hostHeader.get.host.equalsIgnoreCase(uri.authority.host) && hostHeader.get.port == uri.authority.port) uri - else throw IllegalUriException(s"'Host' header value of request to `$uri` doesn't match request target authority", + else throw IllegalUriException( + s"'Host' header value of request to `$uri` doesn't match request target authority", s"Host header: $hostHeader\nrequest target authority: ${uri.authority}") } @@ -295,11 +296,12 @@ object HttpRequest { /* Manual Case Class things, to easen bin-compat */ - def apply(method: HttpMethod = HttpMethods.GET, - uri: Uri = Uri./, - headers: immutable.Seq[HttpHeader] = Nil, - entity: RequestEntity = HttpEntity.Empty, - protocol: HttpProtocol = HttpProtocols.`HTTP/1.1`) = new HttpRequest(method, uri, headers, entity, protocol) + def apply( + method: HttpMethod = HttpMethods.GET, + uri: Uri = Uri./, + headers: immutable.Seq[HttpHeader] = Nil, + entity: RequestEntity = HttpEntity.Empty, + protocol: HttpProtocol = HttpProtocols.`HTTP/1.1`) = new HttpRequest(method, uri, headers, entity, protocol) def unapply(any: HttpRequest) = new OptHttpRequest(any) } @@ -308,14 +310,15 @@ object HttpRequest { * The immutable HTTP response model. */ final class HttpResponse( - val status: StatusCode, - val headers: immutable.Seq[HttpHeader], - val entity: ResponseEntity, - val protocol: HttpProtocol) + val status: StatusCode, + val headers: immutable.Seq[HttpHeader], + val entity: ResponseEntity, + val protocol: HttpProtocol) extends jm.HttpResponse with HttpMessage { require(entity.isKnownEmpty || status.allowsEntity, "Responses with this status code must have an empty entity") - require(protocol == HttpProtocols.`HTTP/1.1` || !entity.isInstanceOf[HttpEntity.Chunked], + require( + protocol == HttpProtocols.`HTTP/1.1` || !entity.isInstanceOf[HttpEntity.Chunked], "HTTP/1.0 responses must not have a chunked entity") type Self = HttpResponse @@ -341,19 +344,19 @@ final class HttpResponse( /* Manual Case Class things, to easen bin-compat */ - def copy(status: StatusCode = status, - headers: immutable.Seq[HttpHeader] = headers, - entity: ResponseEntity = entity, - protocol: HttpProtocol = protocol) = new HttpResponse(status, headers, entity, protocol) - + def copy( + status: StatusCode = status, + headers: immutable.Seq[HttpHeader] = headers, + entity: ResponseEntity = entity, + protocol: HttpProtocol = protocol) = new HttpResponse(status, headers, entity, protocol) override def equals(obj: scala.Any): Boolean = obj match { - case HttpResponse(_status, _headers, _entity, _protocol) => + case HttpResponse(_status, _headers, _entity, _protocol) ⇒ status == _status && headers == _headers && entity == _entity && protocol == _protocol - case _ => false + case _ ⇒ false } override def hashCode: Int = { @@ -378,10 +381,11 @@ final class HttpResponse( object HttpResponse { /* Manual Case Class things, to easen bin-compat */ - def apply(status: StatusCode = StatusCodes.OK, - headers: immutable.Seq[HttpHeader] = Nil, - entity: ResponseEntity = HttpEntity.Empty, - protocol: HttpProtocol = HttpProtocols.`HTTP/1.1`) = new HttpResponse(status, headers, entity, protocol) + def apply( + status: StatusCode = StatusCodes.OK, + headers: immutable.Seq[HttpHeader] = Nil, + entity: ResponseEntity = HttpEntity.Empty, + protocol: HttpProtocol = HttpProtocols.`HTTP/1.1`) = new HttpResponse(status, headers, entity, protocol) def unapply(any: HttpResponse): OptHttpResponse = new OptHttpResponse(any) } diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/model/HttpMethod.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/model/HttpMethod.scala index 2184e1d14a..7ee304c81f 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/model/HttpMethod.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/model/HttpMethod.scala @@ -29,10 +29,11 @@ object RequestEntityAcceptance { * @param isIdempotent true if requests can be safely (& automatically) repeated * @param requestEntityAcceptance Expected if meaning of request entities is properly defined */ -final case class HttpMethod private[http] (override val value: String, - isSafe: Boolean, - isIdempotent: Boolean, - requestEntityAcceptance: RequestEntityAcceptance) extends jm.HttpMethod with SingletonValueRenderable { +final case class HttpMethod private[http] ( + override val value: String, + isSafe: Boolean, + isIdempotent: Boolean, + requestEntityAcceptance: RequestEntityAcceptance) extends jm.HttpMethod with SingletonValueRenderable { override def isEntityAccepted: Boolean = requestEntityAcceptance.isEntityAccepted override def toString: String = s"HttpMethod($value)" } diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/model/MediaRange.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/model/MediaRange.scala index f4119ab98b..ed8c385099 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/model/MediaRange.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/model/MediaRange.scala @@ -50,8 +50,8 @@ sealed abstract class MediaRange extends jm.MediaRange with Renderable with With object MediaRange { private[http] def splitOffQValue(params: Map[String, String], defaultQ: Float = 1.0f): (Map[String, String], Float) = params.get("q") match { - case Some(x) ⇒ (params - "q") -> (try x.toFloat catch { case _: NumberFormatException ⇒ 1.0f }) - case None ⇒ params -> defaultQ + case Some(x) ⇒ (params - "q") → (try x.toFloat catch { case _: NumberFormatException ⇒ 1.0f }) + case None ⇒ params → defaultQ } private final case class Custom(mainType: String, params: Map[String, String], qValue: Float) diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/model/MediaType.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/model/MediaType.scala index 7ab33fa5e9..dc78006599 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/model/MediaType.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/model/MediaType.scala @@ -126,8 +126,8 @@ object MediaType { } def customWithFixedCharset(mainType: String, subType: String, charset: HttpCharset, fileExtensions: List[String] = Nil, - params: Map[String, String] = Map.empty, - allowArbitrarySubtypes: Boolean = false): WithFixedCharset = { + params: Map[String, String] = Map.empty, + allowArbitrarySubtypes: Boolean = false): WithFixedCharset = { require(mainType != "multipart", "Cannot create a MediaType.Multipart here, use `customMultipart` instead!") require(allowArbitrarySubtypes || subType != "*", "Cannot create a MediaRange here, use `MediaRange.custom` instead!") val _params = params @@ -143,8 +143,8 @@ object MediaType { } def customWithOpenCharset(mainType: String, subType: String, fileExtensions: List[String] = Nil, - params: Map[String, String] = Map.empty, - allowArbitrarySubtypes: Boolean = false): WithOpenCharset = { + params: Map[String, String] = Map.empty, + allowArbitrarySubtypes: Boolean = false): WithOpenCharset = { require(mainType != "multipart", "Cannot create a MediaType.Multipart here, use `customMultipart` instead!") require(allowArbitrarySubtypes || subType != "*", "Cannot create a MediaRange here, use `MediaRange.custom` instead!") val _params = params @@ -258,7 +258,7 @@ object MediaType { } object MediaTypes extends ObjectRegistry[(String, String), MediaType] { - type FindCustom = (String, String) => Option[MediaType] + type FindCustom = (String, String) ⇒ Option[MediaType] private[this] var extensionMap = Map.empty[String, MediaType] @@ -276,7 +276,7 @@ object MediaTypes extends ObjectRegistry[(String, String), MediaType] { private def register[T <: MediaType](mediaType: T): T = { registerFileExtensions(mediaType) - register(mediaType.mainType.toRootLowerCase -> mediaType.subType.toRootLowerCase, mediaType) + register(mediaType.mainType.toRootLowerCase → mediaType.subType.toRootLowerCase, mediaType) } import MediaType._ diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/model/Multipart.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/model/Multipart.scala index fdbd6f7b98..7275ff8dab 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/model/Multipart.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/model/Multipart.scala @@ -56,8 +56,9 @@ sealed trait Multipart extends jm.Multipart { /** * Creates a [[akka.http.scaladsl.model.MessageEntity]] from this multipart object. */ - def toEntity(charset: HttpCharset = HttpCharsets.`UTF-8`, - boundary: String = BodyPartRenderer.randomBoundary())(implicit log: LoggingAdapter = NoLogging): MessageEntity = { + def toEntity( + charset: HttpCharset = HttpCharsets.`UTF-8`, + boundary: String = BodyPartRenderer.randomBoundary())(implicit log: LoggingAdapter = NoLogging): MessageEntity = { val chunks = parts .transform(() ⇒ BodyPartRenderer.streamed(boundary, charset.nioCharset, partHeadersSizeHint = 128, log)) @@ -224,7 +225,7 @@ object Multipart { } def unapply(value: Multipart.General): Option[(MediaType.Multipart, Source[Multipart.General.BodyPart, Any])] = - Some(value.mediaType -> value.parts) + Some(value.mediaType → value.parts) /** * Strict [[General]] multipart content. @@ -284,7 +285,7 @@ object Multipart { override def toString = s"General.BodyPart($entity, $headers)" } - def unapply(value: BodyPart): Option[(BodyPartEntity, immutable.Seq[HttpHeader])] = Some(value.entity -> value.headers) + def unapply(value: BodyPart): Option[(BodyPartEntity, immutable.Seq[HttpHeader])] = Some(value.entity → value.headers) /** * Strict [[General.BodyPart]]. @@ -429,8 +430,8 @@ object Multipart { } object BodyPart { def apply(_name: String, _entity: BodyPartEntity, - _additionalDispositionParams: Map[String, String] = Map.empty, - _additionalHeaders: immutable.Seq[HttpHeader] = Nil): Multipart.FormData.BodyPart = + _additionalDispositionParams: Map[String, String] = Map.empty, + _additionalHeaders: immutable.Seq[HttpHeader] = Nil): Multipart.FormData.BodyPart = new Multipart.FormData.BodyPart { def name = _name def additionalDispositionParams = _additionalDispositionParams @@ -450,7 +451,7 @@ object Multipart { * Creates a BodyPart backed by a file that will be streamed using a FileSource. */ def fromPath(name: String, contentType: ContentType, file: Path, chunkSize: Int = -1): BodyPart = - BodyPart(name, HttpEntity.fromPath(contentType, file, chunkSize), Map("filename" -> file.getFileName.toString)) + BodyPart(name, HttpEntity.fromPath(contentType, file, chunkSize), Map("filename" → file.getFileName.toString)) def unapply(value: BodyPart): Option[(String, BodyPartEntity, Map[String, String], immutable.Seq[HttpHeader])] = Some((value.name, value.entity, value.additionalDispositionParams, value.additionalHeaders)) @@ -459,8 +460,8 @@ object Multipart { * Strict [[FormData.BodyPart]]. */ case class Strict(name: String, entity: HttpEntity.Strict, - additionalDispositionParams: Map[String, String] = Map.empty, - additionalHeaders: immutable.Seq[HttpHeader] = Nil) + additionalDispositionParams: Map[String, String] = Map.empty, + additionalHeaders: immutable.Seq[HttpHeader] = Nil) extends Multipart.FormData.BodyPart with Multipart.BodyPart.Strict with jm.Multipart.FormData.BodyPart.Strict { override def toStrict(timeout: FiniteDuration)(implicit fm: Materializer): Future[Multipart.FormData.BodyPart.Strict] = FastFuture.successful(this) diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/model/Uri.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/model/Uri.scala index 9c99da0fb5..6a91a8151c 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/model/Uri.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/model/Uri.scala @@ -600,9 +600,9 @@ object Uri { } private val defaultPorts: Map[String, Int] = - Map("ftp" -> 21, "ssh" -> 22, "telnet" -> 23, "smtp" -> 25, "domain" -> 53, "tftp" -> 69, "http" -> 80, "ws" -> 80, - "pop3" -> 110, "nntp" -> 119, "imap" -> 143, "snmp" -> 161, "ldap" -> 389, "https" -> 443, "wss" -> 443, "imaps" -> 993, - "nfs" -> 2049).withDefaultValue(-1) + Map("ftp" → 21, "ssh" → 22, "telnet" → 23, "smtp" → 25, "domain" → 53, "tftp" → 69, "http" → 80, "ws" → 80, + "pop3" → 110, "nntp" → 119, "imap" → 143, "snmp" → 161, "ldap" → 389, "https" → 443, "wss" → 443, "imaps" → 993, + "nfs" → 2049).withDefaultValue(-1) sealed trait ParsingMode extends akka.http.javadsl.model.Uri.ParsingMode object ParsingMode { @@ -732,9 +732,9 @@ object Uri { case Slash(Segment("..", tail)) ⇒ process( input = if (tail.isEmpty) Path./ else tail, output = - if (output.startsWithSegment) - if (output.tail.startsWithSlash) output.tail.tail else tail - else output) + if (output.startsWithSegment) + if (output.tail.startsWithSlash) output.tail.tail else tail + else output) case Segment("." | "..", tail) ⇒ process(tail, output) case Slash(tail) ⇒ process(tail, Slash(output)) case Segment(string, tail) ⇒ process(tail, string :: output) diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/model/headers/HttpCookie.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/model/headers/HttpCookie.scala index ec5d07efce..5c27f3ead6 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/model/headers/HttpCookie.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/model/headers/HttpCookie.scala @@ -17,7 +17,7 @@ import scala.compat.java8.OptionConverters._ // see http://tools.ietf.org/html/rfc6265 // sealed abstract to prevent generation of default apply method in companion sealed abstract case class HttpCookiePair private ( - name: String, + name: String, value: String) extends jm.headers.HttpCookiePair with ToStringRenderable { def render[R <: Rendering](r: R): r.type = r ~~ name ~~ '=' ~~ value @@ -50,15 +50,15 @@ object HttpCookiePair { // see http://tools.ietf.org/html/rfc6265 final case class HttpCookie( - name: String, - value: String, - expires: Option[DateTime] = None, - maxAge: Option[Long] = None, - domain: Option[String] = None, - path: Option[String] = None, - secure: Boolean = false, - httpOnly: Boolean = false, - extension: Option[String] = None) extends jm.headers.HttpCookie with ToStringRenderable { + name: String, + value: String, + expires: Option[DateTime] = None, + maxAge: Option[Long] = None, + domain: Option[String] = None, + path: Option[String] = None, + secure: Boolean = false, + httpOnly: Boolean = false, + extension: Option[String] = None) extends jm.headers.HttpCookie with ToStringRenderable { /** Returns the name/value pair for this cookie, to be used in [[Cookie]] headers. */ def pair: HttpCookiePair = HttpCookiePair(name, value) @@ -111,14 +111,15 @@ final case class HttpCookie( } object HttpCookie { - def fromPair(pair: HttpCookiePair, - expires: Option[DateTime] = None, - maxAge: Option[Long] = None, - domain: Option[String] = None, - path: Option[String] = None, - secure: Boolean = false, - httpOnly: Boolean = false, - extension: Option[String] = None): HttpCookie = + def fromPair( + pair: HttpCookiePair, + expires: Option[DateTime] = None, + maxAge: Option[Long] = None, + domain: Option[String] = None, + path: Option[String] = None, + secure: Boolean = false, + httpOnly: Boolean = false, + extension: Option[String] = None): HttpCookie = HttpCookie(pair.name, pair.value, expires, maxAge, domain, path, secure, httpOnly, extension) import akka.http.impl.model.parser.CharacterClasses._ diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/model/headers/headers.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/model/headers/headers.scala index a5510aefce..15e3844a1e 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/model/headers/headers.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/model/headers/headers.scala @@ -641,7 +641,7 @@ final case class RawHeader(name: String, value: String) extends jm.headers.RawHe } object RawHeader { def unapply[H <: HttpHeader](customHeader: H): Option[(String, String)] = - Some(customHeader.name -> customHeader.value) + Some(customHeader.name → customHeader.value) } object `Raw-Request-URI` extends ModeledCompanion[`Raw-Request-URI`] diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/model/ws/UpgradeToWebSocket.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/model/ws/UpgradeToWebSocket.scala index 336082e95f..1ebb912906 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/model/ws/UpgradeToWebSocket.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/model/ws/UpgradeToWebSocket.scala @@ -34,8 +34,9 @@ trait UpgradeToWebSocket extends jm.ws.UpgradeToWebSocket { * * Optionally, a subprotocol out of the ones requested by the client can be chosen. */ - def handleMessages(handlerFlow: Graph[FlowShape[Message, Message], Any], - subprotocol: Option[String] = None): HttpResponse + def handleMessages( + handlerFlow: Graph[FlowShape[Message, Message], Any], + subprotocol: Option[String] = None): HttpResponse /** * The high-level interface to create a WebSocket server based on "messages". @@ -47,9 +48,10 @@ trait UpgradeToWebSocket extends jm.ws.UpgradeToWebSocket { * * Optionally, a subprotocol out of the ones requested by the client can be chosen. */ - def handleMessagesWithSinkSource(inSink: Graph[SinkShape[Message], Any], - outSource: Graph[SourceShape[Message], Any], - subprotocol: Option[String] = None): HttpResponse = + def handleMessagesWithSinkSource( + inSink: Graph[SinkShape[Message], Any], + outSource: Graph[SourceShape[Message], Any], + subprotocol: Option[String] = None): HttpResponse = handleMessages(scaladsl.Flow.fromSinkAndSource(inSink, outSource), subprotocol) import scala.collection.JavaConverters._ @@ -80,9 +82,10 @@ trait UpgradeToWebSocket extends jm.ws.UpgradeToWebSocket { /** * Java API */ - def handleMessagesWith(inSink: Graph[SinkShape[jm.ws.Message], _ <: Any], - outSource: Graph[SourceShape[jm.ws.Message], _ <: Any], - subprotocol: String): HttpResponse = + def handleMessagesWith( + inSink: Graph[SinkShape[jm.ws.Message], _ <: Any], + outSource: Graph[SourceShape[jm.ws.Message], _ <: Any], + subprotocol: String): HttpResponse = handleMessages(createScalaFlow(inSink, outSource), subprotocol = Some(subprotocol)) private[this] def createScalaFlow(inSink: Graph[SinkShape[jm.ws.Message], _ <: Any], outSource: Graph[SourceShape[jm.ws.Message], _ <: Any]): Graph[FlowShape[Message, Message], NotUsed] = diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/model/ws/WebSocketRequest.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/model/ws/WebSocketRequest.scala index 89e482b1cd..9a76e7f952 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/model/ws/WebSocketRequest.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/model/ws/WebSocketRequest.scala @@ -17,9 +17,9 @@ import akka.http.scaladsl.model.{ HttpHeader, Uri } * @param subprotocol A WebSocket subprotocol if required. */ final case class WebSocketRequest( - uri: Uri, + uri: Uri, extraHeaders: immutable.Seq[HttpHeader] = Nil, - subprotocol: Option[String] = None) + subprotocol: Option[String] = None) object WebSocketRequest { implicit def fromTargetUri(uri: Uri): WebSocketRequest = WebSocketRequest(uri) implicit def fromTargetUriString(uriString: String): WebSocketRequest = WebSocketRequest(uriString) diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/settings/ParserSettings.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/settings/ParserSettings.scala index b5ae452d54..fa4ae90d73 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/settings/ParserSettings.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/settings/ParserSettings.scala @@ -89,15 +89,15 @@ abstract class ParserSettings private[akka] () extends akka.http.javadsl.setting def withErrorLoggingVerbosity(newValue: ParserSettings.ErrorLoggingVerbosity): ParserSettings = self.copy(errorLoggingVerbosity = newValue) def withHeaderValueCacheLimits(newValue: Map[String, Int]): ParserSettings = self.copy(headerValueCacheLimits = newValue) def withCustomMethods(methods: HttpMethod*): ParserSettings = { - val map = methods.map(m ⇒ m.name -> m).toMap + val map = methods.map(m ⇒ m.name → m).toMap self.copy(customMethods = map.get) } def withCustomStatusCodes(codes: StatusCode*): ParserSettings = { - val map = codes.map(c ⇒ c.intValue -> c).toMap + val map = codes.map(c ⇒ c.intValue → c).toMap self.copy(customStatusCodes = map.get) } def withCustomMediaTypes(types: MediaType*): ParserSettings = { - val map = types.map(c ⇒ (c.mainType, c.subType) -> c).toMap + val map = types.map(c ⇒ (c.mainType, c.subType) → c).toMap self.copy(customMediaTypes = (main, sub) ⇒ map.get((main, sub))) } } diff --git a/akka-http-core/src/main/scala/akka/http/scaladsl/util/FastFuture.scala b/akka-http-core/src/main/scala/akka/http/scaladsl/util/FastFuture.scala index ccb1e1578b..2c8abddb16 100644 --- a/akka-http-core/src/main/scala/akka/http/scaladsl/util/FastFuture.scala +++ b/akka-http-core/src/main/scala/akka/http/scaladsl/util/FastFuture.scala @@ -80,9 +80,9 @@ object FastFuture { def isCompleted = true def result(atMost: Duration)(implicit permit: CanAwait) = a def ready(atMost: Duration)(implicit permit: CanAwait) = this - def transform[S](f: scala.util.Try[A] => scala.util.Try[S])(implicit executor: scala.concurrent.ExecutionContext): scala.concurrent.Future[S] = + def transform[S](f: scala.util.Try[A] ⇒ scala.util.Try[S])(implicit executor: scala.concurrent.ExecutionContext): scala.concurrent.Future[S] = FastFuture(f(Success(a))) - def transformWith[S](f: scala.util.Try[A] => scala.concurrent.Future[S])(implicit executor: scala.concurrent.ExecutionContext): scala.concurrent.Future[S] = + def transformWith[S](f: scala.util.Try[A] ⇒ scala.concurrent.Future[S])(implicit executor: scala.concurrent.ExecutionContext): scala.concurrent.Future[S] = new FastFuture(this).transformWith(f) } private case class ErrorFuture(error: Throwable) extends Future[Nothing] { @@ -91,9 +91,9 @@ object FastFuture { def isCompleted = true def result(atMost: Duration)(implicit permit: CanAwait) = throw error def ready(atMost: Duration)(implicit permit: CanAwait) = this - def transform[S](f: scala.util.Try[Nothing] => scala.util.Try[S])(implicit executor: scala.concurrent.ExecutionContext): scala.concurrent.Future[S] = + def transform[S](f: scala.util.Try[Nothing] ⇒ scala.util.Try[S])(implicit executor: scala.concurrent.ExecutionContext): scala.concurrent.Future[S] = FastFuture(f(Failure(error))) - def transformWith[S](f: scala.util.Try[Nothing] => scala.concurrent.Future[S])(implicit executor: scala.concurrent.ExecutionContext): scala.concurrent.Future[S] = + def transformWith[S](f: scala.util.Try[Nothing] ⇒ scala.concurrent.Future[S])(implicit executor: scala.concurrent.ExecutionContext): scala.concurrent.Future[S] = new FastFuture(this).transformWith(f) } diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/client/ConnectionPoolSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/client/ConnectionPoolSpec.scala index ff8addc3df..4fde9f5469 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/client/ConnectionPoolSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/client/ConnectionPoolSpec.scala @@ -60,7 +60,7 @@ class ConnectionPoolSpec extends AkkaSpec(""" "properly complete a simple request/response cycle" in new TestSetup { val (requestIn, responseOut, responseOutSub, hcp) = cachedHostConnectionPool[Int]() - requestIn.sendNext(HttpRequest(uri = "/") -> 42) + requestIn.sendNext(HttpRequest(uri = "/") → 42) responseOutSub.request(1) acceptIncomingConnection() @@ -71,8 +71,8 @@ class ConnectionPoolSpec extends AkkaSpec(""" "open a second connection if the first one is loaded" in new TestSetup { val (requestIn, responseOut, responseOutSub, hcp) = cachedHostConnectionPool[Int]() - requestIn.sendNext(HttpRequest(uri = "/a") -> 42) - requestIn.sendNext(HttpRequest(uri = "/b") -> 43) + requestIn.sendNext(HttpRequest(uri = "/a") → 42) + requestIn.sendNext(HttpRequest(uri = "/b") → 43) responseOutSub.request(2) acceptIncomingConnection() @@ -100,7 +100,7 @@ class ConnectionPoolSpec extends AkkaSpec(""" case x ⇒ super.testServerHandler(connNr)(x) } - requestIn.sendNext(HttpRequest(uri = "/a") -> 42) + requestIn.sendNext(HttpRequest(uri = "/a") → 42) responseOutSub.request(1) acceptIncomingConnection() val (Success(r1), 42) = responseOut.expectNext() @@ -110,7 +110,7 @@ class ConnectionPoolSpec extends AkkaSpec(""" responseEntityPub.sendNext(ByteString("YEAH")) responseEntityProbe.expectNext(ByteString("YEAH")) - requestIn.sendNext(HttpRequest(uri = "/b") -> 43) + requestIn.sendNext(HttpRequest(uri = "/b") → 43) responseOutSub.request(1) acceptIncomingConnection() val (Success(r2), 43) = responseOut.expectNext() @@ -120,13 +120,13 @@ class ConnectionPoolSpec extends AkkaSpec(""" "not open a second connection if there is an idle one available" in new TestSetup { val (requestIn, responseOut, responseOutSub, hcp) = cachedHostConnectionPool[Int]() - requestIn.sendNext(HttpRequest(uri = "/a") -> 42) + requestIn.sendNext(HttpRequest(uri = "/a") → 42) responseOutSub.request(1) acceptIncomingConnection() val (Success(response1), 42) = responseOut.expectNext() connNr(response1) shouldEqual 1 - requestIn.sendNext(HttpRequest(uri = "/b") -> 43) + requestIn.sendNext(HttpRequest(uri = "/b") → 43) responseOutSub.request(1) val (Success(response2), 43) = responseOut.expectNext() connNr(response2) shouldEqual 1 @@ -138,7 +138,7 @@ class ConnectionPoolSpec extends AkkaSpec(""" val N = 500 val requestIds = Source.fromIterator(() ⇒ Iterator.from(1)).take(N) - val idSum = requestIds.map(id ⇒ HttpRequest(uri = s"/r$id") -> id).via(poolFlow).map { + val idSum = requestIds.map(id ⇒ HttpRequest(uri = s"/r$id") → id).via(poolFlow).map { case (Success(response), id) ⇒ requestUri(response) should endWith(s"/r$id") id @@ -156,8 +156,8 @@ class ConnectionPoolSpec extends AkkaSpec(""" "properly surface connection-level errors" in new TestSetup(autoAccept = true) { val (requestIn, responseOut, responseOutSub, hcp) = cachedHostConnectionPool[Int](maxRetries = 0) - requestIn.sendNext(HttpRequest(uri = "/a") -> 42) - requestIn.sendNext(HttpRequest(uri = "/crash") -> 43) + requestIn.sendNext(HttpRequest(uri = "/a") → 42) + requestIn.sendNext(HttpRequest(uri = "/crash") → 43) responseOutSub.request(2) override def mapServerSideOutboundRawBytes(bytes: ByteString): ByteString = @@ -172,8 +172,8 @@ class ConnectionPoolSpec extends AkkaSpec(""" "retry failed requests" in new TestSetup(autoAccept = true) { val (requestIn, responseOut, responseOutSub, hcp) = cachedHostConnectionPool[Int]() - requestIn.sendNext(HttpRequest(uri = "/a") -> 42) - requestIn.sendNext(HttpRequest(uri = "/crash") -> 43) + requestIn.sendNext(HttpRequest(uri = "/a") → 42) + requestIn.sendNext(HttpRequest(uri = "/crash") → 43) responseOutSub.request(2) val remainingResponsesToKill = new AtomicInteger(1) @@ -191,8 +191,8 @@ class ConnectionPoolSpec extends AkkaSpec(""" "respect the configured `maxRetries` value" in new TestSetup(autoAccept = true) { val (requestIn, responseOut, responseOutSub, hcp) = cachedHostConnectionPool[Int](maxRetries = 4) - requestIn.sendNext(HttpRequest(uri = "/a") -> 42) - requestIn.sendNext(HttpRequest(uri = "/crash") -> 43) + requestIn.sendNext(HttpRequest(uri = "/a") → 42) + requestIn.sendNext(HttpRequest(uri = "/crash") → 43) responseOutSub.request(2) val remainingResponsesToKill = new AtomicInteger(5) @@ -222,7 +222,7 @@ class ConnectionPoolSpec extends AkkaSpec(""" Await.result(gateway.poolStatus(), 1500.millis).get shouldBe a[PoolInterfaceRunning] awaitCond({ Await.result(gateway.poolStatus(), 1500.millis).isEmpty }, 2000.millis) - requestIn.sendNext(HttpRequest(uri = "/") -> 42) + requestIn.sendNext(HttpRequest(uri = "/") → 42) responseOutSub.request(1) acceptIncomingConnection() @@ -272,8 +272,8 @@ class ConnectionPoolSpec extends AkkaSpec(""" val (requestIn, responseOut, responseOutSub, hcp) = superPool[Int]() - requestIn.sendNext(HttpRequest(uri = s"http://$serverHostName:$serverPort/a") -> 42) - requestIn.sendNext(HttpRequest(uri = s"http://$serverHostName2:$serverPort2/b") -> 43) + requestIn.sendNext(HttpRequest(uri = s"http://$serverHostName:$serverPort/a") → 42) + requestIn.sendNext(HttpRequest(uri = s"http://$serverHostName2:$serverPort2/b") → 43) responseOutSub.request(2) Seq(responseOut.expectNext(), responseOut.expectNext()) foreach { @@ -284,8 +284,9 @@ class ConnectionPoolSpec extends AkkaSpec(""" } } - class TestSetup(serverSettings: ServerSettings = ServerSettings(system), - autoAccept: Boolean = false) { + class TestSetup( + serverSettings: ServerSettings = ServerSettings(system), + autoAccept: Boolean = false) { val (serverEndpoint, serverHostName, serverPort) = TestUtils.temporaryServerHostnameAndPort() def testServerHandler(connNr: Int): HttpRequest ⇒ HttpResponse = { @@ -322,23 +323,25 @@ class ConnectionPoolSpec extends AkkaSpec(""" private def handleConnection(c: Http.IncomingConnection) = c.handleWithSyncHandler(testServerHandler(incomingConnectionCounter.incrementAndGet())) - def cachedHostConnectionPool[T](maxConnections: Int = 2, - maxRetries: Int = 2, - maxOpenRequests: Int = 8, - pipeliningLimit: Int = 1, - idleTimeout: Duration = 5.seconds, - ccSettings: ClientConnectionSettings = ClientConnectionSettings(system)) = { + def cachedHostConnectionPool[T]( + maxConnections: Int = 2, + maxRetries: Int = 2, + maxOpenRequests: Int = 8, + pipeliningLimit: Int = 1, + idleTimeout: Duration = 5.seconds, + ccSettings: ClientConnectionSettings = ClientConnectionSettings(system)) = { val settings = new ConnectionPoolSettingsImpl(maxConnections, maxRetries, maxOpenRequests, pipeliningLimit, idleTimeout, ClientConnectionSettings(system)) flowTestBench(Http().cachedHostConnectionPool[T](serverHostName, serverPort, settings)) } - def superPool[T](maxConnections: Int = 2, - maxRetries: Int = 2, - maxOpenRequests: Int = 8, - pipeliningLimit: Int = 1, - idleTimeout: Duration = 5.seconds, - ccSettings: ClientConnectionSettings = ClientConnectionSettings(system)) = { + def superPool[T]( + maxConnections: Int = 2, + maxRetries: Int = 2, + maxOpenRequests: Int = 8, + pipeliningLimit: Int = 1, + idleTimeout: Duration = 5.seconds, + ccSettings: ClientConnectionSettings = ClientConnectionSettings(system)) = { val settings = new ConnectionPoolSettingsImpl(maxConnections, maxRetries, maxOpenRequests, pipeliningLimit, idleTimeout, ClientConnectionSettings(system)) flowTestBench(Http().superPool[T](settings = settings)) diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/client/HighLevelOutgoingConnectionSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/client/HighLevelOutgoingConnectionSpec.scala index 0bc7cca0b7..4e37f69027 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/client/HighLevelOutgoingConnectionSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/client/HighLevelOutgoingConnectionSpec.scala @@ -26,7 +26,8 @@ class HighLevelOutgoingConnectionSpec extends AkkaSpec { "be able to handle 100 pipelined requests across one connection" in Utils.assertAllStagesStopped { val (_, serverHostName, serverPort) = TestUtils.temporaryServerHostnameAndPort() - val binding = Http().bindAndHandleSync(r ⇒ HttpResponse(entity = r.uri.toString.reverse.takeWhile(Character.isDigit).reverse), + val binding = Http().bindAndHandleSync( + r ⇒ HttpResponse(entity = r.uri.toString.reverse.takeWhile(Character.isDigit).reverse), serverHostName, serverPort) val N = 100 @@ -45,7 +46,8 @@ class HighLevelOutgoingConnectionSpec extends AkkaSpec { "be able to handle 100 pipelined requests across 4 connections (client-flow is reusable)" in Utils.assertAllStagesStopped { val (_, serverHostName, serverPort) = TestUtils.temporaryServerHostnameAndPort() - val binding = Http().bindAndHandleSync(r ⇒ HttpResponse(entity = r.uri.toString.reverse.takeWhile(Character.isDigit).reverse), + val binding = Http().bindAndHandleSync( + r ⇒ HttpResponse(entity = r.uri.toString.reverse.takeWhile(Character.isDigit).reverse), serverHostName, serverPort) val connFlow = Http().outgoingConnection(serverHostName, serverPort) diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/client/LowLevelOutgoingConnectionSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/client/LowLevelOutgoingConnectionSpec.scala index 8c1d5fa686..e2cea50f60 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/client/LowLevelOutgoingConnectionSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/client/LowLevelOutgoingConnectionSpec.scala @@ -228,7 +228,7 @@ class LowLevelOutgoingConnectionSpec extends AkkaSpec("akka.loggers = []\n akka. |""") inside(expectResponse()) { - case HttpResponse(StatusCodes.OK, _, HttpEntity.Chunked(_, data), _) => + case HttpResponse(StatusCodes.OK, _, HttpEntity.Chunked(_, data), _) ⇒ val dataProbe = TestSubscriber.manualProbe[ChunkStreamPart] // but only one consumed by server data.take(1).to(Sink.fromSubscriber(dataProbe)).run() @@ -242,7 +242,7 @@ class LowLevelOutgoingConnectionSpec extends AkkaSpec("akka.loggers = []\n akka. } "proceed to next response once previous response's entity has been drained" in new TestSetup { - def twice(action: => Unit): Unit = { action; action } + def twice(action: ⇒ Unit): Unit = { action; action } twice { requestsSub.sendNext(HttpRequest()) @@ -823,17 +823,16 @@ class LowLevelOutgoingConnectionSpec extends AkkaSpec("akka.loggers = []\n akka. val netOut = TestSubscriber.manualProbe[ByteString]() val netIn = TestPublisher.manualProbe[ByteString]() - RunnableGraph.fromGraph(GraphDSL.create(OutgoingConnectionBlueprint(Host("example.com"), settings, NoLogging)) { implicit b ⇒ - client ⇒ - import GraphDSL.Implicits._ - Source.fromPublisher(netIn) ~> Flow[ByteString].map(SessionBytes(null, _)) ~> client.in2 - client.out1 ~> Flow[SslTlsOutbound].collect { case SendBytes(x) ⇒ x } ~> Sink.fromSubscriber(netOut) - Source.fromPublisher(requests) ~> client.in1 - client.out2 ~> Sink.fromSubscriber(responses) - ClosedShape + RunnableGraph.fromGraph(GraphDSL.create(OutgoingConnectionBlueprint(Host("example.com"), settings, NoLogging)) { implicit b ⇒ client ⇒ + import GraphDSL.Implicits._ + Source.fromPublisher(netIn) ~> Flow[ByteString].map(SessionBytes(null, _)) ~> client.in2 + client.out1 ~> Flow[SslTlsOutbound].collect { case SendBytes(x) ⇒ x } ~> Sink.fromSubscriber(netOut) + Source.fromPublisher(requests) ~> client.in1 + client.out2 ~> Sink.fromSubscriber(responses) + ClosedShape }).run() - netOut -> netIn + netOut → netIn } def wipeDate(string: String) = diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/client/TlsEndpointVerificationSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/client/TlsEndpointVerificationSpec.scala index f7ce292145..41bb35fe97 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/client/TlsEndpointVerificationSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/client/TlsEndpointVerificationSpec.scala @@ -98,7 +98,7 @@ class TlsEndpointVerificationSpec extends AkkaSpec(""" } val serverSideTls = Http().sslTlsStage(ExampleHttpContexts.exampleServerContext, Server) - val clientSideTls = Http().sslTlsStage(clientContext, Client, Some(hostname -> 8080)) + val clientSideTls = Http().sslTlsStage(clientContext, Client, Some(hostname → 8080)) val server = Http().serverLayer() diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/parsing/HttpHeaderParserSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/parsing/HttpHeaderParserSpec.scala index 87ae14ade1..4282538f0b 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/parsing/HttpHeaderParserSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/parsing/HttpHeaderParserSpec.scala @@ -33,11 +33,11 @@ class HttpHeaderParserSpec extends WordSpec with Matchers with BeforeAndAfterAll check { """nodes: 0/H, 0/e, 0/l, 0/l, 0/o, 1/Ω |branchData:\u0020 - |values: 'Hello""" -> parser.formatRawTrie + |values: 'Hello""" → parser.formatRawTrie } check { """-H-e-l-l-o- 'Hello - |""" -> parser.formatTrie + |""" → parser.formatTrie } } @@ -47,12 +47,12 @@ class HttpHeaderParserSpec extends WordSpec with Matchers with BeforeAndAfterAll check { """nodes: 0/H, 1/e, 0/l, 0/l, 0/o, 1/Ω, 0/a, 0/l, 0/l, 0/o, 2/Ω |branchData: 6/2/0 - |values: 'Hello, 'Hallo""" -> parser.formatRawTrie + |values: 'Hello, 'Hallo""" → parser.formatRawTrie } check { """ ┌─a-l-l-o- 'Hallo |-H-e-l-l-o- 'Hello - |""" -> parser.formatTrie + |""" → parser.formatTrie } } @@ -63,13 +63,13 @@ class HttpHeaderParserSpec extends WordSpec with Matchers with BeforeAndAfterAll check { """nodes: 2/H, 1/e, 0/l, 0/l, 0/o, 1/Ω, 0/a, 0/l, 0/l, 0/o, 2/Ω, 0/Y, 0/e, 0/a, 0/h, 3/Ω |branchData: 6/2/0, 0/1/11 - |values: 'Hello, 'Hallo, 'Yeah""" -> parser.formatRawTrie + |values: 'Hello, 'Hallo, 'Yeah""" → parser.formatRawTrie } check { """ ┌─a-l-l-o- 'Hallo |-H-e-l-l-o- 'Hello | └─Y-e-a-h- 'Yeah - |""" -> parser.formatTrie + |""" → parser.formatTrie } } @@ -81,14 +81,14 @@ class HttpHeaderParserSpec extends WordSpec with Matchers with BeforeAndAfterAll check { """nodes: 2/H, 1/e, 0/l, 0/l, 0/o, 1/Ω, 0/a, 0/l, 0/l, 0/o, 2/Ω, 0/Y, 0/e, 0/a, 0/h, 3/Ω, 0/o, 0/o, 4/Ω |branchData: 6/2/16, 0/1/11 - |values: 'Hello, 'Hallo, 'Yeah, 'Hoo""" -> parser.formatRawTrie + |values: 'Hello, 'Hallo, 'Yeah, 'Hoo""" → parser.formatRawTrie } check { """ ┌─a-l-l-o- 'Hallo |-H-e-l-l-o- 'Hello | | └─o-o- 'Hoo | └─Y-e-a-h- 'Yeah - |""" -> parser.formatTrie + |""" → parser.formatTrie } } @@ -103,7 +103,7 @@ class HttpHeaderParserSpec extends WordSpec with Matchers with BeforeAndAfterAll |-H-e-l-l-o- 'Hello | | └─o-o- 'Foo | └─Y-e-a-h- 'Yeah - |""" -> parser.formatTrie + |""" → parser.formatTrie } } @@ -142,7 +142,7 @@ class HttpHeaderParserSpec extends WordSpec with Matchers with BeforeAndAfterAll check { """ ┌─f-a-n-c-y---p-a-n-t-s-:-(Fancy-Pants)- -f-o-o-\r-\n- *Fancy-Pants: foo |-h-e-l-l-o-:- -b-o-b- 'Hello - |""" -> parser.formatTrie + |""" → parser.formatTrie } ixA shouldEqual ixB headerA shouldEqual RawHeader("Fancy-Pants", "foo") @@ -253,7 +253,7 @@ class HttpHeaderParserSpec extends WordSpec with Matchers with BeforeAndAfterAll if (parser.isEmpty) HttpHeaderParser.insertRemainingCharsAsNewNodes(parser, ByteString(line), value) else HttpHeaderParser.insert(parser, ByteString(line), value) - def parseLine(line: String) = parser.parseHeaderLine(ByteString(line))() -> parser.resultHeader + def parseLine(line: String) = parser.parseHeaderLine(ByteString(line))() → parser.resultHeader def parseAndCache(lineA: String)(lineB: String = lineA): HttpHeader = { val (ixA, headerA) = parseLine(lineA) diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/parsing/RequestParserSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/parsing/RequestParserSpec.scala index fad24c20e9..a20c8994b2 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/parsing/RequestParserSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/parsing/RequestParserSpec.scala @@ -152,7 +152,8 @@ class RequestParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { |Transfer-Encoding: foo, chunked, bar |Host: x | - |""" should parseTo(HttpRequest(PUT, "/", List(`Transfer-Encoding`(TransferEncodings.Extension("foo"), + |""" should parseTo(HttpRequest(PUT, "/", List(`Transfer-Encoding`( + TransferEncodings.Extension("foo"), TransferEncodings.chunked, TransferEncodings.Extension("bar")), Host("x")))) closeAfterResponseCompletion shouldEqual Seq(false) } @@ -195,8 +196,9 @@ class RequestParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { } "message chunk with and without extension" in new Test { - Seq(start + - """3 + Seq( + start + + """3 |abc |10;some=stuff;bla |0123456789ABCDEF @@ -220,7 +222,8 @@ class RequestParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { } "message end" in new Test { - Seq(start, + Seq( + start, """0 | |""") should generalMultiParseTo( @@ -229,14 +232,16 @@ class RequestParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { } "message end with extension and trailer" in new Test { - Seq(start, + Seq( + start, """000;nice=true |Foo: pip | apo |Bar: xyz | |""") should generalMultiParseTo( - Right(baseRequest.withEntity(Chunked(`application/pdf`, + Right(baseRequest.withEntity(Chunked( + `application/pdf`, source(LastChunk("nice=true", List(RawHeader("Foo", "pip apo"), RawHeader("Bar", "xyz")))))))) closeAfterResponseCompletion shouldEqual Seq(false) } @@ -265,7 +270,8 @@ class RequestParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { | |0 | - |""" should parseTo(HttpRequest(PATCH, "/data", List(`Transfer-Encoding`(TransferEncodings.Extension("fancy")), + |""" should parseTo(HttpRequest(PATCH, "/data", List( + `Transfer-Encoding`(TransferEncodings.Extension("fancy")), Host("ping")), HttpEntity.Chunked(`application/pdf`, source(LastChunk)))) closeAfterResponseCompletion shouldEqual Seq(false) } @@ -300,45 +306,55 @@ class RequestParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { HttpEntity.Chunked(`application/octet-stream`, source())) "an illegal char after chunk size" in new Test { - Seq(start, + Seq( + start, """15 ; - |""") should generalMultiParseTo(Right(baseRequest), + |""") should generalMultiParseTo( + Right(baseRequest), Left(EntityStreamError(ErrorInfo("Illegal character ' ' in chunk start")))) closeAfterResponseCompletion shouldEqual Seq(false) } "an illegal char in chunk size" in new Test { - Seq(start, "bla") should generalMultiParseTo(Right(baseRequest), + Seq(start, "bla") should generalMultiParseTo( + Right(baseRequest), Left(EntityStreamError(ErrorInfo("Illegal character 'l' in chunk start")))) closeAfterResponseCompletion shouldEqual Seq(false) } "too-long chunk extension" in new Test { - Seq(start, "3;" + ("x" * 257)) should generalMultiParseTo(Right(baseRequest), + Seq(start, "3;" + ("x" * 257)) should generalMultiParseTo( + Right(baseRequest), Left(EntityStreamError(ErrorInfo("HTTP chunk extension length exceeds configured limit of 256 characters")))) closeAfterResponseCompletion shouldEqual Seq(false) } "too-large chunk size" in new Test { - Seq(start, + Seq( + start, """1a2b3c4d5e - |""") should generalMultiParseTo(Right(baseRequest), + |""") should generalMultiParseTo( + Right(baseRequest), Left(EntityStreamError(ErrorInfo("HTTP chunk size exceeds the configured limit of 1048576 bytes")))) closeAfterResponseCompletion shouldEqual Seq(false) } "an illegal chunk termination" in new Test { - Seq(start, + Seq( + start, """3 - |abcde""") should generalMultiParseTo(Right(baseRequest), + |abcde""") should generalMultiParseTo( + Right(baseRequest), Left(EntityStreamError(ErrorInfo("Illegal chunk termination")))) closeAfterResponseCompletion shouldEqual Seq(false) } "an illegal header in the trailer" in new Test { - Seq(start, + Seq( + start, """0 - |F@oo: pip""") should generalMultiParseTo(Right(baseRequest), + |F@oo: pip""") should generalMultiParseTo( + Right(baseRequest), Left(EntityStreamError(ErrorInfo("Illegal character '@' in header name")))) closeAfterResponseCompletion shouldEqual Seq(false) } @@ -352,7 +368,8 @@ class RequestParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { "a too long HTTP method" in new Test { "ABCDEFGHIJKLMNOPQ " should - parseToError(BadRequest, + parseToError( + BadRequest, ErrorInfo( "Unsupported HTTP method", "HTTP method too long (started with 'ABCDEFGHIJKLMNOP'). Increase `akka.http.server.parsing.max-method-length` to support HTTP methods with more characters.")) @@ -363,18 +380,21 @@ class RequestParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { |Content-Length: 3 |Content-Length: 4 | - |foo""" should parseToError(BadRequest, + |foo""" should parseToError( + BadRequest, ErrorInfo("HTTP message must not contain more than one Content-Length header")) } "a too-long URI" in new Test { - "GET /23456789012345678901 HTTP/1.1" should parseToError(RequestUriTooLong, + "GET /23456789012345678901 HTTP/1.1" should parseToError( + RequestUriTooLong, ErrorInfo("URI length exceeds the configured limit of 20 characters")) } "HTTP version 1.2" in new Test { """GET / HTTP/1.2 - |""" should parseToError(HTTPVersionNotSupported, + |""" should parseToError( + HTTPVersionNotSupported, ErrorInfo("The server does not support the HTTP protocol version used in the request.")) } @@ -391,7 +411,8 @@ class RequestParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { "with a too-long header-value" in new Test { """|GET / HTTP/1.1 - |Fancy: 123456789012345678901234567890123""" should parseToError(BadRequest, + |Fancy: 123456789012345678901234567890123""" should parseToError( + BadRequest, ErrorInfo("HTTP header value exceeds the configured limit of 32 characters")) } @@ -475,8 +496,9 @@ class RequestParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { def generalRawMultiParseTo(expected: Either[RequestOutput, HttpRequest]*): Matcher[Seq[String]] = generalRawMultiParseTo(newParser, expected: _*) - def generalRawMultiParseTo(parser: HttpRequestParser, - expected: Either[RequestOutput, HttpRequest]*): Matcher[Seq[String]] = + def generalRawMultiParseTo( + parser: HttpRequestParser, + expected: Either[RequestOutput, HttpRequest]*): Matcher[Seq[String]] = equal(expected.map(strictEqualify)) .matcher[Seq[Either[RequestOutput, StrictEqualHttpRequest]]] compose multiParse(parser) diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/parsing/ResponseParserSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/parsing/ResponseParserSpec.scala index f8598af3c7..5ad34b5d38 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/parsing/ResponseParserSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/parsing/ResponseParserSpec.scala @@ -59,7 +59,8 @@ class ResponseParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { } "a response with a simple body" in new Test { - collectBlocking(rawParse(GET, + collectBlocking(rawParse( + GET, prep { """HTTP/1.1 200 Ok |Content-Length: 4 @@ -93,7 +94,8 @@ class ResponseParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { |Transfer-Encoding: foo, chunked, bar |Content-Length: 0 | - |""" should parseTo(HttpResponse(ServerOnTheMove, List(`Transfer-Encoding`(TransferEncodings.Extension("foo"), + |""" should parseTo(HttpResponse(ServerOnTheMove, List(`Transfer-Encoding`( + TransferEncodings.Extension("foo"), TransferEncodings.chunked, TransferEncodings.Extension("bar"))))) closeAfterResponseCompletion shouldEqual Seq(false) } @@ -158,8 +160,9 @@ class ResponseParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { } "message chunk with and without extension" in new Test { - Seq(start + - """3 + Seq( + start + + """3 |abc |10;some=stuff;bla |0123456789ABCDEF @@ -182,7 +185,8 @@ class ResponseParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { } "message end" in new Test { - Seq(start, + Seq( + start, """0 | |""") should generalMultiParseTo( @@ -191,14 +195,16 @@ class ResponseParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { } "message end with extension, trailer and remaining content" in new Test { - Seq(start, + Seq( + start, """000;nice=true |Foo: pip | apo |Bar: xyz | |HT""") should generalMultiParseTo( - Right(baseResponse.withEntity(Chunked(`application/pdf`, + Right(baseResponse.withEntity(Chunked( + `application/pdf`, source(LastChunk("nice=true", List(RawHeader("Foo", "pip apo"), RawHeader("Bar", "xyz"))))))), Left(MessageStartError(400: StatusCode, ErrorInfo("Illegal HTTP message start")))) closeAfterResponseCompletion shouldEqual Seq(false) @@ -210,7 +216,8 @@ class ResponseParserSpec extends FreeSpec with Matchers with BeforeAndAfterAll { |Cont""", """ent-Type: application/pdf | |""") should generalMultiParseTo( - Right(HttpResponse(headers = List(`Transfer-Encoding`(TransferEncodings.Extension("fancy"))), + Right(HttpResponse( + headers = List(`Transfer-Encoding`(TransferEncodings.Extension("fancy"))), entity = HttpEntity.Chunked(`application/pdf`, source()))), Left(EntityStreamError(ErrorInfo("Entity stream truncation")))) closeAfterResponseCompletion shouldEqual Seq(false) diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/rendering/RequestRendererSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/rendering/RequestRendererSpec.scala index 036e704e1d..205481a6c8 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/rendering/RequestRendererSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/rendering/RequestRendererSpec.scala @@ -152,7 +152,8 @@ class RequestRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll } "POST request with body" in new TestSetup() { - HttpRequest(POST, "/abc/xyz", entity = Chunked(ContentTypes.`text/plain(UTF-8)`, + HttpRequest(POST, "/abc/xyz", entity = Chunked( + ContentTypes.`text/plain(UTF-8)`, source("XXXX", "ABCDEFGHIJKLMNOPQRSTUVWXYZ"))) should renderTo { """POST /abc/xyz HTTP/1.1 |Host: test.com:8080 @@ -177,7 +178,8 @@ class RequestRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll ChunkStreamPart("ABCDEFGHIJKLMNOPQRSTUVWXYZ"), LastChunk) - HttpRequest(POST, "/abc/xyz", entity = Chunked(ContentTypes.`text/plain(UTF-8)`, + HttpRequest(POST, "/abc/xyz", entity = Chunked( + ContentTypes.`text/plain(UTF-8)`, Source(chunks))) should renderTo { """POST /abc/xyz HTTP/1.1 |Host: test.com:8080 @@ -203,7 +205,8 @@ class RequestRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll LastChunk, LastChunk) - HttpRequest(POST, "/abc/xyz", entity = Chunked(ContentTypes.`text/plain(UTF-8)`, + HttpRequest(POST, "/abc/xyz", entity = Chunked( + ContentTypes.`text/plain(UTF-8)`, Source(chunks))) should renderTo { """POST /abc/xyz HTTP/1.1 |Host: test.com:8080 @@ -317,8 +320,9 @@ class RequestRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll override def afterAll() = system.terminate() - class TestSetup(val userAgent: Option[`User-Agent`] = Some(`User-Agent`("akka-http/1.0.0")), - serverAddress: InetSocketAddress = new InetSocketAddress("test.com", 8080)) + class TestSetup( + val userAgent: Option[`User-Agent`] = Some(`User-Agent`("akka-http/1.0.0")), + serverAddress: InetSocketAddress = new InetSocketAddress("test.com", 8080)) extends HttpRequestRendererFactory(userAgent, requestHeaderSizeHint = 64, NoLogging) { def awaitAtMost: FiniteDuration = 3.seconds diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/rendering/ResponseRendererSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/rendering/ResponseRendererSpec.scala index 705ad921d4..951d92a4e8 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/rendering/ResponseRendererSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/rendering/ResponseRendererSpec.scala @@ -114,7 +114,8 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll requestMethod = HttpMethods.HEAD, response = HttpResponse( headers = List(Age(30), Connection("Keep-Alive")), - entity = HttpEntity.CloseDelimited(ContentTypes.`text/plain(UTF-8)`, + entity = HttpEntity.CloseDelimited( + ContentTypes.`text/plain(UTF-8)`, Source.single(ByteString("Foo"))))) should renderTo( """HTTP/1.1 200 OK |Age: 30 @@ -130,7 +131,8 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll requestMethod = HttpMethods.HEAD, response = HttpResponse( headers = List(Age(30), Connection("Keep-Alive")), - entity = HttpEntity.Chunked(ContentTypes.`text/plain(UTF-8)`, + entity = HttpEntity.Chunked( + ContentTypes.`text/plain(UTF-8)`, Source.single(HttpEntity.Chunk(ByteString("Foo")))))) should renderTo( """HTTP/1.1 200 OK |Age: 30 @@ -187,7 +189,8 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll } "status 200 and a custom Transfer-Encoding header" in new TestSetup() { - HttpResponse(headers = List(`Transfer-Encoding`(TransferEncodings.Extension("fancy"))), + HttpResponse( + headers = List(`Transfer-Encoding`(TransferEncodings.Extension("fancy"))), entity = "All good") should renderTo { """HTTP/1.1 200 OK |Transfer-Encoding: fancy @@ -232,7 +235,8 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll "a response with a CloseDelimited body" - { "without data" in new TestSetup() { ResponseRenderingContext( - HttpResponse(200, entity = CloseDelimited(ContentTypes.`application/json`, + HttpResponse(200, entity = CloseDelimited( + ContentTypes.`application/json`, source(ByteString.empty)))) should renderTo( """HTTP/1.1 200 OK |Server: akka-http/1.0.0 @@ -244,7 +248,8 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll } "consisting of two parts" in new TestSetup() { ResponseRenderingContext( - HttpResponse(200, entity = CloseDelimited(ContentTypes.`application/json`, + HttpResponse(200, entity = CloseDelimited( + ContentTypes.`application/json`, source(ByteString("abc"), ByteString("defg"))))) should renderTo( """HTTP/1.1 200 OK |Server: akka-http/1.0.0 @@ -283,7 +288,8 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll } "with one chunk and no explicit LastChunk" in new TestSetup() { - HttpResponse(entity = Chunked(ContentTypes.`text/plain(UTF-8)`, + HttpResponse(entity = Chunked( + ContentTypes.`text/plain(UTF-8)`, source("Yahoooo"))) should renderTo { """HTTP/1.1 200 OK |Server: akka-http/1.0.0 @@ -300,8 +306,10 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll } "with one chunk and an explicit LastChunk" in new TestSetup() { - HttpResponse(entity = Chunked(ContentTypes.`text/plain(UTF-8)`, - source(Chunk(ByteString("body123"), """key=value;another="tl;dr""""), + HttpResponse(entity = Chunked( + ContentTypes.`text/plain(UTF-8)`, + source( + Chunk(ByteString("body123"), """key=value;another="tl;dr""""), LastChunk("foo=bar", List(Age(30), RawHeader("Cache-Control", "public")))))) should renderTo { """HTTP/1.1 200 OK |Server: akka-http/1.0.0 @@ -320,8 +328,10 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll } "with one chunk and and extra LastChunks at the end (which should be ignored)" in new TestSetup() { - HttpResponse(entity = Chunked(ContentTypes.`text/plain(UTF-8)`, - source(Chunk(ByteString("body123"), """key=value;another="tl;dr""""), + HttpResponse(entity = Chunked( + ContentTypes.`text/plain(UTF-8)`, + source( + Chunk(ByteString("body123"), """key=value;another="tl;dr""""), LastChunk("foo=bar", List(Age(30), RawHeader("Cache-Control", "public"))), LastChunk))) should renderTo { """HTTP/1.1 200 OK |Server: akka-http/1.0.0 @@ -340,7 +350,8 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll } "with a custom Transfer-Encoding header" in new TestSetup() { - HttpResponse(headers = List(`Transfer-Encoding`(TransferEncodings.Extension("fancy"))), + HttpResponse( + headers = List(`Transfer-Encoding`(TransferEncodings.Extension("fancy"))), entity = Chunked(ContentTypes.`text/plain(UTF-8)`, source("Yahoooo"))) should renderTo { """HTTP/1.1 200 OK |Transfer-Encoding: fancy, chunked @@ -361,7 +372,8 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll "with two chunks" in new TestSetup() { ResponseRenderingContext( requestProtocol = HttpProtocols.`HTTP/1.0`, - response = HttpResponse(entity = Chunked(ContentTypes.`application/json`, + response = HttpResponse(entity = Chunked( + ContentTypes.`application/json`, source(Chunk("abc"), Chunk("defg"))))) should renderTo( """HTTP/1.1 200 OK |Server: akka-http/1.0.0 @@ -375,8 +387,10 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll "with one chunk and an explicit LastChunk" in new TestSetup() { ResponseRenderingContext( requestProtocol = HttpProtocols.`HTTP/1.0`, - response = HttpResponse(entity = Chunked(ContentTypes.`text/plain(UTF-8)`, - source(Chunk(ByteString("body123"), """key=value;another="tl;dr""""), + response = HttpResponse(entity = Chunked( + ContentTypes.`text/plain(UTF-8)`, + source( + Chunk(ByteString("body123"), """key=value;another="tl;dr""""), LastChunk("foo=bar", List(Age(30), RawHeader("Cache-Control", "public"))))))) should renderTo( """HTTP/1.1 200 OK |Server: akka-http/1.0.0 @@ -559,9 +573,10 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll forAll(table)((reqProto, headReq, reqCH, resProto, resCH, resCD, renCH, close) ⇒ ResponseRenderingContext( response = HttpResponse(200, headers = resCH.toList, - entity = if (resCD) HttpEntity.CloseDelimited(ContentTypes.`text/plain(UTF-8)`, - Source.single(ByteString("ENTITY"))) - else HttpEntity("ENTITY"), protocol = resProto), + entity = if (resCD) HttpEntity.CloseDelimited( + ContentTypes.`text/plain(UTF-8)`, + Source.single(ByteString("ENTITY"))) + else HttpEntity("ENTITY"), protocol = resProto), requestMethod = if (headReq) HttpMethods.HEAD else HttpMethods.GET, requestProtocol = reqProto, closeRequested = HttpMessage.connectionCloseExpected(reqProto, reqCH)) should renderTo( @@ -588,7 +603,7 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll renderToImpl(expected, checkClose = Some(close)) def renderToImpl(expected: String, checkClose: Option[Boolean]): Matcher[ResponseRenderingContext] = - equal(expected.stripMarginWithNewline("\r\n") -> checkClose).matcher[(String, Option[Boolean])] compose { ctx ⇒ + equal(expected.stripMarginWithNewline("\r\n") → checkClose).matcher[(String, Option[Boolean])] compose { ctx ⇒ val (wasCompletedFuture, resultFuture) = (Source.single(ctx) ++ Source.maybe[ResponseRenderingContext]) // never send upstream completion .via(renderer.named("renderer")) @@ -612,7 +627,7 @@ class ResponseRendererSpec extends FreeSpec with Matchers with BeforeAndAfterAll } } - Await.result(resultFuture, awaitAtMost).reduceLeft(_ ++ _).utf8String -> wasCompleted + Await.result(resultFuture, awaitAtMost).reduceLeft(_ ++ _).utf8String → wasCompleted } override def currentTimeMillis() = DateTime(2011, 8, 25, 9, 10, 29).clicks // provide a stable date for testing diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/server/HttpServerSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/server/HttpServerSpec.scala index 9891a70c0c..b322a88dbb 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/server/HttpServerSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/server/HttpServerSpec.scala @@ -377,7 +377,7 @@ class HttpServerSpec extends AkkaSpec( }) "proceed to next request once previous request's entity has been drained" in assertAllStagesStopped(new TestSetup { - def twice(action: => Unit): Unit = { action; action } + def twice(action: ⇒ Unit): Unit = { action; action } twice { send("""POST / HTTP/1.1 @@ -977,7 +977,7 @@ class HttpServerSpec extends AkkaSpec( .thrownBy(entity.dataBytes.runFold(ByteString.empty)(_ ++ _).awaitResult(100.millis)) .getCause error shouldEqual EntityStreamSizeException(limit, Some(actualSize)) - error.getMessage should include ("exceeded content length limit") + error.getMessage should include("exceeded content length limit") responses.expectRequest() responses.sendError(error.asInstanceOf[Exception]) @@ -1000,7 +1000,7 @@ class HttpServerSpec extends AkkaSpec( .thrownBy(entity.dataBytes.runFold(ByteString.empty)(_ ++ _).awaitResult(100.millis)) .getCause error shouldEqual EntityStreamSizeException(limit, None) - error.getMessage should include ("exceeded content length limit") + error.getMessage should include("exceeded content length limit") responses.expectRequest() responses.sendError(error.asInstanceOf[Exception]) diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/server/HttpServerTestSetupBase.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/server/HttpServerTestSetupBase.scala index bf85d4c6d7..8758a9e2ab 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/server/HttpServerTestSetupBase.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/server/HttpServerTestSetupBase.scala @@ -34,17 +34,16 @@ abstract class HttpServerTestSetupBase { val netIn = TestPublisher.probe[ByteString]() val netOut = ByteStringSinkProbe() - RunnableGraph.fromGraph(GraphDSL.create(HttpServerBluePrint(settings, remoteAddress = remoteAddress, log = NoLogging)) { implicit b ⇒ - server ⇒ - import GraphDSL.Implicits._ - Source.fromPublisher(netIn) ~> Flow[ByteString].map(SessionBytes(null, _)) ~> server.in2 - server.out1 ~> Flow[SslTlsOutbound].collect { case SendBytes(x) ⇒ x }.buffer(1, OverflowStrategy.backpressure) ~> netOut.sink - server.out2 ~> Sink.fromSubscriber(requests) - Source.fromPublisher(responses) ~> server.in1 - ClosedShape + RunnableGraph.fromGraph(GraphDSL.create(HttpServerBluePrint(settings, remoteAddress = remoteAddress, log = NoLogging)) { implicit b ⇒ server ⇒ + import GraphDSL.Implicits._ + Source.fromPublisher(netIn) ~> Flow[ByteString].map(SessionBytes(null, _)) ~> server.in2 + server.out1 ~> Flow[SslTlsOutbound].collect { case SendBytes(x) ⇒ x }.buffer(1, OverflowStrategy.backpressure) ~> netOut.sink + server.out2 ~> Sink.fromSubscriber(requests) + Source.fromPublisher(responses) ~> server.in1 + ClosedShape }).run() - netIn -> netOut + netIn → netOut } def expectResponseWithWipedDate(expected: String): Unit = { diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/ws/MessageSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/ws/MessageSpec.scala index b3475a5cbf..2b87ddfc18 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/ws/MessageSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/ws/MessageSpec.scala @@ -23,7 +23,7 @@ class MessageSpec extends FreeSpec with Matchers with WithMaterializerSpec { val InvalidUtf8TwoByteSequence: ByteString = ByteString( (128 + 64).toByte, // start two byte sequence 0 // but don't finish it - ) + ) "The WebSocket implementation should" - { "collect messages from frames" - { diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSClientAutobahnTest.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSClientAutobahnTest.scala index 5f68cafeec..d249b73758 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSClientAutobahnTest.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSClientAutobahnTest.scala @@ -90,7 +90,7 @@ object WSClientAutobahnTest extends App { val res = getCaseCount().flatMap { count ⇒ println(s"Retrieving case info for $count cases...") - Future.traverse(1 to count)(getCaseInfo).map(_.map(e ⇒ e.caseInfo.id -> e).toMap) + Future.traverse(1 to count)(getCaseInfo).map(_.map(e ⇒ e.caseInfo.id → e).toMap) } res.foreach { res ⇒ println(s"Received info for ${res.size} cases") diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSServerAutobahnTest.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSServerAutobahnTest.scala index 229623fec1..cf5bf0196b 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSServerAutobahnTest.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSServerAutobahnTest.scala @@ -27,14 +27,15 @@ object WSServerAutobahnTest extends App { val mode = props.getOrElse("akka.ws-mode", "read") // read or sleep try { - val binding = Http().bindAndHandleSync({ - case req @ HttpRequest(GET, Uri.Path("/"), _, _, _) if req.header[UpgradeToWebSocket].isDefined ⇒ - req.header[UpgradeToWebSocket] match { - case Some(upgrade) ⇒ upgrade.handleMessages(echoWebSocketService) // needed for running the autobahn test suite - case None ⇒ HttpResponse(400, entity = "Not a valid websocket request!") - } - case _: HttpRequest ⇒ HttpResponse(404, entity = "Unknown resource!") - }, + val binding = Http().bindAndHandleSync( + { + case req @ HttpRequest(GET, Uri.Path("/"), _, _, _) if req.header[UpgradeToWebSocket].isDefined ⇒ + req.header[UpgradeToWebSocket] match { + case Some(upgrade) ⇒ upgrade.handleMessages(echoWebSocketService) // needed for running the autobahn test suite + case None ⇒ HttpResponse(400, entity = "Not a valid websocket request!") + } + case _: HttpRequest ⇒ HttpResponse(404, entity = "Unknown resource!") + }, interface = host, // adapt to your docker host IP address if necessary port = port) diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSTestSetupBase.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSTestSetupBase.scala index 72a27b31e5..9626741bbe 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSTestSetupBase.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSTestSetupBase.scala @@ -16,13 +16,14 @@ trait WSTestSetupBase extends Matchers { def expectBytes(length: Int): ByteString def expectBytes(bytes: ByteString): Unit - def sendWSFrame(opcode: Opcode, - data: ByteString, - fin: Boolean, - mask: Boolean = false, - rsv1: Boolean = false, - rsv2: Boolean = false, - rsv3: Boolean = false): Unit = { + def sendWSFrame( + opcode: Opcode, + data: ByteString, + fin: Boolean, + mask: Boolean = false, + rsv1: Boolean = false, + rsv2: Boolean = false, + rsv3: Boolean = false): Unit = { val (theMask, theData) = if (mask) { val m = Random.nextInt() @@ -34,13 +35,14 @@ trait WSTestSetupBase extends Matchers { def sendWSCloseFrame(closeCode: Int, mask: Boolean = false): Unit = send(closeFrame(closeCode, mask)) - def expectWSFrame(opcode: Opcode, - data: ByteString, - fin: Boolean, - mask: Option[Int] = None, - rsv1: Boolean = false, - rsv2: Boolean = false, - rsv3: Boolean = false): Unit = + def expectWSFrame( + opcode: Opcode, + data: ByteString, + fin: Boolean, + mask: Option[Int] = None, + rsv1: Boolean = false, + rsv2: Boolean = false, + rsv3: Boolean = false): Unit = expectBytes(frameHeader(opcode, data.length, fin, mask, rsv1, rsv2, rsv3) ++ data) def expectWSCloseFrame(closeCode: Int, mask: Boolean = false): Unit = diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSTestUtils.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSTestUtils.scala index f608bf5ff6..3768c13755 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSTestUtils.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WSTestUtils.scala @@ -13,11 +13,11 @@ object WSTestUtils { def frameHeader( opcode: Opcode, length: Long, - fin: Boolean, - mask: Option[Int] = None, - rsv1: Boolean = false, - rsv2: Boolean = false, - rsv3: Boolean = false): ByteString = { + fin: Boolean, + mask: Option[Int] = None, + rsv1: Boolean = false, + rsv2: Boolean = false, + rsv3: Boolean = false): ByteString = { def set(should: Boolean, mask: Int): Int = if (should) mask else 0 diff --git a/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WebSocketClientSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WebSocketClientSpec.scala index 2c0c4ed10e..8b9d1107e8 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WebSocketClientSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/engine/ws/WebSocketClientSpec.scala @@ -312,13 +312,12 @@ class WebSocketClientSpec extends FreeSpec with Matchers with WithMaterializerSp val netIn = TestPublisher.probe[ByteString]() val graph = - RunnableGraph.fromGraph(GraphDSL.create(clientLayer) { implicit b ⇒ - client ⇒ - import GraphDSL.Implicits._ - Source.fromPublisher(netIn) ~> Flow[ByteString].map(SessionBytes(null, _)) ~> client.in2 - client.out1 ~> Flow[SslTlsOutbound].collect { case SendBytes(x) ⇒ x } ~> netOut.sink - client.out2 ~> clientImplementation ~> client.in1 - ClosedShape + RunnableGraph.fromGraph(GraphDSL.create(clientLayer) { implicit b ⇒ client ⇒ + import GraphDSL.Implicits._ + Source.fromPublisher(netIn) ~> Flow[ByteString].map(SessionBytes(null, _)) ~> client.in2 + client.out1 ~> Flow[SslTlsOutbound].collect { case SendBytes(x) ⇒ x } ~> netOut.sink + client.out2 ~> clientImplementation ~> client.in1 + ClosedShape }) val response = graph.run() diff --git a/akka-http-core/src/test/scala/akka/http/impl/model/parser/HttpHeaderSpec.scala b/akka-http-core/src/test/scala/akka/http/impl/model/parser/HttpHeaderSpec.scala index 51e213a5de..f7e02d5534 100644 --- a/akka-http-core/src/test/scala/akka/http/impl/model/parser/HttpHeaderSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/impl/model/parser/HttpHeaderSpec.scala @@ -37,11 +37,12 @@ class HttpHeaderSpec extends FreeSpec with Matchers { "Accept: application/vnd.spray" =!= Accept(`application/vnd.spray`) "Accept: */*, text/*; foo=bar, custom/custom; bar=\"b>az\"" =!= - Accept(`*/*`, - MediaRange.custom("text", Map("foo" -> "bar")), - MediaType.customBinary("custom", "custom", MediaType.Compressible, params = Map("bar" -> "b>az"))) + Accept( + `*/*`, + MediaRange.custom("text", Map("foo" → "bar")), + MediaType.customBinary("custom", "custom", MediaType.Compressible, params = Map("bar" → "b>az"))) "Accept: application/*+xml; version=2" =!= - Accept(MediaType.customBinary("application", "*+xml", MediaType.Compressible, params = Map("version" -> "2"))) + Accept(MediaType.customBinary("application", "*+xml", MediaType.Compressible, params = Map("version" → "2"))) } "Accept-Charset" in { @@ -135,20 +136,21 @@ class HttpHeaderSpec extends FreeSpec with Matchers { Authorization(BasicHttpCredentials("Aladdin", "open sesame")).renderedTo( "Basic QWxhZGRpbjpvcGVuIHNlc2FtZQ==") """Authorization: Fancy yes="n:o", nonce=42""" =!= - Authorization(GenericHttpCredentials("Fancy", Map("yes" -> "n:o", "nonce" -> "42"))).renderedTo( + Authorization(GenericHttpCredentials("Fancy", Map("yes" → "n:o", "nonce" → "42"))).renderedTo( """Fancy yes="n:o",nonce=42""") """Authorization: Fancy yes=no,nonce="4\\2"""" =!= - Authorization(GenericHttpCredentials("Fancy", Map("yes" -> "no", "nonce" -> """4\2"""))) + Authorization(GenericHttpCredentials("Fancy", Map("yes" → "no", "nonce" → """4\2"""))) "Authorization: Basic Qm9iOg==" =!= Authorization(BasicHttpCredentials("Bob", "")) """Authorization: Digest name=Bob""" =!= - Authorization(GenericHttpCredentials("Digest", Map("name" -> "Bob"))) + Authorization(GenericHttpCredentials("Digest", Map("name" → "Bob"))) """Authorization: Bearer mF_9.B5f-4.1JqM/""" =!= Authorization(OAuth2BearerToken("mF_9.B5f-4.1JqM/")) "Authorization: NoParamScheme" =!= Authorization(GenericHttpCredentials("NoParamScheme", Map.empty[String, String])) "Authorization: QVFJQzV3TTJMWTRTZmN3Zk=" =!= - ErrorInfo("Illegal HTTP header 'Authorization': Invalid input '=', expected auth-param, OWS, token68, 'EOI' or tchar (line 1, column 23)", + ErrorInfo( + "Illegal HTTP header 'Authorization': Invalid input '=', expected auth-param, OWS, token68, 'EOI' or tchar (line 1, column 23)", """QVFJQzV3TTJMWTRTZmN3Zk= | ^""".stripMarginWithNewline("\n")) } @@ -179,7 +181,7 @@ class HttpHeaderSpec extends FreeSpec with Matchers { "Content-Disposition" in { "Content-Disposition: form-data" =!= `Content-Disposition`(ContentDispositionTypes.`form-data`) "Content-Disposition: attachment; name=field1; filename=\"file/txt\"" =!= - `Content-Disposition`(ContentDispositionTypes.attachment, Map("name" -> "field1", "filename" -> "file/txt")) + `Content-Disposition`(ContentDispositionTypes.attachment, Map("name" → "field1", "filename" → "file/txt")) } "Content-Encoding" in { @@ -201,7 +203,7 @@ class HttpHeaderSpec extends FreeSpec with Matchers { "Content-Type: text/plain; charset=utf8" =!= `Content-Type`(ContentType(`text/plain`, `UTF-8`)).renderedTo("text/plain; charset=UTF-8") "Content-Type: text/xml2; version=3; charset=windows-1252" =!= - `Content-Type`(MediaType.customWithOpenCharset("text", "xml2", params = Map("version" -> "3")) + `Content-Type`(MediaType.customWithOpenCharset("text", "xml2", params = Map("version" → "3")) withCharset HttpCharsets.getForKey("windows-1252").get) "Content-Type: text/plain; charset=fancy-pants" =!= `Content-Type`(`text/plain` withCharset HttpCharset.custom("fancy-pants")) @@ -224,17 +226,17 @@ class HttpHeaderSpec extends FreeSpec with Matchers { } "Cookie (RFC 6265)" in { - "Cookie: SID=31d4d96e407aad42" =!= Cookie("SID" -> "31d4d96e407aad42") - "Cookie: SID=31d4d96e407aad42; lang=en>US" =!= Cookie("SID" -> "31d4d96e407aad42", "lang" -> "en>US") - "Cookie: a=1; b=2" =!= Cookie("a" -> "1", "b" -> "2") - "Cookie: a=1;b=2" =!= Cookie("a" -> "1", "b" -> "2").renderedTo("a=1; b=2") - "Cookie: a=1 ;b=2" =!= Cookie("a" -> "1", "b" -> "2").renderedTo("a=1; b=2") + "Cookie: SID=31d4d96e407aad42" =!= Cookie("SID" → "31d4d96e407aad42") + "Cookie: SID=31d4d96e407aad42; lang=en>US" =!= Cookie("SID" → "31d4d96e407aad42", "lang" → "en>US") + "Cookie: a=1; b=2" =!= Cookie("a" → "1", "b" → "2") + "Cookie: a=1;b=2" =!= Cookie("a" → "1", "b" → "2").renderedTo("a=1; b=2") + "Cookie: a=1 ;b=2" =!= Cookie("a" → "1", "b" → "2").renderedTo("a=1; b=2") - "Cookie: z=0;a=1,b=2" =!= Cookie("z" -> "0").renderedTo("z=0") - """Cookie: a=1;b="test"""" =!= Cookie("a" -> "1", "b" -> "test").renderedTo("a=1; b=test") + "Cookie: z=0;a=1,b=2" =!= Cookie("z" → "0").renderedTo("z=0") + """Cookie: a=1;b="test"""" =!= Cookie("a" → "1", "b" → "test").renderedTo("a=1; b=test") - "Cookie: a=1; b=f\"d\"c\"; c=xyz" =!= Cookie("a" -> "1", "c" -> "xyz").renderedTo("a=1; c=xyz") - "Cookie: a=1; b=ä; c=d" =!= Cookie("a" -> "1", "c" -> "d").renderedTo("a=1; c=d") + "Cookie: a=1; b=f\"d\"c\"; c=xyz" =!= Cookie("a" → "1", "c" → "xyz").renderedTo("a=1; c=xyz") + "Cookie: a=1; b=ä; c=d" =!= Cookie("a" → "1", "c" → "d").renderedTo("a=1; c=d") "Cookie: a=1,2" =!= ErrorInfo( @@ -243,16 +245,16 @@ class HttpHeaderSpec extends FreeSpec with Matchers { } "Cookie (Raw)" in { - "Cookie: SID=31d4d96e407aad42" =!= Cookie("SID" -> "31d4d96e407aad42").withCookieParsingMode(CookieParsingMode.Raw) - "Cookie: SID=31d4d96e407aad42; lang=en>US" =!= Cookie("SID" -> "31d4d96e407aad42", "lang" -> "en>US").withCookieParsingMode(CookieParsingMode.Raw) - "Cookie: a=1; b=2" =!= Cookie("a" -> "1", "b" -> "2").withCookieParsingMode(CookieParsingMode.Raw) - "Cookie: a=1;b=2" =!= Cookie("a" -> "1", "b" -> "2").renderedTo("a=1; b=2").withCookieParsingMode(CookieParsingMode.Raw) - "Cookie: a=1 ;b=2" =!= Cookie(List(HttpCookiePair.raw("a" -> "1 "), HttpCookiePair("b" -> "2"))).renderedTo("a=1 ; b=2").withCookieParsingMode(CookieParsingMode.Raw) + "Cookie: SID=31d4d96e407aad42" =!= Cookie("SID" → "31d4d96e407aad42").withCookieParsingMode(CookieParsingMode.Raw) + "Cookie: SID=31d4d96e407aad42; lang=en>US" =!= Cookie("SID" → "31d4d96e407aad42", "lang" → "en>US").withCookieParsingMode(CookieParsingMode.Raw) + "Cookie: a=1; b=2" =!= Cookie("a" → "1", "b" → "2").withCookieParsingMode(CookieParsingMode.Raw) + "Cookie: a=1;b=2" =!= Cookie("a" → "1", "b" → "2").renderedTo("a=1; b=2").withCookieParsingMode(CookieParsingMode.Raw) + "Cookie: a=1 ;b=2" =!= Cookie(List(HttpCookiePair.raw("a" → "1 "), HttpCookiePair("b" → "2"))).renderedTo("a=1 ; b=2").withCookieParsingMode(CookieParsingMode.Raw) - "Cookie: z=0; a=1,b=2" =!= Cookie(List(HttpCookiePair("z" -> "0"), HttpCookiePair.raw("a" -> "1,b=2"))).withCookieParsingMode(CookieParsingMode.Raw) - """Cookie: a=1;b="test"""" =!= Cookie(List(HttpCookiePair("a" -> "1"), HttpCookiePair.raw("b" -> "\"test\""))).renderedTo("a=1; b=\"test\"").withCookieParsingMode(CookieParsingMode.Raw) - "Cookie: a=1; b=f\"d\"c\"; c=xyz" =!= Cookie(List(HttpCookiePair("a" -> "1"), HttpCookiePair.raw("b" -> "f\"d\"c\""), HttpCookiePair("c" -> "xyz"))).withCookieParsingMode(CookieParsingMode.Raw) - "Cookie: a=1; b=ä; c=d" =!= Cookie(List(HttpCookiePair("a" -> "1"), HttpCookiePair.raw("b" -> "ä"), HttpCookiePair("c" -> "d"))).withCookieParsingMode(CookieParsingMode.Raw) + "Cookie: z=0; a=1,b=2" =!= Cookie(List(HttpCookiePair("z" → "0"), HttpCookiePair.raw("a" → "1,b=2"))).withCookieParsingMode(CookieParsingMode.Raw) + """Cookie: a=1;b="test"""" =!= Cookie(List(HttpCookiePair("a" → "1"), HttpCookiePair.raw("b" → "\"test\""))).renderedTo("a=1; b=\"test\"").withCookieParsingMode(CookieParsingMode.Raw) + "Cookie: a=1; b=f\"d\"c\"; c=xyz" =!= Cookie(List(HttpCookiePair("a" → "1"), HttpCookiePair.raw("b" → "f\"d\"c\""), HttpCookiePair("c" → "xyz"))).withCookieParsingMode(CookieParsingMode.Raw) + "Cookie: a=1; b=ä; c=d" =!= Cookie(List(HttpCookiePair("a" → "1"), HttpCookiePair.raw("b" → "ä"), HttpCookiePair("c" → "d"))).withCookieParsingMode(CookieParsingMode.Raw) } "Date" in { @@ -356,7 +358,8 @@ class HttpHeaderSpec extends FreeSpec with Matchers { """Link: ; rel="http://example.net/foo"""" =!= Link(Uri("/"), LinkParams.rel("http://example.net/foo")) .renderedTo("; rel=http://example.net/foo") - """Link: ; rel="start http://example.net/relation/other"""" =!= Link(Uri("http://example.org/"), + """Link: ; rel="start http://example.net/relation/other"""" =!= Link( + Uri("http://example.org/"), LinkParams.rel("start http://example.net/relation/other")) // only one 'rel=' is allowed, http://tools.ietf.org/html/rfc5988#section-5.3 requires any subsequent ones to be skipped @@ -370,18 +373,19 @@ class HttpHeaderSpec extends FreeSpec with Matchers { "Proxy-Authenticate" in { "Proxy-Authenticate: Basic realm=\"WallyWorld\",attr=\"val>ue\", Fancy realm=\"yeah\"" =!= - `Proxy-Authenticate`(HttpChallenge("Basic", "WallyWorld", Map("attr" -> "val>ue")), HttpChallenge("Fancy", "yeah")) + `Proxy-Authenticate`(HttpChallenge("Basic", "WallyWorld", Map("attr" → "val>ue")), HttpChallenge("Fancy", "yeah")) } "Proxy-Authorization" in { """Proxy-Authorization: Fancy yes=no,nonce="4\\2"""" =!= - `Proxy-Authorization`(GenericHttpCredentials("Fancy", Map("yes" -> "no", "nonce" -> """4\2"""))) + `Proxy-Authorization`(GenericHttpCredentials("Fancy", Map("yes" → "no", "nonce" → """4\2"""))) } "Referer" in { "Referer: https://spray.io/secure" =!= Referer(Uri("https://spray.io/secure")) "Referer: /en-us/default.aspx?foo=bar" =!= Referer(Uri("/en-us/default.aspx?foo=bar")) - "Referer: https://akka.io/#sec" =!= ErrorInfo("Illegal HTTP header 'Referer': requirement failed", + "Referer: https://akka.io/#sec" =!= ErrorInfo( + "Illegal HTTP header 'Referer': requirement failed", "Referer header URI must not contain a fragment") } @@ -416,19 +420,19 @@ class HttpHeaderSpec extends FreeSpec with Matchers { "Sec-WebSocket-Extensions: abc, def" =!= `Sec-WebSocket-Extensions`(Vector(WebSocketExtension("abc"), WebSocketExtension("def"))) "Sec-WebSocket-Extensions: abc; param=2; use_y, def" =!= - `Sec-WebSocket-Extensions`(Vector(WebSocketExtension("abc", Map("param" -> "2", "use_y" -> "")), WebSocketExtension("def"))) + `Sec-WebSocket-Extensions`(Vector(WebSocketExtension("abc", Map("param" → "2", "use_y" → "")), WebSocketExtension("def"))) "Sec-WebSocket-Extensions: abc; param=\",xyz\", def" =!= - `Sec-WebSocket-Extensions`(Vector(WebSocketExtension("abc", Map("param" -> ",xyz")), WebSocketExtension("def"))) + `Sec-WebSocket-Extensions`(Vector(WebSocketExtension("abc", Map("param" → ",xyz")), WebSocketExtension("def"))) // real examples from https://tools.ietf.org/html/draft-ietf-hybi-permessage-compression-19 "Sec-WebSocket-Extensions: permessage-deflate" =!= `Sec-WebSocket-Extensions`(Vector(WebSocketExtension("permessage-deflate"))) "Sec-WebSocket-Extensions: permessage-deflate; client_max_window_bits; server_max_window_bits=10" =!= - `Sec-WebSocket-Extensions`(Vector(WebSocketExtension("permessage-deflate", Map("client_max_window_bits" -> "", "server_max_window_bits" -> "10")))) + `Sec-WebSocket-Extensions`(Vector(WebSocketExtension("permessage-deflate", Map("client_max_window_bits" → "", "server_max_window_bits" → "10")))) "Sec-WebSocket-Extensions: permessage-deflate; client_max_window_bits; server_max_window_bits=10, permessage-deflate; client_max_window_bits" =!= `Sec-WebSocket-Extensions`(Vector( - WebSocketExtension("permessage-deflate", Map("client_max_window_bits" -> "", "server_max_window_bits" -> "10")), - WebSocketExtension("permessage-deflate", Map("client_max_window_bits" -> "")))) + WebSocketExtension("permessage-deflate", Map("client_max_window_bits" → "", "server_max_window_bits" → "10")), + WebSocketExtension("permessage-deflate", Map("client_max_window_bits" → "")))) } "Sec-WebSocket-Key" in { "Sec-WebSocket-Key: c2Zxb3JpbmgyMzA5dGpoMDIzOWdlcm5vZ2luCg==" =!= `Sec-WebSocket-Key`("c2Zxb3JpbmgyMzA5dGpoMDIzOWdlcm5vZ2luCg==") @@ -550,13 +554,14 @@ class HttpHeaderSpec extends FreeSpec with Matchers { qop="auth,auth-int", nonce=dcd98b7102dd2f0e8b11d0f600bfb0c093, opaque=5ccc069c403ebaf9f0171e9517f40e41""".stripMarginWithNewline("\r\n") =!= - `WWW-Authenticate`(HttpChallenge("Digest", "testrealm@host.com", Map("qop" -> "auth,auth-int", - "nonce" -> "dcd98b7102dd2f0e8b11d0f600bfb0c093", "opaque" -> "5ccc069c403ebaf9f0171e9517f40e41"))).renderedTo( + `WWW-Authenticate`(HttpChallenge("Digest", "testrealm@host.com", Map( + "qop" → "auth,auth-int", + "nonce" → "dcd98b7102dd2f0e8b11d0f600bfb0c093", "opaque" → "5ccc069c403ebaf9f0171e9517f40e41"))).renderedTo( "Digest realm=\"testrealm@host.com\",qop=\"auth,auth-int\",nonce=dcd98b7102dd2f0e8b11d0f600bfb0c093,opaque=5ccc069c403ebaf9f0171e9517f40e41") "WWW-Authenticate: Basic realm=\"WallyWorld\",attr=\"val>ue\", Fancy realm=\"yeah\"" =!= - `WWW-Authenticate`(HttpChallenge("Basic", "WallyWorld", Map("attr" -> "val>ue")), HttpChallenge("Fancy", "yeah")) + `WWW-Authenticate`(HttpChallenge("Basic", "WallyWorld", Map("attr" → "val>ue")), HttpChallenge("Fancy", "yeah")) """WWW-Authenticate: Fancy realm="Secure Area",nonce=42""" =!= - `WWW-Authenticate`(HttpChallenge("Fancy", "Secure Area", Map("nonce" -> "42"))) + `WWW-Authenticate`(HttpChallenge("Fancy", "Secure Area", Map("nonce" → "42"))) } "X-Forwarded-For" in { diff --git a/akka-http-core/src/test/scala/akka/http/javadsl/model/JavaApiSpec.scala b/akka-http-core/src/test/scala/akka/http/javadsl/model/JavaApiSpec.scala index 609ed7695f..aaafb8ea5b 100644 --- a/akka-http-core/src/test/scala/akka/http/javadsl/model/JavaApiSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/javadsl/model/JavaApiSpec.scala @@ -42,16 +42,16 @@ class JavaApiSpec extends FreeSpec with MustMatchers { } "access parameterMap" in { Uri.create("/abc?name=blub&age=28") - .query().toMap.asScala must contain allOf ("name" -> "blub", "age" -> "28") + .query().toMap.asScala must contain allOf ("name" → "blub", "age" → "28") } "access parameters" in { val Seq(param1, param2, param3) = Uri.create("/abc?name=blub&age=28&name=blub2") .query().toList.asScala.map(_.toScala) - param1 must be("name" -> "blub") - param2 must be("age" -> "28") - param3 must be("name" -> "blub2") + param1 must be("name" → "blub") + param2 must be("age" → "28") + param3 must be("name" → "blub2") } "access single parameter" in { val query = Uri.create("/abc?name=blub").query() diff --git a/akka-http-core/src/test/scala/akka/http/javadsl/model/JavaApiTestCaseSpecs.scala b/akka-http-core/src/test/scala/akka/http/javadsl/model/JavaApiTestCaseSpecs.scala index 794049b84e..6cf8e71254 100644 --- a/akka-http-core/src/test/scala/akka/http/javadsl/model/JavaApiTestCaseSpecs.scala +++ b/akka-http-core/src/test/scala/akka/http/javadsl/model/JavaApiTestCaseSpecs.scala @@ -61,7 +61,8 @@ class JavaApiTestCaseSpecs extends FreeSpec with MustMatchers { Uri.create("/order").query(JavaApiTestCases.addSessionId(orderId)) must be(Uri.create("/order?orderId=123&session=abcdefghijkl")) } "create HttpsContext" in { - akka.http.javadsl.ConnectionContext.https(SSLContext.getDefault, + akka.http.javadsl.ConnectionContext.https( + SSLContext.getDefault, Optional.empty[java.util.Collection[String]], Optional.empty[java.util.Collection[String]], Optional.empty[TLSClientAuth], diff --git a/akka-http-core/src/test/scala/akka/http/scaladsl/ClientServerSpec.scala b/akka-http-core/src/test/scala/akka/http/scaladsl/ClientServerSpec.scala index 6758b300ec..264c3fbae0 100644 --- a/akka-http-core/src/test/scala/akka/http/scaladsl/ClientServerSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/scaladsl/ClientServerSpec.scala @@ -251,7 +251,7 @@ class ClientServerSpec extends WordSpec with Matchers with BeforeAndAfterAll wit def runRequest(uri: Uri): Future[(Try[HttpResponse], Int)] = { val itNeverSends = Chunked.fromData(ContentTypes.`text/plain(UTF-8)`, Source.maybe[ByteString]) - Source.single(HttpRequest(POST, uri, entity = itNeverSends) -> 1) + Source.single(HttpRequest(POST, uri, entity = itNeverSends) → 1) .via(pool) .runWith(Sink.head) } @@ -535,7 +535,7 @@ class ClientServerSpec extends WordSpec with Matchers with BeforeAndAfterAll wit connection.remoteAddress.getHostName shouldEqual hostname connection.remoteAddress.getPort shouldEqual port - requestPublisherProbe -> responseSubscriberProbe + requestPublisherProbe → responseSubscriberProbe } def acceptConnection(): (TestSubscriber.ManualProbe[HttpRequest], TestPublisher.ManualProbe[HttpResponse]) = { @@ -552,7 +552,7 @@ class ClientServerSpec extends WordSpec with Matchers with BeforeAndAfterAll wit pub.subscribe(requestSubscriberProbe) responsePublisherProbe.subscribe(sub) - requestSubscriberProbe -> responsePublisherProbe + requestSubscriberProbe → responsePublisherProbe } def openClientSocket() = new Socket(hostname, port) @@ -568,7 +568,7 @@ class ClientServerSpec extends WordSpec with Matchers with BeforeAndAfterAll wit val sb = new java.lang.StringBuilder val cbuf = new Array[Char](256) @tailrec def drain(): (String, BufferedReader) = reader.read(cbuf) match { - case -1 ⇒ sb.toString -> reader + case -1 ⇒ sb.toString → reader case n ⇒ sb.append(cbuf, 0, n); drain() } drain() diff --git a/akka-http-core/src/test/scala/akka/http/scaladsl/TestServer.scala b/akka-http-core/src/test/scala/akka/http/scaladsl/TestServer.scala index 105e583289..0176913e0d 100644 --- a/akka-http-core/src/test/scala/akka/http/scaladsl/TestServer.scala +++ b/akka-http-core/src/test/scala/akka/http/scaladsl/TestServer.scala @@ -56,7 +56,8 @@ object TestServer extends App { ////////////// helpers ////////////// lazy val index = HttpResponse( - entity = HttpEntity(ContentTypes.`text/html(UTF-8)`, + entity = HttpEntity( + ContentTypes.`text/html(UTF-8)`, """| | |

Say hello to akka-http-core!

diff --git a/akka-http-core/src/test/scala/akka/http/scaladsl/model/MultipartSpec.scala b/akka-http-core/src/test/scala/akka/http/scaladsl/model/MultipartSpec.scala index 2b35b8e4b4..a37f21fcc7 100644 --- a/akka-http-core/src/test/scala/akka/http/scaladsl/model/MultipartSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/scaladsl/model/MultipartSpec.scala @@ -43,7 +43,7 @@ class MultipartSpec extends WordSpec with Matchers with Inside with BeforeAndAft Multipart.FormData.BodyPart("bar", defaultEntity("BAR")) :: Nil)) val strict = Await.result(streamed.toStrict(1.second), 1.second) - strict shouldEqual Multipart.FormData(Map("foo" -> HttpEntity("FOO"), "bar" -> HttpEntity("BAR"))) + strict shouldEqual Multipart.FormData(Map("foo" → HttpEntity("FOO"), "bar" → HttpEntity("BAR"))) } } diff --git a/akka-http-core/src/test/scala/akka/http/scaladsl/model/UriSpec.scala b/akka-http-core/src/test/scala/akka/http/scaladsl/model/UriSpec.scala index b17884d834..bac88cdd02 100644 --- a/akka-http-core/src/test/scala/akka/http/scaladsl/model/UriSpec.scala +++ b/akka-http-core/src/test/scala/akka/http/scaladsl/model/UriSpec.scala @@ -148,7 +148,8 @@ class UriSpec extends WordSpec with Matchers { "not accept illegal IPv6 literals" in { // 5 char quad the[IllegalUriException] thrownBy Host("[::12345]") shouldBe { - IllegalUriException("Illegal URI host: Invalid input '5', expected ':' or ']' (line 1, column 8)", + IllegalUriException( + "Illegal URI host: Invalid input '5', expected ':' or ']' (line 1, column 8)", "[::12345]\n" + " ^") } @@ -305,29 +306,29 @@ class UriSpec extends WordSpec with Matchers { query.getOrElse("d", "x") shouldEqual "x" query.getAll("b") shouldEqual List("", "4", "2") query.getAll("d") shouldEqual Nil - query.toMap shouldEqual Map("a" -> "1", "b" -> "", "c" -> "3") - query.toMultiMap shouldEqual Map("a" -> List("1"), "b" -> List("", "4", "2"), "c" -> List("3")) - query.toList shouldEqual List("a" -> "1", "b" -> "2", "c" -> "3", "b" -> "4", "b" -> "") - query.toSeq shouldEqual Seq("a" -> "1", "b" -> "2", "c" -> "3", "b" -> "4", "b" -> "") + query.toMap shouldEqual Map("a" → "1", "b" → "", "c" → "3") + query.toMultiMap shouldEqual Map("a" → List("1"), "b" → List("", "4", "2"), "c" → List("3")) + query.toList shouldEqual List("a" → "1", "b" → "2", "c" → "3", "b" → "4", "b" → "") + query.toSeq shouldEqual Seq("a" → "1", "b" → "2", "c" → "3", "b" → "4", "b" → "") } "support conversion from list of name/value pairs" in { import Query._ - val pairs = List("key1" -> "value1", "key2" -> "value2", "key3" -> "value3") + val pairs = List("key1" → "value1", "key2" → "value2", "key3" → "value3") Query(pairs: _*).toList.diff(pairs) shouldEqual Nil Query() shouldEqual Empty - Query("k" -> "v") shouldEqual ("k" -> "v") +: Empty + Query("k" → "v") shouldEqual ("k" → "v") +: Empty } "encode special separators in query parameter names" in { - Query("a=b" -> "c").toString() shouldEqual "a%3Db=c" - Query("a&b" -> "c").toString() shouldEqual "a%26b=c" - Query("a+b" -> "c").toString() shouldEqual "a%2Bb=c" - Query("a;b" -> "c").toString() shouldEqual "a%3Bb=c" + Query("a=b" → "c").toString() shouldEqual "a%3Db=c" + Query("a&b" → "c").toString() shouldEqual "a%26b=c" + Query("a+b" → "c").toString() shouldEqual "a%2Bb=c" + Query("a;b" → "c").toString() shouldEqual "a%3Bb=c" } "encode special separators in query parameter values" in { - Query("a" -> "b=c").toString() shouldEqual "a=b%3Dc" - Query("a" -> "b&c").toString() shouldEqual "a=b%26c" - Query("a" -> "b+c").toString() shouldEqual "a=b%2Bc" - Query("a" -> "b;c").toString() shouldEqual "a=b%3Bc" + Query("a" → "b=c").toString() shouldEqual "a=b%3Dc" + Query("a" → "b&c").toString() shouldEqual "a=b%26c" + Query("a" → "b+c").toString() shouldEqual "a=b%2Bc" + Query("a" → "b;c").toString() shouldEqual "a=b%3Bc" } } @@ -456,7 +457,7 @@ class UriSpec extends WordSpec with Matchers { "support tunneling a URI through a query param" in { val uri = Uri("http://aHost/aPath?aParam=aValue#aFragment") - val q = Query("uri" -> uri.toString) + val q = Query("uri" → uri.toString) val uri2 = Uri(path = Path./, fragment = Some("aFragment")).withQuery(q).toString uri2 shouldEqual "/?uri=http://ahost/aPath?aParam%3DaValue%23aFragment#aFragment" Uri(uri2).query() shouldEqual q @@ -466,42 +467,48 @@ class UriSpec extends WordSpec with Matchers { "produce proper error messages for illegal URIs" in { // illegal scheme the[IllegalUriException] thrownBy Uri("foö:/a") shouldBe { - IllegalUriException("Illegal URI reference: Invalid input 'ö', expected scheme-char, 'EOI', '#', ':', '?', slashSegments or pchar (line 1, column 3)", + IllegalUriException( + "Illegal URI reference: Invalid input 'ö', expected scheme-char, 'EOI', '#', ':', '?', slashSegments or pchar (line 1, column 3)", "foö:/a\n" + " ^") } // illegal userinfo the[IllegalUriException] thrownBy Uri("http://user:ö@host") shouldBe { - IllegalUriException("Illegal URI reference: Invalid input 'ö', expected userinfo-char, pct-encoded, '@' or port (line 1, column 13)", + IllegalUriException( + "Illegal URI reference: Invalid input 'ö', expected userinfo-char, pct-encoded, '@' or port (line 1, column 13)", "http://user:ö@host\n" + " ^") } // illegal percent-encoding the[IllegalUriException] thrownBy Uri("http://use%2G@host") shouldBe { - IllegalUriException("Illegal URI reference: Invalid input 'G', expected HEXDIG (line 1, column 13)", + IllegalUriException( + "Illegal URI reference: Invalid input 'G', expected HEXDIG (line 1, column 13)", "http://use%2G@host\n" + " ^") } // illegal path the[IllegalUriException] thrownBy Uri("http://www.example.com/name with spaces/") shouldBe { - IllegalUriException("Illegal URI reference: Invalid input ' ', expected '/', 'EOI', '#', '?' or pchar (line 1, column 28)", + IllegalUriException( + "Illegal URI reference: Invalid input ' ', expected '/', 'EOI', '#', '?' or pchar (line 1, column 28)", "http://www.example.com/name with spaces/\n" + " ^") } // illegal path with control character the[IllegalUriException] thrownBy Uri("http:///with\newline") shouldBe { - IllegalUriException("Illegal URI reference: Invalid input '\\n', expected '/', 'EOI', '#', '?' or pchar (line 1, column 13)", + IllegalUriException( + "Illegal URI reference: Invalid input '\\n', expected '/', 'EOI', '#', '?' or pchar (line 1, column 13)", "http:///with\n" + " ^") } // illegal query the[IllegalUriException] thrownBy Uri("?a=b=c").query() shouldBe { - IllegalUriException("Illegal query: Invalid input '=', expected '+', query-char, 'EOI', '&' or pct-encoded (line 1, column 4)", + IllegalUriException( + "Illegal query: Invalid input '=', expected '+', query-char, 'EOI', '&' or pct-encoded (line 1, column 4)", "a=b=c\n" + " ^") } @@ -596,8 +603,8 @@ class UriSpec extends WordSpec with Matchers { uri.withUserInfo("someInfo") shouldEqual Uri("http://someInfo@host/path?query#fragment") explicitDefault.withUserInfo("someInfo") shouldEqual Uri("http://someInfo@host:80/path?query#fragment") - uri.withQuery(Query("param1" -> "value1")) shouldEqual Uri("http://host/path?param1=value1#fragment") - uri.withQuery(Query(Map("param1" -> "value1"))) shouldEqual Uri("http://host/path?param1=value1#fragment") + uri.withQuery(Query("param1" → "value1")) shouldEqual Uri("http://host/path?param1=value1#fragment") + uri.withQuery(Query(Map("param1" → "value1"))) shouldEqual Uri("http://host/path?param1=value1#fragment") uri.withRawQueryString("param1=value1") shouldEqual Uri("http://host/path?param1=value1#fragment") uri.withFragment("otherFragment") shouldEqual Uri("http://host/path?query#otherFragment") diff --git a/akka-http-core/src/test/scala/io/akka/integrationtest/http/HttpModelIntegrationSpec.scala b/akka-http-core/src/test/scala/io/akka/integrationtest/http/HttpModelIntegrationSpec.scala index 06ef6939c5..1312acde54 100644 --- a/akka-http-core/src/test/scala/io/akka/integrationtest/http/HttpModelIntegrationSpec.scala +++ b/akka-http-core/src/test/scala/io/akka/integrationtest/http/HttpModelIntegrationSpec.scala @@ -79,10 +79,10 @@ class HttpModelIntegrationSpec extends WordSpec with Matchers with BeforeAndAfte } val textHeaders: Seq[(String, String)] = entityTextHeaders ++ partialTextHeaders textHeaders shouldEqual Seq( - "Content-Type" -> "application/json", - "Content-Length" -> "5", - "Host" -> "localhost", - "Origin" -> "null") + "Content-Type" → "application/json", + "Content-Length" → "5", + "Host" → "localhost", + "Origin" → "null") // Finally convert the body into an Array[Byte]. @@ -98,9 +98,9 @@ class HttpModelIntegrationSpec extends WordSpec with Matchers with BeforeAndAfte // example simple model of an HTTP response. val textHeaders: Seq[(String, String)] = Seq( - "Content-Type" -> "text/plain", - "Content-Length" -> "3", - "X-Greeting" -> "Hello") + "Content-Type" → "text/plain", + "Content-Length" → "3", + "X-Greeting" → "Hello") val byteArrayBody: Array[Byte] = "foo".getBytes // Now we need to convert this model to Akka HTTP's model. To do that diff --git a/akka-http-testkit/src/main/scala/akka/http/javadsl/testkit/TestRouteResult.scala b/akka-http-testkit/src/main/scala/akka/http/javadsl/testkit/TestRouteResult.scala index 56b450032b..aee99e08b9 100644 --- a/akka-http-testkit/src/main/scala/akka/http/javadsl/testkit/TestRouteResult.scala +++ b/akka-http-testkit/src/main/scala/akka/http/javadsl/testkit/TestRouteResult.scala @@ -17,7 +17,7 @@ import akka.http.scaladsl.unmarshalling.Unmarshal import akka.http.scaladsl.model.HttpResponse import akka.http.impl.util._ import akka.http.impl.util.JavaMapping.Implicits._ -import akka.http.javadsl.server.{Rejection, RoutingJavaMapping, Unmarshaller} +import akka.http.javadsl.server.{ Rejection, RoutingJavaMapping, Unmarshaller } import RoutingJavaMapping._ import akka.http.javadsl.model._ @@ -31,17 +31,17 @@ import scala.annotation.varargs * implementations for the abstract assertion methods. */ abstract class TestRouteResult(_result: RouteResult, awaitAtMost: FiniteDuration)(implicit ec: ExecutionContext, materializer: Materializer) { - + private def _response = _result match { case scaladsl.server.RouteResult.Complete(r) ⇒ r case scaladsl.server.RouteResult.Rejected(rejections) ⇒ doFail("Expected route to complete, but was instead rejected with " + rejections) } - + private def _rejections = _result match { case scaladsl.server.RouteResult.Complete(r) ⇒ doFail("Request was not rejected, response was " + r) case scaladsl.server.RouteResult.Rejected(ex) ⇒ ex - } - + } + /** * Returns the strictified entity of the response. It will be strictified on first access. */ @@ -56,12 +56,12 @@ abstract class TestRouteResult(_result: RouteResult, awaitAtMost: FiniteDuration * Returns the response's content-type */ def contentType: ContentType = _response.entity.contentType - + /** * Returns a string representation of the response's content-type */ def contentTypeString: String = contentType.toString - + /** * Returns the media-type of the the response's content-type */ @@ -113,7 +113,7 @@ abstract class TestRouteResult(_result: RouteResult, awaitAtMost: FiniteDuration * Fails the test if the route completes with a response rather than having been rejected. */ def rejections: java.util.List[Rejection] = _rejections.map(_.asJava).asJava - + /** * Expects the route to have been rejected with a single rejection. * Fails the test if the route completes with a response, or is rejected with 0 or >1 rejections. @@ -158,7 +158,7 @@ abstract class TestRouteResult(_result: RouteResult, awaitAtMost: FiniteDuration */ def assertContentType(expected: ContentType): TestRouteResult = assertEqualsKind(expected, contentType, "content type") - + /** * Assert on the response entity to be a UTF8 representation of the given string. */ @@ -174,7 +174,7 @@ abstract class TestRouteResult(_result: RouteResult, awaitAtMost: FiniteDuration /** * Assert on the response entity to equal the given object after applying an [[akka.http.javadsl.server.Unmarshaller]]. */ - def assertEntityAs[T <: AnyRef](unmarshaller: Unmarshaller[HttpEntity,T], expected: T): TestRouteResult = + def assertEntityAs[T <: AnyRef](unmarshaller: Unmarshaller[HttpEntity, T], expected: T): TestRouteResult = assertEqualsKind(expected, entity(unmarshaller), "entity") /** @@ -201,17 +201,18 @@ abstract class TestRouteResult(_result: RouteResult, awaitAtMost: FiniteDuration val lowercased = name.toRootLowerCase val headers = response.headers.filter(_.is(lowercased)) if (headers.isEmpty) fail(s"Expected `$name` header was missing.") - else assertTrue(headers.exists(_.value == value), + else assertTrue( + headers.exists(_.value == value), s"`$name` header was found but had the wrong value. Found headers: ${headers.mkString(", ")}") this } - + @varargs def assertRejections(expectedRejections: Rejection*): TestRouteResult = { if (rejections.asScala == expectedRejections.toSeq) { this } else { - doFail(s"Expected rejections [${expectedRejections.mkString(",")}], but rejected with [${rejections.asScala.mkString(",")}] instead.") + doFail(s"Expected rejections [${expectedRejections.mkString(",")}], but rejected with [${rejections.asScala.mkString(",")}] instead.") } } diff --git a/akka-http-testkit/src/main/scala/akka/http/scaladsl/testkit/RouteTest.scala b/akka-http-testkit/src/main/scala/akka/http/scaladsl/testkit/RouteTest.scala index 23581b160e..2c71fc3538 100644 --- a/akka-http-testkit/src/main/scala/akka/http/scaladsl/testkit/RouteTest.scala +++ b/akka-http-testkit/src/main/scala/akka/http/scaladsl/testkit/RouteTest.scala @@ -139,12 +139,13 @@ trait RouteTest extends RequestBuilding with WSTestRequestBuilding with RouteTes type Out = HttpRequest def apply(request: HttpRequest, f: HttpRequest ⇒ HttpRequest) = f(request) } - implicit def injectIntoRoute(implicit timeout: RouteTestTimeout, - defaultHostInfo: DefaultHostInfo, - routingSettings: RoutingSettings, + implicit def injectIntoRoute(implicit + timeout: RouteTestTimeout, + defaultHostInfo: DefaultHostInfo, + routingSettings: RoutingSettings, executionContext: ExecutionContext, - materializer: Materializer, - routingLog: RoutingLog, + materializer: Materializer, + routingLog: RoutingLog, rejectionHandler: RejectionHandler = RejectionHandler.default, exceptionHandler: ExceptionHandler = null) = new TildeArrow[RequestContext, Future[RouteResult]] { diff --git a/akka-http-testkit/src/main/scala/akka/http/scaladsl/testkit/WSTestRequestBuilding.scala b/akka-http-testkit/src/main/scala/akka/http/scaladsl/testkit/WSTestRequestBuilding.scala index bd2e34543d..ea9e0a92ba 100644 --- a/akka-http-testkit/src/main/scala/akka/http/scaladsl/testkit/WSTestRequestBuilding.scala +++ b/akka-http-testkit/src/main/scala/akka/http/scaladsl/testkit/WSTestRequestBuilding.scala @@ -20,10 +20,11 @@ trait WSTestRequestBuilding { self: RouteTest ⇒ def handleMessages(handlerFlow: Graph[FlowShape[Message, Message], Any], subprotocol: Option[String]): HttpResponse = { clientSideHandler.join(handlerFlow).run() - HttpResponse(StatusCodes.SwitchingProtocols, + HttpResponse( + StatusCodes.SwitchingProtocols, headers = - Upgrade(UpgradeProtocol("websocket") :: Nil) :: - subprotocol.map(p ⇒ `Sec-WebSocket-Protocol`(p :: Nil)).toList) + Upgrade(UpgradeProtocol("websocket") :: Nil) :: + subprotocol.map(p ⇒ `Sec-WebSocket-Protocol`(p :: Nil)).toList) } }) } diff --git a/akka-http-tests/src/test/scala/akka/http/javadsl/DirectivesConsistencySpec.scala b/akka-http-tests/src/test/scala/akka/http/javadsl/DirectivesConsistencySpec.scala index 57fc95c57b..c4cbd5b53c 100644 --- a/akka-http-tests/src/test/scala/akka/http/javadsl/DirectivesConsistencySpec.scala +++ b/akka-http-tests/src/test/scala/akka/http/javadsl/DirectivesConsistencySpec.scala @@ -60,7 +60,7 @@ class DirectivesConsistencySpec extends WordSpec with Matchers { d ← javaDirectives if d.isAnnotationPresent(classOf[CorrespondsTo]) annot = d.getAnnotation(classOf[CorrespondsTo]) - } yield d.getName -> annot.value() + } yield d.getName → annot.value() Map(javaToScalaMappings.toList: _*) } @@ -82,12 +82,12 @@ class DirectivesConsistencySpec extends WordSpec with Matchers { } val allowMissing: Map[Class[_], Set[String]] = Map( - scalaDirectivesClazz -> Set( + scalaDirectivesClazz → Set( "route", "request", "completeOK", // solved by raw complete() in Scala "defaultDirectoryRenderer", "defaultContentTypeResolver" // solved by implicits in Scala - ), - javaDirectivesClazz -> Set( + ), + javaDirectivesClazz → Set( "as", "instanceOf", "pass", diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/FormDataSpec.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/FormDataSpec.scala index 83fbb746f4..2cec74a209 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/FormDataSpec.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/FormDataSpec.scala @@ -18,7 +18,7 @@ class FormDataSpec extends AkkaSpec { implicit val materializer = ActorMaterializer() import system.dispatcher - val formData = FormData(Map("surname" -> "Smith", "age" -> "42")) + val formData = FormData(Map("surname" → "Smith", "age" → "42")) "The FormData infrastructure" should { "properly round-trip the fields of www-urlencoded forms" in { @@ -27,10 +27,10 @@ class FormDataSpec extends AkkaSpec { } "properly marshal www-urlencoded forms containing special chars" in { - Marshal(FormData(Map("name" -> "Smith&Wesson"))).to[HttpEntity] + Marshal(FormData(Map("name" → "Smith&Wesson"))).to[HttpEntity] .flatMap(Unmarshal(_).to[String]).futureValue shouldEqual "name=Smith%26Wesson" - Marshal(FormData(Map("name" -> "Smith+Wesson; hopefully!"))).to[HttpEntity] + Marshal(FormData(Map("name" → "Smith+Wesson; hopefully!"))).to[HttpEntity] .flatMap(Unmarshal(_).to[String]).futureValue shouldEqual "name=Smith%2BWesson%3B+hopefully%21" } } diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/marshalling/ContentNegotiationGivenResponseCodeSpec.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/marshalling/ContentNegotiationGivenResponseCodeSpec.scala index 5348fd769d..22e0c35a12 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/marshalling/ContentNegotiationGivenResponseCodeSpec.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/marshalling/ContentNegotiationGivenResponseCodeSpec.scala @@ -15,9 +15,9 @@ class ContentNegotiationGivenResponseCodeSpec extends RoutingSpec { pathPrefix(Segment) { mode ⇒ complete { mode match { - case "200-text" ⇒ OK -> "ok" - case "201-text" ⇒ Created -> "created" - case "400-text" ⇒ BadRequest -> "bad-request" + case "200-text" ⇒ OK → "ok" + case "201-text" ⇒ Created → "created" + case "400-text" ⇒ BadRequest → "bad-request" } } } diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/marshalling/ContentNegotiationSpec.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/marshalling/ContentNegotiationSpec.scala index 770623d887..95110ec915 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/marshalling/ContentNegotiationSpec.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/marshalling/ContentNegotiationSpec.scala @@ -107,7 +107,8 @@ class ContentNegotiationSpec extends FreeSpec with Matchers { } "Accept-Charset: UTF-8, *;q=0.8, us;q=0.1" test { accept ⇒ - accept(`text/plain` withCharset `US-ASCII`, + accept( + `text/plain` withCharset `US-ASCII`, `text/plain` withCharset `ISO-8859-1`) should select(`text/plain` withCharset `ISO-8859-1`) } diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/marshalling/MarshallingSpec.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/marshalling/MarshallingSpec.scala index 62980fbbdb..4d73ee31a1 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/marshalling/MarshallingSpec.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/marshalling/MarshallingSpec.scala @@ -34,7 +34,7 @@ class MarshallingSpec extends FreeSpec with Matchers with BeforeAndAfterAll with marshal("Ha“llo".toCharArray) shouldEqual HttpEntity("Ha“llo") } "FormDataMarshaller should marshal FormData instances to application/x-www-form-urlencoded content" in { - marshal(FormData(Map("name" -> "Bob", "pass" -> "hällo", "admin" -> ""))) shouldEqual + marshal(FormData(Map("name" → "Bob", "pass" → "hällo", "admin" → ""))) shouldEqual HttpEntity(`application/x-www-form-urlencoded` withCharset `UTF-8`, "name=Bob&pass=h%C3%A4llo&admin=") } } @@ -65,7 +65,7 @@ class MarshallingSpec extends FreeSpec with Matchers with BeforeAndAfterAll with "one non-empty part" in { marshal(Multipart.General(`multipart/alternative`, Multipart.General.BodyPart.Strict( entity = HttpEntity(ContentTypes.`text/plain(UTF-8)`, "test@there.com"), - headers = `Content-Disposition`(ContentDispositionTypes.`form-data`, Map("name" -> "email")) :: Nil))) shouldEqual + headers = `Content-Disposition`(ContentDispositionTypes.`form-data`, Map("name" → "email")) :: Nil))) shouldEqual HttpEntity( contentType = `multipart/alternative` withBoundary randomBoundary withCharset `UTF-8`, string = s"""--$randomBoundary @@ -76,7 +76,8 @@ class MarshallingSpec extends FreeSpec with Matchers with BeforeAndAfterAll with |--$randomBoundary--""".stripMarginWithNewline("\r\n")) } "two different parts" in { - marshal(Multipart.General(`multipart/related`, + marshal(Multipart.General( + `multipart/related`, Multipart.General.BodyPart.Strict(HttpEntity(`text/plain` withCharset `US-ASCII`, "first part, with a trailing linebreak\r\n")), Multipart.General.BodyPart.Strict( HttpEntity(`application/octet-stream`, ByteString("filecontent")), @@ -100,8 +101,8 @@ class MarshallingSpec extends FreeSpec with Matchers with BeforeAndAfterAll with "multipartFormDataMarshaller should correctly marshal 'multipart/form-data' content with" - { "two fields" in { marshal(Multipart.FormData(ListMap( - "surname" -> HttpEntity("Mike"), - "age" -> marshal(42)))) shouldEqual + "surname" → HttpEntity("Mike"), + "age" → marshal(42)))) shouldEqual HttpEntity( contentType = `multipart/form-data` withBoundary randomBoundary withCharset `UTF-8`, string = s"""--$randomBoundary @@ -120,9 +121,9 @@ class MarshallingSpec extends FreeSpec with Matchers with BeforeAndAfterAll with "two fields having a custom `Content-Disposition`" in { marshal(Multipart.FormData(Source(List( Multipart.FormData.BodyPart("attachment[0]", HttpEntity(`text/csv` withCharset `UTF-8`, "name,age\r\n\"John Doe\",20\r\n"), - Map("filename" -> "attachment.csv")), + Map("filename" → "attachment.csv")), Multipart.FormData.BodyPart("attachment[1]", HttpEntity("naice!".getBytes), - Map("filename" -> "attachment2.csv"), List(RawHeader("Content-Transfer-Encoding", "binary"))))))) shouldEqual + Map("filename" → "attachment2.csv"), List(RawHeader("Content-Transfer-Encoding", "binary"))))))) shouldEqual HttpEntity( contentType = `multipart/form-data` withBoundary randomBoundary withCharset `UTF-8`, string = s"""--$randomBoundary diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/DontLeakActorsOnFailingConnectionSpecs.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/DontLeakActorsOnFailingConnectionSpecs.scala index 790e38b7f8..ceb19eca38 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/DontLeakActorsOnFailingConnectionSpecs.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/DontLeakActorsOnFailingConnectionSpecs.scala @@ -41,7 +41,7 @@ class DontLeakActorsOnFailingConnectionSpecs extends WordSpecLike with Matchers val reqsCount = 100 val clientFlow = Http().superPool[Int]() val (_, _, port) = TestUtils.temporaryServerHostnameAndPort() - val source = Source(1 to reqsCount).map(i ⇒ HttpRequest(uri = Uri(s"http://127.0.0.1:$port/test/$i")) -> i) + val source = Source(1 to reqsCount).map(i ⇒ HttpRequest(uri = Uri(s"http://127.0.0.1:$port/test/$i")) → i) val countDown = new CountDownLatch(reqsCount) val sink = Sink.foreach[(Try[HttpResponse], Int)] { diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/TestServer.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/TestServer.scala index 39d37885c7..ecca3305dc 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/TestServer.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/TestServer.scala @@ -35,7 +35,8 @@ object TestServer extends App { val bindingFuture = Http().bindAndHandle({ get { path("") { - withRequestTimeout(1.milli, _ ⇒ HttpResponse(StatusCodes.EnhanceYourCalm, + withRequestTimeout(1.milli, _ ⇒ HttpResponse( + StatusCodes.EnhanceYourCalm, entity = "Unable to serve response within time limit, please enchance your calm.")) { Thread.sleep(1000) complete(index) diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/CookieDirectivesSpec.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/CookieDirectivesSpec.scala index 8195b08ab9..3e9c1f8a27 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/CookieDirectivesSpec.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/CookieDirectivesSpec.scala @@ -15,7 +15,7 @@ class CookieDirectivesSpec extends RoutingSpec { "The 'cookie' directive" should { "extract the respectively named cookie" in { - Get() ~> addHeader(Cookie("fancy" -> "pants")) ~> { + Get() ~> addHeader(Cookie("fancy" → "pants")) ~> { cookie("fancy") { echoComplete } } ~> check { responseAs[String] shouldEqual "fancy=pants" } } @@ -25,7 +25,7 @@ class CookieDirectivesSpec extends RoutingSpec { } ~> check { rejection shouldEqual MissingCookieRejection("fancy") } } "properly pass through inner rejections" in { - Get() ~> addHeader(Cookie("fancy" -> "pants")) ~> { + Get() ~> addHeader(Cookie("fancy" → "pants")) ~> { cookie("fancy") { c ⇒ reject(ValidationRejection("Dont like " + c.value)) } } ~> check { rejection shouldEqual ValidationRejection("Dont like pants") } } @@ -56,7 +56,7 @@ class CookieDirectivesSpec extends RoutingSpec { "The 'optionalCookie' directive" should { "produce a `Some(cookie)` extraction if the cookie is present" in { - Get() ~> Cookie("abc" -> "123") ~> { + Get() ~> Cookie("abc" → "123") ~> { optionalCookie("abc") { echoComplete } } ~> check { responseAs[String] shouldEqual "Some(abc=123)" } } diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/FileUploadDirectivesSpec.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/FileUploadDirectivesSpec.scala index 7851be1391..d0c23a0789 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/FileUploadDirectivesSpec.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/FileUploadDirectivesSpec.scala @@ -27,7 +27,7 @@ class FileUploadDirectivesSpec extends RoutingSpec { Multipart.FormData(Multipart.FormData.BodyPart.Strict( "fieldName", HttpEntity(ContentTypes.`text/xml(UTF-8)`, xml), - Map("filename" -> "age.xml"))) + Map("filename" → "age.xml"))) @volatile var file: Option[File] = None @@ -77,7 +77,7 @@ class FileUploadDirectivesSpec extends RoutingSpec { Multipart.FormData(Multipart.FormData.BodyPart.Strict( "field1", HttpEntity(ContentTypes.`text/plain(UTF-8)`, str1), - Map("filename" -> "data1.txt"))) + Map("filename" → "data1.txt"))) Post("/", multipartForm) ~> route ~> check { status shouldEqual StatusCodes.OK @@ -98,11 +98,11 @@ class FileUploadDirectivesSpec extends RoutingSpec { Multipart.FormData.BodyPart.Strict( "field1", HttpEntity(ContentTypes.`text/plain(UTF-8)`, str1), - Map("filename" -> "data1.txt")), + Map("filename" → "data1.txt")), Multipart.FormData.BodyPart.Strict( "field1", HttpEntity(ContentTypes.`text/plain(UTF-8)`, str2), - Map("filename" -> "data2.txt"))) + Map("filename" → "data2.txt"))) Post("/", multipartForm) ~> route ~> check { status shouldEqual StatusCodes.OK @@ -135,7 +135,7 @@ class FileUploadDirectivesSpec extends RoutingSpec { Multipart.FormData(Multipart.FormData.BodyPart.Strict( "field1", HttpEntity(ContentTypes.`text/plain(UTF-8)`, str1), - Map("filename" -> "data1.txt"))) + Map("filename" → "data1.txt"))) Post("/", multipartForm) ~> route ~> check { rejection === MissingFormFieldRejection("missing") diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/FormFieldDirectivesSpec.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/FormFieldDirectivesSpec.scala index 2945554e89..f253dabb30 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/FormFieldDirectivesSpec.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/FormFieldDirectivesSpec.scala @@ -19,24 +19,24 @@ class FormFieldDirectivesSpec extends RoutingSpec { ScalaXmlSupport.nodeSeqUnmarshaller(`text/xml`, `text/html`, `text/plain`) val nodeSeq: xml.NodeSeq = yes - val urlEncodedForm = FormData(Map("firstName" -> "Mike", "age" -> "42")) - val urlEncodedFormWithVip = FormData(Map("firstName" -> "Mike", "age" -> "42", "VIP" -> "true", "super" -> "no")) + val urlEncodedForm = FormData(Map("firstName" → "Mike", "age" → "42")) + val urlEncodedFormWithVip = FormData(Map("firstName" → "Mike", "age" → "42", "VIP" → "true", "super" → "no")) val multipartForm = Multipart.FormData { Map( - "firstName" -> HttpEntity("Mike"), - "age" -> HttpEntity(ContentTypes.`text/xml(UTF-8)`, "42"), - "VIPBoolean" -> HttpEntity("true")) + "firstName" → HttpEntity("Mike"), + "age" → HttpEntity(ContentTypes.`text/xml(UTF-8)`, "42"), + "VIPBoolean" → HttpEntity("true")) } val multipartFormWithTextHtml = Multipart.FormData { Map( - "firstName" -> HttpEntity("Mike"), - "age" -> HttpEntity(ContentTypes.`text/xml(UTF-8)`, "42"), - "VIP" -> HttpEntity(ContentTypes.`text/html(UTF-8)`, "yes"), - "super" -> HttpEntity("no")) + "firstName" → HttpEntity("Mike"), + "age" → HttpEntity(ContentTypes.`text/xml(UTF-8)`, "42"), + "VIP" → HttpEntity(ContentTypes.`text/html(UTF-8)`, "yes"), + "super" → HttpEntity("no")) } val multipartFormWithFile = Multipart.FormData( Multipart.FormData.BodyPart.Strict("file", HttpEntity(ContentTypes.`text/xml(UTF-8)`, "42"), - Map("filename" -> "age.xml"))) + Map("filename" → "age.xml"))) "The 'formFields' extraction directive" should { "properly extract the value of www-urlencoded form fields" in { @@ -142,22 +142,22 @@ class FormFieldDirectivesSpec extends RoutingSpec { "The 'formField' repeated directive" should { "extract an empty Iterable when the parameter is absent" in { - Post("/", FormData("age" -> "42")) ~> { + Post("/", FormData("age" → "42")) ~> { formField('hobby.*) { echoComplete } } ~> check { responseAs[String] === "List()" } } "extract all occurrences into an Iterable when parameter is present" in { - Post("/", FormData("age" -> "42", "hobby" -> "cooking", "hobby" -> "reading")) ~> { + Post("/", FormData("age" → "42", "hobby" → "cooking", "hobby" → "reading")) ~> { formField('hobby.*) { echoComplete } } ~> check { responseAs[String] === "List(cooking, reading)" } } "extract as Iterable[Int]" in { - Post("/", FormData("age" -> "42", "number" -> "3", "number" -> "5")) ~> { + Post("/", FormData("age" → "42", "number" → "3", "number" → "5")) ~> { formField('number.as[Int].*) { echoComplete } } ~> check { responseAs[String] === "List(3, 5)" } } "extract as Iterable[Int] with an explicit deserializer" in { - Post("/", FormData("age" -> "42", "number" -> "3", "number" -> "A")) ~> { + Post("/", FormData("age" → "42", "number" → "3", "number" → "A")) ~> { formField('number.as(HexInt).*) { echoComplete } } ~> check { responseAs[String] === "List(3, 10)" } } @@ -165,7 +165,7 @@ class FormFieldDirectivesSpec extends RoutingSpec { "The 'formFieldMap' directive" should { "extract fields with different keys" in { - Post("/", FormData("age" -> "42", "numberA" -> "3", "numberB" -> "5")) ~> { + Post("/", FormData("age" → "42", "numberA" → "3", "numberB" → "5")) ~> { formFieldMap { echoComplete } } ~> check { responseAs[String] shouldEqual "Map(age -> 42, numberA -> 3, numberB -> 5)" } } @@ -173,7 +173,7 @@ class FormFieldDirectivesSpec extends RoutingSpec { "The 'formFieldSeq' directive" should { "extract all fields" in { - Post("/", FormData("age" -> "42", "number" -> "3", "number" -> "5")) ~> { + Post("/", FormData("age" → "42", "number" → "3", "number" → "5")) ~> { formFieldSeq { echoComplete } } ~> check { responseAs[String] shouldEqual "Vector((age,42), (number,3), (number,5))" } } @@ -186,7 +186,7 @@ class FormFieldDirectivesSpec extends RoutingSpec { "The 'formFieldMultiMap' directive" should { "extract fields with different keys (with duplicates)" in { - Post("/", FormData("age" -> "42", "number" -> "3", "number" -> "5")) ~> { + Post("/", FormData("age" → "42", "number" → "3", "number" → "5")) ~> { formFieldMultiMap { echoComplete } } ~> check { responseAs[String] shouldEqual "Map(age -> List(42), number -> List(5, 3))" } } diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/PathDirectivesSpec.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/PathDirectivesSpec.scala index 1b3021c951..9a5f199e7a 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/PathDirectivesSpec.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/PathDirectivesSpec.scala @@ -103,7 +103,7 @@ class PathDirectivesSpec extends RoutingSpec with Inside { } "pathPrefix(Map(\"red\" -> 1, \"green\" -> 2, \"blue\" -> 3))" should { - val test = testFor(pathPrefix(Map("red" -> 1, "green" -> 2, "blue" -> 3)) { echoCaptureAndUnmatchedPath }) + val test = testFor(pathPrefix(Map("red" → 1, "green" → 2, "blue" → 3)) { echoCaptureAndUnmatchedPath }) "accept [/green]" in test("2:") "accept [/redsea]" in test("1:sea") "reject [/black]" in test() diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/RouteDirectivesSpec.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/RouteDirectivesSpec.scala index 662b09109d..26e9f65b29 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/RouteDirectivesSpec.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/RouteDirectivesSpec.scala @@ -78,7 +78,7 @@ class RouteDirectivesSpec extends FreeSpec with GenericRoutingSpec { case AlreadyRegistered ⇒ import spray.json.DefaultJsonProtocol._ import SprayJsonSupport._ - StatusCodes.BadRequest -> Map("error" -> "User already Registered") + StatusCodes.BadRequest → Map("error" → "User already Registered") } } } @@ -119,7 +119,8 @@ class RouteDirectivesSpec extends FreeSpec with GenericRoutingSpec { } ~> check { response shouldEqual HttpResponse( status = 302, - entity = HttpEntity(ContentTypes.`text/html(UTF-8)`, + entity = HttpEntity( + ContentTypes.`text/html(UTF-8)`, "The requested resource temporarily resides under this URI."), headers = Location("/foo") :: Nil) } diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/TimeoutDirectivesSpec.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/TimeoutDirectivesSpec.scala index 8a324f3bb9..31b89e0f22 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/TimeoutDirectivesSpec.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/server/directives/TimeoutDirectivesSpec.scala @@ -31,7 +31,8 @@ class TimeoutDirectivesSpec extends IntegrationRoutingSpec { } "allow mapping the response" in { - val timeoutResponse = HttpResponse(StatusCodes.EnhanceYourCalm, + val timeoutResponse = HttpResponse( + StatusCodes.EnhanceYourCalm, entity = "Unable to serve response within time limit, please enchance your calm.") val route = diff --git a/akka-http-tests/src/test/scala/akka/http/scaladsl/unmarshalling/MultipartUnmarshallersSpec.scala b/akka-http-tests/src/test/scala/akka/http/scaladsl/unmarshalling/MultipartUnmarshallersSpec.scala index 673394be33..e81b302e46 100644 --- a/akka-http-tests/src/test/scala/akka/http/scaladsl/unmarshalling/MultipartUnmarshallersSpec.scala +++ b/akka-http-tests/src/test/scala/akka/http/scaladsl/unmarshalling/MultipartUnmarshallersSpec.scala @@ -29,13 +29,15 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf "multipartGeneralUnmarshaller should correctly unmarshal 'multipart/*' content with" - { "an empty part" in { - Unmarshal(HttpEntity(`multipart/mixed` withBoundary "XYZABC" withCharset `UTF-8`, + Unmarshal(HttpEntity( + `multipart/mixed` withBoundary "XYZABC" withCharset `UTF-8`, """--XYZABC |--XYZABC--""".stripMarginWithNewline("\r\n"))).to[Multipart.General] should haveParts( Multipart.General.BodyPart.Strict(HttpEntity.empty(ContentTypes.`text/plain(UTF-8)`))) } "two empty parts" in { - Unmarshal(HttpEntity(`multipart/mixed` withBoundary "XYZABC" withCharset `UTF-8`, + Unmarshal(HttpEntity( + `multipart/mixed` withBoundary "XYZABC" withCharset `UTF-8`, """--XYZABC |--XYZABC |--XYZABC--""".stripMarginWithNewline("\r\n"))).to[Multipart.General] should haveParts( @@ -43,7 +45,8 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf Multipart.General.BodyPart.Strict(HttpEntity.empty(ContentTypes.`text/plain(UTF-8)`))) } "a part without entity and missing header separation CRLF" in { - Unmarshal(HttpEntity(`multipart/mixed` withBoundary "XYZABC" withCharset `UTF-8`, + Unmarshal(HttpEntity( + `multipart/mixed` withBoundary "XYZABC" withCharset `UTF-8`, """--XYZABC |Content-type: text/xml |Age: 12 @@ -51,7 +54,8 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf Multipart.General.BodyPart.Strict(HttpEntity.empty(ContentTypes.`text/xml(UTF-8)`), List(Age(12)))) } "an implicitly typed part (without headers) (Strict)" in { - Unmarshal(HttpEntity(`multipart/mixed` withBoundary "XYZABC" withCharset `UTF-8`, + Unmarshal(HttpEntity( + `multipart/mixed` withBoundary "XYZABC" withCharset `UTF-8`, """--XYZABC | |Perfectly fine part content. @@ -69,7 +73,8 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf Multipart.General.BodyPart.Strict(HttpEntity(ContentTypes.`text/plain(UTF-8)`, "Perfectly fine part content."))) } "one non-empty form-data part" in { - Unmarshal(HttpEntity(`multipart/form-data` withBoundary "-" withCharset `UTF-8`, + Unmarshal(HttpEntity( + `multipart/form-data` withBoundary "-" withCharset `UTF-8`, """--- |Content-type: text/plain; charset=UTF8 |content-disposition: form-data; name="email" @@ -78,10 +83,11 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf |-----""".stripMarginWithNewline("\r\n"))).to[Multipart.General] should haveParts( Multipart.General.BodyPart.Strict( HttpEntity(ContentTypes.`text/plain(UTF-8)`, "test@there.com"), - List(`Content-Disposition`(ContentDispositionTypes.`form-data`, Map("name" -> "email"))))) + List(`Content-Disposition`(ContentDispositionTypes.`form-data`, Map("name" → "email"))))) } "two different parts" in { - Unmarshal(HttpEntity(`multipart/mixed` withBoundary "12345" withCharset `UTF-8`, + Unmarshal(HttpEntity( + `multipart/mixed` withBoundary "12345" withCharset `UTF-8`, """--12345 | |first part, with a trailing newline @@ -93,11 +99,13 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf |filecontent |--12345--""".stripMarginWithNewline("\r\n"))).to[Multipart.General] should haveParts( Multipart.General.BodyPart.Strict(HttpEntity(ContentTypes.`text/plain(UTF-8)`, "first part, with a trailing newline\r\n")), - Multipart.General.BodyPart.Strict(HttpEntity(`application/octet-stream`, ByteString("filecontent")), + Multipart.General.BodyPart.Strict( + HttpEntity(`application/octet-stream`, ByteString("filecontent")), List(RawHeader("Content-Transfer-Encoding", "binary")))) } "illegal headers" in ( - Unmarshal(HttpEntity(`multipart/form-data` withBoundary "XYZABC" withCharset `UTF-8`, + Unmarshal(HttpEntity( + `multipart/form-data` withBoundary "XYZABC" withCharset `UTF-8`, """--XYZABC |Date: unknown |content-disposition: form-data; name=email @@ -106,10 +114,12 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf |--XYZABC--""".stripMarginWithNewline("\r\n"))).to[Multipart.General] should haveParts( Multipart.General.BodyPart.Strict( HttpEntity(ContentTypes.`text/plain(UTF-8)`, "test@there.com"), - List(RawHeader("date", "unknown"), - `Content-Disposition`(ContentDispositionTypes.`form-data`, Map("name" -> "email")))))) + List( + RawHeader("date", "unknown"), + `Content-Disposition`(ContentDispositionTypes.`form-data`, Map("name" → "email")))))) "a full example (Strict)" in { - Unmarshal(HttpEntity(`multipart/mixed` withBoundary "12345" withCharset `UTF-8`, + Unmarshal(HttpEntity( + `multipart/mixed` withBoundary "12345" withCharset `UTF-8`, """preamble and |more preamble |--12345 @@ -145,7 +155,8 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf Multipart.General.BodyPart.Strict(HttpEntity(`application/octet-stream`, ByteString("second part, explicitly typed")))) } "a boundary with spaces" in { - Unmarshal(HttpEntity(`multipart/mixed` withBoundary "simple boundary" withCharset `UTF-8`, + Unmarshal(HttpEntity( + `multipart/mixed` withBoundary "simple boundary" withCharset `UTF-8`, """--simple boundary |--simple boundary--""".stripMarginWithNewline("\r\n"))).to[Multipart.General] should haveParts( Multipart.General.BodyPart.Strict(HttpEntity.empty(ContentTypes.`text/plain(UTF-8)`))) @@ -158,13 +169,15 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf .to[Multipart.General].failed, 1.second).getMessage shouldEqual "Unexpected end of multipart entity" } "an entity without initial boundary" in { - Await.result(Unmarshal(HttpEntity(`multipart/mixed` withBoundary "XYZABC" withCharset `UTF-8`, + Await.result(Unmarshal(HttpEntity( + `multipart/mixed` withBoundary "XYZABC" withCharset `UTF-8`, """this is |just preamble text""".stripMarginWithNewline("\r\n"))) .to[Multipart.General].failed, 1.second).getMessage shouldEqual "Unexpected end of multipart entity" } "a stray boundary" in { - Await.result(Unmarshal(HttpEntity(`multipart/form-data` withBoundary "ABC" withCharset `UTF-8`, + Await.result(Unmarshal(HttpEntity( + `multipart/form-data` withBoundary "ABC" withCharset `UTF-8`, """--ABC |Content-type: text/plain; charset=UTF8 |--ABCContent-type: application/json @@ -173,7 +186,8 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf .to[Multipart.General].failed, 1.second).getMessage shouldEqual "Illegal multipart boundary in message content" } "duplicate Content-Type header" in { - Await.result(Unmarshal(HttpEntity(`multipart/form-data` withBoundary "-" withCharset `UTF-8`, + Await.result(Unmarshal(HttpEntity( + `multipart/form-data` withBoundary "-" withCharset `UTF-8`, """--- |Content-type: text/plain; charset=UTF8 |Content-type: application/json @@ -185,7 +199,8 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf "multipart part must not contain more than one Content-Type header" } "a missing header-separating CRLF (in Strict entity)" in { - Await.result(Unmarshal(HttpEntity(`multipart/form-data` withBoundary "-" withCharset `UTF-8`, + Await.result(Unmarshal(HttpEntity( + `multipart/form-data` withBoundary "-" withCharset `UTF-8`, """--- |not good here |-----""".stripMarginWithNewline("\r\n"))) @@ -207,19 +222,20 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf "a boundary with a trailing space" in { Await.result( Unmarshal(HttpEntity(`multipart/mixed` withBoundary "simple boundary " withCharset `UTF-8`, ByteString.empty)) - .to[Multipart.General].failed, 1.second).getMessage shouldEqual + .to[Multipart.General].failed, 1.second).getMessage shouldEqual "requirement failed: 'boundary' parameter of multipart Content-Type must not end with a space char" } "a boundary with an illegal character" in { Await.result( Unmarshal(HttpEntity(`multipart/mixed` withBoundary "simple&boundary" withCharset `UTF-8`, ByteString.empty)) - .to[Multipart.General].failed, 1.second).getMessage shouldEqual + .to[Multipart.General].failed, 1.second).getMessage shouldEqual "requirement failed: 'boundary' parameter of multipart Content-Type contains illegal character '&'" } } "multipartByteRangesUnmarshaller should correctly unmarshal multipart/byteranges content with two different parts" in { - Unmarshal(HttpEntity(`multipart/byteranges` withBoundary "12345" withCharset `UTF-8`, + Unmarshal(HttpEntity( + `multipart/byteranges` withBoundary "12345" withCharset `UTF-8`, """--12345 |Content-Range: bytes 0-2/26 |Content-Type: text/plain @@ -237,7 +253,8 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf "multipartFormDataUnmarshaller should correctly unmarshal 'multipart/form-data' content" - { "with one element and no explicit content-type" in { - Unmarshal(HttpEntity(`multipart/form-data` withBoundary "XYZABC" withCharset `UTF-8`, + Unmarshal(HttpEntity( + `multipart/form-data` withBoundary "XYZABC" withCharset `UTF-8`, """--XYZABC |content-disposition: form-data; name=email | @@ -246,7 +263,8 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf Multipart.FormData.BodyPart.Strict("email", HttpEntity(ContentTypes.`text/plain(UTF-8)`, "test@there.com"))) } "with one element" in { - Unmarshal(HttpEntity(`multipart/form-data` withBoundary "XYZABC" withCharset `UTF-8`, + Unmarshal(HttpEntity( + `multipart/form-data` withBoundary "XYZABC" withCharset `UTF-8`, """--XYZABC |content-disposition: form-data; name=email |Content-Type: application/octet-stream @@ -284,7 +302,7 @@ class MultipartUnmarshallersSpec extends FreeSpec with Matchers with BeforeAndAf }) }.to[Multipart.FormData].flatMap(_.toStrict(1.second)) should haveParts( Multipart.FormData.BodyPart.Strict("email", HttpEntity(`application/octet-stream`, ByteString("test@there.com"))), - Multipart.FormData.BodyPart.Strict("userfile", HttpEntity(`application/pdf`, ByteString("filecontent")), Map("filename" -> "test€.dat"), + Multipart.FormData.BodyPart.Strict("userfile", HttpEntity(`application/pdf`, ByteString("filecontent")), Map("filename" → "test€.dat"), List( RawHeader("Content-Transfer-Encoding", "binary"), RawHeader("Content-Additional-1", "anything"), diff --git a/akka-http/src/main/scala/akka/http/javadsl/server/Marshaller.scala b/akka-http/src/main/scala/akka/http/javadsl/server/Marshaller.scala index 179f5d05a3..ee53d5890d 100644 --- a/akka-http/src/main/scala/akka/http/javadsl/server/Marshaller.scala +++ b/akka-http/src/main/scala/akka/http/javadsl/server/Marshaller.scala @@ -20,7 +20,7 @@ import akka.http.javadsl.model.HttpResponse import akka.http.javadsl.model.HttpRequest import akka.http.javadsl.model.RequestEntity import akka.util.ByteString -import akka.http.scaladsl.model.{FormData, HttpCharset} +import akka.http.scaladsl.model.{ FormData, HttpCharset } import akka.http.javadsl.model.StatusCode import akka.http.javadsl.model.HttpHeader @@ -36,18 +36,18 @@ object Marshaller { def fromScala[A, B](scalaMarshaller: marshalling.Marshaller[A, B]): Marshaller[A, B] = new Marshaller()(scalaMarshaller) /** - * Safe downcasting of the output type of the marshaller to a superclass. + * Safe downcasting of the output type of the marshaller to a superclass. * - * Marshaller is covariant in B, i.e. if B2 is a subclass of B1, - * then Marshaller[X,B2] is OK to use where Marshaller[X,B1] is expected. + * Marshaller is covariant in B, i.e. if B2 is a subclass of B1, + * then Marshaller[X,B2] is OK to use where Marshaller[X,B1] is expected. */ def downcast[A, B1, B2 <: B1](m: Marshaller[A, B2]): Marshaller[A, B1] = m.asInstanceOf[Marshaller[A, B1]] /** - * Safe downcasting of the output type of the marshaller to a superclass. + * Safe downcasting of the output type of the marshaller to a superclass. * - * Marshaller is covariant in B, i.e. if B2 is a subclass of B1, - * then Marshaller[X,B2] is OK to use where Marshaller[X,B1] is expected. + * Marshaller is covariant in B, i.e. if B2 is a subclass of B1, + * then Marshaller[X,B2] is OK to use where Marshaller[X,B1] is expected. */ def downcast[A, B1, B2 <: B1](m: Marshaller[A, B2], target: Class[B1]): Marshaller[A, B1] = m.asInstanceOf[Marshaller[A, B1]] @@ -64,20 +64,18 @@ object Marshaller { def byteStringMarshaller(t: ContentType): Marshaller[ByteString, RequestEntity] = fromScala(scaladsl.marshalling.Marshaller.byteStringMarshaller(t.asScala)) - // TODO make sure these are actually usable in a sane way def wrapEntity[A, C](f: function.BiFunction[ExecutionContext, C, A], m: Marshaller[A, RequestEntity], mediaType: MediaType): Marshaller[C, RequestEntity] = { val scalaMarshaller = m.asScalaToEntityMarshaller - fromScala(scalaMarshaller.wrapWithEC(mediaType.asScala) { ctx => c: C => f(ctx, c) } (ContentTypeOverrider.forEntity)) + fromScala(scalaMarshaller.wrapWithEC(mediaType.asScala) { ctx ⇒ c: C ⇒ f(ctx, c) }(ContentTypeOverrider.forEntity)) } def wrapEntity[A, C, E <: RequestEntity](f: function.Function[C, A], m: Marshaller[A, E], mediaType: MediaType): Marshaller[C, RequestEntity] = { val scalaMarshaller = m.asScalaToEntityMarshaller - fromScala(scalaMarshaller.wrap(mediaType.asScala)((in: C) => f.apply(in))(ContentTypeOverrider.forEntity)) + fromScala(scalaMarshaller.wrap(mediaType.asScala)((in: C) ⇒ f.apply(in))(ContentTypeOverrider.forEntity)) } - def entityToOKResponse[A](m: Marshaller[A, _ <: RequestEntity]): Marshaller[A, HttpResponse] = { fromScala(marshalling.Marshaller.fromToEntityMarshaller[A]()(m.asScalaToEntityMarshaller)) } @@ -144,9 +142,7 @@ object Marshaller { * Helper for creating a synchronous [[Marshaller]] to non-negotiable content from the given function. */ def opaque[A, B](f: function.Function[A, B]): Marshaller[A, B] = - fromScala(scaladsl.marshalling.Marshaller.opaque[A, B] { a => f.apply(a) }) - - + fromScala(scaladsl.marshalling.Marshaller.opaque[A, B] { a ⇒ f.apply(a) }) implicit def asScalaToResponseMarshaller[T](m: Marshaller[T, akka.http.javadsl.model.HttpResponse]): ToResponseMarshaller[T] = m.asScala.map(_.asScala) @@ -155,7 +151,7 @@ object Marshaller { m.asScala.map(_.asScala) } -class Marshaller[A, B] private(implicit val asScala: marshalling.Marshaller[A, B]) { +class Marshaller[A, B] private (implicit val asScala: marshalling.Marshaller[A, B]) { import Marshaller.fromScala // TODO would be nice to not need this special case diff --git a/akka-http/src/main/scala/akka/http/javadsl/server/RejectionHandler.scala b/akka-http/src/main/scala/akka/http/javadsl/server/RejectionHandler.scala index b3d3a5df5f..727f9e3529 100644 --- a/akka-http/src/main/scala/akka/http/javadsl/server/RejectionHandler.scala +++ b/akka-http/src/main/scala/akka/http/javadsl/server/RejectionHandler.scala @@ -13,7 +13,7 @@ object RejectionHandler { * Creates a new [[RejectionHandler]] builder. */ def newBuilder = new RejectionHandlerBuilder(server.RejectionHandler.newBuilder) - + def defaultHandler = new RejectionHandler(server.RejectionHandler.default) } @@ -22,7 +22,7 @@ final class RejectionHandler(val asScala: server.RejectionHandler) { * Creates a new [[RejectionHandler]] which uses the given one as fallback for this one. */ def withFallback(fallback: RejectionHandler) = new RejectionHandler(asScala.withFallback(fallback.asScala)) - + /** * "Seals" this handler by attaching a default handler as fallback if necessary. */ @@ -31,24 +31,24 @@ final class RejectionHandler(val asScala: server.RejectionHandler) { class RejectionHandlerBuilder(asScala: server.RejectionHandler.Builder) { def build = new RejectionHandler(asScala.result()) - + /** * Handles a single [[Rejection]] with the given partial function. */ def handle[T <: Rejection](t: Class[T], handler: function.Function[T, Route]): RejectionHandlerBuilder = { - asScala.handle { case r if t.isInstance(r) => handler.apply(t.cast(r)).delegate } + asScala.handle { case r if t.isInstance(r) ⇒ handler.apply(t.cast(r)).delegate } this } - + /** * Handles several Rejections of the same type at the same time. * The list passed to the given function is guaranteed to be non-empty. */ def handleAll[T <: Rejection](t: Class[T], handler: function.Function[java.util.List[T], Route]): RejectionHandlerBuilder = { - asScala.handleAll { rejections:collection.immutable.Seq[T] => handler.apply(rejections.asJava).delegate } (ClassTag(t)) + asScala.handleAll { rejections: collection.immutable.Seq[T] ⇒ handler.apply(rejections.asJava).delegate }(ClassTag(t)) this } - + /** * Handles the special "not found" case using the given [[Route]]. */ @@ -58,13 +58,13 @@ class RejectionHandlerBuilder(asScala: server.RejectionHandler.Builder) { } /** - * Convenience method for handling rejections created by created by the onCompleteWithBreaker directive. - * Signals that the request was rejected because the supplied circuit breaker is open and requests are failing fast. - * - * Use to customise the error response being written instead of the default [[akka.http.javadsl.model.StatusCodes.SERVICE_UNAVAILABLE]] response. - */ + * Convenience method for handling rejections created by created by the onCompleteWithBreaker directive. + * Signals that the request was rejected because the supplied circuit breaker is open and requests are failing fast. + * + * Use to customise the error response being written instead of the default [[akka.http.javadsl.model.StatusCodes.SERVICE_UNAVAILABLE]] response. + */ def handleCircuitBreakerOpenRejection(handler: function.Function[CircuitBreakerOpenRejection, Route]): RejectionHandlerBuilder = { - asScala.handleCircuitBreakerOpenRejection(t => handler.apply(t).delegate) + asScala.handleCircuitBreakerOpenRejection(t ⇒ handler.apply(t).delegate) this } } diff --git a/akka-http/src/main/scala/akka/http/javadsl/server/Rejections.scala b/akka-http/src/main/scala/akka/http/javadsl/server/Rejections.scala index 6be926f852..a9cbe31da9 100644 --- a/akka-http/src/main/scala/akka/http/javadsl/server/Rejections.scala +++ b/akka-http/src/main/scala/akka/http/javadsl/server/Rejections.scala @@ -351,8 +351,9 @@ object Rejections { def requestEntityExpected = RequestEntityExpectedRejection - def unacceptedResponseContentType(supportedContentTypes: java.lang.Iterable[ContentType], - supportedMediaTypes: java.lang.Iterable[MediaType]): UnacceptedResponseContentTypeRejection = { + def unacceptedResponseContentType( + supportedContentTypes: java.lang.Iterable[ContentType], + supportedMediaTypes: java.lang.Iterable[MediaType]): UnacceptedResponseContentTypeRejection = { val s1: Set[Alternative] = supportedContentTypes.asScala.map(_.asScala).map(ct ⇒ ContentNegotiator.Alternative(ct)).toSet val s2: Set[Alternative] = supportedMediaTypes.asScala.map(_.asScala).map(mt ⇒ ContentNegotiator.Alternative(mt)).toSet s.UnacceptedResponseContentTypeRejection(s1 ++ s2) diff --git a/akka-http/src/main/scala/akka/http/javadsl/server/RequestContext.scala b/akka-http/src/main/scala/akka/http/javadsl/server/RequestContext.scala index 0d60b59447..26c474f11b 100644 --- a/akka-http/src/main/scala/akka/http/javadsl/server/RequestContext.scala +++ b/akka-http/src/main/scala/akka/http/javadsl/server/RequestContext.scala @@ -35,9 +35,9 @@ class RequestContext private (val delegate: scaladsl.server.RequestContext) { def reconfigure( executionContext: ExecutionContextExecutor, - materializer: Materializer, - log: LoggingAdapter, - settings: RoutingSettings): RequestContext = wrap(delegate.reconfigure(executionContext, materializer, log, settings.asScala)) + materializer: Materializer, + log: LoggingAdapter, + settings: RoutingSettings): RequestContext = wrap(delegate.reconfigure(executionContext, materializer, log, settings.asScala)) def complete[T](value: T, marshaller: Marshaller[T, HttpResponse]): CompletionStage[RouteResult] = { delegate.complete(ToResponseMarshallable(value)(marshaller)) diff --git a/akka-http/src/main/scala/akka/http/javadsl/server/Route.scala b/akka-http/src/main/scala/akka/http/javadsl/server/Route.scala index 009fc2926c..e16cc0a2f0 100644 --- a/akka-http/src/main/scala/akka/http/javadsl/server/Route.scala +++ b/akka-http/src/main/scala/akka/http/javadsl/server/Route.scala @@ -47,12 +47,13 @@ trait Route { /** * "Seals" a route by wrapping it with explicit exception handling and rejection conversion. */ - def seal(routingSettings: RoutingSettings, - parserSettings: ParserSettings, - rejectionHandler: RejectionHandler, - exceptionHandler: ExceptionHandler, - system: ActorSystem, - materializer: Materializer): Route + def seal( + routingSettings: RoutingSettings, + parserSettings: ParserSettings, + rejectionHandler: RejectionHandler, + exceptionHandler: ExceptionHandler, + system: ActorSystem, + materializer: Materializer): Route def orElse(alternative: Route): Route } diff --git a/akka-http/src/main/scala/akka/http/javadsl/server/Unmarshaller.scala b/akka-http/src/main/scala/akka/http/javadsl/server/Unmarshaller.scala index 718b8b7ddf..7d06ea7ff9 100644 --- a/akka-http/src/main/scala/akka/http/javadsl/server/Unmarshaller.scala +++ b/akka-http/src/main/scala/akka/http/javadsl/server/Unmarshaller.scala @@ -41,16 +41,14 @@ object Unmarshaller { * Creates an unmarshaller from an asynchronous Java function. */ def async[A, B](f: java.util.function.Function[A, CompletionStage[B]]): Unmarshaller[A, B] = - unmarshalling.Unmarshaller[A, B] { - ctx ⇒ a ⇒ f(a).toScala + unmarshalling.Unmarshaller[A, B] { ctx ⇒ a ⇒ f(a).toScala } /** * Creates an unmarshaller from a Java function. */ def sync[A, B](f: java.util.function.Function[A, B]): Unmarshaller[A, B] = - unmarshalling.Unmarshaller[A, B] { - ctx ⇒ a ⇒ scala.concurrent.Future.successful(f.apply(a)) + unmarshalling.Unmarshaller[A, B] { ctx ⇒ a ⇒ scala.concurrent.Future.successful(f.apply(a)) } // format: OFF @@ -65,14 +63,13 @@ object Unmarshaller { unmarshalling.Unmarshaller.strict[HttpRequest, RequestEntity](_.entity) def forMediaType[B](t: MediaType, um: Unmarshaller[HttpEntity, B]): Unmarshaller[HttpEntity, B] = { - unmarshalling.Unmarshaller.withMaterializer[HttpEntity, B] { implicit ex ⇒ - implicit mat ⇒ jEntity ⇒ { - val entity = jEntity.asScala - val mediaType = t.asScala - if (entity.contentType == ContentTypes.NoContentType || mediaType.matches(entity.contentType.mediaType)) { - um.asScala(entity) - } else FastFuture.failed(UnsupportedContentTypeException(ContentTypeRange(t.toRange.asScala))) - } + unmarshalling.Unmarshaller.withMaterializer[HttpEntity, B] { implicit ex ⇒ implicit mat ⇒ jEntity ⇒ { + val entity = jEntity.asScala + val mediaType = t.asScala + if (entity.contentType == ContentTypes.NoContentType || mediaType.matches(entity.contentType.mediaType)) { + um.asScala(entity) + } else FastFuture.failed(UnsupportedContentTypeException(ContentTypeRange(t.toRange.asScala))) + } } } diff --git a/akka-http/src/main/scala/akka/http/javadsl/server/directives/DebuggingDirectives.scala b/akka-http/src/main/scala/akka/http/javadsl/server/directives/DebuggingDirectives.scala index e8bab166df..32865014e0 100644 --- a/akka-http/src/main/scala/akka/http/javadsl/server/directives/DebuggingDirectives.scala +++ b/akka-http/src/main/scala/akka/http/javadsl/server/directives/DebuggingDirectives.scala @@ -66,9 +66,10 @@ abstract class DebuggingDirectives extends CookieDirectives { * @param showSuccess Function invoked when the route result was successful and yielded an HTTP response * @param showRejection Function invoked when the route yielded a rejection */ - def logResult(showSuccess: JFunction[HttpResponse, LogEntry], - showRejection: JFunction[JList[Rejection], LogEntry], - inner: Supplier[Route]) = RouteAdapter { + def logResult( + showSuccess: JFunction[HttpResponse, LogEntry], + showRejection: JFunction[JList[Rejection], LogEntry], + inner: Supplier[Route]) = RouteAdapter { D.logResult(LoggingMagnet.forMessageFromFullShow { case RouteResult.Complete(response) ⇒ showSuccess.apply(response).asScala case RouteResult.Rejected(rejections) ⇒ showRejection.apply(rejections.asJava).asScala @@ -83,9 +84,10 @@ abstract class DebuggingDirectives extends CookieDirectives { * @param showSuccess Function invoked when the route result was successful and yielded an HTTP response * @param showRejection Function invoked when the route yielded a rejection */ - def logRequestResult(showSuccess: BiFunction[HttpRequest, HttpResponse, LogEntry], - showRejection: BiFunction[HttpRequest, JList[Rejection], LogEntry], - inner: Supplier[Route]) = RouteAdapter { + def logRequestResult( + showSuccess: BiFunction[HttpRequest, HttpResponse, LogEntry], + showRejection: BiFunction[HttpRequest, JList[Rejection], LogEntry], + inner: Supplier[Route]) = RouteAdapter { D.logRequestResult(LoggingMagnet.forRequestResponseFromFullShow(request ⇒ { case RouteResult.Complete(response) ⇒ Some(showSuccess.apply(request, response).asScala) case RouteResult.Rejected(rejections) ⇒ Some(showRejection.apply(request, rejections.asJava).asScala) @@ -101,9 +103,10 @@ abstract class DebuggingDirectives extends CookieDirectives { * @param showRejection Function invoked when the route yielded a rejection */ @CorrespondsTo("logRequestResult") - def logRequestResultOptional(showSuccess: BiFunction[HttpRequest, HttpResponse, Optional[LogEntry]], - showRejection: BiFunction[HttpRequest, JList[Rejection], Optional[LogEntry]], - inner: Supplier[Route]) = RouteAdapter { + def logRequestResultOptional( + showSuccess: BiFunction[HttpRequest, HttpResponse, Optional[LogEntry]], + showRejection: BiFunction[HttpRequest, JList[Rejection], Optional[LogEntry]], + inner: Supplier[Route]) = RouteAdapter { D.logRequestResult(LoggingMagnet.forRequestResponseFromFullShow(request ⇒ { case RouteResult.Complete(response) ⇒ showSuccess.apply(request, response).asScala case RouteResult.Rejected(rejections) ⇒ showRejection.apply(request, rejections.asJava).asScala diff --git a/akka-http/src/main/scala/akka/http/javadsl/server/directives/HeaderDirectives.scala b/akka-http/src/main/scala/akka/http/javadsl/server/directives/HeaderDirectives.scala index c650e700b1..ebc94285bb 100644 --- a/akka-http/src/main/scala/akka/http/javadsl/server/directives/HeaderDirectives.scala +++ b/akka-http/src/main/scala/akka/http/javadsl/server/directives/HeaderDirectives.scala @@ -4,35 +4,35 @@ package akka.http.javadsl.server.directives import java.util.Optional -import java.util.{function => jf} +import java.util.{ function ⇒ jf } import akka.actor.ReflectiveDynamicAccess import scala.compat.java8.OptionConverters import scala.compat.java8.OptionConverters._ import akka.http.impl.util.JavaMapping.Implicits._ -import akka.http.javadsl.model.{HttpHeader, StatusCodes} +import akka.http.javadsl.model.{ HttpHeader, StatusCodes } import akka.http.javadsl.model.headers.HttpOriginRange -import akka.http.javadsl.server.{InvalidOriginRejection, MissingHeaderRejection, Route} -import akka.http.scaladsl.model.headers.{ModeledCustomHeader, ModeledCustomHeaderCompanion, Origin} -import akka.http.scaladsl.server.directives.{HeaderMagnet, BasicDirectives => B, HeaderDirectives => D} +import akka.http.javadsl.server.{ InvalidOriginRejection, MissingHeaderRejection, Route } +import akka.http.scaladsl.model.headers.{ ModeledCustomHeader, ModeledCustomHeaderCompanion, Origin } +import akka.http.scaladsl.server.directives.{ HeaderMagnet, BasicDirectives ⇒ B, HeaderDirectives ⇒ D } import akka.stream.ActorMaterializer import scala.reflect.ClassTag -import scala.util.{Failure, Success} +import scala.util.{ Failure, Success } abstract class HeaderDirectives extends FutureDirectives { private type ScalaHeaderMagnet = HeaderMagnet[akka.http.scaladsl.model.HttpHeader] /** - * Checks that request comes from the same origin. Extracts the [[Origin]] header value and verifies that - * allowed range contains the obtained value. In the case of absent of the [[Origin]] header rejects - * with [[MissingHeaderRejection]]. If the origin value is not in the allowed range - * rejects with an [[InvalidOriginRejection]] and [[StatusCodes.FORBIDDEN]] status. - * - * @group header - */ + * Checks that request comes from the same origin. Extracts the [[Origin]] header value and verifies that + * allowed range contains the obtained value. In the case of absent of the [[Origin]] header rejects + * with [[MissingHeaderRejection]]. If the origin value is not in the allowed range + * rejects with an [[InvalidOriginRejection]] and [[StatusCodes.FORBIDDEN]] status. + * + * @group header + */ def checkSameOrigin(allowed: HttpOriginRange, inner: jf.Supplier[Route]): Route = RouteAdapter { D.checkSameOrigin(allowed.asScala) { inner.get().delegate } } @@ -43,27 +43,27 @@ abstract class HeaderDirectives extends FutureDirectives { * with a [[akka.http.javadsl.server.MalformedHeaderRejection]]. */ def headerValue[T](f: jf.Function[HttpHeader, Optional[T]], inner: jf.Function[T, Route]) = RouteAdapter { - D.headerValue(h => f.apply(h).asScala) { value => + D.headerValue(h ⇒ f.apply(h).asScala) { value ⇒ inner.apply(value).delegate } } - + /** * Extracts an HTTP header value using the given partial function. If the function is undefined for all headers the * request is rejected with an empty rejection set. */ def headerValuePF[T](pf: PartialFunction[HttpHeader, T], inner: jf.Function[T, Route]) = RouteAdapter { - D.headerValuePF(pf) { value => + D.headerValuePF(pf) { value ⇒ inner.apply(value).delegate } } - + /** * Extracts the value of the first HTTP request header with the given name. * If no header with a matching name is found the request is rejected with a [[akka.http.javadsl.server.MissingHeaderRejection]]. */ def headerValueByName(headerName: String, inner: jf.Function[String, Route]) = RouteAdapter { - D.headerValueByName(headerName) { value => + D.headerValueByName(headerName) { value ⇒ inner.apply(value).delegate } } @@ -78,15 +78,15 @@ abstract class HeaderDirectives extends FutureDirectives { // figure out the modeled header companion and use that to parse the header val refl = new ReflectiveDynamicAccess(getClass.getClassLoader) refl.getObjectFor[ModeledCustomHeaderCompanion[_]](t.getName) match { - case Success(companion) => + case Success(companion) ⇒ new HeaderMagnet[T] { override def classTag = ClassTag(t) override def runtimeClass = t override def extractPF = { - case h if h.is(companion.lowercaseName) => companion.apply(h.toString).asInstanceOf[T] + case h if h.is(companion.lowercaseName) ⇒ companion.apply(h.toString).asInstanceOf[T] } } - case Failure(ex) => throw new RuntimeException(s"Failed to find or access the ModeledCustomHeaderCompanion for [${t.getName}]", ex) + case Failure(ex) ⇒ throw new RuntimeException(s"Failed to find or access the ModeledCustomHeaderCompanion for [${t.getName}]", ex) } } @@ -94,39 +94,39 @@ abstract class HeaderDirectives extends FutureDirectives { if (classOf[ModeledCustomHeader[_]].isAssignableFrom(t)) magnetForModeledCustomHeader(t) else HeaderMagnet.fromClassNormalJavaHeader(t) - D.headerValueByType(magnet) { value => + D.headerValueByType(magnet) { value ⇒ inner.apply(value).delegate } } - + /** * Extracts an optional HTTP header value using the given function. * If the given function throws an exception the request is rejected * with a [[akka.http.javadsl.server.MalformedHeaderRejection]]. */ def optionalHeaderValue[T](f: jf.Function[HttpHeader, Optional[T]], inner: jf.Function[Optional[T], Route]) = RouteAdapter { - D.optionalHeaderValue(h => f.apply(h).asScala) { value => + D.optionalHeaderValue(h ⇒ f.apply(h).asScala) { value ⇒ inner.apply(value.asJava).delegate } } - + /** * Extracts an optional HTTP header value using the given partial function. * If the given function throws an exception the request is rejected * with a [[akka.http.javadsl.server.MalformedHeaderRejection]]. */ def optionalHeaderValuePF[T](pf: PartialFunction[HttpHeader, T], inner: jf.Function[Optional[T], Route]) = RouteAdapter { - D.optionalHeaderValuePF(pf) { value => + D.optionalHeaderValuePF(pf) { value ⇒ inner.apply(value.asJava).delegate } } - + /** * Extracts the value of the optional HTTP request header with the given name. */ def optionalHeaderValueByName(headerName: String, inner: jf.Function[Optional[String], Route]) = RouteAdapter { - D.optionalHeaderValueByName(headerName) { value => + D.optionalHeaderValueByName(headerName) { value ⇒ inner.apply(value.asJava).delegate } } @@ -139,10 +139,10 @@ abstract class HeaderDirectives extends FutureDirectives { def optionalHeaderValueByType[T <: HttpHeader](t: Class[T], inner: jf.Function[Optional[T], Route]) = RouteAdapter { // TODO custom headers don't work yet // TODO needs instance of check if it's a modeled header and then magically locate companion - D.optionalHeaderValueByType(HeaderMagnet.fromClassNormalJavaHeader(t).asInstanceOf[ScalaHeaderMagnet]) { value => + D.optionalHeaderValueByType(HeaderMagnet.fromClassNormalJavaHeader(t).asInstanceOf[ScalaHeaderMagnet]) { value ⇒ val valueT = value.asInstanceOf[Option[T]] // we know this is safe because T <: HttpHeader inner.apply(OptionConverters.toJava[T](valueT)).delegate } } - + } diff --git a/akka-http/src/main/scala/akka/http/javadsl/server/directives/MarshallingDirectives.scala b/akka-http/src/main/scala/akka/http/javadsl/server/directives/MarshallingDirectives.scala index b358173db0..8bad98b2d3 100644 --- a/akka-http/src/main/scala/akka/http/javadsl/server/directives/MarshallingDirectives.scala +++ b/akka-http/src/main/scala/akka/http/javadsl/server/directives/MarshallingDirectives.scala @@ -16,8 +16,9 @@ abstract class MarshallingDirectives extends HostDirectives { * If there is a problem with unmarshalling the request is rejected with the [[akka.http.javadsl.server.Rejection]] * produced by the unmarshaller. */ - def request[T](unmarshaller: Unmarshaller[_ >: HttpRequest, T], - inner: java.util.function.Function[T, Route]): Route = RouteAdapter { + def request[T]( + unmarshaller: Unmarshaller[_ >: HttpRequest, T], + inner: java.util.function.Function[T, Route]): Route = RouteAdapter { D.entity(unmarshaller.asScala) { value ⇒ inner.apply(value).delegate } @@ -28,8 +29,9 @@ abstract class MarshallingDirectives extends HostDirectives { * If there is a problem with unmarshalling the request is rejected with the [[akka.http.javadsl.server.Rejection]] * produced by the unmarshaller. */ - def entity[T](unmarshaller: Unmarshaller[_ >: HttpEntity, T], - inner: java.util.function.Function[T, Route]): Route = RouteAdapter { + def entity[T]( + unmarshaller: Unmarshaller[_ >: HttpEntity, T], + inner: java.util.function.Function[T, Route]): Route = RouteAdapter { D.entity(Unmarshaller.requestToEntity.flatMap(unmarshaller).asScala) { value ⇒ inner.apply(value).delegate } diff --git a/akka-http/src/main/scala/akka/http/javadsl/server/directives/SecurityDirectives.scala b/akka-http/src/main/scala/akka/http/javadsl/server/directives/SecurityDirectives.scala index 1500da97e5..f25d08aa42 100644 --- a/akka-http/src/main/scala/akka/http/javadsl/server/directives/SecurityDirectives.scala +++ b/akka-http/src/main/scala/akka/http/javadsl/server/directives/SecurityDirectives.scala @@ -5,16 +5,16 @@ package akka.http.javadsl.server.directives import java.util.Optional import java.util.concurrent.CompletionStage -import java.util.function.{Function => JFunction} +import java.util.function.{ Function ⇒ JFunction } import java.util.function.Supplier import scala.compat.java8.FutureConverters._ import scala.compat.java8.OptionConverters._ import akka.http.javadsl.model.headers.HttpChallenge import akka.http.javadsl.model.headers.HttpCredentials -import akka.http.javadsl.server.{RequestContext, Route} +import akka.http.javadsl.server.{ RequestContext, Route } import akka.http.scaladsl -import akka.http.scaladsl.server.{AuthorizationFailedRejection, Directives => D} +import akka.http.scaladsl.server.{ AuthorizationFailedRejection, Directives ⇒ D } object SecurityDirectives { /** @@ -25,19 +25,19 @@ object SecurityDirectives { * The username or token provided with the credentials */ def identifier: String = asScala.identifier - + /** * Safely compares the passed in `secret` with the received secret part of the Credentials. * Use of this method instead of manual String equality testing is recommended in order to guard against timing attacks. * * See also [[akka.http.impl.util.EnhancedString#secure_==]], for more information. */ - def verify(secret: String): Boolean = asScala.verify(secret) + def verify(secret: String): Boolean = asScala.verify(secret) } - + private def toJava(cred: scaladsl.server.directives.Credentials): Optional[ProvidedCredentials] = cred match { - case provided: scaladsl.server.directives.Credentials.Provided => Optional.of(ProvidedCredentials(provided)) - case _ => Optional.empty() + case provided: scaladsl.server.directives.Credentials.Provided ⇒ Optional.of(ProvidedCredentials(provided)) + case _ ⇒ Optional.empty() } } @@ -49,167 +49,169 @@ abstract class SecurityDirectives extends SchemeDirectives { * Extracts the potentially present [[HttpCredentials]] provided with the request's [[akka.http.javadsl.model.headers.Authorization]] header. */ def extractCredentials(inner: JFunction[Optional[HttpCredentials], Route]): Route = RouteAdapter { - D.extractCredentials { cred => + D.extractCredentials { cred ⇒ inner.apply(cred.map(_.asJava).asJava).delegate // TODO attempt to not need map() } } - + /** * Wraps the inner route with Http Basic authentication support using a given `Authenticator[T]`. * The given authenticator determines whether the credentials in the request are valid * and, if so, which user object to supply to the inner route. - * + * * Authentication is required in this variant, i.e. the request is rejected if [authenticator] returns Optional.empty. */ - def authenticateBasic[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], Optional[T]], + def authenticateBasic[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], Optional[T]], inner: JFunction[T, Route]): Route = RouteAdapter { - D.authenticateBasic(realm, c => authenticator.apply(toJava(c)).asScala) { t => + D.authenticateBasic(realm, c ⇒ authenticator.apply(toJava(c)).asScala) { t ⇒ inner.apply(t).delegate } } - + /** * Wraps the inner route with Http Basic authentication support using a given `Authenticator[T]`. * The given authenticator determines whether the credentials in the request are valid * and, if so, which user object to supply to the inner route. - * + * * Authentication is optional in this variant. */ @CorrespondsTo("authenticateBasic") - def authenticateBasicOptional[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], Optional[T]], + def authenticateBasicOptional[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], Optional[T]], inner: JFunction[Optional[T], Route]): Route = RouteAdapter { - D.authenticateBasic(realm, c => authenticator.apply(toJava(c)).asScala).optional { t => + D.authenticateBasic(realm, c ⇒ authenticator.apply(toJava(c)).asScala).optional { t ⇒ inner.apply(t.asJava).delegate } } - + /** * Wraps the inner route with Http Basic authentication support. * The given authenticator determines whether the credentials in the request are valid * and, if so, which user object to supply to the inner route. - * + * * Authentication is required in this variant, i.e. the request is rejected if [authenticator] returns Optional.empty. */ - def authenticateBasicAsync[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], CompletionStage[Optional[T]]], + def authenticateBasicAsync[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], CompletionStage[Optional[T]]], inner: JFunction[T, Route]): Route = RouteAdapter { - D.extractExecutionContext { implicit ctx => - D.authenticateBasicAsync(realm, c => authenticator.apply(toJava(c)).toScala.map(_.asScala)) { t => + D.extractExecutionContext { implicit ctx ⇒ + D.authenticateBasicAsync(realm, c ⇒ authenticator.apply(toJava(c)).toScala.map(_.asScala)) { t ⇒ inner.apply(t).delegate } } } - + /** * Wraps the inner route with Http Basic authentication support. * The given authenticator determines whether the credentials in the request are valid * and, if so, which user object to supply to the inner route. - * + * * Authentication is optional in this variant. */ @CorrespondsTo("authenticateBasicAsync") - def authenticateBasicAsyncOptional[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], CompletionStage[Optional[T]]], + def authenticateBasicAsyncOptional[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], CompletionStage[Optional[T]]], inner: JFunction[Optional[T], Route]): Route = RouteAdapter { - D.extractExecutionContext { implicit ctx => - D.authenticateBasicAsync(realm, c => authenticator.apply(toJava(c)).toScala.map(_.asScala)).optional { t => + D.extractExecutionContext { implicit ctx ⇒ + D.authenticateBasicAsync(realm, c ⇒ authenticator.apply(toJava(c)).toScala.map(_.asScala)).optional { t ⇒ inner.apply(t.asJava).delegate } } } - + /** * A directive that wraps the inner route with OAuth2 Bearer Token authentication support. * The given authenticator determines whether the credentials in the request are valid * and, if so, which user object to supply to the inner route. - * + * * Authentication is required in this variant, i.e. the request is rejected if [authenticator] returns Optional.empty. */ - def authenticateOAuth2[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], Optional[T]], + def authenticateOAuth2[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], Optional[T]], inner: JFunction[T, Route]): Route = RouteAdapter { - D.authenticateOAuth2(realm, c => authenticator.apply(toJava(c)).asScala) { t => + D.authenticateOAuth2(realm, c ⇒ authenticator.apply(toJava(c)).asScala) { t ⇒ inner.apply(t).delegate } } - + /** * A directive that wraps the inner route with OAuth2 Bearer Token authentication support. * The given authenticator determines whether the credentials in the request are valid * and, if so, which user object to supply to the inner route. - * + * * Authentication is optional in this variant. */ @CorrespondsTo("authenticateOAuth2") - def authenticateOAuth2Optional[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], Optional[T]], + def authenticateOAuth2Optional[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], Optional[T]], inner: JFunction[Optional[T], Route]): Route = RouteAdapter { - D.authenticateOAuth2(realm, c => authenticator.apply(toJava(c)).asScala).optional { t => + D.authenticateOAuth2(realm, c ⇒ authenticator.apply(toJava(c)).asScala).optional { t ⇒ inner.apply(t.asJava).delegate } } - + /** * A directive that wraps the inner route with OAuth2 Bearer Token authentication support. * The given authenticator determines whether the credentials in the request are valid * and, if so, which user object to supply to the inner route. - * + * * Authentication is required in this variant, i.e. the request is rejected if [authenticator] returns Optional.empty. */ - def authenticateOAuth2Async[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], CompletionStage[Optional[T]]], - inner: JFunction[T, Route]): Route = RouteAdapter { - D.extractExecutionContext { implicit ctx => - D.authenticateOAuth2Async(realm, c => authenticator.apply(toJava(c)).toScala.map(_.asScala)) { t => + def authenticateOAuth2Async[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], CompletionStage[Optional[T]]], + inner: JFunction[T, Route]): Route = RouteAdapter { + D.extractExecutionContext { implicit ctx ⇒ + D.authenticateOAuth2Async(realm, c ⇒ authenticator.apply(toJava(c)).toScala.map(_.asScala)) { t ⇒ inner.apply(t).delegate } } } - + /** * A directive that wraps the inner route with OAuth2 Bearer Token authentication support. * The given authenticator determines whether the credentials in the request are valid * and, if so, which user object to supply to the inner route. - * + * * Authentication is optional in this variant. */ @CorrespondsTo("authenticateOAuth2Async") def authenticateOAuth2AsyncOptional[T](realm: String, authenticator: JFunction[Optional[ProvidedCredentials], CompletionStage[Optional[T]]], inner: JFunction[Optional[T], Route]): Route = RouteAdapter { - D.extractExecutionContext { implicit ctx => - D.authenticateOAuth2Async(realm, c => authenticator.apply(toJava(c)).toScala.map(_.asScala)).optional { t => + D.extractExecutionContext { implicit ctx ⇒ + D.authenticateOAuth2Async(realm, c ⇒ authenticator.apply(toJava(c)).toScala.map(_.asScala)).optional { t ⇒ inner.apply(t.asJava).delegate } } } - + /** * Lifts an authenticator function into a directive. The authenticator function gets passed in credentials from the * [[akka.http.javadsl.model.headers.Authorization]] header of the request. If the function returns `Right(user)` the user object is provided * to the inner route. If the function returns `Left(challenge)` the request is rejected with an * [[akka.http.javadsl.server.AuthenticationFailedRejection]] that contains this challenge to be added to the response. */ - def authenticateOrRejectWithChallenge[T](authenticator: JFunction[Optional[HttpCredentials], CompletionStage[Either[HttpChallenge,T]]], - inner: JFunction[T, Route]): Route = RouteAdapter { - D.extractExecutionContext { implicit ctx => - val scalaAuthenticator = { cred: Option[scaladsl.model.headers.HttpCredentials] => + def authenticateOrRejectWithChallenge[T]( + authenticator: JFunction[Optional[HttpCredentials], CompletionStage[Either[HttpChallenge, T]]], + inner: JFunction[T, Route]): Route = RouteAdapter { + D.extractExecutionContext { implicit ctx ⇒ + val scalaAuthenticator = { cred: Option[scaladsl.model.headers.HttpCredentials] ⇒ authenticator.apply(cred.map(_.asJava).asJava).toScala.map(_.left.map(_.asScala)) } - - D.authenticateOrRejectWithChallenge(scalaAuthenticator) { t => + + D.authenticateOrRejectWithChallenge(scalaAuthenticator) { t ⇒ inner.apply(t).delegate } } } - + /** * Lifts an authenticator function into a directive. Same as `authenticateOrRejectWithChallenge` * but only applies the authenticator function with a certain type of credentials. */ - def authenticateOrRejectWithChallenge[C <: HttpCredentials, T](c: Class[C], - authenticator: JFunction[Optional[C], CompletionStage[Either[HttpChallenge,T]]], - inner: JFunction[T, Route]): Route = RouteAdapter { - D.extractExecutionContext { implicit ctx => - val scalaAuthenticator = { cred: Option[scaladsl.model.headers.HttpCredentials] => + def authenticateOrRejectWithChallenge[C <: HttpCredentials, T]( + c: Class[C], + authenticator: JFunction[Optional[C], CompletionStage[Either[HttpChallenge, T]]], + inner: JFunction[T, Route]): Route = RouteAdapter { + D.extractExecutionContext { implicit ctx ⇒ + val scalaAuthenticator = { cred: Option[scaladsl.model.headers.HttpCredentials] ⇒ authenticator.apply(cred.filter(c.isInstance).map(_.asJava).asJava.asInstanceOf[Optional[C]]).toScala.map(_.left.map(_.asScala)) // TODO make sure cast is safe } - - D.authenticateOrRejectWithChallenge(scalaAuthenticator) { t => + + D.authenticateOrRejectWithChallenge(scalaAuthenticator) { t ⇒ inner.apply(t).delegate } } @@ -231,7 +233,7 @@ abstract class SecurityDirectives extends SchemeDirectives { */ @CorrespondsTo("authorize") def authorizeWithRequestContext(check: akka.japi.function.Function[RequestContext, Boolean], inner: Supplier[Route]): Route = RouteAdapter { - D.authorize(rc => check(RequestContext.wrap(rc)))(inner.get().delegate) + D.authorize(rc ⇒ check(RequestContext.wrap(rc)))(inner.get().delegate) } /** @@ -251,12 +253,12 @@ abstract class SecurityDirectives extends SchemeDirectives { */ @CorrespondsTo("authorizeAsync") def authorizeAsyncWithRequestContext(check: akka.japi.function.Function[RequestContext, CompletionStage[Boolean]], inner: Supplier[Route]): Route = RouteAdapter { - D.authorizeAsync(rc => check(RequestContext.wrap(rc)).toScala)(inner.get().delegate) + D.authorizeAsync(rc ⇒ check(RequestContext.wrap(rc)).toScala)(inner.get().delegate) } /** * Creates a `Basic` [[HttpChallenge]] for the given realm. */ def challengeFor(realm: String): HttpChallenge = HttpChallenge.create("Basic", realm) - + } \ No newline at end of file diff --git a/akka-http/src/main/scala/akka/http/scaladsl/coding/Decoder.scala b/akka-http/src/main/scala/akka/http/scaladsl/coding/Decoder.scala index dd905691c9..d91ecdc2c6 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/coding/Decoder.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/coding/Decoder.scala @@ -7,7 +7,7 @@ package akka.http.scaladsl.coding import akka.NotUsed import akka.http.scaladsl.model._ import akka.stream.{ FlowShape, Materializer } -import akka.stream.stage.{ GraphStage} +import akka.stream.stage.{ GraphStage } import akka.util.ByteString import headers.HttpEncoding import akka.stream.scaladsl.{ Sink, Source, Flow } diff --git a/akka-http/src/main/scala/akka/http/scaladsl/coding/Gzip.scala b/akka-http/src/main/scala/akka/http/scaladsl/coding/Gzip.scala index 8613630845..59c4dd90c6 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/coding/Gzip.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/coding/Gzip.scala @@ -125,5 +125,5 @@ private[http] object GzipDecompressor { 0, // MTIME 4 0, // XFL 0 // OS - ) + ) } diff --git a/akka-http/src/main/scala/akka/http/scaladsl/coding/NoCoding.scala b/akka-http/src/main/scala/akka/http/scaladsl/coding/NoCoding.scala index b48518182e..6e74ad9ae4 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/coding/NoCoding.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/coding/NoCoding.scala @@ -7,7 +7,7 @@ package akka.http.scaladsl.coding import akka.http.scaladsl.model._ import akka.http.impl.util.StreamUtils import akka.stream.FlowShape -import akka.stream.stage.{ GraphStage} +import akka.stream.stage.{ GraphStage } import akka.util.ByteString import headers.HttpEncodings diff --git a/akka-http/src/main/scala/akka/http/scaladsl/common/StrictForm.scala b/akka-http/src/main/scala/akka/http/scaladsl/common/StrictForm.scala index 147b9a216f..124746ccd5 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/common/StrictForm.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/common/StrictForm.scala @@ -91,38 +91,38 @@ object StrictForm { } } - implicit def unmarshaller(implicit formDataUM: FromEntityUnmarshaller[FormData], + implicit def unmarshaller(implicit + formDataUM: FromEntityUnmarshaller[FormData], multipartUM: FromEntityUnmarshaller[Multipart.FormData]): FromEntityUnmarshaller[StrictForm] = - Unmarshaller.withMaterializer { implicit ec ⇒ - implicit fm ⇒ - entity ⇒ + Unmarshaller.withMaterializer { implicit ec ⇒ implicit fm ⇒ + entity ⇒ - def tryUnmarshalToQueryForm: Future[StrictForm] = - for (formData ← formDataUM(entity).fast) yield { - new StrictForm { - val fields = formData.fields.map { case (name, value) ⇒ name -> Field.FromString(value) }(collection.breakOut) - } + def tryUnmarshalToQueryForm: Future[StrictForm] = + for (formData ← formDataUM(entity).fast) yield { + new StrictForm { + val fields = formData.fields.map { case (name, value) ⇒ name → Field.FromString(value) }(collection.breakOut) } - - def tryUnmarshalToMultipartForm: Future[StrictForm] = - for { - multiPartFD ← multipartUM(entity).fast - strictMultiPartFD ← multiPartFD.toStrict(10.seconds).fast // TODO: make timeout configurable - } yield { - new StrictForm { - val fields = strictMultiPartFD.strictParts.map { - case x: Multipart.FormData.BodyPart.Strict ⇒ x.name -> Field.FromPart(x) - }(collection.breakOut) - } - } - - tryUnmarshalToQueryForm.fast.recoverWith { - case Unmarshaller.UnsupportedContentTypeException(supported1) ⇒ - tryUnmarshalToMultipartForm.fast.recoverWith { - case Unmarshaller.UnsupportedContentTypeException(supported2) ⇒ - FastFuture.failed(Unmarshaller.UnsupportedContentTypeException(supported1 ++ supported2)) - } } + + def tryUnmarshalToMultipartForm: Future[StrictForm] = + for { + multiPartFD ← multipartUM(entity).fast + strictMultiPartFD ← multiPartFD.toStrict(10.seconds).fast // TODO: make timeout configurable + } yield { + new StrictForm { + val fields = strictMultiPartFD.strictParts.map { + case x: Multipart.FormData.BodyPart.Strict ⇒ x.name → Field.FromPart(x) + }(collection.breakOut) + } + } + + tryUnmarshalToQueryForm.fast.recoverWith { + case Unmarshaller.UnsupportedContentTypeException(supported1) ⇒ + tryUnmarshalToMultipartForm.fast.recoverWith { + case Unmarshaller.UnsupportedContentTypeException(supported2) ⇒ + FastFuture.failed(Unmarshaller.UnsupportedContentTypeException(supported1 ++ supported2)) + } + } } /** diff --git a/akka-http/src/main/scala/akka/http/scaladsl/marshalling/ContentTypeOverrider.scala b/akka-http/src/main/scala/akka/http/scaladsl/marshalling/ContentTypeOverrider.scala index 4c78a9a40a..b7b74df025 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/marshalling/ContentTypeOverrider.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/marshalling/ContentTypeOverrider.scala @@ -21,7 +21,7 @@ object ContentTypeOverrider { implicit def forHeadersAndEntity[T <: HttpEntity]: ContentTypeOverrider[(immutable.Seq[HttpHeader], T)] = new ContentTypeOverrider[(immutable.Seq[HttpHeader], T)] { def apply(value: (immutable.Seq[HttpHeader], T), newContentType: ContentType) = - value._1 -> value._2.withContentType(newContentType).asInstanceOf[T] + value._1 → value._2.withContentType(newContentType).asInstanceOf[T] } implicit val forResponse: ContentTypeOverrider[HttpResponse] = diff --git a/akka-http/src/main/scala/akka/http/scaladsl/marshalling/EmptyValue.scala b/akka-http/src/main/scala/akka/http/scaladsl/marshalling/EmptyValue.scala index d10d993fb7..28dd4fc8b8 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/marshalling/EmptyValue.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/marshalling/EmptyValue.scala @@ -14,7 +14,7 @@ object EmptyValue { new EmptyValue[UniversalEntity](HttpEntity.Empty) implicit val emptyHeadersAndEntity: EmptyValue[(immutable.Seq[HttpHeader], UniversalEntity)] = - new EmptyValue[(immutable.Seq[HttpHeader], UniversalEntity)](Nil -> HttpEntity.Empty) + new EmptyValue[(immutable.Seq[HttpHeader], UniversalEntity)](Nil → HttpEntity.Empty) implicit val emptyResponse: EmptyValue[HttpResponse] = new EmptyValue[HttpResponse](HttpResponse(entity = emptyEntity.emptyValue)) diff --git a/akka-http/src/main/scala/akka/http/scaladsl/marshalling/Marshaller.scala b/akka-http/src/main/scala/akka/http/scaladsl/marshalling/Marshaller.scala index 1974bc8000..81c0290448 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/marshalling/Marshaller.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/marshalling/Marshaller.scala @@ -36,36 +36,35 @@ sealed abstract class Marshaller[-A, +B] { * If the wrapping is illegal the [[scala.concurrent.Future]] produced by the resulting marshaller will contain a [[RuntimeException]]. */ def wrapWithEC[C, D >: B](newMediaType: MediaType)(f: ExecutionContext ⇒ C ⇒ A)(implicit cto: ContentTypeOverrider[D]): Marshaller[C, D] = - Marshaller { implicit ec ⇒ - value ⇒ - import Marshalling._ - this(f(ec)(value)).fast map { - _ map { - (_, newMediaType) match { - case (WithFixedContentType(_, marshal), newMT: MediaType.Binary) ⇒ - WithFixedContentType(newMT, () ⇒ cto(marshal(), newMT)) - case (WithFixedContentType(oldCT: ContentType.Binary, marshal), newMT: MediaType.WithFixedCharset) ⇒ - WithFixedContentType(newMT, () ⇒ cto(marshal(), newMT)) - case (WithFixedContentType(oldCT: ContentType.NonBinary, marshal), newMT: MediaType.WithFixedCharset) if oldCT.charset == newMT.charset ⇒ - WithFixedContentType(newMT, () ⇒ cto(marshal(), newMT)) - case (WithFixedContentType(oldCT: ContentType.NonBinary, marshal), newMT: MediaType.WithOpenCharset) ⇒ - val newCT = newMT withCharset oldCT.charset - WithFixedContentType(newCT, () ⇒ cto(marshal(), newCT)) + Marshaller { implicit ec ⇒ value ⇒ + import Marshalling._ + this(f(ec)(value)).fast map { + _ map { + (_, newMediaType) match { + case (WithFixedContentType(_, marshal), newMT: MediaType.Binary) ⇒ + WithFixedContentType(newMT, () ⇒ cto(marshal(), newMT)) + case (WithFixedContentType(oldCT: ContentType.Binary, marshal), newMT: MediaType.WithFixedCharset) ⇒ + WithFixedContentType(newMT, () ⇒ cto(marshal(), newMT)) + case (WithFixedContentType(oldCT: ContentType.NonBinary, marshal), newMT: MediaType.WithFixedCharset) if oldCT.charset == newMT.charset ⇒ + WithFixedContentType(newMT, () ⇒ cto(marshal(), newMT)) + case (WithFixedContentType(oldCT: ContentType.NonBinary, marshal), newMT: MediaType.WithOpenCharset) ⇒ + val newCT = newMT withCharset oldCT.charset + WithFixedContentType(newCT, () ⇒ cto(marshal(), newCT)) - case (WithOpenCharset(oldMT, marshal), newMT: MediaType.WithOpenCharset) ⇒ - WithOpenCharset(newMT, cs ⇒ cto(marshal(cs), newMT withCharset cs)) - case (WithOpenCharset(oldMT, marshal), newMT: MediaType.WithFixedCharset) ⇒ - WithFixedContentType(newMT, () ⇒ cto(marshal(newMT.charset), newMT)) + case (WithOpenCharset(oldMT, marshal), newMT: MediaType.WithOpenCharset) ⇒ + WithOpenCharset(newMT, cs ⇒ cto(marshal(cs), newMT withCharset cs)) + case (WithOpenCharset(oldMT, marshal), newMT: MediaType.WithFixedCharset) ⇒ + WithFixedContentType(newMT, () ⇒ cto(marshal(newMT.charset), newMT)) - case (Opaque(marshal), newMT: MediaType.Binary) ⇒ - WithFixedContentType(newMT, () ⇒ cto(marshal(), newMT)) - case (Opaque(marshal), newMT: MediaType.WithFixedCharset) ⇒ - WithFixedContentType(newMT, () ⇒ cto(marshal(), newMT)) + case (Opaque(marshal), newMT: MediaType.Binary) ⇒ + WithFixedContentType(newMT, () ⇒ cto(marshal(), newMT)) + case (Opaque(marshal), newMT: MediaType.WithFixedCharset) ⇒ + WithFixedContentType(newMT, () ⇒ cto(marshal(), newMT)) - case x ⇒ sys.error(s"Illegal marshaller wrapping. Marshalling `$x` cannot be wrapped with MediaType `$newMediaType`") - } + case x ⇒ sys.error(s"Illegal marshaller wrapping. Marshalling `$x` cannot be wrapped with MediaType `$newMediaType`") } } + } } def compose[C](f: C ⇒ A): Marshaller[C, B] = @@ -152,16 +151,18 @@ object Marshalling { /** * A Marshalling to a specific [[akka.http.scaladsl.model.ContentType]]. */ - final case class WithFixedContentType[A](contentType: ContentType, - marshal: () ⇒ A) extends Marshalling[A] { + final case class WithFixedContentType[A]( + contentType: ContentType, + marshal: () ⇒ A) extends Marshalling[A] { def map[B](f: A ⇒ B): WithFixedContentType[B] = copy(marshal = () ⇒ f(marshal())) } /** * A Marshalling to a specific [[akka.http.scaladsl.model.MediaType]] with a flexible charset. */ - final case class WithOpenCharset[A](mediaType: MediaType.WithOpenCharset, - marshal: HttpCharset ⇒ A) extends Marshalling[A] { + final case class WithOpenCharset[A]( + mediaType: MediaType.WithOpenCharset, + marshal: HttpCharset ⇒ A) extends Marshalling[A] { def map[B](f: A ⇒ B): WithOpenCharset[B] = copy(marshal = cs ⇒ f(marshal(cs))) } diff --git a/akka-http/src/main/scala/akka/http/scaladsl/marshalling/PredefinedToResponseMarshallers.scala b/akka-http/src/main/scala/akka/http/scaladsl/marshalling/PredefinedToResponseMarshallers.scala index fa612d828f..62777103a2 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/marshalling/PredefinedToResponseMarshallers.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/marshalling/PredefinedToResponseMarshallers.scala @@ -15,9 +15,11 @@ trait PredefinedToResponseMarshallers extends LowPriorityToResponseMarshallerImp private type TRM[T] = ToResponseMarshaller[T] // brevity alias - def fromToEntityMarshaller[T](status: StatusCode = StatusCodes.OK, - headers: immutable.Seq[HttpHeader] = Nil)( - implicit m: ToEntityMarshaller[T]): ToResponseMarshaller[T] = + def fromToEntityMarshaller[T]( + status: StatusCode = StatusCodes.OK, + headers: immutable.Seq[HttpHeader] = Nil)( + implicit + m: ToEntityMarshaller[T]): ToResponseMarshaller[T] = fromStatusCodeAndHeadersAndValue compose (t ⇒ (status, headers, t)) implicit val fromResponse: TRM[HttpResponse] = Marshaller.opaque(ConstantFun.scalaIdentityFunction) @@ -30,7 +32,8 @@ trait PredefinedToResponseMarshallers extends LowPriorityToResponseMarshallerImp implicit def fromStatusCodeAndValue[S, T](implicit sConv: S ⇒ StatusCode, mt: ToEntityMarshaller[T]): TRM[(S, T)] = fromStatusCodeAndHeadersAndValue[T] compose { case (status, value) ⇒ (sConv(status), Nil, value) } - implicit def fromStatusCodeConvertibleAndHeadersAndT[S, T](implicit sConv: S ⇒ StatusCode, + implicit def fromStatusCodeConvertibleAndHeadersAndT[S, T](implicit + sConv: S ⇒ StatusCode, mt: ToEntityMarshaller[T]): TRM[(S, immutable.Seq[HttpHeader], T)] = fromStatusCodeAndHeadersAndValue[T] compose { case (status, headers, value) ⇒ (sConv(status), headers, value) } diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/Directive.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/Directive.scala index 1986b0d3d3..a9d3125391 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/Directive.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/Directive.scala @@ -44,12 +44,11 @@ abstract class Directive[L](implicit val ev: Tuple[L]) { def as[A](constructor: ConstructFromTuple[L, A]): Directive1[A] = { def validatedMap[R](f: L ⇒ R)(implicit tupler: Tupler[R]): Directive[tupler.Out] = Directive[tupler.Out] { inner ⇒ - tapply { values ⇒ - ctx ⇒ - try inner(tupler(f(values)))(ctx) - catch { - case e: IllegalArgumentException ⇒ ctx.reject(ValidationRejection(e.getMessage.nullAsEmpty, Some(e))) - } + tapply { values ⇒ ctx ⇒ + try inner(tupler(f(values)))(ctx) + catch { + case e: IllegalArgumentException ⇒ ctx.reject(ValidationRejection(e.getMessage.nullAsEmpty, Some(e))) + } } }(tupler.OutIsTuple) @@ -88,14 +87,13 @@ abstract class Directive[L](implicit val ev: Tuple[L]) { * **before the inner route was applied**. */ def recover[R >: L: Tuple](recovery: immutable.Seq[Rejection] ⇒ Directive[R]): Directive[R] = - Directive[R] { inner ⇒ - ctx ⇒ - import ctx.executionContext - @volatile var rejectedFromInnerRoute = false - tapply({ list ⇒ c ⇒ rejectedFromInnerRoute = true; inner(list)(c) })(ctx).fast.flatMap { - case RouteResult.Rejected(rejections) if !rejectedFromInnerRoute ⇒ recovery(rejections).tapply(inner)(ctx) - case x ⇒ FastFuture.successful(x) - } + Directive[R] { inner ⇒ ctx ⇒ + import ctx.executionContext + @volatile var rejectedFromInnerRoute = false + tapply({ list ⇒ c ⇒ rejectedFromInnerRoute = true; inner(list)(c) })(ctx).fast.flatMap { + case RouteResult.Rejected(rejections) if !rejectedFromInnerRoute ⇒ recovery(rejections).tapply(inner)(ctx) + case x ⇒ FastFuture.successful(x) + } } /** diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/ExceptionHandler.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/ExceptionHandler.scala index 907bcbd282..10fc8e10ed 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/ExceptionHandler.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/ExceptionHandler.scala @@ -40,7 +40,8 @@ object ExceptionHandler { def default(settings: RoutingSettings): ExceptionHandler = apply(knownToBeSealed = true) { case IllegalRequestException(info, status) ⇒ ctx ⇒ { - ctx.log.warning("Illegal request {}\n\t{}\n\tCompleting with '{}' response", + ctx.log.warning( + "Illegal request {}\n\t{}\n\tCompleting with '{}' response", ctx.request, info.formatPretty, status) ctx.complete((status, info.format(settings.verboseErrorMessages))) } diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/RejectionHandler.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/RejectionHandler.scala index f816a6d22f..acdb5715af 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/RejectionHandler.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/RejectionHandler.scala @@ -78,13 +78,13 @@ object RejectionHandler { } /** - * Convenience method for handling rejections created by created by the onCompleteWithBreaker directive. - * Signals that the request was rejected because the supplied circuit breaker is open and requests are failing fast. - * - * Use to customise the error response being written instead of the default [[ServiceUnavailable]] response. - */ - def handleCircuitBreakerOpenRejection(handler: CircuitBreakerOpenRejection => Route): this.type = - handle { case r: CircuitBreakerOpenRejection => handler(r) } + * Convenience method for handling rejections created by created by the onCompleteWithBreaker directive. + * Signals that the request was rejected because the supplied circuit breaker is open and requests are failing fast. + * + * Use to customise the error response being written instead of the default [[ServiceUnavailable]] response. + */ + def handleCircuitBreakerOpenRejection(handler: CircuitBreakerOpenRejection ⇒ Route): this.type = + handle { case r: CircuitBreakerOpenRejection ⇒ handler(r) } def result(): RejectionHandler = new BuiltRejectionHandler(cases.result(), notFound, isDefault) @@ -98,9 +98,10 @@ object RejectionHandler { def apply(rejection: Rejection) = rejection.asInstanceOf[T] } - private class BuiltRejectionHandler(val cases: Vector[Handler], - val notFound: Option[Route], - val isDefault: Boolean) extends RejectionHandler { + private class BuiltRejectionHandler( + val cases: Vector[Handler], + val notFound: Option[Route], + val isDefault: Boolean) extends RejectionHandler { def apply(rejections: immutable.Seq[Rejection]): Option[Route] = if (rejections.nonEmpty) { @tailrec def rec(ix: Int): Option[Route] = @@ -130,7 +131,7 @@ object RejectionHandler { complete((BadRequest, "Uri scheme not allowed, supported schemes: " + schemes)) } .handleAll[MethodRejection] { rejections ⇒ - val (methods, names) = rejections.map(r ⇒ r.supported -> r.supported.name).unzip + val (methods, names) = rejections.map(r ⇒ r.supported → r.supported.name).unzip complete((MethodNotAllowed, List(Allow(methods)), "HTTP method not allowed, supported methods: " + names.mkString(", "))) } .handle { @@ -225,7 +226,8 @@ object RejectionHandler { .handle { case ExpectedWebSocketRequestRejection ⇒ complete((BadRequest, "Expected WebSocket Upgrade request")) } .handleAll[UnsupportedWebSocketSubprotocolRejection] { rejections ⇒ val supported = rejections.map(_.supportedProtocol) - complete(HttpResponse(BadRequest, + complete(HttpResponse( + BadRequest, entity = s"None of the websocket subprotocols offered in the request are supported. Supported are ${supported.map("'" + _ + "'").mkString(",")}.", headers = `Sec-WebSocket-Protocol`(supported) :: Nil)) } diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/RequestContext.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/RequestContext.scala index 537eac176b..37e3855cbf 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/RequestContext.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/RequestContext.scala @@ -53,9 +53,9 @@ trait RequestContext { */ def reconfigure( executionContext: ExecutionContextExecutor = executionContext, - materializer: Materializer = materializer, - log: LoggingAdapter = log, - settings: RoutingSettings = settings): RequestContext + materializer: Materializer = materializer, + log: LoggingAdapter = log, + settings: RoutingSettings = settings): RequestContext /** * Completes the request with the given ToResponseMarshallable. diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/RequestContextImpl.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/RequestContextImpl.scala index af291bc7cd..2e17c3cbd0 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/RequestContextImpl.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/RequestContextImpl.scala @@ -17,13 +17,13 @@ import akka.http.scaladsl.util.FastFuture._ * INTERNAL API */ private[http] class RequestContextImpl( - val request: HttpRequest, - val unmatchedPath: Uri.Path, + val request: HttpRequest, + val unmatchedPath: Uri.Path, val executionContext: ExecutionContextExecutor, - val materializer: Materializer, - val log: LoggingAdapter, - val settings: RoutingSettings, - val parserSettings: ParserSettings) extends RequestContext { + val materializer: Materializer, + val log: LoggingAdapter, + val settings: RoutingSettings, + val parserSettings: ParserSettings) extends RequestContext { def this(request: HttpRequest, log: LoggingAdapter, settings: RoutingSettings, parserSettings: ParserSettings)(implicit ec: ExecutionContextExecutor, materializer: Materializer) = this(request, request.uri.path, ec, materializer, log, settings, parserSettings) @@ -97,12 +97,13 @@ private[http] class RequestContextImpl( case _ ⇒ Future.successful(RouteResult.Rejected(UnacceptedResponseContentTypeRejection(supported) :: Nil)) } - private def copy(request: HttpRequest = request, - unmatchedPath: Uri.Path = unmatchedPath, - executionContext: ExecutionContextExecutor = executionContext, - materializer: Materializer = materializer, - log: LoggingAdapter = log, - routingSettings: RoutingSettings = settings, - parserSettings: ParserSettings = parserSettings) = + private def copy( + request: HttpRequest = request, + unmatchedPath: Uri.Path = unmatchedPath, + executionContext: ExecutionContextExecutor = executionContext, + materializer: Materializer = materializer, + log: LoggingAdapter = log, + routingSettings: RoutingSettings = settings, + parserSettings: ParserSettings = parserSettings) = new RequestContextImpl(request, unmatchedPath, executionContext, materializer, log, routingSettings, parserSettings) } diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/Route.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/Route.scala index de573c3e23..41f6c8bf49 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/Route.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/Route.scala @@ -23,8 +23,9 @@ object Route { /** * "Seals" a route by wrapping it with exception handling and rejection conversion. */ - def seal(route: Route)(implicit routingSettings: RoutingSettings, - parserSettings: ParserSettings = null, + def seal(route: Route)(implicit + routingSettings: RoutingSettings, + parserSettings: ParserSettings = null, rejectionHandler: RejectionHandler = RejectionHandler.default, exceptionHandler: ExceptionHandler = null): Route = { import directives.ExecutionDirectives._ @@ -40,25 +41,27 @@ object Route { * * This conversion is also implicitly available through [[RouteResult#route2HandlerFlow]]. */ - def handlerFlow(route: Route)(implicit routingSettings: RoutingSettings, - parserSettings: ParserSettings, - materializer: Materializer, - routingLog: RoutingLog, + def handlerFlow(route: Route)(implicit + routingSettings: RoutingSettings, + parserSettings: ParserSettings, + materializer: Materializer, + routingLog: RoutingLog, executionContext: ExecutionContextExecutor = null, - rejectionHandler: RejectionHandler = RejectionHandler.default, - exceptionHandler: ExceptionHandler = null): Flow[HttpRequest, HttpResponse, NotUsed] = + rejectionHandler: RejectionHandler = RejectionHandler.default, + exceptionHandler: ExceptionHandler = null): Flow[HttpRequest, HttpResponse, NotUsed] = Flow[HttpRequest].mapAsync(1)(asyncHandler(route)) /** * Turns a `Route` into an async handler function. */ - def asyncHandler(route: Route)(implicit routingSettings: RoutingSettings, - parserSettings: ParserSettings, - materializer: Materializer, - routingLog: RoutingLog, + def asyncHandler(route: Route)(implicit + routingSettings: RoutingSettings, + parserSettings: ParserSettings, + materializer: Materializer, + routingLog: RoutingLog, executionContext: ExecutionContextExecutor = null, - rejectionHandler: RejectionHandler = RejectionHandler.default, - exceptionHandler: ExceptionHandler = null): HttpRequest ⇒ Future[HttpResponse] = { + rejectionHandler: RejectionHandler = RejectionHandler.default, + exceptionHandler: ExceptionHandler = null): HttpRequest ⇒ Future[HttpResponse] = { val effectiveEC = if (executionContext ne null) executionContext else materializer.executionContext { diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/RouteResult.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/RouteResult.scala index 39e18c4034..0e4b613093 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/RouteResult.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/RouteResult.scala @@ -30,10 +30,11 @@ object RouteResult { override def getRejections = rejections.map(r ⇒ r: javadsl.server.Rejection).toIterable.asJava } - implicit def route2HandlerFlow(route: Route)(implicit routingSettings: RoutingSettings, - parserSettings: ParserSettings, - materializer: Materializer, - routingLog: RoutingLog, + implicit def route2HandlerFlow(route: Route)(implicit + routingSettings: RoutingSettings, + parserSettings: ParserSettings, + materializer: Materializer, + routingLog: RoutingLog, executionContext: ExecutionContext = null, rejectionHandler: RejectionHandler = RejectionHandler.default, exceptionHandler: ExceptionHandler = null): Flow[HttpRequest, HttpResponse, NotUsed] = diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/DebuggingDirectives.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/DebuggingDirectives.scala index 6d4ac5cf37..c274a598e1 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/DebuggingDirectives.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/DebuggingDirectives.scala @@ -62,7 +62,7 @@ case class LoggingMagnet[T](f: LoggingAdapter ⇒ T) // # logging-magnet object LoggingMagnet { implicit def forMessageFromMarker[T](marker: String): LoggingMagnet[T ⇒ Unit] = // # message-magnets - forMessageFromMarkerAndLevel[T](marker -> DebugLevel) + forMessageFromMarkerAndLevel[T](marker → DebugLevel) implicit def forMessageFromMarkerAndLevel[T](markerAndLevel: (String, LogLevel)): LoggingMagnet[T ⇒ Unit] = // # message-magnets forMessageFromFullShow[T] { @@ -77,7 +77,7 @@ object LoggingMagnet { LoggingMagnet(log ⇒ show(_).logTo(log)) implicit def forRequestResponseFromMarker(marker: String): LoggingMagnet[HttpRequest ⇒ RouteResult ⇒ Unit] = // # request-response-magnets - forRequestResponseFromMarkerAndLevel(marker -> DebugLevel) + forRequestResponseFromMarkerAndLevel(marker → DebugLevel) implicit def forRequestResponseFromMarkerAndLevel(markerAndLevel: (String, LogLevel)): LoggingMagnet[HttpRequest ⇒ RouteResult ⇒ Unit] = // # request-response-magnets forRequestResponseFromFullShow { @@ -87,10 +87,9 @@ object LoggingMagnet { } implicit def forRequestResponseFromFullShow(show: HttpRequest ⇒ RouteResult ⇒ Option[LogEntry]): LoggingMagnet[HttpRequest ⇒ RouteResult ⇒ Unit] = // # request-response-magnets - LoggingMagnet { log ⇒ - request ⇒ - val showResult = show(request) - result ⇒ showResult(result).foreach(_.logTo(log)) + LoggingMagnet { log ⇒ request ⇒ + val showResult = show(request) + result ⇒ showResult(result).foreach(_.logTo(log)) } } diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/ExecutionDirectives.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/ExecutionDirectives.scala index b803e22947..639d2ca80a 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/ExecutionDirectives.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/ExecutionDirectives.scala @@ -25,15 +25,14 @@ trait ExecutionDirectives { * @group execution */ def handleExceptions(handler: ExceptionHandler): Directive0 = - Directive { innerRouteBuilder ⇒ - ctx ⇒ - import ctx.executionContext - def handleException: PartialFunction[Throwable, Future[RouteResult]] = - handler andThen (_(ctx.withAcceptAll)) - try innerRouteBuilder(())(ctx).fast.recoverWith(handleException) - catch { - case NonFatal(e) ⇒ handleException.applyOrElse[Throwable, Future[RouteResult]](e, throw _) - } + Directive { innerRouteBuilder ⇒ ctx ⇒ + import ctx.executionContext + def handleException: PartialFunction[Throwable, Future[RouteResult]] = + handler andThen (_(ctx.withAcceptAll)) + try innerRouteBuilder(())(ctx).fast.recoverWith(handleException) + catch { + case NonFatal(e) ⇒ handleException.applyOrElse[Throwable, Future[RouteResult]](e, throw _) + } } /** diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/FileAndResourceDirectives.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/FileAndResourceDirectives.scala index d084736f3f..c8edaa8bc0 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/FileAndResourceDirectives.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/FileAndResourceDirectives.scala @@ -355,39 +355,38 @@ object DirectoryListing { |""".stripMarginWithNewline("\n") split '$' def directoryMarshaller(renderVanityFooter: Boolean): ToEntityMarshaller[DirectoryListing] = - Marshaller.StringMarshaller.wrapWithEC(MediaTypes.`text/html`) { implicit ec ⇒ - listing ⇒ - val DirectoryListing(path, isRoot, files) = listing - val filesAndNames = files.map(file ⇒ file -> file.getName).sortBy(_._2) - val deduped = filesAndNames.zipWithIndex.flatMap { - case (fan @ (file, name), ix) ⇒ - if (ix == 0 || filesAndNames(ix - 1)._2 != name) Some(fan) else None - } - val (directoryFilesAndNames, fileFilesAndNames) = deduped.partition(_._1.isDirectory) - def maxNameLength(seq: Seq[(File, String)]) = if (seq.isEmpty) 0 else seq.map(_._2.length).max - val maxNameLen = math.max(maxNameLength(directoryFilesAndNames) + 1, maxNameLength(fileFilesAndNames)) - val sb = new java.lang.StringBuilder - sb.append(html(0)).append(path).append(html(1)).append(path).append(html(2)) - if (!isRoot) { - val secondToLastSlash = path.lastIndexOf('/', path.lastIndexOf('/', path.length - 1) - 1) - sb.append("../\n" format path.substring(0, secondToLastSlash)) - } - def lastModified(file: File) = DateTime(file.lastModified).toIsoLikeDateTimeString - def start(name: String) = - sb.append("").append(name).append("") - .append(" " * (maxNameLen - name.length)) - def renderDirectory(file: File, name: String) = - start(name + '/').append(" ").append(lastModified(file)).append('\n') - def renderFile(file: File, name: String) = { - val size = akka.http.impl.util.humanReadableByteCount(file.length, si = true) - start(name).append(" ").append(lastModified(file)) - sb.append(" ".substring(size.length)).append(size).append('\n') - } - for ((file, name) ← directoryFilesAndNames) renderDirectory(file, name) - for ((file, name) ← fileFilesAndNames) renderFile(file, name) - if (isRoot && files.isEmpty) sb.append("(no files)\n") - sb.append(html(3)) - if (renderVanityFooter) sb.append(html(4)).append(DateTime.now.toIsoLikeDateTimeString).append(html(5)) - sb.append(html(6)).toString + Marshaller.StringMarshaller.wrapWithEC(MediaTypes.`text/html`) { implicit ec ⇒ listing ⇒ + val DirectoryListing(path, isRoot, files) = listing + val filesAndNames = files.map(file ⇒ file → file.getName).sortBy(_._2) + val deduped = filesAndNames.zipWithIndex.flatMap { + case (fan @ (file, name), ix) ⇒ + if (ix == 0 || filesAndNames(ix - 1)._2 != name) Some(fan) else None + } + val (directoryFilesAndNames, fileFilesAndNames) = deduped.partition(_._1.isDirectory) + def maxNameLength(seq: Seq[(File, String)]) = if (seq.isEmpty) 0 else seq.map(_._2.length).max + val maxNameLen = math.max(maxNameLength(directoryFilesAndNames) + 1, maxNameLength(fileFilesAndNames)) + val sb = new java.lang.StringBuilder + sb.append(html(0)).append(path).append(html(1)).append(path).append(html(2)) + if (!isRoot) { + val secondToLastSlash = path.lastIndexOf('/', path.lastIndexOf('/', path.length - 1) - 1) + sb.append("../\n" format path.substring(0, secondToLastSlash)) + } + def lastModified(file: File) = DateTime(file.lastModified).toIsoLikeDateTimeString + def start(name: String) = + sb.append("").append(name).append("") + .append(" " * (maxNameLen - name.length)) + def renderDirectory(file: File, name: String) = + start(name + '/').append(" ").append(lastModified(file)).append('\n') + def renderFile(file: File, name: String) = { + val size = akka.http.impl.util.humanReadableByteCount(file.length, si = true) + start(name).append(" ").append(lastModified(file)) + sb.append(" ".substring(size.length)).append(size).append('\n') + } + for ((file, name) ← directoryFilesAndNames) renderDirectory(file, name) + for ((file, name) ← fileFilesAndNames) renderFile(file, name) + if (isRoot && files.isEmpty) sb.append("(no files)\n") + sb.append(html(3)) + if (renderVanityFooter) sb.append(html(4)).append(DateTime.now.toIsoLikeDateTimeString).append(html(5)) + sb.append(html(6)).toString } } diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/FormFieldDirectives.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/FormFieldDirectives.scala index bff78d9a12..4b170422f3 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/FormFieldDirectives.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/FormFieldDirectives.scala @@ -89,7 +89,7 @@ object FormFieldDirectives extends FormFieldDirectives { private val _formFieldMultiMap: Directive1[Map[String, List[String]]] = { @tailrec def append( - map: Map[String, List[String]], + map: Map[String, List[String]], fields: immutable.Seq[(String, String)]): Map[String, List[String]] = { if (fields.isEmpty) { map diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/HeaderDirectives.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/HeaderDirectives.scala index 172b22e4d9..87ae5a1910 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/HeaderDirectives.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/HeaderDirectives.scala @@ -21,13 +21,13 @@ trait HeaderDirectives { import RouteDirectives._ /** - * Checks that request comes from the same origin. Extracts the [[Origin]] header value and verifies that - * allowed range contains the obtained value. In the case of absent of the [[Origin]] header rejects - * with [[MissingHeaderRejection]]. If the origin value is not in the allowed range - * rejects with an [[InvalidOriginRejection]] and [[StatusCodes.Forbidden]] status. - * - * @group header - */ + * Checks that request comes from the same origin. Extracts the [[Origin]] header value and verifies that + * allowed range contains the obtained value. In the case of absent of the [[Origin]] header rejects + * with [[MissingHeaderRejection]]. If the origin value is not in the allowed range + * rejects with an [[InvalidOriginRejection]] and [[StatusCodes.Forbidden]] status. + * + * @group header + */ def checkSameOrigin(allowed: HttpOriginRange): Directive0 = { headerValueByType[Origin]().flatMap { origin ⇒ if (origin.origins.exists(allowed.matches)) pass @@ -172,22 +172,18 @@ object HeaderMagnet extends LowPriorityHeaderMagnetImplicits { * If possible we want to apply the special logic for [[ModeledCustomHeader]] to extract custom headers by type, * otherwise the default `fromUnit` is good enough (for headers that the parser emits in the right type already). */ - implicit def fromUnitForModeledCustomHeader[T <: ModeledCustomHeader[T], H <: ModeledCustomHeaderCompanion[T]] - (u: Unit)(implicit tag: ClassTag[T], companion: ModeledCustomHeaderCompanion[T]): HeaderMagnet[T] = - fromClassTagForModeledCustomHeader[T, H](tag, companion) + implicit def fromUnitForModeledCustomHeader[T <: ModeledCustomHeader[T], H <: ModeledCustomHeaderCompanion[T]](u: Unit)(implicit tag: ClassTag[T], companion: ModeledCustomHeaderCompanion[T]): HeaderMagnet[T] = + fromClassTagForModeledCustomHeader[T, H](tag, companion) + implicit def fromClassForModeledCustomHeader[T <: ModeledCustomHeader[T], H <: ModeledCustomHeaderCompanion[T]](clazz: Class[T], companion: ModeledCustomHeaderCompanion[T]): HeaderMagnet[T] = + fromClassTagForModeledCustomHeader(ClassTag(clazz), companion) - implicit def fromClassForModeledCustomHeader[T <: ModeledCustomHeader[T], H <: ModeledCustomHeaderCompanion[T]] - (clazz: Class[T], companion: ModeledCustomHeaderCompanion[T]): HeaderMagnet[T] = - fromClassTagForModeledCustomHeader(ClassTag(clazz), companion) - - implicit def fromClassTagForModeledCustomHeader[T <: ModeledCustomHeader[T], H <: ModeledCustomHeaderCompanion[T]] - (tag: ClassTag[T], companion: ModeledCustomHeaderCompanion[T]): HeaderMagnet[T] = + implicit def fromClassTagForModeledCustomHeader[T <: ModeledCustomHeader[T], H <: ModeledCustomHeaderCompanion[T]](tag: ClassTag[T], companion: ModeledCustomHeaderCompanion[T]): HeaderMagnet[T] = new HeaderMagnet[T] { override def runtimeClass = tag.runtimeClass.asInstanceOf[Class[T]] override def classTag = tag override def extractPF = { - case h if h.is(companion.lowercaseName) => companion.apply(h.value) + case h if h.is(companion.lowercaseName) ⇒ companion.apply(h.value) } } @@ -199,11 +195,11 @@ trait LowPriorityHeaderMagnetImplicits { // TODO DRY? implicit def fromClassNormalJavaHeader[T <: akka.http.javadsl.model.HttpHeader](clazz: Class[T]): HeaderMagnet[T] = - new HeaderMagnet[T] { - override def classTag: ClassTag[T] = ClassTag(clazz) - override def runtimeClass: Class[T] = clazz - override def extractPF: PartialFunction[HttpHeader, T] = { case x if runtimeClass.isAssignableFrom(x.getClass) => x.asInstanceOf[T] } - } + new HeaderMagnet[T] { + override def classTag: ClassTag[T] = ClassTag(clazz) + override def runtimeClass: Class[T] = clazz + override def extractPF: PartialFunction[HttpHeader, T] = { case x if runtimeClass.isAssignableFrom(x.getClass) ⇒ x.asInstanceOf[T] } + } implicit def fromUnitNormalHeader[T <: HttpHeader](u: Unit)(implicit tag: ClassTag[T]): HeaderMagnet[T] = fromClassTagNormalHeader(tag) diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/SecurityDirectives.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/SecurityDirectives.scala index 16cab40e0e..7b845e3e15 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/SecurityDirectives.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/SecurityDirectives.scala @@ -13,7 +13,7 @@ import akka.http.scaladsl.util.FastFuture._ import akka.http.scaladsl.model.headers._ import akka.http.scaladsl.server.AuthenticationFailedRejection.{ CredentialsRejected, CredentialsMissing } -import scala.util.{Try, Success} +import scala.util.{ Try, Success } /** * Provides directives for securing an inner route using the standard Http authentication headers [[`WWW-Authenticate`]] @@ -220,7 +220,7 @@ trait SecurityDirectives { * @group security */ def authorize(check: RequestContext ⇒ Boolean): Directive0 = - authorizeAsync(ctx => Future.successful(check(ctx))) + authorizeAsync(ctx ⇒ Future.successful(check(ctx))) /** * Asynchronous version of [[authorize]]. @@ -230,7 +230,7 @@ trait SecurityDirectives { * @group security */ def authorizeAsync(check: ⇒ Future[Boolean]): Directive0 = - authorizeAsync(ctx => check) + authorizeAsync(ctx ⇒ check) /** * Asynchronous version of [[authorize]]. @@ -241,10 +241,10 @@ trait SecurityDirectives { */ def authorizeAsync(check: RequestContext ⇒ Future[Boolean]): Directive0 = extractExecutionContext.flatMap { implicit ec ⇒ - extract(check).flatMap[Unit] { fa => + extract(check).flatMap[Unit] { fa ⇒ onComplete(fa).flatMap { - case Success(true) => pass - case _ => reject(AuthorizationFailedRejection) + case Success(true) ⇒ pass + case _ ⇒ reject(AuthorizationFailedRejection) } } } diff --git a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/TimeoutDirectives.scala b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/TimeoutDirectives.scala index 5964538e5a..835adafa9c 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/server/directives/TimeoutDirectives.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/server/directives/TimeoutDirectives.scala @@ -57,17 +57,16 @@ trait TimeoutDirectives { * @group timeout */ def withRequestTimeout(timeout: Duration, handler: Option[HttpRequest ⇒ HttpResponse]): Directive0 = - Directive { inner ⇒ - ctx ⇒ - ctx.request.header[`Timeout-Access`] match { - case Some(t) ⇒ - handler match { - case Some(h) ⇒ t.timeoutAccess.update(timeout, h) - case _ ⇒ t.timeoutAccess.updateTimeout(timeout) - } - case _ ⇒ ctx.log.warning("withRequestTimeout was used in route however no request-timeout is set!") - } - inner()(ctx) + Directive { inner ⇒ ctx ⇒ + ctx.request.header[`Timeout-Access`] match { + case Some(t) ⇒ + handler match { + case Some(h) ⇒ t.timeoutAccess.update(timeout, h) + case _ ⇒ t.timeoutAccess.updateTimeout(timeout) + } + case _ ⇒ ctx.log.warning("withRequestTimeout was used in route however no request-timeout is set!") + } + inner()(ctx) } /** @@ -80,13 +79,12 @@ trait TimeoutDirectives { * @group timeout */ def withRequestTimeoutResponse(handler: HttpRequest ⇒ HttpResponse): Directive0 = - Directive { inner ⇒ - ctx ⇒ - ctx.request.header[`Timeout-Access`] match { - case Some(t) ⇒ t.timeoutAccess.updateHandler(handler) - case _ ⇒ ctx.log.warning("withRequestTimeoutResponse was used in route however no request-timeout is set!") - } - inner()(ctx) + Directive { inner ⇒ ctx ⇒ + ctx.request.header[`Timeout-Access`] match { + case Some(t) ⇒ t.timeoutAccess.updateHandler(handler) + case _ ⇒ ctx.log.warning("withRequestTimeoutResponse was used in route however no request-timeout is set!") + } + inner()(ctx) } } diff --git a/akka-http/src/main/scala/akka/http/scaladsl/unmarshalling/MultipartUnmarshallers.scala b/akka-http/src/main/scala/akka/http/scaladsl/unmarshalling/MultipartUnmarshallers.scala index 2933073b39..38aa5efe3b 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/unmarshalling/MultipartUnmarshallers.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/unmarshalling/MultipartUnmarshallers.scala @@ -61,13 +61,13 @@ trait MultipartUnmarshallers { createStrict = (_, parts) ⇒ Multipart.ByteRanges.Strict(parts)) def multipartUnmarshaller[T <: Multipart, BP <: Multipart.BodyPart, BPS <: Multipart.BodyPart.Strict]( - mediaRange: MediaRange, - defaultContentType: ContentType, - createBodyPart: (BodyPartEntity, List[HttpHeader]) ⇒ BP, - createStreamed: (MediaType.Multipart, Source[BP, Any]) ⇒ T, + mediaRange: MediaRange, + defaultContentType: ContentType, + createBodyPart: (BodyPartEntity, List[HttpHeader]) ⇒ BP, + createStreamed: (MediaType.Multipart, Source[BP, Any]) ⇒ T, createStrictBodyPart: (HttpEntity.Strict, List[HttpHeader]) ⇒ BPS, - createStrict: (MediaType.Multipart, immutable.Seq[BPS]) ⇒ T)(implicit log: LoggingAdapter = NoLogging, parserSettings: ParserSettings = null): FromEntityUnmarshaller[T] = - Unmarshaller.withMaterializer { implicit ec ⇒ mat => + createStrict: (MediaType.Multipart, immutable.Seq[BPS]) ⇒ T)(implicit log: LoggingAdapter = NoLogging, parserSettings: ParserSettings = null): FromEntityUnmarshaller[T] = + Unmarshaller.withMaterializer { implicit ec ⇒ mat ⇒ entity ⇒ if (entity.contentType.mediaType.isMultipart && mediaRange.matches(entity.contentType.mediaType)) { entity.contentType.mediaType.params.get("boundary") match { diff --git a/akka-http/src/main/scala/akka/http/scaladsl/unmarshalling/PredefinedFromStringUnmarshallers.scala b/akka-http/src/main/scala/akka/http/scaladsl/unmarshalling/PredefinedFromStringUnmarshallers.scala index 6fedce64a3..6b6ac6b96a 100755 --- a/akka-http/src/main/scala/akka/http/scaladsl/unmarshalling/PredefinedFromStringUnmarshallers.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/unmarshalling/PredefinedFromStringUnmarshallers.scala @@ -40,9 +40,8 @@ trait PredefinedFromStringUnmarshallers { implicit def CsvSeq[T](implicit unmarshaller: Unmarshaller[String, T]): Unmarshaller[String, immutable.Seq[T]] = Unmarshaller.strict[String, immutable.Seq[String]] { string ⇒ string.split(",").toList - } flatMap { implicit ec ⇒ - implicit mat ⇒ strings ⇒ - FastFuture.sequence(strings.map(unmarshaller(_))) + } flatMap { implicit ec ⇒ implicit mat ⇒ strings ⇒ + FastFuture.sequence(strings.map(unmarshaller(_))) } val HexByte: Unmarshaller[String, Byte] = diff --git a/akka-http/src/main/scala/akka/http/scaladsl/unmarshalling/Unmarshaller.scala b/akka-http/src/main/scala/akka/http/scaladsl/unmarshalling/Unmarshaller.scala index 0ef8e12940..d295b4bb38 100644 --- a/akka-http/src/main/scala/akka/http/scaladsl/unmarshalling/Unmarshaller.scala +++ b/akka-http/src/main/scala/akka/http/scaladsl/unmarshalling/Unmarshaller.scala @@ -104,16 +104,16 @@ object Unmarshaller * an IllegalStateException will be thrown! */ def forContentTypes(ranges: ContentTypeRange*): FromEntityUnmarshaller[A] = - Unmarshaller.withMaterializer { implicit ec ⇒ - implicit mat ⇒ - entity ⇒ - if (entity.contentType == ContentTypes.NoContentType || ranges.exists(_ matches entity.contentType)) { - underlying(entity).fast.recover[A](barkAtUnsupportedContentTypeException(ranges, entity.contentType)) - } else FastFuture.failed(UnsupportedContentTypeException(ranges: _*)) + Unmarshaller.withMaterializer { implicit ec ⇒ implicit mat ⇒ + entity ⇒ + if (entity.contentType == ContentTypes.NoContentType || ranges.exists(_ matches entity.contentType)) { + underlying(entity).fast.recover[A](barkAtUnsupportedContentTypeException(ranges, entity.contentType)) + } else FastFuture.failed(UnsupportedContentTypeException(ranges: _*)) } - private def barkAtUnsupportedContentTypeException(ranges: Seq[ContentTypeRange], - newContentType: ContentType): PartialFunction[Throwable, Nothing] = { + private def barkAtUnsupportedContentTypeException( + ranges: Seq[ContentTypeRange], + newContentType: ContentType): PartialFunction[Throwable, Nothing] = { case UnsupportedContentTypeException(supported) ⇒ throw new IllegalStateException( s"Illegal use of `unmarshaller.forContentTypes($ranges)`: $newContentType is not supported by underlying marshaller!") } diff --git a/akka-multi-node-testkit/src/main/scala/akka/remote/testconductor/Conductor.scala b/akka-multi-node-testkit/src/main/scala/akka/remote/testconductor/Conductor.scala index 7aa6c66ef7..5ac5c688a4 100644 --- a/akka-multi-node-testkit/src/main/scala/akka/remote/testconductor/Conductor.scala +++ b/akka-multi-node-testkit/src/main/scala/akka/remote/testconductor/Conductor.scala @@ -4,27 +4,24 @@ package akka.remote.testconductor import language.postfixOps -import akka.actor.{ Actor, ActorRef, LoggingFSM, Props, NoSerializationVerificationNeeded } -import RemoteConnection.getAddrString -import TestConductorProtocol._ -import org.jboss.netty.channel.{ Channel, SimpleChannelUpstreamHandler, ChannelHandlerContext, ChannelStateEvent, MessageEvent } -import scala.concurrent.duration._ -import akka.pattern.ask -import scala.concurrent.Await -import akka.event.{ LoggingAdapter, Logging } -import scala.util.control.NoStackTrace -import akka.event.LoggingReceive -import java.net.InetSocketAddress -import scala.concurrent.Future -import akka.actor.{ OneForOneStrategy, SupervisorStrategy, Status, Address } -import java.util.concurrent.ConcurrentHashMap -import akka.util.{ Timeout } -import scala.reflect.classTag -import akka.ConfigurationException + +import akka.actor.{ Actor, ActorRef, Address, DeadLetterSuppression, Deploy, FSM, LoggingFSM, NoSerializationVerificationNeeded, OneForOneStrategy, Props, Status, SupervisorStrategy } import akka.AkkaException +import akka.ConfigurationException +import akka.event.LoggingReceive +import akka.event.{ Logging, LoggingAdapter } +import akka.pattern.ask import akka.remote.transport.ThrottlerTransportAdapter.Direction -import akka.actor.Deploy -import akka.actor.DeadLetterSuppression +import akka.util.Timeout +import java.net.InetSocketAddress +import java.util.concurrent.ConcurrentHashMap +import org.jboss.netty.channel.{ Channel, ChannelHandlerContext, ChannelStateEvent, MessageEvent, SimpleChannelUpstreamHandler } +import RemoteConnection.getAddrString +import scala.concurrent.Await +import scala.concurrent.duration._ +import scala.concurrent.Future +import scala.reflect.classTag +import scala.util.control.NoStackTrace /** * The conductor is the one orchestrating the test: it governs the @@ -431,7 +428,7 @@ private[akka] class Controller(private var initialParticipants: Int, controllerP } fsm ! ToClient(BarrierResult("initial startup", false)) } else { - nodes += name -> c + nodes += name → c if (initialParticipants <= 0) fsm ! ToClient(Done) else if (nodes.size == initialParticipants) { for (NodeInfo(_, _, client) ← nodes.values) client ! ToClient(Done) @@ -451,7 +448,7 @@ private[akka] class Controller(private var initialParticipants: Int, controllerP case _: FailBarrier ⇒ barrier forward op case GetAddress(node) ⇒ if (nodes contains node) sender() ! ToClient(AddressReply(node, nodes(node).addr)) - else addrInterest += node -> ((addrInterest get node getOrElse Set()) + sender()) + else addrInterest += node → ((addrInterest get node getOrElse Set()) + sender()) case _: Done ⇒ //FIXME what should happen? } case op: CommandOp ⇒ @@ -523,6 +520,7 @@ private[akka] object BarrierCoordinator { private[akka] class BarrierCoordinator extends Actor with LoggingFSM[BarrierCoordinator.State, BarrierCoordinator.Data] { import BarrierCoordinator._ import Controller._ + import FSM.`→` // this shall be set to true if all subsequent barriers shall fail var failed = false @@ -567,8 +565,8 @@ private[akka] class BarrierCoordinator extends Actor with LoggingFSM[BarrierCoor } onTransition { - case Idle -> Waiting ⇒ setTimer("Timeout", StateTimeout, nextStateData.deadline.timeLeft, false) - case Waiting -> Idle ⇒ cancelTimer("Timeout") + case Idle → Waiting ⇒ setTimer("Timeout", StateTimeout, nextStateData.deadline.timeLeft, false) + case Waiting → Idle ⇒ cancelTimer("Timeout") } when(Waiting) { diff --git a/akka-multi-node-testkit/src/main/scala/akka/remote/testconductor/DataTypes.scala b/akka-multi-node-testkit/src/main/scala/akka/remote/testconductor/DataTypes.scala index 94a046b13c..faa0582c13 100644 --- a/akka-multi-node-testkit/src/main/scala/akka/remote/testconductor/DataTypes.scala +++ b/akka-multi-node-testkit/src/main/scala/akka/remote/testconductor/DataTypes.scala @@ -133,7 +133,8 @@ private[akka] class MsgDecoder extends OneToOneDecoder { case BarrierOp.Succeeded ⇒ BarrierResult(barrier.getName, true) case BarrierOp.Failed ⇒ BarrierResult(barrier.getName, false) case BarrierOp.Fail ⇒ FailBarrier(barrier.getName) - case BarrierOp.Enter ⇒ EnterBarrier(barrier.getName, + case BarrierOp.Enter ⇒ EnterBarrier( + barrier.getName, if (barrier.hasTimeout) Option(Duration.fromNanos(barrier.getTimeout)) else None) } } else if (w.hasFailure) { diff --git a/akka-multi-node-testkit/src/main/scala/akka/remote/testconductor/Player.scala b/akka-multi-node-testkit/src/main/scala/akka/remote/testconductor/Player.scala index d698c673bc..d2ef4452b8 100644 --- a/akka-multi-node-testkit/src/main/scala/akka/remote/testconductor/Player.scala +++ b/akka-multi-node-testkit/src/main/scala/akka/remote/testconductor/Player.scala @@ -192,8 +192,8 @@ private[akka] class ClientFSM(name: RoleName, controllerAddr: InetSocketAddress) case Event(ToServer(msg), d @ Data(Some(channel), None)) ⇒ channel.write(msg) val token = msg match { - case EnterBarrier(barrier, timeout) ⇒ Some(barrier -> sender()) - case GetAddress(node) ⇒ Some(node.name -> sender()) + case EnterBarrier(barrier, timeout) ⇒ Some(barrier → sender()) + case GetAddress(node) ⇒ Some(node.name → sender()) case _ ⇒ None } stay using d.copy(runningOp = token) @@ -274,13 +274,13 @@ private[akka] class ClientFSM(name: RoleName, controllerAddr: InetSocketAddress) * INTERNAL API. */ private[akka] class PlayerHandler( - server: InetSocketAddress, + server: InetSocketAddress, private var reconnects: Int, - backoff: FiniteDuration, - poolSize: Int, - fsm: ActorRef, - log: LoggingAdapter, - scheduler: Scheduler)(implicit executor: ExecutionContext) + backoff: FiniteDuration, + poolSize: Int, + fsm: ActorRef, + log: LoggingAdapter, + scheduler: Scheduler)(implicit executor: ExecutionContext) extends SimpleChannelUpstreamHandler { import ClientFSM._ diff --git a/akka-multi-node-testkit/src/main/scala/akka/remote/testkit/MultiNodeSpec.scala b/akka-multi-node-testkit/src/main/scala/akka/remote/testkit/MultiNodeSpec.scala index aae55a1db7..7bf179e12a 100644 --- a/akka-multi-node-testkit/src/main/scala/akka/remote/testkit/MultiNodeSpec.scala +++ b/akka-multi-node-testkit/src/main/scala/akka/remote/testkit/MultiNodeSpec.scala @@ -41,7 +41,7 @@ abstract class MultiNodeConfig { */ def nodeConfig(roles: RoleName*)(configs: Config*): Unit = { val c = configs.reduceLeft(_ withFallback _) - _nodeConf ++= roles map { _ -> c } + _nodeConf ++= roles map { _ → c } } /** @@ -78,7 +78,7 @@ abstract class MultiNodeConfig { } def deployOn(role: RoleName, deployment: String): Unit = - _deployments += role -> ((_deployments get role getOrElse Vector()) :+ deployment) + _deployments += role → ((_deployments get role getOrElse Vector()) :+ deployment) def deployOnAll(deployment: String): Unit = _allDeploy :+= deployment @@ -195,9 +195,9 @@ object MultiNodeSpec { require(selfIndex >= 0 && selfIndex < maxNodes, "multinode.index is out of bounds: " + selfIndex) private[testkit] val nodeConfig = mapToConfig(Map( - "akka.actor.provider" -> "akka.remote.RemoteActorRefProvider", - "akka.remote.netty.tcp.hostname" -> selfName, - "akka.remote.netty.tcp.port" -> selfPort)) + "akka.actor.provider" → "akka.remote.RemoteActorRefProvider", + "akka.remote.netty.tcp.hostname" → selfName, + "akka.remote.netty.tcp.port" → selfPort)) private[testkit] val baseConfig: Config = ConfigFactory.parseString(""" akka { diff --git a/akka-parsing/build.sbt b/akka-parsing/build.sbt index 7703337865..04bfd07854 100644 --- a/akka-parsing/build.sbt +++ b/akka-parsing/build.sbt @@ -1,4 +1,5 @@ import akka._ +import com.typesafe.sbt.SbtScalariform.ScalariformKeys AkkaBuild.defaultSettings Formatting.docFormatSettings diff --git a/akka-parsing/src/main/scala/akka/parboiled2/ErrorFormatter.scala b/akka-parsing/src/main/scala/akka/parboiled2/ErrorFormatter.scala index 5b454c701c..716b66867d 100644 --- a/akka-parsing/src/main/scala/akka/parboiled2/ErrorFormatter.scala +++ b/akka-parsing/src/main/scala/akka/parboiled2/ErrorFormatter.scala @@ -34,13 +34,14 @@ import java.lang.{ StringBuilder ⇒ JStringBuilder } * Set to a value < 0 to disable tab expansion. * @param traceCutOff the maximum number of (trailing) characters shown for a rule trace */ -class ErrorFormatter(showExpected: Boolean = true, - showPosition: Boolean = true, - showLine: Boolean = true, - showTraces: Boolean = false, - showFrameStartOffset: Boolean = true, - expandTabs: Int = -1, - traceCutOff: Int = 120) { +class ErrorFormatter( + showExpected: Boolean = true, + showPosition: Boolean = true, + showLine: Boolean = true, + showTraces: Boolean = false, + showFrameStartOffset: Boolean = true, + expandTabs: Int = -1, + traceCutOff: Int = 120) { /** * Formats the given [[ParseError]] into a String using the settings configured for this formatter instance. @@ -225,8 +226,9 @@ class ErrorFormatter(showExpected: Boolean = true, /** * Formats the head element of a [[RuleTrace]] into a String. */ - def formatNonTerminal(nonTerminal: RuleTrace.NonTerminal, - showFrameStartOffset: Boolean = showFrameStartOffset): String = { + def formatNonTerminal( + nonTerminal: RuleTrace.NonTerminal, + showFrameStartOffset: Boolean = showFrameStartOffset): String = { import RuleTrace._ import CharUtils.escape val keyString = nonTerminal.key match { diff --git a/akka-parsing/src/main/scala/akka/parboiled2/ParseError.scala b/akka-parsing/src/main/scala/akka/parboiled2/ParseError.scala index 7c62c2f0d7..bbddb1d3c0 100644 --- a/akka-parsing/src/main/scala/akka/parboiled2/ParseError.scala +++ b/akka-parsing/src/main/scala/akka/parboiled2/ParseError.scala @@ -19,9 +19,10 @@ package akka.parboiled2 import scala.annotation.tailrec import scala.collection.immutable -case class ParseError(position: Position, - principalPosition: Position, - traces: immutable.Seq[RuleTrace]) extends RuntimeException { +case class ParseError( + position: Position, + principalPosition: Position, + traces: immutable.Seq[RuleTrace]) extends RuntimeException { require(principalPosition.index >= position.index, "principalPosition must be > position") def format(parser: Parser): String = format(parser.input) def format(parser: Parser, formatter: ErrorFormatter): String = format(parser.input, formatter) diff --git a/akka-parsing/src/main/scala/akka/parboiled2/Parser.scala b/akka-parsing/src/main/scala/akka/parboiled2/Parser.scala index 5471a30fc9..78959023cd 100644 --- a/akka-parsing/src/main/scala/akka/parboiled2/Parser.scala +++ b/akka-parsing/src/main/scala/akka/parboiled2/Parser.scala @@ -23,8 +23,9 @@ import scala.util.control.{ NonFatal, NoStackTrace } import akka.shapeless._ import akka.parboiled2.support._ -abstract class Parser(initialValueStackSize: Int = 16, - maxValueStackSize: Int = 1024) extends RuleDSL { +abstract class Parser( + initialValueStackSize: Int = 16, + maxValueStackSize: Int = 1024) extends RuleDSL { import Parser._ require(maxValueStackSize <= 65536, "`maxValueStackSize` > 2^16 is not supported") // due to current snapshot design @@ -176,7 +177,7 @@ abstract class Parser(initialValueStackSize: Int = 16, @tailrec def phase4_collectRuleTraces(reportedErrorIndex: Int, principalErrorIndex: Int, reportQuiet: Boolean)( - phase3: CollectingRuleTraces = new CollectingRuleTraces(reportedErrorIndex, reportQuiet), + phase3: CollectingRuleTraces = new CollectingRuleTraces(reportedErrorIndex, reportQuiet), traces: VectorBuilder[RuleTrace] = new VectorBuilder): ParseError = { def done = { @@ -592,8 +593,8 @@ object Parser { // or -1 if no atomic rule fails with a mismatch at the principal error index private class EstablishingReportedErrorIndex( private var _principalErrorIndex: Int, - var currentAtomicStart: Int = Int.MinValue, - var maxAtomicErrorStart: Int = Int.MinValue) extends ErrorAnalysisPhase { + var currentAtomicStart: Int = Int.MinValue, + var maxAtomicErrorStart: Int = Int.MinValue) extends ErrorAnalysisPhase { def reportedErrorIndex = if (maxAtomicErrorStart >= 0) maxAtomicErrorStart else _principalErrorIndex def applyOffset(offset: Int) = { _principalErrorIndex -= offset @@ -606,8 +607,8 @@ object Parser { // in which case we need to report them even though they are marked as "quiet" private class DetermineReportQuiet( private var _minErrorIndex: Int, // the smallest index at which a mismatch triggers a StartTracingException - var inQuiet: Boolean = false // are we currently in a quiet rule? - ) extends ErrorAnalysisPhase { + var inQuiet: Boolean = false // are we currently in a quiet rule? + ) extends ErrorAnalysisPhase { def minErrorIndex = _minErrorIndex def applyOffset(offset: Int) = _minErrorIndex -= offset } @@ -615,11 +616,11 @@ object Parser { // collect the traces of all mismatches happening at an index >= minErrorIndex (the reported error index) // by throwing a StartTracingException which gets turned into a TracingBubbleException by the terminal rule private class CollectingRuleTraces( - var minErrorIndex: Int, // the smallest index at which a mismatch triggers a StartTracingException - val reportQuiet: Boolean, // do we need to trace mismatches from quiet rules? - val traceNr: Int = 0, // the zero-based index number of the RuleTrace we are currently building - var errorMismatches: Int = 0 // the number of times we have already seen a mismatch at >= minErrorIndex - ) extends ErrorAnalysisPhase { + var minErrorIndex: Int, // the smallest index at which a mismatch triggers a StartTracingException + val reportQuiet: Boolean, // do we need to trace mismatches from quiet rules? + val traceNr: Int = 0, // the zero-based index number of the RuleTrace we are currently building + var errorMismatches: Int = 0 // the number of times we have already seen a mismatch at >= minErrorIndex + ) extends ErrorAnalysisPhase { def applyOffset(offset: Int) = minErrorIndex -= offset } } diff --git a/akka-parsing/src/main/scala/akka/parboiled2/Rule.scala b/akka-parsing/src/main/scala/akka/parboiled2/Rule.scala index 50bcc68db8..a74936d423 100644 --- a/akka-parsing/src/main/scala/akka/parboiled2/Rule.scala +++ b/akka-parsing/src/main/scala/akka/parboiled2/Rule.scala @@ -46,7 +46,8 @@ sealed class Rule[-I <: HList, +O <: HList] extends RuleX { * Rule[A, B:C] ~ Rule[D:B:C, E:F] = Rule[D:A, E:F] */ @compileTimeOnly("Calls to `~` must be inside `rule` macro") - def ~[I2 <: HList, O2 <: HList](that: Rule[I2, O2])(implicit i: TailSwitch[I2, O @uncheckedVariance, I @uncheckedVariance], + def ~[I2 <: HList, O2 <: HList](that: Rule[I2, O2])(implicit + i: TailSwitch[I2, O @uncheckedVariance, I @uncheckedVariance], o: TailSwitch[O @uncheckedVariance, I2, O2]): Rule[i.Out, o.Out] = `n/a` /** @@ -54,7 +55,8 @@ sealed class Rule[-I <: HList, +O <: HList] extends RuleX { * If the rule being concatenated doesn't match a parse error will be triggered immediately. */ @compileTimeOnly("Calls to `~!~` must be inside `rule` macro") - def ~!~[I2 <: HList, O2 <: HList](that: Rule[I2, O2])(implicit i: TailSwitch[I2, O @uncheckedVariance, I @uncheckedVariance], + def ~!~[I2 <: HList, O2 <: HList](that: Rule[I2, O2])(implicit + i: TailSwitch[I2, O @uncheckedVariance, I @uncheckedVariance], o: TailSwitch[O @uncheckedVariance, I2, O2]): Rule[i.Out, o.Out] = `n/a` /** diff --git a/akka-parsing/src/main/scala/akka/parboiled2/support/OpTreeContext.scala b/akka-parsing/src/main/scala/akka/parboiled2/support/OpTreeContext.scala index a9f9dfc95c..168ec7d503 100644 --- a/akka-parsing/src/main/scala/akka/parboiled2/support/OpTreeContext.scala +++ b/akka-parsing/src/main/scala/akka/parboiled2/support/OpTreeContext.scala @@ -397,13 +397,13 @@ trait OpTreeContext[OpTreeCtx <: ParserMacros.ParserContext] { if (i <= 0) c.abort(base.pos, "`x` in `x.times` must be positive") else if (i == 1) rule else Times(rule, q"val min, max = $n", collector, separator) - case x@(Ident(_) | Select(_, _)) ⇒ Times(rule, q"val min = $n; val max = min", collector, separator) - case _ ⇒ c.abort(n.pos, "Invalid int base expression for `.times(...)`: " + n) + case x @ (Ident(_) | Select(_, _)) ⇒ Times(rule, q"val min = $n; val max = min", collector, separator) + case _ ⇒ c.abort(n.pos, "Invalid int base expression for `.times(...)`: " + n) } case q"$a.this.range2NTimes($r)" ⇒ r match { - case q"scala.Predef.intWrapper($mn).to($mx)" ⇒ handleRange(mn, mx, r) // Scala 2.12 + case q"scala.Predef.intWrapper($mn).to($mx)" ⇒ handleRange(mn, mx, r) // Scala 2.12 case q"scala.this.Predef.intWrapper($mn).to($mx)" ⇒ handleRange(mn, mx, r) // Scala 2.11 - case x@(Ident(_) | Select(_, _)) ⇒ + case x @ (Ident(_) | Select(_, _)) ⇒ Times(rule, q"val r = $r; val min = r.start; val max = r.end", collector, separator) case _ ⇒ c.abort(r.pos, "Invalid range base expression for `.times(...)`: " + r) } @@ -689,11 +689,11 @@ trait OpTreeContext[OpTreeCtx <: ParserMacros.ParserContext] { /////////////////////////////////// helpers //////////////////////////////////// class Collector( - val valBuilder: Tree, - val popToBuilder: Tree, + val valBuilder: Tree, + val popToBuilder: Tree, val pushBuilderResult: Tree, - val pushSomePop: Tree, - val pushNone: Tree) + val pushSomePop: Tree, + val pushNone: Tree) lazy val rule0Collector = { val unit = q"()" diff --git a/akka-parsing/src/main/scala/akka/shapeless/hlists.scala b/akka-parsing/src/main/scala/akka/shapeless/hlists.scala index e14c8be049..0353e89c35 100644 --- a/akka-parsing/src/main/scala/akka/shapeless/hlists.scala +++ b/akka-parsing/src/main/scala/akka/shapeless/hlists.scala @@ -16,7 +16,6 @@ package akka.shapeless - /** * `HList` ADT base trait. * diff --git a/akka-parsing/src/main/scala/akka/shapeless/ops/hlists.scala b/akka-parsing/src/main/scala/akka/shapeless/ops/hlists.scala index 6f2b677348..2b12cef49a 100644 --- a/akka-parsing/src/main/scala/akka/shapeless/ops/hlists.scala +++ b/akka-parsing/src/main/scala/akka/shapeless/ops/hlists.scala @@ -17,7 +17,6 @@ package akka.shapeless package ops - object hlist { /** * Type class witnessing that this `HList` is composite and providing access to head and tail. diff --git a/akka-persistence-query/src/main/scala/akka/persistence/query/EventEnvelope.scala b/akka-persistence-query/src/main/scala/akka/persistence/query/EventEnvelope.scala index b6b17067c9..67ac0c15ae 100644 --- a/akka-persistence-query/src/main/scala/akka/persistence/query/EventEnvelope.scala +++ b/akka-persistence-query/src/main/scala/akka/persistence/query/EventEnvelope.scala @@ -8,7 +8,7 @@ package akka.persistence.query * [[akka.persistence.query.scaladsl.EventsByTagQuery]] query, or similar queries. */ final case class EventEnvelope( - offset: Long, + offset: Long, persistenceId: String, - sequenceNr: Long, - event: Any) + sequenceNr: Long, + event: Any) diff --git a/akka-persistence-query/src/main/scala/akka/persistence/query/PersistenceQuery.scala b/akka-persistence-query/src/main/scala/akka/persistence/query/PersistenceQuery.scala index ed86bfb7c6..059dc8f329 100644 --- a/akka-persistence-query/src/main/scala/akka/persistence/query/PersistenceQuery.scala +++ b/akka-persistence-query/src/main/scala/akka/persistence/query/PersistenceQuery.scala @@ -71,7 +71,8 @@ class PersistenceQuery(system: ExtendedActorSystem) extends Extension { } private def createPlugin(configPath: String): ReadJournalProvider = { - require(!isEmpty(configPath) && system.settings.config.hasPath(configPath), + require( + !isEmpty(configPath) && system.settings.config.hasPath(configPath), s"'reference.conf' is missing persistence read journal plugin config path: '${configPath}'") val pluginConfig = system.settings.config.getConfig(configPath) val pluginClassName = pluginConfig.getString("class") diff --git a/akka-persistence-query/src/main/scala/akka/persistence/query/journal/leveldb/EventsByPersistenceIdPublisher.scala b/akka-persistence-query/src/main/scala/akka/persistence/query/journal/leveldb/EventsByPersistenceIdPublisher.scala index 63fa0f6312..e5215658e6 100644 --- a/akka-persistence-query/src/main/scala/akka/persistence/query/journal/leveldb/EventsByPersistenceIdPublisher.scala +++ b/akka-persistence-query/src/main/scala/akka/persistence/query/journal/leveldb/EventsByPersistenceIdPublisher.scala @@ -123,7 +123,7 @@ private[akka] abstract class AbstractEventsByPersistenceIdPublisher( private[akka] class LiveEventsByPersistenceIdPublisher( persistenceId: String, fromSequenceNr: Long, override val toSequenceNr: Long, refreshInterval: FiniteDuration, - maxBufSize: Int, writeJournalPluginId: String) + maxBufSize: Int, writeJournalPluginId: String) extends AbstractEventsByPersistenceIdPublisher( persistenceId, fromSequenceNr, maxBufSize, writeJournalPluginId) { import EventsByPersistenceIdPublisher._ diff --git a/akka-persistence-query/src/main/scala/akka/persistence/query/journal/leveldb/EventsByTagPublisher.scala b/akka-persistence-query/src/main/scala/akka/persistence/query/journal/leveldb/EventsByTagPublisher.scala index 49903e5282..4f2d41d41b 100644 --- a/akka-persistence-query/src/main/scala/akka/persistence/query/journal/leveldb/EventsByTagPublisher.scala +++ b/akka-persistence-query/src/main/scala/akka/persistence/query/journal/leveldb/EventsByTagPublisher.scala @@ -125,7 +125,7 @@ private[akka] abstract class AbstractEventsByTagPublisher( private[akka] class LiveEventsByTagPublisher( tag: String, fromOffset: Long, override val toOffset: Long, refreshInterval: FiniteDuration, - maxBufSize: Int, writeJournalPluginId: String) + maxBufSize: Int, writeJournalPluginId: String) extends AbstractEventsByTagPublisher( tag, fromOffset, maxBufSize, writeJournalPluginId) { import EventsByTagPublisher._ diff --git a/akka-persistence/src/main/scala/akka/persistence/AtLeastOnceDelivery.scala b/akka-persistence/src/main/scala/akka/persistence/AtLeastOnceDelivery.scala index 399297bb6a..b6745c6818 100644 --- a/akka-persistence/src/main/scala/akka/persistence/AtLeastOnceDelivery.scala +++ b/akka-persistence/src/main/scala/akka/persistence/AtLeastOnceDelivery.scala @@ -308,7 +308,8 @@ trait AtLeastOnceDeliveryLike extends Eventsourced { * as a blob in your custom snapshot. */ def getDeliverySnapshot: AtLeastOnceDeliverySnapshot = - AtLeastOnceDeliverySnapshot(deliverySequenceNr, + AtLeastOnceDeliverySnapshot( + deliverySequenceNr, unconfirmed.map { case (deliveryId, d) ⇒ UnconfirmedDelivery(deliveryId, d.destination, d.message) }(breakOut)) /** @@ -319,7 +320,7 @@ trait AtLeastOnceDeliveryLike extends Eventsourced { deliverySequenceNr = snapshot.currentDeliveryId val now = System.nanoTime() unconfirmed = snapshot.unconfirmedDeliveries.map(d ⇒ - d.deliveryId -> Delivery(d.destination, d.message, now, 0))(breakOut) + d.deliveryId → Delivery(d.destination, d.message, now, 0))(breakOut) } /** diff --git a/akka-persistence/src/main/scala/akka/persistence/Eventsourced.scala b/akka-persistence/src/main/scala/akka/persistence/Eventsourced.scala index 72c0067e14..6b8c1d1b20 100644 --- a/akka-persistence/src/main/scala/akka/persistence/Eventsourced.scala +++ b/akka-persistence/src/main/scala/akka/persistence/Eventsourced.scala @@ -145,7 +145,8 @@ private[persistence] trait Eventsourced extends Snapshotter with PersistenceStas * @param event the event that was to be persisted */ protected def onPersistRejected(cause: Throwable, event: Any, seqNr: Long): Unit = { - log.warning("Rejected to persist event type [{}] with sequence number [{}] for persistenceId [{}] due to [{}].", + log.warning( + "Rejected to persist event type [{}] with sequence number [{}] for persistenceId [{}] due to [{}].", event.getClass.getName, seqNr, persistenceId, cause.getMessage) } @@ -229,7 +230,8 @@ private[persistence] trait Eventsourced extends Snapshotter with PersistenceStas case DeleteSnapshotsFailure(c, e) ⇒ log.warning("Failed to deleteSnapshots given criteria [{}] due to: [{}: {}]", c, e.getClass.getCanonicalName, e.getMessage) case DeleteMessagesFailure(e, toSequenceNr) ⇒ - log.warning("Failed to deleteMessages toSequenceNr [{}] for persistenceId [{}] due to [{}: {}].", + log.warning( + "Failed to deleteMessages toSequenceNr [{}] for persistenceId [{}] due to [{}: {}].", toSequenceNr, persistenceId, e.getClass.getCanonicalName, e.getMessage) case m ⇒ super.unhandled(m) } diff --git a/akka-persistence/src/main/scala/akka/persistence/Persistence.scala b/akka-persistence/src/main/scala/akka/persistence/Persistence.scala index 7cd3d31a33..c8dd4b7e49 100644 --- a/akka-persistence/src/main/scala/akka/persistence/Persistence.scala +++ b/akka-persistence/src/main/scala/akka/persistence/Persistence.scala @@ -305,7 +305,8 @@ class Persistence(val system: ExtendedActorSystem) extends Extension { private class PluginHolderExtensionId(configPath: String, fallbackPath: String) extends ExtensionId[PluginHolder] { override def createExtension(system: ExtendedActorSystem): PluginHolder = { - require(!isEmpty(configPath) && system.settings.config.hasPath(configPath), + require( + !isEmpty(configPath) && system.settings.config.hasPath(configPath), s"'reference.conf' is missing persistence plugin config path: '$configPath'") val config: Config = system.settings.config.getConfig(configPath) .withFallback(system.settings.config.getConfig(fallbackPath)) diff --git a/akka-persistence/src/main/scala/akka/persistence/Persistent.scala b/akka-persistence/src/main/scala/akka/persistence/Persistent.scala index 2e1ed023b1..b50cd80e47 100644 --- a/akka-persistence/src/main/scala/akka/persistence/Persistent.scala +++ b/akka-persistence/src/main/scala/akka/persistence/Persistent.scala @@ -42,7 +42,8 @@ final case class AtomicWrite(payload: immutable.Seq[PersistentRepr]) extends Per case l: List[PersistentRepr] ⇒ l.tail.nonEmpty // avoids calling .size case v: Vector[PersistentRepr] ⇒ v.size > 1 case _ ⇒ true // some other collection type, let's just check - }) require(payload.forall(_.persistenceId == payload.head.persistenceId), + }) require( + payload.forall(_.persistenceId == payload.head.persistenceId), "AtomicWrite must contain messages for the same persistenceId, " + s"yet different persistenceIds found: ${payload.map(_.persistenceId).toSet}") @@ -115,11 +116,11 @@ trait PersistentRepr extends Message { * Creates a new copy of this [[PersistentRepr]]. */ def update( - sequenceNr: Long = sequenceNr, - persistenceId: String = persistenceId, - deleted: Boolean = deleted, - sender: ActorRef = sender, - writerUuid: String = writerUuid): PersistentRepr + sequenceNr: Long = sequenceNr, + persistenceId: String = persistenceId, + deleted: Boolean = deleted, + sender: ActorRef = sender, + writerUuid: String = writerUuid): PersistentRepr } object PersistentRepr { @@ -132,13 +133,13 @@ object PersistentRepr { * Plugin API. */ def apply( - payload: Any, - sequenceNr: Long = 0L, - persistenceId: String = PersistentRepr.Undefined, - manifest: String = PersistentRepr.Undefined, - deleted: Boolean = false, - sender: ActorRef = null, - writerUuid: String = PersistentRepr.Undefined): PersistentRepr = + payload: Any, + sequenceNr: Long = 0L, + persistenceId: String = PersistentRepr.Undefined, + manifest: String = PersistentRepr.Undefined, + deleted: Boolean = false, + sender: ActorRef = null, + writerUuid: String = PersistentRepr.Undefined): PersistentRepr = PersistentImpl(payload, sequenceNr, persistenceId, manifest, deleted, sender, writerUuid) /** @@ -157,13 +158,13 @@ object PersistentRepr { * INTERNAL API. */ private[persistence] final case class PersistentImpl( - override val payload: Any, - override val sequenceNr: Long, + override val payload: Any, + override val sequenceNr: Long, override val persistenceId: String, - override val manifest: String, - override val deleted: Boolean, - override val sender: ActorRef, - override val writerUuid: String) extends PersistentRepr with NoSerializationVerificationNeeded { + override val manifest: String, + override val deleted: Boolean, + override val sender: ActorRef, + override val writerUuid: String) extends PersistentRepr with NoSerializationVerificationNeeded { def withPayload(payload: Any): PersistentRepr = copy(payload = payload) diff --git a/akka-persistence/src/main/scala/akka/persistence/PersistentActor.scala b/akka-persistence/src/main/scala/akka/persistence/PersistentActor.scala index cccb635c4d..b95689458b 100644 --- a/akka-persistence/src/main/scala/akka/persistence/PersistentActor.scala +++ b/akka-persistence/src/main/scala/akka/persistence/PersistentActor.scala @@ -52,8 +52,8 @@ final case class DeleteMessagesFailure(cause: Throwable, toSequenceNr: Long) @SerialVersionUID(1L) final case class Recovery( fromSnapshot: SnapshotSelectionCriteria = SnapshotSelectionCriteria.Latest, - toSequenceNr: Long = Long.MaxValue, - replayMax: Long = Long.MaxValue) + toSequenceNr: Long = Long.MaxValue, + replayMax: Long = Long.MaxValue) object Recovery { diff --git a/akka-persistence/src/main/scala/akka/persistence/SnapshotProtocol.scala b/akka-persistence/src/main/scala/akka/persistence/SnapshotProtocol.scala index 8ab09fb0f4..8a489dbd33 100644 --- a/akka-persistence/src/main/scala/akka/persistence/SnapshotProtocol.scala +++ b/akka-persistence/src/main/scala/akka/persistence/SnapshotProtocol.scala @@ -107,9 +107,9 @@ final case class SnapshotOffer(metadata: SnapshotMetadata, snapshot: Any) @SerialVersionUID(1L) final case class SnapshotSelectionCriteria( maxSequenceNr: Long = Long.MaxValue, - maxTimestamp: Long = Long.MaxValue, + maxTimestamp: Long = Long.MaxValue, minSequenceNr: Long = 0L, - minTimestamp: Long = 0L) { + minTimestamp: Long = 0L) { /** * INTERNAL API. diff --git a/akka-persistence/src/main/scala/akka/persistence/fsm/PersistentFSM.scala b/akka-persistence/src/main/scala/akka/persistence/fsm/PersistentFSM.scala index c2cef062e8..6d8226cd54 100644 --- a/akka-persistence/src/main/scala/akka/persistence/fsm/PersistentFSM.scala +++ b/akka-persistence/src/main/scala/akka/persistence/fsm/PersistentFSM.scala @@ -49,8 +49,8 @@ trait PersistentFSM[S <: FSMState, D, E] extends PersistentActor with Persistent lazy val statesMap: Map[String, S] = stateNames.map(name ⇒ (name.identifier, name)).toMap /** - * Timeout set for the current state. Used when saving a snapshot - */ + * Timeout set for the current state. Used when saving a snapshot + */ private var currentStateTimeout: Option[FiniteDuration] = None /** @@ -68,8 +68,8 @@ trait PersistentFSM[S <: FSMState, D, E] extends PersistentActor with Persistent def onRecoveryCompleted(): Unit = {} /** - * Save the current state as a snapshot - */ + * Save the current state as a snapshot + */ final def saveStateSnapshot(): Unit = { saveSnapshot(PersistentFSMSnapshot(stateName.identifier, stateData, currentStateTimeout)) } @@ -85,9 +85,9 @@ trait PersistentFSM[S <: FSMState, D, E] extends PersistentActor with Persistent * Discover the latest recorded state */ override def receiveRecover: Receive = { - case domainEventTag(event) ⇒ startWith(stateName, applyEvent(event, stateData)) + case domainEventTag(event) ⇒ startWith(stateName, applyEvent(event, stateData)) case StateChangeEvent(stateIdentifier, timeout) ⇒ startWith(statesMap(stateIdentifier), stateData, timeout) - case SnapshotOffer(_, PersistentFSMSnapshot(stateIdentifier, data: D, timeout)) => startWith(statesMap(stateIdentifier), data, timeout) + case SnapshotOffer(_, PersistentFSMSnapshot(stateIdentifier, data: D, timeout)) ⇒ startWith(statesMap(stateIdentifier), data, timeout) case RecoveryCompleted ⇒ initialize() onRecoveryCompleted() @@ -147,13 +147,13 @@ object PersistentFSM { private[persistence] case class StateChangeEvent(stateIdentifier: String, timeout: Option[FiniteDuration]) extends PersistentFsmEvent /** - * FSM state and data snapshot - * - * @param stateIdentifier FSM state identifier - * @param data FSM state data - * @param timeout FSM state timeout - * @tparam D state data type - */ + * FSM state and data snapshot + * + * @param stateIdentifier FSM state identifier + * @param data FSM state data + * @param timeout FSM state timeout + * @tparam D state data type + */ private[persistence] case class PersistentFSMSnapshot[D](stateIdentifier: String, data: D, timeout: Option[FiniteDuration]) extends Message /** @@ -259,9 +259,10 @@ object PersistentFSM { * This extractor is just convenience for matching a (S, S) pair, including a * reminder what the new state is. */ - object -> { + object `->` { def unapply[S](in: (S, S)) = Some(in) } + val `→` = `->` /** * Log Entry of the [[akka.actor.LoggingFSM]], can be obtained by calling `getLog`. @@ -275,13 +276,13 @@ object PersistentFSM { * to be executed after FSM moves to the new state (also triggered when staying in the same state) */ final case class State[S, D, E]( - stateName: S, - stateData: D, - timeout: Option[FiniteDuration] = None, - stopReason: Option[Reason] = None, - replies: List[Any] = Nil, - domainEvents: Seq[E] = Nil, - afterTransitionDo: D ⇒ Unit = { _: D ⇒ })(private[akka] val notifies: Boolean = true) { + stateName: S, + stateData: D, + timeout: Option[FiniteDuration] = None, + stopReason: Option[Reason] = None, + replies: List[Any] = Nil, + domainEvents: Seq[E] = Nil, + afterTransitionDo: D ⇒ Unit = { _: D ⇒ })(private[akka] val notifies: Boolean = true) { /** * Copy object and update values if needed. diff --git a/akka-persistence/src/main/scala/akka/persistence/fsm/PersistentFSMBase.scala b/akka-persistence/src/main/scala/akka/persistence/fsm/PersistentFSMBase.scala index ad30835e5e..9994e95154 100644 --- a/akka-persistence/src/main/scala/akka/persistence/fsm/PersistentFSMBase.scala +++ b/akka-persistence/src/main/scala/akka/persistence/fsm/PersistentFSMBase.scala @@ -113,7 +113,7 @@ trait PersistentFSMBase[S, D, E] extends Actor with Listeners with ActorLogging * This extractor is just convenience for matching a (S, S) pair, including a * reminder what the new state is. */ - val -> = PersistentFSM.-> + val `->` = PersistentFSM.`->` /** * This case object is received in case of a state timeout. @@ -669,9 +669,10 @@ abstract class AbstractPersistentFSMBase[S, D, E] extends PersistentFSMBase[S, D * @param stateTimeout default state timeout for this state * @param stateFunctionBuilder partial function builder describing response to input */ - final def when(stateName: S, - stateTimeout: FiniteDuration, - stateFunctionBuilder: FSMStateFunctionBuilder[S, D, E]): Unit = + final def when( + stateName: S, + stateTimeout: FiniteDuration, + stateFunctionBuilder: FSMStateFunctionBuilder[S, D, E]): Unit = when(stateName, stateTimeout)(stateFunctionBuilder.build()) /** diff --git a/akka-persistence/src/main/scala/akka/persistence/journal/AsyncWriteJournal.scala b/akka-persistence/src/main/scala/akka/persistence/journal/AsyncWriteJournal.scala index 417d20f565..6623d6d2d1 100644 --- a/akka-persistence/src/main/scala/akka/persistence/journal/AsyncWriteJournal.scala +++ b/akka-persistence/src/main/scala/akka/persistence/journal/AsyncWriteJournal.scala @@ -281,7 +281,7 @@ private[persistence] object AsyncWriteJournal { delivered = d.snr d.target.tell(d.msg, d.sender) } else { - delayed += (d.snr -> d) + delayed += (d.snr → d) } val ro = delayed.remove(delivered + 1) if (ro.isDefined) resequence(ro.get) diff --git a/akka-persistence/src/main/scala/akka/persistence/journal/EventAdapters.scala b/akka-persistence/src/main/scala/akka/persistence/journal/EventAdapters.scala index a5e237b1cb..847bbfcd58 100644 --- a/akka-persistence/src/main/scala/akka/persistence/journal/EventAdapters.scala +++ b/akka-persistence/src/main/scala/akka/persistence/journal/EventAdapters.scala @@ -20,9 +20,9 @@ import scala.util.Try * `EventAdapters` serves as a per-journal collection of bound event adapters. */ class EventAdapters( - map: ConcurrentHashMap[Class[_], EventAdapter], + map: ConcurrentHashMap[Class[_], EventAdapter], bindings: immutable.Seq[(Class[_], EventAdapter)], - log: LoggingAdapter) { + log: LoggingAdapter) { /** * Finds the "most specific" matching adapter for the given class (i.e. it may return an adapter that can work on a @@ -71,20 +71,21 @@ private[akka] object EventAdapters { } private def apply( - system: ExtendedActorSystem, - adapters: Map[Name, FQN], + system: ExtendedActorSystem, + adapters: Map[Name, FQN], adapterBindings: Map[FQN, BoundAdapters]): EventAdapters = { val adapterNames = adapters.keys.toSet for { (fqn, boundToAdapters) ← adapterBindings boundAdapter ← boundToAdapters - } require(adapterNames(boundAdapter.toString), + } require( + adapterNames(boundAdapter.toString), s"$fqn was bound to undefined event-adapter: $boundAdapter (bindings: ${boundToAdapters.mkString("[", ", ", "]")}, known adapters: ${adapters.keys.mkString})") // A Map of handler from alias to implementation (i.e. class implementing akka.serialization.Serializer) // For example this defines a handler named 'country': `"country" -> com.example.comain.CountryTagsAdapter` - val handlers = for ((k: String, v: String) ← adapters) yield k -> instantiateAdapter(v, system).get + val handlers = for ((k: String, v: String) ← adapters) yield k → instantiateAdapter(v, system).get // bindings is a Seq of tuple representing the mapping from Class to handler. // It is primarily ordered by the most specific classes first, and secondly in the configured order. @@ -131,7 +132,7 @@ private[akka] object EventAdapters { * loading is performed by the system’s [[akka.actor.DynamicAccess]]. */ private def instantiate[T: ClassTag](fqn: FQN, system: ExtendedActorSystem): Try[T] = - system.dynamicAccess.createInstanceFor[T](fqn, List(classOf[ExtendedActorSystem] -> system)) recoverWith { + system.dynamicAccess.createInstanceFor[T](fqn, List(classOf[ExtendedActorSystem] → system)) recoverWith { case _: NoSuchMethodException ⇒ system.dynamicAccess.createInstanceFor[T](fqn, Nil) } @@ -151,7 +152,7 @@ private[akka] object EventAdapters { private final def configToMap(config: Config, path: String): Map[String, String] = { import scala.collection.JavaConverters._ if (config.hasPath(path)) { - config.getConfig(path).root.unwrapped.asScala.toMap map { case (k, v) ⇒ k -> v.toString } + config.getConfig(path).root.unwrapped.asScala.toMap map { case (k, v) ⇒ k → v.toString } } else Map.empty } @@ -159,8 +160,8 @@ private[akka] object EventAdapters { import scala.collection.JavaConverters._ if (config.hasPath(path)) { config.getConfig(path).root.unwrapped.asScala.toMap map { - case (k, v: util.ArrayList[_]) if v.isInstanceOf[util.ArrayList[_]] ⇒ k -> v.asScala.map(_.toString).toList - case (k, v) ⇒ k -> List(v.toString) + case (k, v: util.ArrayList[_]) if v.isInstanceOf[util.ArrayList[_]] ⇒ k → v.asScala.map(_.toString).toList + case (k, v) ⇒ k → List(v.toString) } } else Map.empty } diff --git a/akka-persistence/src/main/scala/akka/persistence/journal/ReplayFilter.scala b/akka-persistence/src/main/scala/akka/persistence/journal/ReplayFilter.scala index 87e6e68467..4df0bb0d4f 100644 --- a/akka-persistence/src/main/scala/akka/persistence/journal/ReplayFilter.scala +++ b/akka-persistence/src/main/scala/akka/persistence/journal/ReplayFilter.scala @@ -20,10 +20,10 @@ import scala.collection.mutable.LinkedHashSet private[akka] object ReplayFilter { def props( persistentActor: ActorRef, - mode: Mode, - windowSize: Int, - maxOldWriters: Int, - debugEnabled: Boolean): Props = { + mode: Mode, + windowSize: Int, + maxOldWriters: Int, + debugEnabled: Boolean): Props = { require(windowSize > 0, "windowSize must be > 0") require(maxOldWriters > 0, "maxOldWriters must be > 0") require(mode != Disabled, "mode must not be Disabled") @@ -33,9 +33,9 @@ private[akka] object ReplayFilter { // for binary compatibility def props( persistentActor: ActorRef, - mode: Mode, - windowSize: Int, - maxOldWriters: Int): Props = props(persistentActor, mode, windowSize, maxOldWriters, debugEnabled = false) + mode: Mode, + windowSize: Int, + maxOldWriters: Int): Props = props(persistentActor, mode, windowSize, maxOldWriters, debugEnabled = false) sealed trait Mode case object Fail extends Mode diff --git a/akka-persistence/src/main/scala/akka/persistence/journal/inmem/InmemJournal.scala b/akka-persistence/src/main/scala/akka/persistence/journal/inmem/InmemJournal.scala index 771c860141..e52b90228a 100644 --- a/akka-persistence/src/main/scala/akka/persistence/journal/inmem/InmemJournal.scala +++ b/akka-persistence/src/main/scala/akka/persistence/journal/inmem/InmemJournal.scala @@ -54,17 +54,17 @@ private[persistence] trait InmemMessages { var messages = Map.empty[String, Vector[PersistentRepr]] def add(p: PersistentRepr): Unit = messages = messages + (messages.get(p.persistenceId) match { - case Some(ms) ⇒ p.persistenceId -> (ms :+ p) - case None ⇒ p.persistenceId -> Vector(p) + case Some(ms) ⇒ p.persistenceId → (ms :+ p) + case None ⇒ p.persistenceId → Vector(p) }) def update(pid: String, snr: Long)(f: PersistentRepr ⇒ PersistentRepr): Unit = messages = messages.get(pid) match { - case Some(ms) ⇒ messages + (pid -> ms.map(sp ⇒ if (sp.sequenceNr == snr) f(sp) else sp)) + case Some(ms) ⇒ messages + (pid → ms.map(sp ⇒ if (sp.sequenceNr == snr) f(sp) else sp)) case None ⇒ messages } def delete(pid: String, snr: Long): Unit = messages = messages.get(pid) match { - case Some(ms) ⇒ messages + (pid -> ms.filterNot(_.sequenceNr == snr)) + case Some(ms) ⇒ messages + (pid → ms.filterNot(_.sequenceNr == snr)) case None ⇒ messages } diff --git a/akka-persistence/src/main/scala/akka/persistence/journal/leveldb/LeveldbIdMapping.scala b/akka-persistence/src/main/scala/akka/persistence/journal/leveldb/LeveldbIdMapping.scala index a0b36cf306..b63ada5a8b 100644 --- a/akka-persistence/src/main/scala/akka/persistence/journal/leveldb/LeveldbIdMapping.scala +++ b/akka-persistence/src/main/scala/akka/persistence/journal/leveldb/LeveldbIdMapping.scala @@ -55,13 +55,13 @@ private[persistence] trait LeveldbIdMapping extends Actor { this: LeveldbStore val nextKey = keyFromBytes(nextEntry.getKey) if (!isMappingKey(nextKey)) pathMap else { val nextVal = new String(nextEntry.getValue, UTF_8) - readIdMap(pathMap + (nextVal -> nextKey.mappingId), iter) + readIdMap(pathMap + (nextVal → nextKey.mappingId), iter) } } } private def writeIdMapping(id: String, numericId: Int): Int = { - idMap = idMap + (id -> numericId) + idMap = idMap + (id → numericId) leveldb.put(keyToBytes(mappingKey(numericId)), id.getBytes(UTF_8)) newPersistenceIdAdded(id) numericId diff --git a/akka-persistence/src/main/scala/akka/persistence/journal/leveldb/LeveldbKey.scala b/akka-persistence/src/main/scala/akka/persistence/journal/leveldb/LeveldbKey.scala index 29cfdd43de..0db740c440 100644 --- a/akka-persistence/src/main/scala/akka/persistence/journal/leveldb/LeveldbKey.scala +++ b/akka-persistence/src/main/scala/akka/persistence/journal/leveldb/LeveldbKey.scala @@ -12,8 +12,8 @@ import java.nio.ByteBuffer */ private[leveldb] final case class Key( persistenceId: Int, - sequenceNr: Long, - mappingId: Int) + sequenceNr: Long, + mappingId: Int) private[leveldb] object Key { def keyToBytes(key: Key): Array[Byte] = { diff --git a/akka-persistence/src/main/scala/akka/persistence/journal/leveldb/LeveldbStore.scala b/akka-persistence/src/main/scala/akka/persistence/journal/leveldb/LeveldbStore.scala index c51a6c8463..6eb1931a9d 100644 --- a/akka-persistence/src/main/scala/akka/persistence/journal/leveldb/LeveldbStore.scala +++ b/akka-persistence/src/main/scala/akka/persistence/journal/leveldb/LeveldbStore.scala @@ -64,7 +64,8 @@ private[persistence] trait LeveldbStore extends Actor with WriteJournalBase with if (tags.nonEmpty && hasTagSubscribers) allTags = allTags union tags - require(!p2.persistenceId.startsWith(tagPersistenceIdPrefix), + require( + !p2.persistenceId.startsWith(tagPersistenceIdPrefix), s"persistenceId [${p.persistenceId}] must not start with $tagPersistenceIdPrefix") addToMessageBatch(p2, tags, batch) } diff --git a/akka-persistence/src/test/scala/akka/persistence/AtLeastOnceDeliverySpec.scala b/akka-persistence/src/test/scala/akka/persistence/AtLeastOnceDeliverySpec.scala index af56ffa077..9d8d936816 100644 --- a/akka-persistence/src/test/scala/akka/persistence/AtLeastOnceDeliverySpec.scala +++ b/akka-persistence/src/test/scala/akka/persistence/AtLeastOnceDeliverySpec.scala @@ -31,19 +31,20 @@ object AtLeastOnceDeliverySpec { def senderProps(testActor: ActorRef, name: String, redeliverInterval: FiniteDuration, warnAfterNumberOfUnconfirmedAttempts: Int, redeliveryBurstLimit: Int, - destinations: Map[String, ActorPath], - async: Boolean, actorSelectionDelivery: Boolean = false): Props = + destinations: Map[String, ActorPath], + async: Boolean, actorSelectionDelivery: Boolean = false): Props = Props(new Sender(testActor, name, redeliverInterval, warnAfterNumberOfUnconfirmedAttempts, redeliveryBurstLimit, destinations, async, actorSelectionDelivery)) - class Sender(testActor: ActorRef, - name: String, - override val redeliverInterval: FiniteDuration, - override val warnAfterNumberOfUnconfirmedAttempts: Int, - override val redeliveryBurstLimit: Int, - destinations: Map[String, ActorPath], - async: Boolean, - actorSelectionDelivery: Boolean) + class Sender( + testActor: ActorRef, + name: String, + override val redeliverInterval: FiniteDuration, + override val warnAfterNumberOfUnconfirmedAttempts: Int, + override val redeliveryBurstLimit: Int, + destinations: Map[String, ActorPath], + async: Boolean, + actorSelectionDelivery: Boolean) extends PersistentActor with AtLeastOnceDelivery with ActorLogging { override def persistenceId: String = name @@ -179,7 +180,7 @@ abstract class AtLeastOnceDeliverySpec(config: Config) extends PersistenceSpec(c s"deliver messages in order when nothing is lost (using actorSelection: $deliverUsingActorSelection)" taggedAs (TimingTest) in { val probe = TestProbe() val probeA = TestProbe() - val destinations = Map("A" -> system.actorOf(destinationProps(probeA.ref)).path) + val destinations = Map("A" → system.actorOf(destinationProps(probeA.ref)).path) val snd = system.actorOf(senderProps(probe.ref, name, 1000.millis, 5, 1000, destinations, async = false), name) snd.tell(Req("a"), probe.ref) probe.expectMsg(ReqAck) @@ -191,7 +192,7 @@ abstract class AtLeastOnceDeliverySpec(config: Config) extends PersistenceSpec(c val probe = TestProbe() val probeA = TestProbe() val dst = system.actorOf(destinationProps(probeA.ref)) - val destinations = Map("A" -> system.actorOf(unreliableProps(3, dst)).path) + val destinations = Map("A" → system.actorOf(unreliableProps(3, dst)).path) val snd = system.actorOf(senderProps(probe.ref, name, 1000.millis, 5, 1000, destinations, async = false, actorSelectionDelivery = deliverUsingActorSelection), name) snd.tell(Req("a-1"), probe.ref) probe.expectMsg(ReqAck) @@ -222,7 +223,7 @@ abstract class AtLeastOnceDeliverySpec(config: Config) extends PersistenceSpec(c val probe = TestProbe() val probeA = TestProbe() val dst = system.actorOf(destinationProps(probeA.ref)) - val destinations = Map("A" -> system.actorOf(unreliableProps(3, dst)).path) + val destinations = Map("A" → system.actorOf(unreliableProps(3, dst)).path) val snd = system.actorOf(senderProps(probe.ref, name, 1000.millis, 5, 1000, destinations, async = false), name) snd.tell(Req("a-1"), probe.ref) probe.expectMsg(ReqAck) @@ -256,7 +257,7 @@ abstract class AtLeastOnceDeliverySpec(config: Config) extends PersistenceSpec(c val probe = TestProbe() val probeA = TestProbe() val dst = system.actorOf(destinationProps(probeA.ref)) - val destinations = Map("A" -> system.actorOf(unreliableProps(2, dst)).path) + val destinations = Map("A" → system.actorOf(unreliableProps(2, dst)).path) val snd = system.actorOf(senderProps(probe.ref, name, 1000.millis, 5, 1000, destinations, async = false), name) snd.tell(Req("a-1"), probe.ref) probe.expectMsg(ReqAck) @@ -293,7 +294,7 @@ abstract class AtLeastOnceDeliverySpec(config: Config) extends PersistenceSpec(c val probe = TestProbe() val probeA = TestProbe() val dst = system.actorOf(destinationProps(probeA.ref)) - val destinations = Map("A" -> system.actorOf(unreliableProps(3, dst)).path) + val destinations = Map("A" → system.actorOf(unreliableProps(3, dst)).path) val snd = system.actorOf(senderProps(probe.ref, name, 1000.millis, 5, 1000, destinations, async = false), name) snd.tell(Req("a-1"), probe.ref) probe.expectMsg(ReqAck) @@ -331,7 +332,7 @@ abstract class AtLeastOnceDeliverySpec(config: Config) extends PersistenceSpec(c val probe = TestProbe() val probeA = TestProbe() val probeB = TestProbe() - val destinations = Map("A" -> probeA.ref.path, "B" -> probeB.ref.path) + val destinations = Map("A" → probeA.ref.path, "B" → probeB.ref.path) val snd = system.actorOf(senderProps(probe.ref, name, 1000.millis, 3, 1000, destinations, async = false), name) snd.tell(Req("a-1"), probe.ref) snd.tell(Req("b-1"), probe.ref) @@ -356,9 +357,9 @@ abstract class AtLeastOnceDeliverySpec(config: Config) extends PersistenceSpec(c val dstB = system.actorOf(destinationProps(probeB.ref), "destination-b") val dstC = system.actorOf(destinationProps(probeC.ref), "destination-c") val destinations = Map( - "A" -> system.actorOf(unreliableProps(2, dstA), "unreliable-a").path, - "B" -> system.actorOf(unreliableProps(5, dstB), "unreliable-b").path, - "C" -> system.actorOf(unreliableProps(3, dstC), "unreliable-c").path) + "A" → system.actorOf(unreliableProps(2, dstA), "unreliable-a").path, + "B" → system.actorOf(unreliableProps(5, dstB), "unreliable-b").path, + "C" → system.actorOf(unreliableProps(3, dstC), "unreliable-c").path) val snd = system.actorOf(senderProps(probe.ref, name, 1000.millis, 5, 1000, destinations, async = true), name) val N = 100 for (n ← 1 to N) { @@ -380,7 +381,7 @@ abstract class AtLeastOnceDeliverySpec(config: Config) extends PersistenceSpec(c val probe = TestProbe() val probeA = TestProbe() val dst = system.actorOf(destinationProps(probeA.ref)) - val destinations = Map("A" -> system.actorOf(unreliableProps(2, dst)).path) + val destinations = Map("A" → system.actorOf(unreliableProps(2, dst)).path) val snd = system.actorOf(senderProps(probe.ref, name, 1000.millis, 5, 2, destinations, async = true), name) diff --git a/akka-persistence/src/test/scala/akka/persistence/PersistentActorStashingSpec.scala b/akka-persistence/src/test/scala/akka/persistence/PersistentActorStashingSpec.scala index 464bb01536..d99191744b 100644 --- a/akka-persistence/src/test/scala/akka/persistence/PersistentActorStashingSpec.scala +++ b/akka-persistence/src/test/scala/akka/persistence/PersistentActorStashingSpec.scala @@ -29,7 +29,7 @@ object PersistentActorStashingSpec { case "boom" ⇒ throw new TestException("boom") case GetState ⇒ sender() ! events.reverse } - + def unstashBehavior: Receive def receiveRecover = updateState @@ -37,27 +37,28 @@ object PersistentActorStashingSpec { class UserStashPersistentActor(name: String) extends StashExamplePersistentActor(name) { var stashed = false - + val receiveCommand: Receive = unstashBehavior orElse { - case Cmd("a") if !stashed ⇒ stash(); stashed = true - case Cmd("a") ⇒ sender() ! "a" - case Cmd("b") ⇒ persist(Evt("b"))(evt ⇒ sender() ! evt.data) + case Cmd("a") if !stashed ⇒ + stash(); stashed = true + case Cmd("a") ⇒ sender() ! "a" + case Cmd("b") ⇒ persist(Evt("b"))(evt ⇒ sender() ! evt.data) } - + def unstashBehavior: Receive = { - case Cmd("c") ⇒ unstashAll(); sender () ! "c" + case Cmd("c") ⇒ unstashAll(); sender() ! "c" } } - + class UserStashWithinHandlerPersistentActor(name: String) extends UserStashPersistentActor(name: String) { override def unstashBehavior: Receive = { - case Cmd("c") ⇒ persist(Evt("c")) { evt ⇒ sender() ! evt.data; unstashAll() } + case Cmd("c") ⇒ persist(Evt("c")) { evt ⇒ sender() ! evt.data; unstashAll() } } } class UserStashManyPersistentActor(name: String) extends StashExamplePersistentActor(name) { val receiveCommand: Receive = commonBehavior orElse { - case Cmd("a") ⇒ persist(Evt("a")) { evt ⇒ + case Cmd("a") ⇒ persist(Evt("a")) { evt ⇒ updateState(evt) context.become(processC) } @@ -68,14 +69,14 @@ object PersistentActorStashingSpec { val processC: Receive = unstashBehavior orElse { case other ⇒ stash() } - + def unstashBehavior: Receive = { case Cmd("c") ⇒ persist(Evt("c")) { evt ⇒ updateState(evt); context.unbecome() } unstashAll() } } - + class UserStashWithinHandlerManyPersistentActor(name: String) extends UserStashManyPersistentActor(name) { override def unstashBehavior: Receive = { case Cmd("c") ⇒ persist(Evt("c")) { evt ⇒ updateState(evt); context.unbecome(); unstashAll() } @@ -95,7 +96,7 @@ object PersistentActorStashingSpec { val otherCommandHandler: Receive = unstashBehavior orElse { case other ⇒ stash() } - + def unstashBehavior: Receive = { case Cmd("c") ⇒ persist(Evt("c")) { evt ⇒ @@ -119,18 +120,19 @@ object PersistentActorStashingSpec { class AsyncStashingPersistentActor(name: String) extends StashExamplePersistentActor(name) { var stashed = false - + val receiveCommand: Receive = commonBehavior orElse unstashBehavior orElse { - case Cmd("a") ⇒ persistAsync(Evt("a"))(updateState) - case Cmd("b") if !stashed ⇒ stash(); stashed = true - case Cmd("b") ⇒ persistAsync(Evt("b"))(updateState) + case Cmd("a") ⇒ persistAsync(Evt("a"))(updateState) + case Cmd("b") if !stashed ⇒ + stash(); stashed = true + case Cmd("b") ⇒ persistAsync(Evt("b"))(updateState) } override def unstashBehavior: Receive = { case Cmd("c") ⇒ persistAsync(Evt("c"))(updateState); unstashAll() } } - + class AsyncStashingWithinHandlerPersistentActor(name: String) extends AsyncStashingPersistentActor(name) { override def unstashBehavior: Receive = { case Cmd("c") ⇒ persistAsync(Evt("c")) { evt ⇒ updateState(evt); unstashAll() } @@ -143,7 +145,7 @@ abstract class PersistentActorStashingSpec(config: Config) extends PersistenceSp with ImplicitSender { import PersistentActorStashingSpec._ - def stash[T <: NamedPersistentActor : ClassTag](): Unit = { + def stash[T <: NamedPersistentActor: ClassTag](): Unit = { "support user stash operations" in { val persistentActor = namedPersistentActor[T] persistentActor ! Cmd("a") @@ -155,7 +157,7 @@ abstract class PersistentActorStashingSpec(config: Config) extends PersistenceSp } } - def stashWithSeveralMessages[T <: NamedPersistentActor : ClassTag](): Unit = { + def stashWithSeveralMessages[T <: NamedPersistentActor: ClassTag](): Unit = { "support user stash operations with several stashed messages" in { val persistentActor = namedPersistentActor[T] val n = 10 @@ -168,7 +170,7 @@ abstract class PersistentActorStashingSpec(config: Config) extends PersistenceSp } } - def stashUnderFailures[T <: NamedPersistentActor : ClassTag](): Unit = { + def stashUnderFailures[T <: NamedPersistentActor: ClassTag](): Unit = { "support user stash operations under failures" in { val persistentActor = namedPersistentActor[T] val bs = 1 to 10 map ("b-" + _) @@ -185,13 +187,13 @@ abstract class PersistentActorStashingSpec(config: Config) extends PersistenceSp behave like stashWithSeveralMessages[UserStashManyPersistentActor]() behave like stashUnderFailures[UserStashFailurePersistentActor]() } - + "Stashing(unstashAll called in handler) in a persistent actor" must { behave like stash[UserStashWithinHandlerPersistentActor]() behave like stashWithSeveralMessages[UserStashWithinHandlerManyPersistentActor]() behave like stashUnderFailures[UserStashWithinHandlerFailureCallbackPersistentActor]() } - + } class SteppingInMemPersistentActorStashingSpec extends PersistenceSpec( @@ -199,7 +201,7 @@ class SteppingInMemPersistentActorStashingSpec extends PersistenceSpec( with ImplicitSender { import PersistentActorStashingSpec._ - def stash[T <: NamedPersistentActor : ClassTag](): Unit = { + def stash[T <: NamedPersistentActor: ClassTag](): Unit = { "handle async callback not happening until next message has been stashed" in { val persistentActor = namedPersistentActor[T] awaitAssert(SteppingInmemJournal.getRef("persistence-stash"), 3.seconds) @@ -231,7 +233,7 @@ class SteppingInMemPersistentActorStashingSpec extends PersistenceSpec( "Stashing in a persistent actor mixed with persistAsync" must { behave like stash[AsyncStashingPersistentActor]() } - + "Stashing(unstashAll called in handler) in a persistent actor mixed with persistAsync" must { behave like stash[AsyncStashingWithinHandlerPersistentActor]() } diff --git a/akka-persistence/src/test/scala/akka/persistence/journal/SteppingInmemJournal.scala b/akka-persistence/src/test/scala/akka/persistence/journal/SteppingInmemJournal.scala index 6b2f70d299..0477f79b06 100644 --- a/akka-persistence/src/test/scala/akka/persistence/journal/SteppingInmemJournal.scala +++ b/akka-persistence/src/test/scala/akka/persistence/journal/SteppingInmemJournal.scala @@ -47,7 +47,7 @@ object SteppingInmemJournal { def getRef(instanceId: String): ActorRef = synchronized(_current(instanceId)) private def putRef(instanceId: String, instance: ActorRef): Unit = synchronized { - _current = _current + (instanceId -> instance) + _current = _current + (instanceId → instance) } private def remove(instanceId: String): Unit = synchronized( _current -= instanceId) diff --git a/akka-remote-tests/src/multi-jvm/scala/akka/remote/RemoteQuarantinePiercingSpec.scala b/akka-remote-tests/src/multi-jvm/scala/akka/remote/RemoteQuarantinePiercingSpec.scala index 84dbf87593..1683bba4ba 100644 --- a/akka-remote-tests/src/multi-jvm/scala/akka/remote/RemoteQuarantinePiercingSpec.scala +++ b/akka-remote-tests/src/multi-jvm/scala/akka/remote/RemoteQuarantinePiercingSpec.scala @@ -31,7 +31,7 @@ object RemoteQuarantinePiercingSpec extends MultiNodeConfig { class Subject extends Actor { def receive = { case "shutdown" ⇒ context.system.terminate() - case "identify" ⇒ sender() ! (AddressUidExtension(context.system).addressUid -> self) + case "identify" ⇒ sender() ! (AddressUidExtension(context.system).addressUid → self) } } diff --git a/akka-remote-tests/src/multi-jvm/scala/akka/remote/RemoteRestartedQuarantinedSpec.scala b/akka-remote-tests/src/multi-jvm/scala/akka/remote/RemoteRestartedQuarantinedSpec.scala index b5aa2c8168..10837756f1 100644 --- a/akka-remote-tests/src/multi-jvm/scala/akka/remote/RemoteRestartedQuarantinedSpec.scala +++ b/akka-remote-tests/src/multi-jvm/scala/akka/remote/RemoteRestartedQuarantinedSpec.scala @@ -46,7 +46,7 @@ object RemoteRestartedQuarantinedSpec extends MultiNodeConfig { class Subject extends Actor { def receive = { case "shutdown" ⇒ context.system.terminate() - case "identify" ⇒ sender() ! (AddressUidExtension(context.system).addressUid -> self) + case "identify" ⇒ sender() ! (AddressUidExtension(context.system).addressUid → self) } } diff --git a/akka-remote-tests/src/multi-jvm/scala/akka/remote/routing/RemoteRandomSpec.scala b/akka-remote-tests/src/multi-jvm/scala/akka/remote/routing/RemoteRandomSpec.scala index 0d9662d289..9270c85e25 100644 --- a/akka-remote-tests/src/multi-jvm/scala/akka/remote/routing/RemoteRandomSpec.scala +++ b/akka-remote-tests/src/multi-jvm/scala/akka/remote/routing/RemoteRandomSpec.scala @@ -71,8 +71,8 @@ class RemoteRandomSpec extends MultiNodeSpec(RemoteRandomMultiJvmSpec) val replies: Map[Address, Int] = (receiveWhile(5.seconds, messages = connectionCount * iterationCount) { case ref: ActorRef ⇒ ref.path.address - }).foldLeft(Map(node(first).address -> 0, node(second).address -> 0, node(third).address -> 0)) { - case (replyMap, address) ⇒ replyMap + (address -> (replyMap(address) + 1)) + }).foldLeft(Map(node(first).address → 0, node(second).address → 0, node(third).address → 0)) { + case (replyMap, address) ⇒ replyMap + (address → (replyMap(address) + 1)) } enterBarrier("broadcast-end") diff --git a/akka-remote-tests/src/multi-jvm/scala/akka/remote/routing/RemoteRoundRobinSpec.scala b/akka-remote-tests/src/multi-jvm/scala/akka/remote/routing/RemoteRoundRobinSpec.scala index 614be32426..c80789bd0c 100644 --- a/akka-remote-tests/src/multi-jvm/scala/akka/remote/routing/RemoteRoundRobinSpec.scala +++ b/akka-remote-tests/src/multi-jvm/scala/akka/remote/routing/RemoteRoundRobinSpec.scala @@ -99,8 +99,8 @@ class RemoteRoundRobinSpec extends MultiNodeSpec(RemoteRoundRobinMultiJvmSpec) val replies: Map[Address, Int] = (receiveWhile(5 seconds, messages = connectionCount * iterationCount) { case ref: ActorRef ⇒ ref.path.address - }).foldLeft(Map(node(first).address -> 0, node(second).address -> 0, node(third).address -> 0)) { - case (replyMap, address) ⇒ replyMap + (address -> (replyMap(address) + 1)) + }).foldLeft(Map(node(first).address → 0, node(second).address → 0, node(third).address → 0)) { + case (replyMap, address) ⇒ replyMap + (address → (replyMap(address) + 1)) } enterBarrier("broadcast-end") @@ -184,8 +184,8 @@ class RemoteRoundRobinSpec extends MultiNodeSpec(RemoteRoundRobinMultiJvmSpec) val replies: Map[Address, Int] = (receiveWhile(5 seconds, messages = connectionCount * iterationCount) { case ref: ActorRef ⇒ ref.path.address - }).foldLeft(Map(node(first).address -> 0, node(second).address -> 0, node(third).address -> 0)) { - case (replyMap, address) ⇒ replyMap + (address -> (replyMap(address) + 1)) + }).foldLeft(Map(node(first).address → 0, node(second).address → 0, node(third).address → 0)) { + case (replyMap, address) ⇒ replyMap + (address → (replyMap(address) + 1)) } enterBarrier("end") diff --git a/akka-remote-tests/src/multi-jvm/scala/akka/remote/routing/RemoteScatterGatherSpec.scala b/akka-remote-tests/src/multi-jvm/scala/akka/remote/routing/RemoteScatterGatherSpec.scala index cbad189ac5..6f0fdb4412 100644 --- a/akka-remote-tests/src/multi-jvm/scala/akka/remote/routing/RemoteScatterGatherSpec.scala +++ b/akka-remote-tests/src/multi-jvm/scala/akka/remote/routing/RemoteScatterGatherSpec.scala @@ -74,8 +74,8 @@ class RemoteScatterGatherSpec extends MultiNodeSpec(RemoteScatterGatherMultiJvmS val replies: Map[Address, Int] = (receiveWhile(5.seconds, messages = connectionCount * iterationCount) { case ref: ActorRef ⇒ ref.path.address - }).foldLeft(Map(node(first).address -> 0, node(second).address -> 0, node(third).address -> 0)) { - case (replyMap, address) ⇒ replyMap + (address -> (replyMap(address) + 1)) + }).foldLeft(Map(node(first).address → 0, node(second).address → 0, node(third).address → 0)) { + case (replyMap, address) ⇒ replyMap + (address → (replyMap(address) + 1)) } enterBarrier("broadcast-end") diff --git a/akka-remote-tests/src/test/scala/akka/remote/testkit/LogRoleReplace.scala b/akka-remote-tests/src/test/scala/akka/remote/testkit/LogRoleReplace.scala index 4b547174e2..d00782f7d4 100644 --- a/akka-remote-tests/src/test/scala/akka/remote/testkit/LogRoleReplace.scala +++ b/akka-remote-tests/src/test/scala/akka/remote/testkit/LogRoleReplace.scala @@ -128,8 +128,8 @@ class LogRoleReplace { line match { case RoleStarted(jvm, role, host, port) ⇒ - replacements += (jvm -> role) - replacements += ((host + ":" + port) -> role) + replacements += (jvm → role) + replacements += ((host + ":" + port) → role) false case _ ⇒ true } diff --git a/akka-remote/src/main/scala/akka/remote/AckedDelivery.scala b/akka-remote/src/main/scala/akka/remote/AckedDelivery.scala index 75595812b2..e845a13b50 100644 --- a/akka-remote/src/main/scala/akka/remote/AckedDelivery.scala +++ b/akka-remote/src/main/scala/akka/remote/AckedDelivery.scala @@ -90,8 +90,8 @@ class ResendUnfulfillableException final case class AckedSendBuffer[T <: HasSequenceNumber]( capacity: Int, nonAcked: IndexedSeq[T] = Vector.empty[T], - nacked: IndexedSeq[T] = Vector.empty[T], - maxSeq: SeqNo = SeqNo(-1)) { + nacked: IndexedSeq[T] = Vector.empty[T], + maxSeq: SeqNo = SeqNo(-1)) { /** * Processes an incoming acknowledgement and returns a new buffer with only unacknowledged elements remaining. @@ -137,9 +137,9 @@ final case class AckedSendBuffer[T <: HasSequenceNumber]( * @param buf Buffer of messages that are waiting for delivery */ final case class AckedReceiveBuffer[T <: HasSequenceNumber]( - lastDelivered: SeqNo = SeqNo(-1), - cumulativeAck: SeqNo = SeqNo(-1), - buf: SortedSet[T] = TreeSet.empty[T])(implicit val seqOrdering: Ordering[T]) { + lastDelivered: SeqNo = SeqNo(-1), + cumulativeAck: SeqNo = SeqNo(-1), + buf: SortedSet[T] = TreeSet.empty[T])(implicit val seqOrdering: Ordering[T]) { import SeqNo.ord.max diff --git a/akka-remote/src/main/scala/akka/remote/DeadlineFailureDetector.scala b/akka-remote/src/main/scala/akka/remote/DeadlineFailureDetector.scala index a04283440f..560533af27 100644 --- a/akka-remote/src/main/scala/akka/remote/DeadlineFailureDetector.scala +++ b/akka-remote/src/main/scala/akka/remote/DeadlineFailureDetector.scala @@ -28,8 +28,9 @@ import akka.util.Helpers.ConfigOps */ class DeadlineFailureDetector( val acceptableHeartbeatPause: FiniteDuration, - val heartbeatInterval: FiniteDuration)( - implicit clock: Clock) extends FailureDetector { + val heartbeatInterval: FiniteDuration)( + implicit + clock: Clock) extends FailureDetector { /** * Constructor that reads parameters from config. diff --git a/akka-remote/src/main/scala/akka/remote/DefaultFailureDetectorRegistry.scala b/akka-remote/src/main/scala/akka/remote/DefaultFailureDetectorRegistry.scala index 5d20087f30..20462a5c99 100644 --- a/akka-remote/src/main/scala/akka/remote/DefaultFailureDetectorRegistry.scala +++ b/akka-remote/src/main/scala/akka/remote/DefaultFailureDetectorRegistry.scala @@ -48,7 +48,7 @@ class DefaultFailureDetectorRegistry[A](detectorFactory: () ⇒ FailureDetector) case None ⇒ val newDetector: FailureDetector = detectorFactory() newDetector.heartbeat() - resourceToFailureDetector.set(oldTable + (resource -> newDetector)) + resourceToFailureDetector.set(oldTable + (resource → newDetector)) } } finally failureDetectorCreationLock.unlock() } diff --git a/akka-remote/src/main/scala/akka/remote/Endpoint.scala b/akka-remote/src/main/scala/akka/remote/Endpoint.scala index 48f06d2513..c92f1b1032 100644 --- a/akka-remote/src/main/scala/akka/remote/Endpoint.scala +++ b/akka-remote/src/main/scala/akka/remote/Endpoint.scala @@ -32,25 +32,28 @@ import scala.concurrent.Future * INTERNAL API */ private[remote] trait InboundMessageDispatcher { - def dispatch(recipient: InternalActorRef, - recipientAddress: Address, - serializedMessage: SerializedMessage, - senderOption: Option[ActorRef]): Unit + def dispatch( + recipient: InternalActorRef, + recipientAddress: Address, + serializedMessage: SerializedMessage, + senderOption: Option[ActorRef]): Unit } /** * INTERNAL API */ -private[remote] class DefaultMessageDispatcher(private val system: ExtendedActorSystem, - private val provider: RemoteActorRefProvider, - private val log: LoggingAdapter) extends InboundMessageDispatcher { +private[remote] class DefaultMessageDispatcher( + private val system: ExtendedActorSystem, + private val provider: RemoteActorRefProvider, + private val log: LoggingAdapter) extends InboundMessageDispatcher { private val remoteDaemon = provider.remoteDaemon - override def dispatch(recipient: InternalActorRef, - recipientAddress: Address, - serializedMessage: SerializedMessage, - senderOption: Option[ActorRef]): Unit = { + override def dispatch( + recipient: InternalActorRef, + recipientAddress: Address, + serializedMessage: SerializedMessage, + senderOption: Option[ActorRef]): Unit = { import provider.remoteSettings._ @@ -76,8 +79,9 @@ private[remote] class DefaultMessageDispatcher(private val system: ExtendedActor case sel: ActorSelectionMessage ⇒ if (UntrustedMode && (!TrustedSelectionPaths.contains(sel.elements.mkString("/", "/", "")) || sel.msg.isInstanceOf[PossiblyHarmful] || l != provider.rootGuardian)) - log.debug("operating in UntrustedMode, dropping inbound actor selection to [{}], " + - "allow it by adding the path to 'akka.remote.trusted-selection-paths' configuration", + log.debug( + "operating in UntrustedMode, dropping inbound actor selection to [{}], " + + "allow it by adding the path to 'akka.remote.trusted-selection-paths' configuration", sel.elements.mkString("/", "/", "")) else // run the receive logic for ActorSelectionMessage here to make sure it is not stuck on busy user actor @@ -94,10 +98,12 @@ private[remote] class DefaultMessageDispatcher(private val system: ExtendedActor // if it was originally addressed to us but is in fact remote from our point of view (i.e. remote-deployed) r.!(payload)(sender) else - log.error("dropping message [{}] for non-local recipient [{}] arriving at [{}] inbound addresses are [{}]", + log.error( + "dropping message [{}] for non-local recipient [{}] arriving at [{}] inbound addresses are [{}]", payloadClass, r, recipientAddress, provider.transport.addresses.mkString(", ")) - case r ⇒ log.error("dropping message [{}] for unknown recipient [{}] arriving at [{}] inbound addresses are [{}]", + case r ⇒ log.error( + "dropping message [{}] for unknown recipient [{}] arriving at [{}] inbound addresses are [{}]", payloadClass, r, recipientAddress, provider.transport.addresses.mkString(", ")) } @@ -129,10 +135,11 @@ private[remote] final case class ShutDownAssociation(localAddress: Address, remo * INTERNAL API */ @SerialVersionUID(2L) -private[remote] final case class InvalidAssociation(localAddress: Address, - remoteAddress: Address, - cause: Throwable, - disassociationInfo: Option[DisassociateInfo] = None) +private[remote] final case class InvalidAssociation( + localAddress: Address, + remoteAddress: Address, + cause: Throwable, + disassociationInfo: Option[DisassociateInfo] = None) extends EndpointException("Invalid address: " + remoteAddress, cause) with AssociationProblem /** @@ -174,12 +181,12 @@ private[remote] object ReliableDeliverySupervisor { def props( handleOrActive: Option[AkkaProtocolHandle], - localAddress: Address, - remoteAddress: Address, - refuseUid: Option[Int], - transport: AkkaProtocolTransport, - settings: RemoteSettings, - codec: AkkaPduCodec, + localAddress: Address, + remoteAddress: Address, + refuseUid: Option[Int], + transport: AkkaProtocolTransport, + settings: RemoteSettings, + codec: AkkaPduCodec, receiveBuffers: ConcurrentHashMap[Link, ResendState]): Props = Props(classOf[ReliableDeliverySupervisor], handleOrActive, localAddress, remoteAddress, refuseUid, transport, settings, codec, receiveBuffers) @@ -189,13 +196,13 @@ private[remote] object ReliableDeliverySupervisor { * INTERNAL API */ private[remote] class ReliableDeliverySupervisor( - handleOrActive: Option[AkkaProtocolHandle], - val localAddress: Address, - val remoteAddress: Address, - val refuseUid: Option[Int], - val transport: AkkaProtocolTransport, - val settings: RemoteSettings, - val codec: AkkaPduCodec, + handleOrActive: Option[AkkaProtocolHandle], + val localAddress: Address, + val remoteAddress: Address, + val refuseUid: Option[Int], + val transport: AkkaProtocolTransport, + val settings: RemoteSettings, + val codec: AkkaPduCodec, val receiveBuffers: ConcurrentHashMap[Link, ResendState]) extends Actor with ActorLogging { import ReliableDeliverySupervisor._ import context.dispatcher @@ -209,7 +216,8 @@ private[remote] class ReliableDeliverySupervisor( case e @ (_: AssociationProblem) ⇒ Escalate case NonFatal(e) ⇒ val causedBy = if (e.getCause == null) "" else s"Caused by: [${e.getCause.getMessage}]" - log.warning("Association with remote system [{}] has failed, address is now gated for [{}] ms. Reason: [{}] {}", + log.warning( + "Association with remote system [{}] has failed, address is now gated for [{}] ms. Reason: [{}] {}", remoteAddress, settings.RetryGateClosedFor.toMillis, e.getMessage, causedBy) uidConfirmed = false // Need confirmation of UID again if (bufferWasInUse) { @@ -437,11 +445,11 @@ private[remote] class ReliableDeliverySupervisor( * INTERNAL API */ private[remote] abstract class EndpointActor( - val localAddress: Address, + val localAddress: Address, val remoteAddress: Address, - val transport: Transport, - val settings: RemoteSettings, - val codec: AkkaPduCodec) extends Actor with ActorLogging { + val transport: Transport, + val settings: RemoteSettings, + val codec: AkkaPduCodec) extends Actor with ActorLogging { def inbound: Boolean @@ -463,14 +471,14 @@ private[remote] abstract class EndpointActor( private[remote] object EndpointWriter { def props( - handleOrActive: Option[AkkaProtocolHandle], - localAddress: Address, - remoteAddress: Address, - refuseUid: Option[Int], - transport: AkkaProtocolTransport, - settings: RemoteSettings, - codec: AkkaPduCodec, - receiveBuffers: ConcurrentHashMap[Link, ResendState], + handleOrActive: Option[AkkaProtocolHandle], + localAddress: Address, + remoteAddress: Address, + refuseUid: Option[Int], + transport: AkkaProtocolTransport, + settings: RemoteSettings, + codec: AkkaPduCodec, + receiveBuffers: ConcurrentHashMap[Link, ResendState], reliableDeliverySupervisor: Option[ActorRef]): Props = Props(classOf[EndpointWriter], handleOrActive, localAddress, remoteAddress, refuseUid, transport, settings, codec, receiveBuffers, reliableDeliverySupervisor) @@ -508,14 +516,14 @@ private[remote] object EndpointWriter { * INTERNAL API */ private[remote] class EndpointWriter( - handleOrActive: Option[AkkaProtocolHandle], - localAddress: Address, - remoteAddress: Address, - refuseUid: Option[Int], - transport: AkkaProtocolTransport, - settings: RemoteSettings, - codec: AkkaPduCodec, - val receiveBuffers: ConcurrentHashMap[Link, ResendState], + handleOrActive: Option[AkkaProtocolHandle], + localAddress: Address, + remoteAddress: Address, + refuseUid: Option[Int], + transport: AkkaProtocolTransport, + settings: RemoteSettings, + codec: AkkaPduCodec, + val receiveBuffers: ConcurrentHashMap[Link, ResendState], val reliableDeliverySupervisor: Option[ActorRef]) extends EndpointActor(localAddress, remoteAddress, transport, settings, codec) { @@ -704,8 +712,9 @@ private[remote] class EndpointWriter( if (size > settings.LogBufferSizeExceeding) { val now = System.nanoTime() if (now - largeBufferLogTimestamp >= LogBufferSizeInterval) { - log.warning("[{}] buffered messages in EndpointWriter for [{}]. " + - "You should probably implement flow control to avoid flooding the remote connection.", + log.warning( + "[{}] buffered messages in EndpointWriter for [{}]. " + + "You should probably implement flow control to avoid flooding the remote connection.", size, remoteAddress) largeBufferLogTimestamp = now } @@ -888,16 +897,16 @@ private[remote] class EndpointWriter( private[remote] object EndpointReader { def props( - localAddress: Address, - remoteAddress: Address, - transport: Transport, - settings: RemoteSettings, - codec: AkkaPduCodec, - msgDispatch: InboundMessageDispatcher, - inbound: Boolean, - uid: Int, + localAddress: Address, + remoteAddress: Address, + transport: Transport, + settings: RemoteSettings, + codec: AkkaPduCodec, + msgDispatch: InboundMessageDispatcher, + inbound: Boolean, + uid: Int, reliableDeliverySupervisor: Option[ActorRef], - receiveBuffers: ConcurrentHashMap[Link, ResendState]): Props = + receiveBuffers: ConcurrentHashMap[Link, ResendState]): Props = Props(classOf[EndpointReader], localAddress, remoteAddress, transport, settings, codec, msgDispatch, inbound, uid, reliableDeliverySupervisor, receiveBuffers) @@ -907,16 +916,16 @@ private[remote] object EndpointReader { * INTERNAL API */ private[remote] class EndpointReader( - localAddress: Address, - remoteAddress: Address, - transport: Transport, - settings: RemoteSettings, - codec: AkkaPduCodec, - msgDispatch: InboundMessageDispatcher, - val inbound: Boolean, - val uid: Int, + localAddress: Address, + remoteAddress: Address, + transport: Transport, + settings: RemoteSettings, + codec: AkkaPduCodec, + msgDispatch: InboundMessageDispatcher, + val inbound: Boolean, + val uid: Int, val reliableDeliverySupervisor: Option[ActorRef], - val receiveBuffers: ConcurrentHashMap[Link, ResendState]) extends EndpointActor(localAddress, remoteAddress, transport, settings, codec) { + val receiveBuffers: ConcurrentHashMap[Link, ResendState]) extends EndpointActor(localAddress, remoteAddress, transport, settings, codec) { import EndpointWriter.{ OutboundAck, StopReading, StoppedReading } @@ -972,8 +981,9 @@ private[remote] class EndpointReader( } case InboundPayload(oversized) ⇒ - log.error(new OversizedPayloadException(s"Discarding oversized payload received: " + - s"max allowed size [${transport.maximumPayloadBytes}] bytes, actual size [${oversized.size}] bytes."), + log.error( + new OversizedPayloadException(s"Discarding oversized payload received: " + + s"max allowed size [${transport.maximumPayloadBytes}] bytes, actual size [${oversized.size}] bytes."), "Transient error while reading from association (association remains live)") case StopReading(writer, replyTo) ⇒ diff --git a/akka-remote/src/main/scala/akka/remote/FailureDetectorRegistry.scala b/akka-remote/src/main/scala/akka/remote/FailureDetectorRegistry.scala index edc7cdfd82..49fd506f03 100644 --- a/akka-remote/src/main/scala/akka/remote/FailureDetectorRegistry.scala +++ b/akka-remote/src/main/scala/akka/remote/FailureDetectorRegistry.scala @@ -67,11 +67,11 @@ private[akka] object FailureDetectorLoader { def load(fqcn: String, config: Config, system: ActorSystem): FailureDetector = { system.asInstanceOf[ExtendedActorSystem].dynamicAccess.createInstanceFor[FailureDetector]( fqcn, List( - classOf[Config] -> config, - classOf[EventStream] -> system.eventStream)).recover({ - case e ⇒ throw new ConfigurationException( - s"Could not create custom failure detector [$fqcn] due to: ${e.toString}", e) - }).get + classOf[Config] → config, + classOf[EventStream] → system.eventStream)).recover({ + case e ⇒ throw new ConfigurationException( + s"Could not create custom failure detector [$fqcn] due to: ${e.toString}", e) + }).get } /** diff --git a/akka-remote/src/main/scala/akka/remote/PhiAccrualFailureDetector.scala b/akka-remote/src/main/scala/akka/remote/PhiAccrualFailureDetector.scala index 2bff7f13c7..8f208d3309 100644 --- a/akka-remote/src/main/scala/akka/remote/PhiAccrualFailureDetector.scala +++ b/akka-remote/src/main/scala/akka/remote/PhiAccrualFailureDetector.scala @@ -54,12 +54,13 @@ import akka.util.Helpers.ConfigOps * purposes. It is only used for measuring intervals (duration). */ class PhiAccrualFailureDetector( - val threshold: Double, - val maxSampleSize: Int, - val minStdDeviation: FiniteDuration, + val threshold: Double, + val maxSampleSize: Int, + val minStdDeviation: FiniteDuration, val acceptableHeartbeatPause: FiniteDuration, - val firstHeartbeatEstimate: FiniteDuration)( - implicit clock: Clock) extends FailureDetector { + val firstHeartbeatEstimate: FiniteDuration)( + implicit + clock: Clock) extends FailureDetector { /** * Constructor that reads parameters from config. @@ -203,9 +204,9 @@ private[akka] object HeartbeatHistory { * for empty HeartbeatHistory, i.e. throws ArithmeticException. */ private[akka] final case class HeartbeatHistory private ( - maxSampleSize: Int, - intervals: immutable.IndexedSeq[Long], - intervalSum: Long, + maxSampleSize: Int, + intervals: immutable.IndexedSeq[Long], + intervalSum: Long, squaredIntervalSum: Long) { // Heartbeat histories are created trough the firstHeartbeat variable of the PhiAccrualFailureDetector diff --git a/akka-remote/src/main/scala/akka/remote/RemoteActorRefProvider.scala b/akka-remote/src/main/scala/akka/remote/RemoteActorRefProvider.scala index 7546dc7ee1..4ad398f696 100644 --- a/akka-remote/src/main/scala/akka/remote/RemoteActorRefProvider.scala +++ b/akka-remote/src/main/scala/akka/remote/RemoteActorRefProvider.scala @@ -79,9 +79,10 @@ private[akka] object RemoteActorRefProvider { * and handled as dead letters to the original (remote) destination. Without this special case, DeathWatch related * functionality breaks, like the special handling of Watch messages arriving to dead letters. */ - private class RemoteDeadLetterActorRef(_provider: ActorRefProvider, - _path: ActorPath, - _eventStream: EventStream) extends DeadLetterActorRef(_provider, _path, _eventStream) { + private class RemoteDeadLetterActorRef( + _provider: ActorRefProvider, + _path: ActorPath, + _eventStream: EventStream) extends DeadLetterActorRef(_provider, _path, _eventStream) { import EndpointManager.Send override def !(message: Any)(implicit sender: ActorRef): Unit = message match { @@ -109,9 +110,9 @@ private[akka] object RemoteActorRefProvider { * */ private[akka] class RemoteActorRefProvider( - val systemName: String, - val settings: ActorSystem.Settings, - val eventStream: EventStream, + val systemName: String, + val settings: ActorSystem.Settings, + val eventStream: EventStream, val dynamicAccess: DynamicAccess) extends ActorRefProvider { import RemoteActorRefProvider._ @@ -168,16 +169,16 @@ private[akka] class RemoteActorRefProvider( val internals = Internals( remoteDaemon = { - val d = new RemoteSystemDaemon( - system, - local.rootPath / "remote", - rootGuardian, - remotingTerminator, - log, - untrustedMode = remoteSettings.UntrustedMode) - local.registerExtraNames(Map(("remote", d))) - d - }, + val d = new RemoteSystemDaemon( + system, + local.rootPath / "remote", + rootGuardian, + remotingTerminator, + log, + untrustedMode = remoteSettings.UntrustedMode) + local.registerExtraNames(Map(("remote", d))) + d + }, serialization = SerializationExtension(system), transport = new Remoting(system, this)) @@ -440,12 +441,12 @@ private[akka] trait RemoteRef extends ActorRefScope { * This reference is network-aware (remembers its origin) and immutable. */ private[akka] class RemoteActorRef private[akka] ( - remote: RemoteTransport, + remote: RemoteTransport, val localAddressToUse: Address, - val path: ActorPath, - val getParent: InternalActorRef, - props: Option[Props], - deploy: Option[Deploy]) + val path: ActorPath, + val getParent: InternalActorRef, + props: Option[Props], + deploy: Option[Deploy]) extends InternalActorRef with RemoteRef { def getChild(name: Iterator[String]): InternalActorRef = { diff --git a/akka-remote/src/main/scala/akka/remote/RemoteDaemon.scala b/akka-remote/src/main/scala/akka/remote/RemoteDaemon.scala index b1b744fec1..618b71aa3e 100644 --- a/akka-remote/src/main/scala/akka/remote/RemoteDaemon.scala +++ b/akka-remote/src/main/scala/akka/remote/RemoteDaemon.scala @@ -42,11 +42,11 @@ private[akka] final case class DaemonMsgCreate(props: Props, deploy: Deploy, pat * It acts as the brain of the remote that responds to system remote events (messages) and undertakes action. */ private[akka] class RemoteSystemDaemon( - system: ActorSystemImpl, - _path: ActorPath, - _parent: InternalActorRef, - terminator: ActorRef, - _log: LoggingAdapter, + system: ActorSystemImpl, + _path: ActorPath, + _parent: InternalActorRef, + terminator: ActorRef, + _log: LoggingAdapter, val untrustedMode: Boolean) extends VirtualPathContainer(system.provider, _path, _parent, _log) { diff --git a/akka-remote/src/main/scala/akka/remote/RemoteDeploymentWatcher.scala b/akka-remote/src/main/scala/akka/remote/RemoteDeploymentWatcher.scala index 2c8d248d2b..cbcc36e28e 100644 --- a/akka-remote/src/main/scala/akka/remote/RemoteDeploymentWatcher.scala +++ b/akka-remote/src/main/scala/akka/remote/RemoteDeploymentWatcher.scala @@ -30,7 +30,7 @@ private[akka] class RemoteDeploymentWatcher extends Actor with RequiresMessageQu def receive = { case WatchRemote(a, supervisor: InternalActorRef) ⇒ - supervisors += (a -> supervisor) + supervisors += (a → supervisor) context.watch(a) case t @ Terminated(a) if supervisors isDefinedAt a ⇒ diff --git a/akka-remote/src/main/scala/akka/remote/RemoteSettings.scala b/akka-remote/src/main/scala/akka/remote/RemoteSettings.scala index e35aee092a..33a5a01d34 100644 --- a/akka-remote/src/main/scala/akka/remote/RemoteSettings.scala +++ b/akka-remote/src/main/scala/akka/remote/RemoteSettings.scala @@ -94,7 +94,8 @@ final class RemoteSettings(val config: Config) { } requiring (_ > Duration.Zero, "quarantine-after-silence must be > 0") val QuarantineDuration: FiniteDuration = { - config.getMillisDuration("akka.remote.prune-quarantine-marker-after").requiring(_ > Duration.Zero, + config.getMillisDuration("akka.remote.prune-quarantine-marker-after").requiring( + _ > Duration.Zero, "prune-quarantine-marker-after must be > 0 ms") } @@ -116,7 +117,8 @@ final class RemoteSettings(val config: Config) { val Transports: immutable.Seq[(String, immutable.Seq[String], Config)] = transportNames.map { name ⇒ val transportConfig = transportConfigFor(name) - (transportConfig.getString("transport-class"), + ( + transportConfig.getString("transport-class"), immutableSeq(transportConfig.getStringList("applied-adapters")).reverse, transportConfig) } diff --git a/akka-remote/src/main/scala/akka/remote/RemoteWatcher.scala b/akka-remote/src/main/scala/akka/remote/RemoteWatcher.scala index 4fc7e0cb44..1da2c8c797 100644 --- a/akka-remote/src/main/scala/akka/remote/RemoteWatcher.scala +++ b/akka-remote/src/main/scala/akka/remote/RemoteWatcher.scala @@ -21,9 +21,9 @@ private[akka] object RemoteWatcher { * Factory method for `RemoteWatcher` [[akka.actor.Props]]. */ def props( - failureDetector: FailureDetectorRegistry[Address], - heartbeatInterval: FiniteDuration, - unreachableReaperInterval: FiniteDuration, + failureDetector: FailureDetectorRegistry[Address], + heartbeatInterval: FiniteDuration, + unreachableReaperInterval: FiniteDuration, heartbeatExpectedResponseAfter: FiniteDuration): Props = Props(classOf[RemoteWatcher], failureDetector, heartbeatInterval, unreachableReaperInterval, heartbeatExpectedResponseAfter).withDeploy(Deploy.local) @@ -44,8 +44,9 @@ private[akka] object RemoteWatcher { lazy val empty: Stats = counts(0, 0) def counts(watching: Int, watchingNodes: Int): Stats = Stats(watching, watchingNodes)(Set.empty, Set.empty) } - final case class Stats(watching: Int, watchingNodes: Int)(val watchingRefs: Set[(ActorRef, ActorRef)], - val watchingAddresses: Set[Address]) { + final case class Stats(watching: Int, watchingNodes: Int)( + val watchingRefs: Set[(ActorRef, ActorRef)], + val watchingAddresses: Set[Address]) { override def toString: String = { def formatWatchingRefs: String = watchingRefs.map(x ⇒ x._2.path.name + " -> " + x._1.path.name).mkString("[", ", ", "]") @@ -78,9 +79,9 @@ private[akka] object RemoteWatcher { * */ private[akka] class RemoteWatcher( - failureDetector: FailureDetectorRegistry[Address], - heartbeatInterval: FiniteDuration, - unreachableReaperInterval: FiniteDuration, + failureDetector: FailureDetectorRegistry[Address], + heartbeatInterval: FiniteDuration, + unreachableReaperInterval: FiniteDuration, heartbeatExpectedResponseAfter: FiniteDuration) extends Actor with ActorLogging with RequiresMessageQueue[UnboundedMessageQueueSemantics] { diff --git a/akka-remote/src/main/scala/akka/remote/Remoting.scala b/akka-remote/src/main/scala/akka/remote/Remoting.scala index 4a611b6320..5b54b33148 100644 --- a/akka-remote/src/main/scala/akka/remote/Remoting.scala +++ b/akka-remote/src/main/scala/akka/remote/Remoting.scala @@ -178,13 +178,14 @@ private[remote] class Remoting(_system: ExtendedActorSystem, _provider: RemoteAc val addressesPromise: Promise[Seq[(AkkaProtocolTransport, Address)]] = Promise() manager ! Listen(addressesPromise) - val transports: Seq[(AkkaProtocolTransport, Address)] = Await.result(addressesPromise.future, + val transports: Seq[(AkkaProtocolTransport, Address)] = Await.result( + addressesPromise.future, StartupTimeout.duration) if (transports.isEmpty) throw new RemoteTransportException("No transport drivers were loaded.", null) transportMapping = transports.groupBy { case (transport, _) ⇒ transport.schemeIdentifier - } map { case (k, v) ⇒ k -> v.toSet } + } map { case (k, v) ⇒ k → v.toSet } defaultAddress = transports.head._2 addresses = transports.map { _._2 }.toSet @@ -233,7 +234,7 @@ private[remote] class Remoting(_system: ExtendedActorSystem, _provider: RemoteAc private[akka] def boundAddresses: Map[String, Set[Address]] = { transportMapping.map { case (scheme, transports) ⇒ - scheme -> transports.flatMap { + scheme → transports.flatMap { // Need to do like this for binary compatibility reasons case (t, _) ⇒ Option(t.boundAddress) } @@ -265,8 +266,9 @@ private[remote] object EndpointManager { // Messages internal to EndpointManager case object Prune extends NoSerializationVerificationNeeded - final case class ListensResult(addressesPromise: Promise[Seq[(AkkaProtocolTransport, Address)]], - results: Seq[(AkkaProtocolTransport, Address, Promise[AssociationEventListener])]) + final case class ListensResult( + addressesPromise: Promise[Seq[(AkkaProtocolTransport, Address)]], + results: Seq[(AkkaProtocolTransport, Address, Promise[AssociationEventListener])]) extends NoSerializationVerificationNeeded final case class ListensFailure(addressesPromise: Promise[Seq[(AkkaProtocolTransport, Address)]], cause: Throwable) extends NoSerializationVerificationNeeded @@ -308,30 +310,30 @@ private[remote] object EndpointManager { case Some(Pass(e, _, _)) ⇒ throw new IllegalArgumentException(s"Attempting to overwrite existing endpoint [$e] with [$endpoint]") case _ ⇒ - addressToWritable += address -> Pass(endpoint, uid, refuseUid) - writableToAddress += endpoint -> address + addressToWritable += address → Pass(endpoint, uid, refuseUid) + writableToAddress += endpoint → address endpoint } def registerWritableEndpointUid(remoteAddress: Address, uid: Int): Unit = { addressToWritable.get(remoteAddress) match { - case Some(Pass(ep, _, refuseUid)) ⇒ addressToWritable += remoteAddress -> Pass(ep, Some(uid), refuseUid) + case Some(Pass(ep, _, refuseUid)) ⇒ addressToWritable += remoteAddress → Pass(ep, Some(uid), refuseUid) case other ⇒ } } def registerWritableEndpointRefuseUid(remoteAddress: Address, refuseUid: Int): Unit = { addressToWritable.get(remoteAddress) match { - case Some(Pass(ep, uid, _)) ⇒ addressToWritable += remoteAddress -> Pass(ep, uid, Some(refuseUid)) - case Some(g: Gated) ⇒ addressToWritable += remoteAddress -> g.copy(refuseUid = Some(refuseUid)) - case Some(w: WasGated) ⇒ addressToWritable += remoteAddress -> w.copy(refuseUid = Some(refuseUid)) + case Some(Pass(ep, uid, _)) ⇒ addressToWritable += remoteAddress → Pass(ep, uid, Some(refuseUid)) + case Some(g: Gated) ⇒ addressToWritable += remoteAddress → g.copy(refuseUid = Some(refuseUid)) + case Some(w: WasGated) ⇒ addressToWritable += remoteAddress → w.copy(refuseUid = Some(refuseUid)) case other ⇒ } } def registerReadOnlyEndpoint(address: Address, endpoint: ActorRef, uid: Int): ActorRef = { - addressToReadonly += address -> ((endpoint, uid)) - readonlyToAddress += endpoint -> address + addressToReadonly += address → ((endpoint, uid)) + readonlyToAddress += endpoint → address endpoint } @@ -390,14 +392,14 @@ private[remote] object EndpointManager { addressToWritable.get(address) match { case Some(Quarantined(_, _)) ⇒ // don't overwrite Quarantined with Gated case Some(Pass(_, _, refuseUid)) ⇒ - addressToWritable += address -> Gated(timeOfRelease, refuseUid) + addressToWritable += address → Gated(timeOfRelease, refuseUid) writableToAddress -= endpoint case Some(WasGated(refuseUid)) ⇒ - addressToWritable += address -> Gated(timeOfRelease, refuseUid) + addressToWritable += address → Gated(timeOfRelease, refuseUid) writableToAddress -= endpoint case Some(Gated(_, _)) ⇒ // already gated case None ⇒ - addressToWritable += address -> Gated(timeOfRelease, refuseUid = None) + addressToWritable += address → Gated(timeOfRelease, refuseUid = None) writableToAddress -= endpoint } } else if (isReadOnly(endpoint)) { @@ -406,7 +408,7 @@ private[remote] object EndpointManager { } def markAsQuarantined(address: Address, uid: Int, timeOfRelease: Deadline): Unit = - addressToWritable += address -> Quarantined(uid, timeOfRelease) + addressToWritable += address → Quarantined(uid, timeOfRelease) def removePolicy(address: Address): Unit = addressToWritable -= address @@ -417,7 +419,7 @@ private[remote] object EndpointManager { addressToWritable = addressToWritable.collect { case entry @ (key, Gated(timeOfRelease, refuseUid)) ⇒ if (timeOfRelease.hasTimeLeft) entry - else (key -> WasGated(refuseUid)) + else (key → WasGated(refuseUid)) case entry @ (_, Quarantined(_, timeOfRelease)) if timeOfRelease.hasTimeLeft ⇒ // Querantined removed when no time left entry @@ -475,9 +477,10 @@ private[remote] class EndpointManager(conf: Config, log: LoggingAdapter) extends case e @ InvalidAssociation(localAddress, remoteAddress, reason, disassiciationInfo) ⇒ keepQuarantinedOr(remoteAddress) { val causedBy = if (reason.getCause == null) "" else s"Caused by: [${reason.getCause.getMessage}]" - log.warning("Tried to associate with unreachable remote address [{}]. " + - "Address is now gated for {} ms, all messages to this address will be delivered to dead letters. " + - "Reason: [{}] {}", + log.warning( + "Tried to associate with unreachable remote address [{}]. " + + "Address is now gated for {} ms, all messages to this address will be delivered to dead letters. " + + "Reason: [{}] {}", remoteAddress, settings.RetryGateClosedFor.toMillis, reason.getMessage, causedBy) endpoints.markAsFailed(sender(), Deadline.now + settings.RetryGateClosedFor) } @@ -490,8 +493,9 @@ private[remote] class EndpointManager(conf: Config, log: LoggingAdapter) extends case ShutDownAssociation(localAddress, remoteAddress, _) ⇒ keepQuarantinedOr(remoteAddress) { - log.debug("Remote system with address [{}] has shut down. " + - "Address is now gated for {} ms, all messages to this address will be delivered to dead letters.", + log.debug( + "Remote system with address [{}] has shut down. " + + "Address is now gated for {} ms, all messages to this address will be delivered to dead letters.", remoteAddress, settings.RetryGateClosedFor.toMillis) endpoints.markAsFailed(sender(), Deadline.now + settings.RetryGateClosedFor) } @@ -510,8 +514,9 @@ private[remote] class EndpointManager(conf: Config, log: LoggingAdapter) extends case HopelessAssociation(localAddress, remoteAddress, None, _) ⇒ keepQuarantinedOr(remoteAddress) { - log.warning("Association to [{}] with unknown UID is irrecoverably failed. " + - "Address cannot be quarantined without knowing the UID, gating instead for {} ms.", + log.warning( + "Association to [{}] with unknown UID is irrecoverably failed. " + + "Address cannot be quarantined without knowing the UID, gating instead for {} ms.", remoteAddress, settings.RetryGateClosedFor.toMillis) endpoints.markAsFailed(sender(), Deadline.now + settings.RetryGateClosedFor) } @@ -540,13 +545,13 @@ private[remote] class EndpointManager(conf: Config, log: LoggingAdapter) extends } map { case (a, t) if t.size > 1 ⇒ throw new RemoteTransportException(s"There are more than one transports listening on local address [$a]", null) - case (a, t) ⇒ a -> t.head._1 + case (a, t) ⇒ a → t.head._1 } // Register to each transport as listener and collect mapping to addresses val transportsAndAddresses = results map { case (transport, address, promise) ⇒ promise.success(ActorAssociationEventListener(self)) - transport -> address + transport → address } addressesPromise.success(transportsAndAddresses) case ListensFailure(addressesPromise, cause) ⇒ @@ -574,8 +579,9 @@ private[remote] class EndpointManager(conf: Config, log: LoggingAdapter) extends (endpoints.writableEndpointWithPolicyFor(address), uidToQuarantineOption) match { case (Some(Pass(endpoint, _, _)), None) ⇒ context.stop(endpoint) - log.warning("Association to [{}] with unknown UID is reported as quarantined, but " + - "address cannot be quarantined without knowing the UID, gating instead for {} ms.", + log.warning( + "Association to [{}] with unknown UID is reported as quarantined, but " + + "address cannot be quarantined without knowing the UID, gating instead for {} ms.", address, settings.RetryGateClosedFor.toMillis) endpoints.markAsFailed(endpoint, Deadline.now + settings.RetryGateClosedFor) case (Some(Pass(endpoint, uidOption, refuseUidOption)), Some(quarantineUid)) ⇒ @@ -628,7 +634,7 @@ private[remote] class EndpointManager(conf: Config, log: LoggingAdapter) extends // Stop all matching stashed connections stashedInbound = stashedInbound.map { case (writer, associations) ⇒ - writer -> associations.filter { assoc ⇒ + writer → associations.filter { assoc ⇒ val handle = assoc.association.asInstanceOf[AkkaProtocolHandle] val drop = matchesQuarantine(handle) if (drop) handle.disassociate() @@ -734,7 +740,7 @@ private[remote] class EndpointManager(conf: Config, log: LoggingAdapter) extends case ia @ InboundAssociation(handle: AkkaProtocolHandle) ⇒ endpoints.readOnlyEndpointFor(handle.remoteAddress) match { case Some((endpoint, _)) ⇒ pendingReadHandoffs.get(endpoint) foreach (_.disassociate()) - pendingReadHandoffs += endpoint -> handle + pendingReadHandoffs += endpoint → handle endpoint ! EndpointWriter.TakeOver(handle, self) endpoints.writableEndpointWithPolicyFor(handle.remoteAddress) match { case Some(Pass(ep, _, _)) ⇒ ep ! ReliableDeliverySupervisor.Ungate @@ -749,13 +755,13 @@ private[remote] class EndpointManager(conf: Config, log: LoggingAdapter) extends // to get an unstash event if (!writerIsIdle) { ep ! ReliableDeliverySupervisor.IsIdle - stashedInbound += ep -> (stashedInbound.getOrElse(ep, Vector.empty) :+ ia) + stashedInbound += ep → (stashedInbound.getOrElse(ep, Vector.empty) :+ ia) } else createAndRegisterEndpoint(handle, refuseUid = endpoints.refuseUid(handle.remoteAddress)) case Some(Pass(ep, Some(uid), _)) ⇒ if (handle.handshakeInfo.uid == uid) { pendingReadHandoffs.get(ep) foreach (_.disassociate()) - pendingReadHandoffs += ep -> handle + pendingReadHandoffs += ep → handle ep ! EndpointWriter.StopReading(ep, self) ep ! ReliableDeliverySupervisor.Ungate } else { @@ -800,7 +806,7 @@ private[remote] class EndpointManager(conf: Config, log: LoggingAdapter) extends */ val transports: Seq[AkkaProtocolTransport] = for ((fqn, adapters, config) ← settings.Transports) yield { - val args = Seq(classOf[ExtendedActorSystem] -> context.system, classOf[Config] -> config) + val args = Seq(classOf[ExtendedActorSystem] → context.system, classOf[Config] → config) // Loads the driver -- the bottom element of the chain. // The chain at this point: @@ -859,37 +865,40 @@ private[remote] class EndpointManager(conf: Config, log: LoggingAdapter) extends pendingReadHandoffs -= takingOverFrom } - private def createEndpoint(remoteAddress: Address, - localAddress: Address, - transport: AkkaProtocolTransport, - endpointSettings: RemoteSettings, - handleOption: Option[AkkaProtocolHandle], - writing: Boolean, - refuseUid: Option[Int]): ActorRef = { + private def createEndpoint( + remoteAddress: Address, + localAddress: Address, + transport: AkkaProtocolTransport, + endpointSettings: RemoteSettings, + handleOption: Option[AkkaProtocolHandle], + writing: Boolean, + refuseUid: Option[Int]): ActorRef = { require(transportMapping contains localAddress, "Transport mapping is not defined for the address") // refuseUid is ignored for read-only endpoints since the UID of the remote system is already known and has passed // quarantine checks - if (writing) context.watch(context.actorOf(RARP(extendedSystem).configureDispatcher(ReliableDeliverySupervisor.props( - handleOption, - localAddress, - remoteAddress, - refuseUid, - transport, - endpointSettings, - AkkaPduProtobufCodec, - receiveBuffers)).withDeploy(Deploy.local), + if (writing) context.watch(context.actorOf( + RARP(extendedSystem).configureDispatcher(ReliableDeliverySupervisor.props( + handleOption, + localAddress, + remoteAddress, + refuseUid, + transport, + endpointSettings, + AkkaPduProtobufCodec, + receiveBuffers)).withDeploy(Deploy.local), "reliableEndpointWriter-" + AddressUrlEncoder(remoteAddress) + "-" + endpointId.next())) - else context.watch(context.actorOf(RARP(extendedSystem).configureDispatcher(EndpointWriter.props( - handleOption, - localAddress, - remoteAddress, - refuseUid, - transport, - endpointSettings, - AkkaPduProtobufCodec, - receiveBuffers, - reliableDeliverySupervisor = None)).withDeploy(Deploy.local), + else context.watch(context.actorOf( + RARP(extendedSystem).configureDispatcher(EndpointWriter.props( + handleOption, + localAddress, + remoteAddress, + refuseUid, + transport, + endpointSettings, + AkkaPduProtobufCodec, + receiveBuffers, + reliableDeliverySupervisor = None)).withDeploy(Deploy.local), "endpointWriter-" + AddressUrlEncoder(remoteAddress) + "-" + endpointId.next())) } diff --git a/akka-remote/src/main/scala/akka/remote/RemotingLifecycleEvent.scala b/akka-remote/src/main/scala/akka/remote/RemotingLifecycleEvent.scala index f988447907..1f8350640d 100644 --- a/akka-remote/src/main/scala/akka/remote/RemotingLifecycleEvent.scala +++ b/akka-remote/src/main/scala/akka/remote/RemotingLifecycleEvent.scala @@ -26,9 +26,9 @@ sealed trait AssociationEvent extends RemotingLifecycleEvent { @SerialVersionUID(1L) final case class AssociatedEvent( - localAddress: Address, + localAddress: Address, remoteAddress: Address, - inbound: Boolean) + inbound: Boolean) extends AssociationEvent { protected override def eventName: String = "Associated" @@ -38,9 +38,9 @@ final case class AssociatedEvent( @SerialVersionUID(1L) final case class DisassociatedEvent( - localAddress: Address, + localAddress: Address, remoteAddress: Address, - inbound: Boolean) + inbound: Boolean) extends AssociationEvent { protected override def eventName: String = "Disassociated" override def logLevel: Logging.LogLevel = Logging.DebugLevel @@ -48,11 +48,11 @@ final case class DisassociatedEvent( @SerialVersionUID(1L) final case class AssociationErrorEvent( - cause: Throwable, - localAddress: Address, + cause: Throwable, + localAddress: Address, remoteAddress: Address, - inbound: Boolean, - logLevel: Logging.LogLevel) extends AssociationEvent { + inbound: Boolean, + logLevel: Logging.LogLevel) extends AssociationEvent { protected override def eventName: String = "AssociationError" override def toString: String = s"${super.toString}: Error [${cause.getMessage}] [${Logging.stackTraceFor(cause)}]" def getCause: Throwable = cause diff --git a/akka-remote/src/main/scala/akka/remote/security/provider/InternetSeedGenerator.scala b/akka-remote/src/main/scala/akka/remote/security/provider/InternetSeedGenerator.scala index 0ad678cb43..de04e8f6bd 100644 --- a/akka-remote/src/main/scala/akka/remote/security/provider/InternetSeedGenerator.scala +++ b/akka-remote/src/main/scala/akka/remote/security/provider/InternetSeedGenerator.scala @@ -36,7 +36,8 @@ object InternetSeedGenerator { private final val Instance: InternetSeedGenerator = new InternetSeedGenerator /**Delegate generators. */ private final val Generators: immutable.Seq[SeedGenerator] = - List(new RandomDotOrgSeedGenerator, // first try the Internet seed generator + List( + new RandomDotOrgSeedGenerator, // first try the Internet seed generator new SecureRandomSeedGenerator) // this is last because it always works } diff --git a/akka-remote/src/main/scala/akka/remote/serialization/MiscMessageSerializer.scala b/akka-remote/src/main/scala/akka/remote/serialization/MiscMessageSerializer.scala index 625d6487d0..c2d3fa3ef6 100644 --- a/akka-remote/src/main/scala/akka/remote/serialization/MiscMessageSerializer.scala +++ b/akka-remote/src/main/scala/akka/remote/serialization/MiscMessageSerializer.scala @@ -68,8 +68,8 @@ class MiscMessageSerializer(val system: ExtendedActorSystem) extends SerializerW private val ActorIdentifyManifest = "B" private val fromBinaryMap = Map[String, Array[Byte] ⇒ AnyRef]( - IdentifyManifest -> deserializeIdentify, - ActorIdentifyManifest -> deserializeActorIdentity) + IdentifyManifest → deserializeIdentify, + ActorIdentifyManifest → deserializeActorIdentity) override def manifest(o: AnyRef): String = o match { diff --git a/akka-remote/src/main/scala/akka/remote/transport/AbstractTransportAdapter.scala b/akka-remote/src/main/scala/akka/remote/transport/AbstractTransportAdapter.scala index 548b5ae1bb..620c31b24b 100644 --- a/akka-remote/src/main/scala/akka/remote/transport/AbstractTransportAdapter.scala +++ b/akka-remote/src/main/scala/akka/remote/transport/AbstractTransportAdapter.scala @@ -27,7 +27,7 @@ class TransportAdapters(system: ExtendedActorSystem) extends Extension { val settings = RARP(system).provider.remoteSettings private val adaptersTable: Map[String, TransportAdapterProvider] = for ((name, fqn) ← settings.Adapters) yield { - name -> system.dynamicAccess.createInstanceFor[TransportAdapterProvider](fqn, immutable.Seq.empty).recover({ + name → system.dynamicAccess.createInstanceFor[TransportAdapterProvider](fqn, immutable.Seq.empty).recover({ case e ⇒ throw new IllegalArgumentException(s"Cannot instantiate transport adapter [${fqn}]", e) }).get } @@ -68,8 +68,9 @@ abstract class AbstractTransportAdapter(protected val wrappedTransport: Transpor protected def maximumOverhead: Int - protected def interceptListen(listenAddress: Address, - listenerFuture: Future[AssociationEventListener]): Future[AssociationEventListener] + protected def interceptListen( + listenAddress: Address, + listenerFuture: Future[AssociationEventListener]): Future[AssociationEventListener] protected def interceptAssociate(remoteAddress: Address, statusPromise: Promise[AssociationHandle]): Unit @@ -116,14 +117,16 @@ abstract class AbstractTransportAdapter(protected val wrappedTransport: Transpor } -abstract class AbstractTransportAdapterHandle(val originalLocalAddress: Address, - val originalRemoteAddress: Address, - val wrappedHandle: AssociationHandle, - val addedSchemeIdentifier: String) extends AssociationHandle +abstract class AbstractTransportAdapterHandle( + val originalLocalAddress: Address, + val originalRemoteAddress: Address, + val wrappedHandle: AssociationHandle, + val addedSchemeIdentifier: String) extends AssociationHandle with SchemeAugmenter { def this(wrappedHandle: AssociationHandle, addedSchemeIdentifier: String) = - this(wrappedHandle.localAddress, + this( + wrappedHandle.localAddress, wrappedHandle.remoteAddress, wrappedHandle, addedSchemeIdentifier) @@ -138,8 +141,9 @@ object ActorTransportAdapter { final case class ListenerRegistered(listener: AssociationEventListener) extends TransportOperation final case class AssociateUnderlying(remoteAddress: Address, statusPromise: Promise[AssociationHandle]) extends TransportOperation - final case class ListenUnderlying(listenAddress: Address, - upstreamListener: Future[AssociationEventListener]) extends TransportOperation + final case class ListenUnderlying( + listenAddress: Address, + upstreamListener: Future[AssociationEventListener]) extends TransportOperation final case class DisassociateUnderlying(info: DisassociateInfo = AssociationHandle.Unknown) extends TransportOperation with DeadLetterSuppression @@ -159,8 +163,9 @@ abstract class ActorTransportAdapter(wrappedTransport: Transport, system: ActorS private def registerManager(): Future[ActorRef] = (system.actorSelection("/system/transports") ? RegisterTransportActor(managerProps, managerName)).mapTo[ActorRef] - override def interceptListen(listenAddress: Address, - listenerPromise: Future[AssociationEventListener]): Future[AssociationEventListener] = { + override def interceptListen( + listenAddress: Address, + listenerPromise: Future[AssociationEventListener]): Future[AssociationEventListener] = { registerManager().map { mgr ⇒ // Side effecting: storing the manager instance in volatile var // This is done only once: during the initialization of the protocol stack. The variable manager is not read diff --git a/akka-remote/src/main/scala/akka/remote/transport/AkkaPduCodec.scala b/akka-remote/src/main/scala/akka/remote/transport/AkkaPduCodec.scala index 8415e2eaaf..ed8e3d5ad7 100644 --- a/akka-remote/src/main/scala/akka/remote/transport/AkkaPduCodec.scala +++ b/akka-remote/src/main/scala/akka/remote/transport/AkkaPduCodec.scala @@ -34,11 +34,12 @@ private[remote] object AkkaPduCodec { case object Heartbeat extends AkkaPdu final case class Payload(bytes: ByteString) extends AkkaPdu - final case class Message(recipient: InternalActorRef, - recipientAddress: Address, - serializedMessage: SerializedMessage, - senderOption: Option[ActorRef], - seqOption: Option[SeqNo]) extends HasSequenceNumber { + final case class Message( + recipient: InternalActorRef, + recipientAddress: Address, + serializedMessage: SerializedMessage, + senderOption: Option[ActorRef], + seqOption: Option[SeqNo]) extends HasSequenceNumber { def reliableDeliveryEnabled = seqOption.isDefined @@ -93,12 +94,12 @@ private[remote] trait AkkaPduCodec { def decodeMessage(raw: ByteString, provider: RemoteActorRefProvider, localAddress: Address): (Option[Ack], Option[Message]) def constructMessage( - localAddress: Address, - recipient: ActorRef, + localAddress: Address, + recipient: ActorRef, serializedMessage: SerializedMessage, - senderOption: Option[ActorRef], - seqOption: Option[SeqNo] = None, - ackOption: Option[Ack] = None): ByteString + senderOption: Option[ActorRef], + seqOption: Option[SeqNo] = None, + ackOption: Option[Ack] = None): ByteString def constructPureAck(ack: Ack): ByteString } @@ -117,12 +118,12 @@ private[remote] object AkkaPduProtobufCodec extends AkkaPduCodec { } override def constructMessage( - localAddress: Address, - recipient: ActorRef, + localAddress: Address, + recipient: ActorRef, serializedMessage: SerializedMessage, - senderOption: Option[ActorRef], - seqOption: Option[SeqNo] = None, - ackOption: Option[Ack] = None): ByteString = { + senderOption: Option[ActorRef], + seqOption: Option[SeqNo] = None, + ackOption: Option[Ack] = None): ByteString = { val ackAndEnvelopeBuilder = AckAndEnvelopeContainer.newBuilder @@ -175,8 +176,8 @@ private[remote] object AkkaPduProtobufCodec extends AkkaPduCodec { } override def decodeMessage( - raw: ByteString, - provider: RemoteActorRefProvider, + raw: ByteString, + provider: RemoteActorRefProvider, localAddress: Address): (Option[Ack], Option[Message]) = { val ackAndEnvelope = AckAndEnvelopeContainer.parseFrom(raw.toArray) @@ -225,7 +226,7 @@ private[remote] object AkkaPduProtobufCodec extends AkkaPduCodec { Address(encodedAddress.getProtocol, encodedAddress.getSystem, encodedAddress.getHostname, encodedAddress.getPort) private def constructControlMessagePdu( - code: WireFormats.CommandType, + code: WireFormats.CommandType, handshakeInfo: Option[AkkaHandshakeInfo.Builder]): ByteString = { val controlMessageBuilder = AkkaControlMessage.newBuilder() diff --git a/akka-remote/src/main/scala/akka/remote/transport/AkkaProtocolTransport.scala b/akka-remote/src/main/scala/akka/remote/transport/AkkaProtocolTransport.scala index 187237e8da..8a0ac30caa 100644 --- a/akka-remote/src/main/scala/akka/remote/transport/AkkaProtocolTransport.scala +++ b/akka-remote/src/main/scala/akka/remote/transport/AkkaProtocolTransport.scala @@ -51,7 +51,8 @@ private[remote] class AkkaProtocolSettings(config: Config) { else if (enabledTransports.contains("akka.remote.netty.ssl")) config.getMillisDuration("akka.remote.netty.ssl.connection-timeout") else - config.getMillisDuration("akka.remote.handshake-timeout").requiring(_ > Duration.Zero, + config.getMillisDuration("akka.remote.handshake-timeout").requiring( + _ > Duration.Zero, "handshake-timeout must be > 0") } } @@ -64,7 +65,7 @@ private[remote] object AkkaProtocolTransport { //Couldn't these go into the Remo final case class AssociateUnderlyingRefuseUid( remoteAddress: Address, statusPromise: Promise[AssociationHandle], - refuseUid: Option[Int]) extends NoSerializationVerificationNeeded + refuseUid: Option[Int]) extends NoSerializationVerificationNeeded } final case class HandshakeInfo(origin: Address, uid: Int, cookie: Option[String]) @@ -93,10 +94,10 @@ final case class HandshakeInfo(origin: Address, uid: Int, cookie: Option[String] * the codec that will be used to encode/decode Akka PDUs */ private[remote] class AkkaProtocolTransport( - wrappedTransport: Transport, - private val system: ActorSystem, + wrappedTransport: Transport, + private val system: ActorSystem, private val settings: AkkaProtocolSettings, - private val codec: AkkaPduCodec) extends ActorTransportAdapter(wrappedTransport, system) { + private val codec: AkkaPduCodec) extends ActorTransportAdapter(wrappedTransport, system) { override val addedSchemeIdentifier: String = AkkaScheme @@ -122,7 +123,7 @@ private[remote] class AkkaProtocolTransport( private[transport] class AkkaProtocolManager( private val wrappedTransport: Transport, - private val settings: AkkaProtocolSettings) + private val settings: AkkaProtocolSettings) extends ActorTransportAdapterManager { // The AkkaProtocolTransport does not handle the recovery of associations, this task is implemented in the @@ -158,7 +159,7 @@ private[transport] class AkkaProtocolManager( private def createOutboundStateActor( remoteAddress: Address, statusPromise: Promise[AssociationHandle], - refuseUid: Option[Int]): Unit = { + refuseUid: Option[Int]): Unit = { val stateActorLocalAddress = localAddress val stateActorSettings = settings @@ -181,13 +182,13 @@ private[transport] class AkkaProtocolManager( } private[remote] class AkkaProtocolHandle( - _localAddress: Address, - _remoteAddress: Address, + _localAddress: Address, + _remoteAddress: Address, val readHandlerPromise: Promise[HandleEventListener], - _wrappedHandle: AssociationHandle, - val handshakeInfo: HandshakeInfo, + _wrappedHandle: AssociationHandle, + val handshakeInfo: HandshakeInfo, private val stateActor: ActorRef, - private val codec: AkkaPduCodec) + private val codec: AkkaPduCodec) extends AbstractTransportAdapterHandle(_localAddress, _remoteAddress, _wrappedHandle, AkkaScheme) { override def write(payload: ByteString): Boolean = wrappedHandle.write(codec.constructPayload(payload)) @@ -257,34 +258,35 @@ private[transport] object ProtocolStateActor { case object ForbiddenUidReason private[remote] def outboundProps( - handshakeInfo: HandshakeInfo, - remoteAddress: Address, - statusPromise: Promise[AssociationHandle], - transport: Transport, - settings: AkkaProtocolSettings, - codec: AkkaPduCodec, + handshakeInfo: HandshakeInfo, + remoteAddress: Address, + statusPromise: Promise[AssociationHandle], + transport: Transport, + settings: AkkaProtocolSettings, + codec: AkkaPduCodec, failureDetector: FailureDetector, - refuseUid: Option[Int]): Props = + refuseUid: Option[Int]): Props = Props(classOf[ProtocolStateActor], handshakeInfo, remoteAddress, statusPromise, transport, settings, codec, failureDetector, refuseUid).withDeploy(Deploy.local) private[remote] def inboundProps( - handshakeInfo: HandshakeInfo, - wrappedHandle: AssociationHandle, + handshakeInfo: HandshakeInfo, + wrappedHandle: AssociationHandle, associationListener: AssociationEventListener, - settings: AkkaProtocolSettings, - codec: AkkaPduCodec, - failureDetector: FailureDetector): Props = + settings: AkkaProtocolSettings, + codec: AkkaPduCodec, + failureDetector: FailureDetector): Props = Props(classOf[ProtocolStateActor], handshakeInfo, wrappedHandle, associationListener, settings, codec, failureDetector).withDeploy(Deploy.local) } -private[transport] class ProtocolStateActor(initialData: InitialProtocolStateData, - private val localHandshakeInfo: HandshakeInfo, - private val refuseUid: Option[Int], - private val settings: AkkaProtocolSettings, - private val codec: AkkaPduCodec, - private val failureDetector: FailureDetector) +private[transport] class ProtocolStateActor( + initialData: InitialProtocolStateData, + private val localHandshakeInfo: HandshakeInfo, + private val refuseUid: Option[Int], + private val settings: AkkaProtocolSettings, + private val codec: AkkaPduCodec, + private val failureDetector: FailureDetector) extends Actor with FSM[AssociationState, ProtocolStateData] with RequiresMessageQueue[UnboundedMessageQueueSemantics] { @@ -292,24 +294,26 @@ private[transport] class ProtocolStateActor(initialData: InitialProtocolStateDat import context.dispatcher // Outbound case - def this(handshakeInfo: HandshakeInfo, - remoteAddress: Address, - statusPromise: Promise[AssociationHandle], - transport: Transport, - settings: AkkaProtocolSettings, - codec: AkkaPduCodec, - failureDetector: FailureDetector, - refuseUid: Option[Int]) = { + def this( + handshakeInfo: HandshakeInfo, + remoteAddress: Address, + statusPromise: Promise[AssociationHandle], + transport: Transport, + settings: AkkaProtocolSettings, + codec: AkkaPduCodec, + failureDetector: FailureDetector, + refuseUid: Option[Int]) = { this(OutboundUnassociated(remoteAddress, statusPromise, transport), handshakeInfo, refuseUid, settings, codec, failureDetector) } // Inbound case - def this(handshakeInfo: HandshakeInfo, - wrappedHandle: AssociationHandle, - associationListener: AssociationEventListener, - settings: AkkaProtocolSettings, - codec: AkkaPduCodec, - failureDetector: FailureDetector) = { + def this( + handshakeInfo: HandshakeInfo, + wrappedHandle: AssociationHandle, + associationListener: AssociationEventListener, + settings: AkkaProtocolSettings, + codec: AkkaPduCodec, + failureDetector: FailureDetector) = { this(InboundUnassociated(associationListener, wrappedHandle), handshakeInfo, refuseUid = None, settings, codec, failureDetector) } @@ -413,7 +417,8 @@ private[transport] class ProtocolStateActor(initialData: InitialProtocolStateDat immutable.Queue.empty) } else { if (log.isDebugEnabled) - log.warning(s"Association attempt with mismatching cookie from [{}]. Expected [{}] but received [{}].", + log.warning( + s"Association attempt with mismatching cookie from [{}]. Expected [{}] but received [{}].", info.origin, localHandshakeInfo.cookie.getOrElse(""), info.cookie.getOrElse("")) else log.warning(s"Association attempt with mismatching cookie from [{}].", info.origin) @@ -581,9 +586,10 @@ private[transport] class ProtocolStateActor(initialData: InitialProtocolStateDat private def listenForListenerRegistration(readHandlerPromise: Promise[HandleEventListener]): Unit = readHandlerPromise.future.map { HandleListenerRegistered(_) } pipeTo self - private def notifyOutboundHandler(wrappedHandle: AssociationHandle, - handshakeInfo: HandshakeInfo, - statusPromise: Promise[AssociationHandle]): Future[HandleEventListener] = { + private def notifyOutboundHandler( + wrappedHandle: AssociationHandle, + handshakeInfo: HandshakeInfo, + statusPromise: Promise[AssociationHandle]): Future[HandleEventListener] = { val readHandlerPromise = Promise[HandleEventListener]() listenForListenerRegistration(readHandlerPromise) @@ -599,9 +605,10 @@ private[transport] class ProtocolStateActor(initialData: InitialProtocolStateDat readHandlerPromise.future } - private def notifyInboundHandler(wrappedHandle: AssociationHandle, - handshakeInfo: HandshakeInfo, - associationListener: AssociationEventListener): Future[HandleEventListener] = { + private def notifyInboundHandler( + wrappedHandle: AssociationHandle, + handshakeInfo: HandshakeInfo, + associationListener: AssociationEventListener): Future[HandleEventListener] = { val readHandlerPromise = Promise[HandleEventListener]() listenForListenerRegistration(readHandlerPromise) diff --git a/akka-remote/src/main/scala/akka/remote/transport/FailureInjectorTransportAdapter.scala b/akka-remote/src/main/scala/akka/remote/transport/FailureInjectorTransportAdapter.scala index 6f367d1078..b439244415 100644 --- a/akka-remote/src/main/scala/akka/remote/transport/FailureInjectorTransportAdapter.scala +++ b/akka-remote/src/main/scala/akka/remote/transport/FailureInjectorTransportAdapter.scala @@ -77,8 +77,9 @@ private[remote] class FailureInjectorTransportAdapter(wrappedTransport: Transpor case _ ⇒ wrappedTransport.managementCommand(cmd) } - protected def interceptListen(listenAddress: Address, - listenerFuture: Future[AssociationEventListener]): Future[AssociationEventListener] = { + protected def interceptListen( + listenAddress: Address, + listenerFuture: Future[AssociationEventListener]): Future[AssociationEventListener] = { log.warning("FailureInjectorTransport is active on this system. Gremlins might munch your packets.") listenerFuture.onSuccess { // Side effecting: As this class is not an actor, the only way to safely modify state is through volatile vars. @@ -140,8 +141,9 @@ private[remote] class FailureInjectorTransportAdapter(wrappedTransport: Transpor /** * INTERNAL API */ -private[remote] final case class FailureInjectorHandle(_wrappedHandle: AssociationHandle, - private val gremlinAdapter: FailureInjectorTransportAdapter) +private[remote] final case class FailureInjectorHandle( + _wrappedHandle: AssociationHandle, + private val gremlinAdapter: FailureInjectorTransportAdapter) extends AbstractTransportAdapterHandle(_wrappedHandle, FailureInjectorSchemeIdentifier) with HandleEventListener { import gremlinAdapter.extendedSystem.dispatcher diff --git a/akka-remote/src/main/scala/akka/remote/transport/TestTransport.scala b/akka-remote/src/main/scala/akka/remote/transport/TestTransport.scala index 8d5de1e414..d66ff291f5 100644 --- a/akka-remote/src/main/scala/akka/remote/transport/TestTransport.scala +++ b/akka-remote/src/main/scala/akka/remote/transport/TestTransport.scala @@ -24,10 +24,10 @@ import scala.concurrent.ExecutionContext.Implicits.global * production systems. */ class TestTransport( - val localAddress: Address, - final val registry: AssociationRegistry, - val maximumPayloadBytes: Int = 32000, - val schemeIdentifier: String = "test") extends Transport { + val localAddress: Address, + final val registry: AssociationRegistry, + val maximumPayloadBytes: Int = 32000, + val schemeIdentifier: String = "test") extends Transport { def this(system: ExtendedActorSystem, conf: Config) = { this( @@ -141,12 +141,12 @@ class TestTransport( */ val writeBehavior = new SwitchableLoggedBehavior[(TestAssociationHandle, ByteString), Boolean]( defaultBehavior = { - defaultWrite _ - }, + defaultWrite _ + }, logCallback = { - case (handle, payload) ⇒ - registry.logActivity(WriteAttempt(handle.localAddress, handle.remoteAddress, payload)) - }) + case (handle, payload) ⇒ + registry.logActivity(WriteAttempt(handle.localAddress, handle.remoteAddress, payload)) + }) /** * The [[akka.remote.transport.TestTransport.SwitchableLoggedBehavior]] for the disassociate() method on handles. All @@ -154,12 +154,12 @@ class TestTransport( */ val disassociateBehavior = new SwitchableLoggedBehavior[TestAssociationHandle, Unit]( defaultBehavior = { - defaultDisassociate _ - }, + defaultDisassociate _ + }, logCallback = { - (handle) ⇒ - registry.logActivity(DisassociateAttempt(handle.localAddress, handle.remoteAddress)) - }) + (handle) ⇒ + registry.logActivity(DisassociateAttempt(handle.localAddress, handle.remoteAddress)) + }) private[akka] def write(handle: TestAssociationHandle, payload: ByteString): Boolean = Await.result(writeBehavior((handle, payload)), 3.seconds) @@ -299,8 +299,9 @@ object TestTransport { * @param listenerPair pair of listeners in initiator, receiver order. * @return */ - def remoteListenerRelativeTo(handle: TestAssociationHandle, - listenerPair: (HandleEventListener, HandleEventListener)): HandleEventListener = { + def remoteListenerRelativeTo( + handle: TestAssociationHandle, + listenerPair: (HandleEventListener, HandleEventListener)): HandleEventListener = { listenerPair match { case (initiator, receiver) ⇒ if (handle.inbound) initiator else receiver } @@ -448,10 +449,10 @@ object AssociationRegistry { } final case class TestAssociationHandle( - localAddress: Address, + localAddress: Address, remoteAddress: Address, - transport: TestTransport, - inbound: Boolean) extends AssociationHandle { + transport: TestTransport, + inbound: Boolean) extends AssociationHandle { @volatile var writable = true diff --git a/akka-remote/src/main/scala/akka/remote/transport/ThrottlerTransportAdapter.scala b/akka-remote/src/main/scala/akka/remote/transport/ThrottlerTransportAdapter.scala index b24beb2b43..6e9d525e07 100644 --- a/akka-remote/src/main/scala/akka/remote/transport/ThrottlerTransportAdapter.scala +++ b/akka-remote/src/main/scala/akka/remote/transport/ThrottlerTransportAdapter.scala @@ -232,7 +232,7 @@ private[transport] class ThrottlerManager(wrappedTransport: Transport) extends A val inMode = getInboundMode(naked) wrappedHandle.outboundThrottleMode.set(getOutboundMode(naked)) wrappedHandle.readHandlerPromise.future map { ListenerAndMode(_, inMode) } pipeTo wrappedHandle.throttlerActor - handleTable ::= naked -> wrappedHandle + handleTable ::= naked → wrappedHandle statusPromise.success(wrappedHandle) case SetThrottle(address, direction, mode) ⇒ val naked = nakedAddress(address) @@ -259,7 +259,7 @@ private[transport] class ThrottlerManager(wrappedTransport: Transport) extends A case Checkin(origin, handle) ⇒ val naked: Address = nakedAddress(origin) - handleTable ::= naked -> handle + handleTable ::= naked → handle setMode(naked, handle) } @@ -360,10 +360,10 @@ private[transport] object ThrottledAssociation { * INTERNAL API */ private[transport] class ThrottledAssociation( - val manager: ActorRef, + val manager: ActorRef, val associationHandler: AssociationEventListener, - val originalHandle: AssociationHandle, - val inbound: Boolean) + val originalHandle: AssociationHandle, + val inbound: Boolean) extends Actor with LoggingFSM[ThrottledAssociation.ThrottlerState, ThrottledAssociation.ThrottlerData] with RequiresMessageQueue[UnboundedMessageQueueSemantics] { import ThrottledAssociation._ diff --git a/akka-remote/src/main/scala/akka/remote/transport/netty/NettyTransport.scala b/akka-remote/src/main/scala/akka/remote/transport/netty/NettyTransport.scala index 15dbc9171f..4985efee79 100644 --- a/akka-remote/src/main/scala/akka/remote/transport/netty/NettyTransport.scala +++ b/akka-remote/src/main/scala/akka/remote/transport/netty/NettyTransport.scala @@ -167,10 +167,11 @@ private[netty] trait CommonHandlers extends NettyHelpers { protected def createHandle(channel: Channel, localAddress: Address, remoteAddress: Address): AssociationHandle - protected def registerListener(channel: Channel, - listener: HandleEventListener, - msg: ChannelBuffer, - remoteSocketAddress: InetSocketAddress): Unit + protected def registerListener( + channel: Channel, + listener: HandleEventListener, + msg: ChannelBuffer, + remoteSocketAddress: InetSocketAddress): Unit final protected def init(channel: Channel, remoteSocketAddress: SocketAddress, remoteAddress: Address, msg: ChannelBuffer)( op: (AssociationHandle ⇒ Any)): Unit = { @@ -193,8 +194,9 @@ private[netty] trait CommonHandlers extends NettyHelpers { /** * INTERNAL API */ -private[netty] abstract class ServerHandler(protected final val transport: NettyTransport, - private final val associationListenerFuture: Future[AssociationEventListener]) +private[netty] abstract class ServerHandler( + protected final val transport: NettyTransport, + private final val associationListenerFuture: Future[AssociationEventListener]) extends NettyServerHelpers with CommonHandlers { import transport.executionContext @@ -205,7 +207,7 @@ private[netty] abstract class ServerHandler(protected final val transport: Netty case listener: AssociationEventListener ⇒ val remoteAddress = NettyTransport.addressFromSocketAddress(remoteSocketAddress, transport.schemeIdentifier, transport.system.name, hostName = None, port = None).getOrElse( - throw new NettyTransportException(s"Unknown inbound remote address type [${remoteSocketAddress.getClass.getName}]")) + throw new NettyTransportException(s"Unknown inbound remote address type [${remoteSocketAddress.getClass.getName}]")) init(channel, remoteSocketAddress, remoteAddress, msg) { listener notify InboundAssociation(_) } } } diff --git a/akka-remote/src/main/scala/akka/remote/transport/netty/TcpSupport.scala b/akka-remote/src/main/scala/akka/remote/transport/netty/TcpSupport.scala index 787c754906..26fe1f892d 100644 --- a/akka-remote/src/main/scala/akka/remote/transport/netty/TcpSupport.scala +++ b/akka-remote/src/main/scala/akka/remote/transport/netty/TcpSupport.scala @@ -28,10 +28,11 @@ private[remote] trait TcpHandlers extends CommonHandlers { import ChannelLocalActor._ - override def registerListener(channel: Channel, - listener: HandleEventListener, - msg: ChannelBuffer, - remoteSocketAddress: InetSocketAddress): Unit = ChannelLocalActor.set(channel, Some(listener)) + override def registerListener( + channel: Channel, + listener: HandleEventListener, + msg: ChannelBuffer, + remoteSocketAddress: InetSocketAddress): Unit = ChannelLocalActor.set(channel, Some(listener)) override def createHandle(channel: Channel, localAddress: Address, remoteAddress: Address): AssociationHandle = new TcpAssociationHandle(localAddress, remoteAddress, transport, channel) @@ -75,10 +76,11 @@ private[remote] class TcpClientHandler(_transport: NettyTransport, remoteAddress /** * INTERNAL API */ -private[remote] class TcpAssociationHandle(val localAddress: Address, - val remoteAddress: Address, - val transport: NettyTransport, - private val channel: Channel) +private[remote] class TcpAssociationHandle( + val localAddress: Address, + val remoteAddress: Address, + val transport: NettyTransport, + private val channel: Channel) extends AssociationHandle { import transport.executionContext diff --git a/akka-remote/src/main/scala/akka/remote/transport/netty/UdpSupport.scala b/akka-remote/src/main/scala/akka/remote/transport/netty/UdpSupport.scala index 7e17cd7987..37d0192f74 100644 --- a/akka-remote/src/main/scala/akka/remote/transport/netty/UdpSupport.scala +++ b/akka-remote/src/main/scala/akka/remote/transport/netty/UdpSupport.scala @@ -21,10 +21,11 @@ private[remote] trait UdpHandlers extends CommonHandlers { override def createHandle(channel: Channel, localAddress: Address, remoteAddress: Address): AssociationHandle = new UdpAssociationHandle(localAddress, remoteAddress, channel, transport) - override def registerListener(channel: Channel, - listener: HandleEventListener, - msg: ChannelBuffer, - remoteSocketAddress: InetSocketAddress): Unit = { + override def registerListener( + channel: Channel, + listener: HandleEventListener, + msg: ChannelBuffer, + remoteSocketAddress: InetSocketAddress): Unit = { transport.udpConnectionTable.putIfAbsent(remoteSocketAddress, listener) match { case null ⇒ listener notify InboundPayload(ByteString(msg.array())) case oldReader ⇒ @@ -72,10 +73,11 @@ private[remote] class UdpClientHandler(_transport: NettyTransport, remoteAddress /** * INTERNAL API */ -private[remote] class UdpAssociationHandle(val localAddress: Address, - val remoteAddress: Address, - private val channel: Channel, - private val transport: NettyTransport) extends AssociationHandle { +private[remote] class UdpAssociationHandle( + val localAddress: Address, + val remoteAddress: Address, + private val channel: Channel, + private val transport: NettyTransport) extends AssociationHandle { override val readHandlerPromise: Promise[HandleEventListener] = Promise() diff --git a/akka-remote/src/test/scala/akka/remote/AccrualFailureDetectorSpec.scala b/akka-remote/src/test/scala/akka/remote/AccrualFailureDetectorSpec.scala index 4b40c2208b..2da9207c72 100644 --- a/akka-remote/src/test/scala/akka/remote/AccrualFailureDetectorSpec.scala +++ b/akka-remote/src/test/scala/akka/remote/AccrualFailureDetectorSpec.scala @@ -23,12 +23,12 @@ class AccrualFailureDetectorSpec extends AkkaSpec("akka.loglevel = INFO") { } def createFailureDetector( - threshold: Double = 8.0, - maxSampleSize: Int = 1000, - minStdDeviation: FiniteDuration = 100.millis, + threshold: Double = 8.0, + maxSampleSize: Int = 1000, + minStdDeviation: FiniteDuration = 100.millis, acceptableLostDuration: FiniteDuration = Duration.Zero, firstHeartbeatEstimate: FiniteDuration = 1.second, - clock: Clock = FailureDetector.defaultClock) = + clock: Clock = FailureDetector.defaultClock) = new PhiAccrualFailureDetector( threshold, maxSampleSize, @@ -63,7 +63,7 @@ class AccrualFailureDetectorSpec extends AkkaSpec("akka.loglevel = INFO") { "return realistic phi values" in { val fd = createFailureDetector() - val test = TreeMap(0 -> 0.0, 500 -> 0.1, 1000 -> 0.3, 1200 -> 1.6, 1400 -> 4.7, 1600 -> 10.8, 1700 -> 15.3) + val test = TreeMap(0 → 0.0, 500 → 0.1, 1000 → 0.3, 1200 → 1.6, 1400 → 4.7, 1600 → 10.8, 1700 → 15.3) for ((timeDiff, expectedPhi) ← test) { fd.phi(timeDiff = timeDiff, mean = 1000.0, stdDeviation = 100.0) should ===(expectedPhi +- (0.1)) } @@ -81,7 +81,8 @@ class AccrualFailureDetectorSpec extends AkkaSpec("akka.loglevel = INFO") { "return phi based on guess when only one heartbeat" in { val timeInterval = List[Long](0, 1000, 1000, 1000, 1000) - val fd = createFailureDetector(firstHeartbeatEstimate = 1.seconds, + val fd = createFailureDetector( + firstHeartbeatEstimate = 1.seconds, clock = fakeTimeGenerator(timeInterval)) fd.heartbeat() diff --git a/akka-remote/src/test/scala/akka/remote/DeadlineFailureDetectorSpec.scala b/akka-remote/src/test/scala/akka/remote/DeadlineFailureDetectorSpec.scala index 4edee05bc1..8bb4256b47 100644 --- a/akka-remote/src/test/scala/akka/remote/DeadlineFailureDetectorSpec.scala +++ b/akka-remote/src/test/scala/akka/remote/DeadlineFailureDetectorSpec.scala @@ -23,7 +23,7 @@ class DeadlineFailureDetectorSpec extends AkkaSpec { def createFailureDetector( acceptableLostDuration: FiniteDuration, - clock: Clock = FailureDetector.defaultClock) = + clock: Clock = FailureDetector.defaultClock) = new DeadlineFailureDetector(acceptableLostDuration, heartbeatInterval = 1.second)(clock = clock) "mark node as monitored after a series of successful heartbeats" in { diff --git a/akka-remote/src/test/scala/akka/remote/FailureDetectorRegistrySpec.scala b/akka-remote/src/test/scala/akka/remote/FailureDetectorRegistrySpec.scala index a620de6726..4800b3c060 100644 --- a/akka-remote/src/test/scala/akka/remote/FailureDetectorRegistrySpec.scala +++ b/akka-remote/src/test/scala/akka/remote/FailureDetectorRegistrySpec.scala @@ -16,12 +16,12 @@ class FailureDetectorRegistrySpec extends AkkaSpec("akka.loglevel = INFO") { } def createFailureDetector( - threshold: Double = 8.0, - maxSampleSize: Int = 1000, - minStdDeviation: FiniteDuration = 10.millis, + threshold: Double = 8.0, + maxSampleSize: Int = 1000, + minStdDeviation: FiniteDuration = 10.millis, acceptableLostDuration: FiniteDuration = Duration.Zero, firstHeartbeatEstimate: FiniteDuration = 1.second, - clock: Clock = FailureDetector.defaultClock) = + clock: Clock = FailureDetector.defaultClock) = new PhiAccrualFailureDetector( threshold, maxSampleSize, @@ -29,12 +29,13 @@ class FailureDetectorRegistrySpec extends AkkaSpec("akka.loglevel = INFO") { acceptableLostDuration, firstHeartbeatEstimate = firstHeartbeatEstimate)(clock = clock) - def createFailureDetectorRegistry(threshold: Double = 8.0, - maxSampleSize: Int = 1000, - minStdDeviation: FiniteDuration = 10.millis, - acceptableLostDuration: FiniteDuration = Duration.Zero, - firstHeartbeatEstimate: FiniteDuration = 1.second, - clock: Clock = FailureDetector.defaultClock): FailureDetectorRegistry[String] = { + def createFailureDetectorRegistry( + threshold: Double = 8.0, + maxSampleSize: Int = 1000, + minStdDeviation: FiniteDuration = 10.millis, + acceptableLostDuration: FiniteDuration = Duration.Zero, + firstHeartbeatEstimate: FiniteDuration = 1.second, + clock: Clock = FailureDetector.defaultClock): FailureDetectorRegistry[String] = { new DefaultFailureDetectorRegistry[String](() ⇒ createFailureDetector( threshold, maxSampleSize, diff --git a/akka-remote/src/test/scala/akka/remote/RemoteConfigSpec.scala b/akka-remote/src/test/scala/akka/remote/RemoteConfigSpec.scala index 5de9b1ad98..75f6781108 100644 --- a/akka-remote/src/test/scala/akka/remote/RemoteConfigSpec.scala +++ b/akka-remote/src/test/scala/akka/remote/RemoteConfigSpec.scala @@ -46,8 +46,8 @@ class RemoteConfigSpec extends AkkaSpec( Transports.head._1 should ===(classOf[akka.remote.transport.netty.NettyTransport].getName) Transports.head._2 should ===(Nil) Adapters should ===(Map( - "gremlin" -> classOf[akka.remote.transport.FailureInjectorProvider].getName, - "trttl" -> classOf[akka.remote.transport.ThrottlerProvider].getName)) + "gremlin" → classOf[akka.remote.transport.FailureInjectorProvider].getName, + "trttl" → classOf[akka.remote.transport.ThrottlerProvider].getName)) WatchFailureDetectorImplementationClass should ===(classOf[PhiAccrualFailureDetector].getName) WatchHeartBeatInterval should ===(1 seconds) diff --git a/akka-remote/src/test/scala/akka/remote/RemoteRouterSpec.scala b/akka-remote/src/test/scala/akka/remote/RemoteRouterSpec.scala index d37e6bcafc..c574e94c21 100644 --- a/akka-remote/src/test/scala/akka/remote/RemoteRouterSpec.scala +++ b/akka-remote/src/test/scala/akka/remote/RemoteRouterSpec.scala @@ -110,7 +110,8 @@ class RemoteRouterSpec extends AkkaSpec(""" "deploy its children on remote host driven by programatic definition" in { val probe = TestProbe()(masterSystem) - val router = masterSystem.actorOf(new RemoteRouterConfig(RoundRobinPool(2), + val router = masterSystem.actorOf(new RemoteRouterConfig( + RoundRobinPool(2), Seq(Address("akka.tcp", sysName, "localhost", port))).props(echoActorProps), "blub2") val replies = collectRouteePaths(probe, router, 5) val children = replies.toSet diff --git a/akka-remote/src/test/scala/akka/remote/RemoteWatcherSpec.scala b/akka-remote/src/test/scala/akka/remote/RemoteWatcherSpec.scala index ac88c68859..23d1072c51 100644 --- a/akka-remote/src/test/scala/akka/remote/RemoteWatcherSpec.scala +++ b/akka-remote/src/test/scala/akka/remote/RemoteWatcherSpec.scala @@ -40,7 +40,8 @@ object RemoteWatcherSpec { final case class Quarantined(address: Address, uid: Option[Int]) } - class TestRemoteWatcher(heartbeatExpectedResponseAfter: FiniteDuration) extends RemoteWatcher(createFailureDetector, + class TestRemoteWatcher(heartbeatExpectedResponseAfter: FiniteDuration) extends RemoteWatcher( + createFailureDetector, heartbeatInterval = TurnOff, unreachableReaperInterval = TurnOff, heartbeatExpectedResponseAfter = heartbeatExpectedResponseAfter) { diff --git a/akka-remote/src/test/scala/akka/remote/RemotingSpec.scala b/akka-remote/src/test/scala/akka/remote/RemotingSpec.scala index dbd188d377..4999a00548 100644 --- a/akka-remote/src/test/scala/akka/remote/RemotingSpec.scala +++ b/akka-remote/src/test/scala/akka/remote/RemotingSpec.scala @@ -140,9 +140,9 @@ class RemotingSpec extends AkkaSpec(RemotingSpec.cfg) with ImplicitSender with D for ( (name, proto) ← Seq( - "/gonk" -> "tcp", - "/zagzag" -> "udp", - "/roghtaar" -> "ssl.tcp") + "/gonk" → "tcp", + "/zagzag" → "udp", + "/roghtaar" → "ssl.tcp") ) deploy(system, Deploy(name, scope = RemoteScope(addr(remoteSystem, proto)))) def addr(sys: ActorSystem, proto: String) = diff --git a/akka-remote/src/test/scala/akka/remote/serialization/MiscMessageSerializerSpec.scala b/akka-remote/src/test/scala/akka/remote/serialization/MiscMessageSerializerSpec.scala index 27efdbfc03..07e4128027 100644 --- a/akka-remote/src/test/scala/akka/remote/serialization/MiscMessageSerializerSpec.scala +++ b/akka-remote/src/test/scala/akka/remote/serialization/MiscMessageSerializerSpec.scala @@ -26,9 +26,9 @@ class MiscMessageSerializerSpec extends AkkaSpec(MiscMessageSerializerSpec.testC "MiscMessageSerializer" must { Seq( - "Identify" -> Identify("some-message"), - s"ActorIdentity without actor ref" -> ActorIdentity("some-message", ref = None), - s"ActorIdentity with actor ref" -> ActorIdentity("some-message", ref = Some(testActor))).foreach { + "Identify" → Identify("some-message"), + s"ActorIdentity without actor ref" → ActorIdentity("some-message", ref = None), + s"ActorIdentity with actor ref" → ActorIdentity("some-message", ref = Some(testActor))).foreach { case (scenario, item) ⇒ s"resolve serializer for $scenario" in { val serializer = SerializationExtension(system) diff --git a/akka-remote/src/test/scala/akka/remote/transport/SystemMessageDeliveryStressTest.scala b/akka-remote/src/test/scala/akka/remote/transport/SystemMessageDeliveryStressTest.scala index a99fb5c3d3..b459d701bb 100644 --- a/akka-remote/src/test/scala/akka/remote/transport/SystemMessageDeliveryStressTest.scala +++ b/akka-remote/src/test/scala/akka/remote/transport/SystemMessageDeliveryStressTest.scala @@ -189,9 +189,11 @@ abstract class SystemMessageDeliveryStressTest(msg: String, cfg: String) } -class SystemMessageDeliveryRetryGate extends SystemMessageDeliveryStressTest("passive connections on", +class SystemMessageDeliveryRetryGate extends SystemMessageDeliveryStressTest( + "passive connections on", "akka.remote.retry-gate-closed-for = 0.5 s") -class SystemMessageDeliveryNoPassiveRetryGate extends SystemMessageDeliveryStressTest("passive connections off", +class SystemMessageDeliveryNoPassiveRetryGate extends SystemMessageDeliveryStressTest( + "passive connections off", """ akka.remote.use-passive-connections = off akka.remote.retry-gate-closed-for = 0.5 s diff --git a/akka-samples/akka-sample-cluster-java/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSingleMasterSpec.scala b/akka-samples/akka-sample-cluster-java/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSingleMasterSpec.scala index 875b3d9053..68e0bb0e71 100644 --- a/akka-samples/akka-sample-cluster-java/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSingleMasterSpec.scala +++ b/akka-samples/akka-sample-cluster-java/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSingleMasterSpec.scala @@ -32,7 +32,7 @@ object StatsSampleSingleMasterSpecConfig extends MultiNodeConfig { def nodeList = Seq(first, second, third) // Extract individual sigar library for every node. - nodeList foreach { role ⇒ + nodeList foreach { role => nodeConfig(role) { ConfigFactory.parseString(s""" # Disable legacy metrics in akka-cluster. diff --git a/akka-samples/akka-sample-cluster-java/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSpec.scala b/akka-samples/akka-sample-cluster-java/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSpec.scala index 567ad2806b..e2bb09ab3e 100644 --- a/akka-samples/akka-sample-cluster-java/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSpec.scala +++ b/akka-samples/akka-sample-cluster-java/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSpec.scala @@ -28,7 +28,7 @@ object StatsSampleSpecConfig extends MultiNodeConfig { def nodeList = Seq(first, second, third) // Extract individual sigar library for every node. - nodeList foreach { role ⇒ + nodeList foreach { role => nodeConfig(role) { ConfigFactory.parseString(s""" # Disable legacy metrics in akka-cluster. @@ -131,4 +131,4 @@ abstract class StatsSampleSpec extends MultiNodeSpec(StatsSampleSpecConfig) } -} \ No newline at end of file +} diff --git a/akka-samples/akka-sample-cluster-java/src/multi-jvm/scala/sample/cluster/transformation/TransformationSampleSpec.scala b/akka-samples/akka-sample-cluster-java/src/multi-jvm/scala/sample/cluster/transformation/TransformationSampleSpec.scala index ea075f2ed0..331cbb8580 100644 --- a/akka-samples/akka-sample-cluster-java/src/multi-jvm/scala/sample/cluster/transformation/TransformationSampleSpec.scala +++ b/akka-samples/akka-sample-cluster-java/src/multi-jvm/scala/sample/cluster/transformation/TransformationSampleSpec.scala @@ -27,7 +27,7 @@ object TransformationSampleSpecConfig extends MultiNodeConfig { def nodeList = Seq(frontend1, frontend2, backend1, backend2, backend3) // Extract individual sigar library for every node. - nodeList foreach { role ⇒ + nodeList foreach { role => nodeConfig(role) { ConfigFactory.parseString(s""" # Disable legacy metrics in akka-cluster. @@ -138,4 +138,4 @@ abstract class TransformationSampleSpec extends MultiNodeSpec(TransformationSamp } } -} \ No newline at end of file +} diff --git a/akka-samples/akka-sample-cluster-scala/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSingleMasterSpec.scala b/akka-samples/akka-sample-cluster-scala/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSingleMasterSpec.scala index 3bc3b2be21..e22a1a281f 100644 --- a/akka-samples/akka-sample-cluster-scala/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSingleMasterSpec.scala +++ b/akka-samples/akka-sample-cluster-scala/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSingleMasterSpec.scala @@ -31,7 +31,7 @@ object StatsSampleSingleMasterSpecConfig extends MultiNodeConfig { def nodeList = Seq(first, second, third) // Extract individual sigar library for every node. - nodeList foreach { role ⇒ + nodeList foreach { role => nodeConfig(role) { ConfigFactory.parseString(s""" # Disable legacy metrics in akka-cluster. diff --git a/akka-samples/akka-sample-cluster-scala/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSpec.scala b/akka-samples/akka-sample-cluster-scala/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSpec.scala index 9e80f02ccf..dba0965de2 100644 --- a/akka-samples/akka-sample-cluster-scala/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSpec.scala +++ b/akka-samples/akka-sample-cluster-scala/src/multi-jvm/scala/sample/cluster/stats/StatsSampleSpec.scala @@ -24,7 +24,7 @@ object StatsSampleSpecConfig extends MultiNodeConfig { def nodeList = Seq(first, second, third) // Extract individual sigar library for every node. - nodeList foreach { role ⇒ + nodeList foreach { role => nodeConfig(role) { ConfigFactory.parseString(s""" # Disable legacy metrics in akka-cluster. @@ -147,4 +147,4 @@ abstract class StatsSampleSpec extends MultiNodeSpec(StatsSampleSpecConfig) } -} \ No newline at end of file +} diff --git a/akka-samples/akka-sample-cluster-scala/src/multi-jvm/scala/sample/cluster/transformation/TransformationSampleSpec.scala b/akka-samples/akka-sample-cluster-scala/src/multi-jvm/scala/sample/cluster/transformation/TransformationSampleSpec.scala index d21388b393..cd9324181c 100644 --- a/akka-samples/akka-sample-cluster-scala/src/multi-jvm/scala/sample/cluster/transformation/TransformationSampleSpec.scala +++ b/akka-samples/akka-sample-cluster-scala/src/multi-jvm/scala/sample/cluster/transformation/TransformationSampleSpec.scala @@ -26,7 +26,7 @@ object TransformationSampleSpecConfig extends MultiNodeConfig { def nodeList = Seq(frontend1, frontend2, backend1, backend2, backend3) // Extract individual sigar library for every node. - nodeList foreach { role ⇒ + nodeList foreach { role => nodeConfig(role) { ConfigFactory.parseString(s""" # Disable legacy metrics in akka-cluster. @@ -137,4 +137,4 @@ abstract class TransformationSampleSpec extends MultiNodeSpec(TransformationSamp } } -} \ No newline at end of file +} diff --git a/akka-samples/akka-sample-distributed-data-java/src/multi-jvm/scala/sample/distributeddata/ServiceRegistrySpec.scala b/akka-samples/akka-sample-distributed-data-java/src/multi-jvm/scala/sample/distributeddata/ServiceRegistrySpec.scala index 9efcf2f63a..b7f13f9e1b 100644 --- a/akka-samples/akka-sample-distributed-data-java/src/multi-jvm/scala/sample/distributeddata/ServiceRegistrySpec.scala +++ b/akka-samples/akka-sample-distributed-data-java/src/multi-jvm/scala/sample/distributeddata/ServiceRegistrySpec.scala @@ -28,7 +28,7 @@ object ServiceRegistrySpec extends MultiNodeConfig { class Service extends Actor { def receive = { - case s: String ⇒ sender() ! self.path.name + ": " + s + case s: String => sender() ! self.path.name + ": " + s } } diff --git a/akka-samples/akka-sample-distributed-data-java/src/multi-jvm/scala/sample/distributeddata/VotingServiceSpec.scala b/akka-samples/akka-sample-distributed-data-java/src/multi-jvm/scala/sample/distributeddata/VotingServiceSpec.scala index 37c62cfe7a..6ae3471c49 100644 --- a/akka-samples/akka-sample-distributed-data-java/src/multi-jvm/scala/sample/distributeddata/VotingServiceSpec.scala +++ b/akka-samples/akka-sample-distributed-data-java/src/multi-jvm/scala/sample/distributeddata/VotingServiceSpec.scala @@ -84,7 +84,7 @@ class VotingServiceSpec extends MultiNodeSpec(VotingServiceSpec) with STMultiNod votingService ! VotingService.CLOSE } - val expected = (1 to 20).map(n ⇒ "#" + n -> BigInteger.valueOf(3L * N / 20)).toMap + val expected = (1 to 20).map(n => "#" + n -> BigInteger.valueOf(3L * N / 20)).toMap awaitAssert { votingService ! VotingService.GET_VOTES val votes = expectMsgType[Votes](3.seconds) diff --git a/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ReplicatedCache.scala b/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ReplicatedCache.scala index 3187449bfa..bc53f12bf5 100644 --- a/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ReplicatedCache.scala +++ b/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ReplicatedCache.scala @@ -32,22 +32,22 @@ class ReplicatedCache extends Actor { LWWMapKey("cache-" + math.abs(entryKey.hashCode) % 100) def receive = { - case PutInCache(key, value) ⇒ + case PutInCache(key, value) => replicator ! Update(dataKey(key), LWWMap(), WriteLocal)(_ + (key -> value)) - case Evict(key) ⇒ + case Evict(key) => replicator ! Update(dataKey(key), LWWMap(), WriteLocal)(_ - key) - case GetFromCache(key) ⇒ + case GetFromCache(key) => replicator ! Get(dataKey(key), ReadLocal, Some(Request(key, sender()))) - case g @ GetSuccess(LWWMapKey(_), Some(Request(key, replyTo))) ⇒ + case g @ GetSuccess(LWWMapKey(_), Some(Request(key, replyTo))) => g.dataValue match { - case data: LWWMap[_] ⇒ data.get(key) match { - case Some(value) ⇒ replyTo ! Cached(key, Some(value)) - case None ⇒ replyTo ! Cached(key, None) + case data: LWWMap[_] => data.get(key) match { + case Some(value) => replyTo ! Cached(key, Some(value)) + case None => replyTo ! Cached(key, None) } } - case NotFound(_, Some(Request(key, replyTo))) ⇒ + case NotFound(_, Some(Request(key, replyTo))) => replyTo ! Cached(key, None) - case _: UpdateResponse[_] ⇒ // ok + case _: UpdateResponse[_] => // ok } } diff --git a/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ReplicatedMetrics.scala b/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ReplicatedMetrics.scala index ce056545ef..7c40e1180e 100644 --- a/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ReplicatedMetrics.scala +++ b/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ReplicatedMetrics.scala @@ -30,7 +30,7 @@ object ReplicatedMetrics { case class UsedHeap(percentPerNode: Map[String, Double]) { override def toString = percentPerNode.toSeq.sortBy(_._1).map { - case (key, value) ⇒ key + " --> " + value + " %" + case (key, value) => key + " --> " + value + " %" }.mkString("\n") } @@ -71,42 +71,42 @@ class ReplicatedMetrics(measureInterval: FiniteDuration, cleanupInterval: Finite var nodesInCluster = Set.empty[String] def receive = { - case Tick ⇒ + case Tick => val heap = memoryMBean.getHeapMemoryUsage val used = heap.getUsed val max = heap.getMax replicator ! Update(UsedHeapKey, LWWMap.empty[Long], WriteLocal)(_ + (node -> used)) - replicator ! Update(MaxHeapKey, LWWMap.empty[Long], WriteLocal) { data ⇒ + replicator ! Update(MaxHeapKey, LWWMap.empty[Long], WriteLocal) { data => data.get(node) match { - case Some(`max`) ⇒ data // unchanged - case _ ⇒ data + (node -> max) + case Some(`max`) => data // unchanged + case _ => data + (node -> max) } } - case c @ Changed(MaxHeapKey) ⇒ + case c @ Changed(MaxHeapKey) => maxHeap = c.get(MaxHeapKey).entries - case c @ Changed(UsedHeapKey) ⇒ + case c @ Changed(UsedHeapKey) => val usedHeapPercent = UsedHeap(c.get(UsedHeapKey).entries.collect { - case (key, value) if maxHeap.contains(key) ⇒ + case (key, value) if maxHeap.contains(key) => (key -> (value.toDouble / maxHeap(key)) * 100.0) }) log.debug("Node {} observed:\n{}", node, usedHeapPercent) context.system.eventStream.publish(usedHeapPercent) - case _: UpdateResponse[_] ⇒ // ok + case _: UpdateResponse[_] => // ok - case MemberUp(m) ⇒ + case MemberUp(m) => nodesInCluster += nodeKey(m.address) - case MemberRemoved(m, _) ⇒ + case MemberRemoved(m, _) => nodesInCluster -= nodeKey(m.address) if (m.address == cluster.selfAddress) context.stop(self) - case Cleanup ⇒ + case Cleanup => def cleanupRemoved(data: LWWMap[Long]): LWWMap[Long] = - (data.entries.keySet -- nodesInCluster).foldLeft(data) { case (d, key) ⇒ d - key } + (data.entries.keySet -- nodesInCluster).foldLeft(data) { case (d, key) => d - key } replicator ! Update(UsedHeapKey, LWWMap.empty[Long], WriteLocal)(cleanupRemoved) replicator ! Update(MaxHeapKey, LWWMap.empty[Long], WriteLocal)(cleanupRemoved) diff --git a/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ServiceRegistry.scala b/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ServiceRegistry.scala index 4d6c91df1e..dfa3722257 100644 --- a/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ServiceRegistry.scala +++ b/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ServiceRegistry.scala @@ -69,7 +69,7 @@ class ServiceRegistry extends Actor with ActorLogging { } def receive = { - case Register(name, service) ⇒ + case Register(name, service) => val dKey = serviceKey(name) // store the service names in a separate GSet to be able to // get notifications of new names @@ -78,19 +78,19 @@ class ServiceRegistry extends Actor with ActorLogging { // add the service replicator ! Update(dKey, ORSet(), WriteLocal)(_ + service) - case Lookup(name) ⇒ + case Lookup(name) => sender() ! Bindings(name, services.getOrElse(name, Set.empty)) - case c @ Changed(AllServicesKey) ⇒ + case c @ Changed(AllServicesKey) => val newKeys = c.get(AllServicesKey).elements log.debug("Services changed, added: {}, all: {}", (newKeys -- keys), newKeys) - (newKeys -- keys).foreach { dKey ⇒ + (newKeys -- keys).foreach { dKey => // subscribe to get notifications of when services with this name are added or removed replicator ! Subscribe(dKey, self) } keys = newKeys - case c @ Changed(ServiceKey(serviceName)) ⇒ + case c @ Changed(ServiceKey(serviceName)) => val name = serviceName.split(":").tail.mkString val newServices = c.get(serviceKey(name)).elements log.debug("Services changed for name [{}]: {}", name, newServices) @@ -99,7 +99,7 @@ class ServiceRegistry extends Actor with ActorLogging { if (leader) newServices.foreach(context.watch) // watch is idempotent - case LeaderChanged(node) ⇒ + case LeaderChanged(node) => // Let one node (the leader) be responsible for removal of terminated services // to avoid redundant work and too many death watch notifications. // It is not critical to only do it from one node. @@ -114,14 +114,14 @@ class ServiceRegistry extends Actor with ActorLogging { for (refs ← services.valuesIterator; ref ← refs) context.unwatch(ref) - case Terminated(ref) ⇒ - val names = services.collect { case (name, refs) if refs.contains(ref) ⇒ name } - names.foreach { name ⇒ + case Terminated(ref) => + val names = services.collect { case (name, refs) if refs.contains(ref) => name } + names.foreach { name => log.debug("Service with name [{}] terminated: {}", name, ref) replicator ! Update(serviceKey(name), ORSet(), WriteLocal)(_ - ref) } - case _: UpdateResponse[_] ⇒ // ok + case _: UpdateResponse[_] => // ok } } diff --git a/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ShoppingCart.scala b/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ShoppingCart.scala index 89d94fbda5..a695e5d637 100644 --- a/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ShoppingCart.scala +++ b/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/ShoppingCart.scala @@ -45,18 +45,18 @@ class ShoppingCart(userId: String) extends Actor { //#get-cart def receiveGetCart: Receive = { - case GetCart ⇒ + case GetCart => replicator ! Get(DataKey, readMajority, Some(sender())) - case g @ GetSuccess(DataKey, Some(replyTo: ActorRef)) ⇒ + case g @ GetSuccess(DataKey, Some(replyTo: ActorRef)) => val data = g.get(DataKey) val cart = Cart(data.entries.values.toSet) replyTo ! cart - case NotFound(DataKey, Some(replyTo: ActorRef)) ⇒ + case NotFound(DataKey, Some(replyTo: ActorRef)) => replyTo ! Cart(Set.empty) - case GetFailure(DataKey, Some(replyTo: ActorRef)) ⇒ + case GetFailure(DataKey, Some(replyTo: ActorRef)) => // ReadMajority failure, try again with local read replicator ! Get(DataKey, ReadLocal, Some(replyTo)) } @@ -64,9 +64,9 @@ class ShoppingCart(userId: String) extends Actor { //#add-item def receiveAddItem: Receive = { - case cmd @ AddItem(item) ⇒ + case cmd @ AddItem(item) => val update = Update(DataKey, LWWMap.empty[LineItem], writeMajority, Some(cmd)) { - cart ⇒ updateCart(cart, item) + cart => updateCart(cart, item) } replicator ! update } @@ -74,38 +74,38 @@ class ShoppingCart(userId: String) extends Actor { def updateCart(data: LWWMap[LineItem], item: LineItem): LWWMap[LineItem] = data.get(item.productId) match { - case Some(LineItem(_, _, existingQuantity)) ⇒ + case Some(LineItem(_, _, existingQuantity)) => data + (item.productId -> item.copy(quantity = existingQuantity + item.quantity)) - case None ⇒ data + (item.productId -> item) + case None => data + (item.productId -> item) } //#remove-item def receiveRemoveItem: Receive = { - case cmd @ RemoveItem(productId) ⇒ + case cmd @ RemoveItem(productId) => // Try to fetch latest from a majority of nodes first, since ORMap // remove must have seen the item to be able to remove it. replicator ! Get(DataKey, readMajority, Some(cmd)) - case GetSuccess(DataKey, Some(RemoveItem(productId))) ⇒ + case GetSuccess(DataKey, Some(RemoveItem(productId))) => replicator ! Update(DataKey, LWWMap(), writeMajority, None) { _ - productId } - case GetFailure(DataKey, Some(RemoveItem(productId))) ⇒ + case GetFailure(DataKey, Some(RemoveItem(productId))) => // ReadMajority failed, fall back to best effort local value replicator ! Update(DataKey, LWWMap(), writeMajority, None) { _ - productId } - case NotFound(DataKey, Some(RemoveItem(productId))) ⇒ + case NotFound(DataKey, Some(RemoveItem(productId))) => // nothing to remove } //#remove-item def receiveOther: Receive = { - case _: UpdateSuccess[_] | _: UpdateTimeout[_] ⇒ + case _: UpdateSuccess[_] | _: UpdateTimeout[_] => // UpdateTimeout, will eventually be replicated - case e: UpdateFailure[_] ⇒ throw new IllegalStateException("Unexpected failure: " + e) + case e: UpdateFailure[_] => throw new IllegalStateException("Unexpected failure: " + e) } } diff --git a/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/VotingService.scala b/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/VotingService.scala index 22e9c8bee4..0d34d9002d 100644 --- a/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/VotingService.scala +++ b/akka-samples/akka-sample-distributed-data-scala/src/main/scala/sample/distributeddata/VotingService.scala @@ -35,14 +35,14 @@ class VotingService extends Actor { replicator ! Subscribe(OpenedKey, self) def receive = { - case Open ⇒ + case Open => replicator ! Update(OpenedKey, Flag(), WriteAll(5.seconds))(_.switchOn) becomeOpen() - case c @ Changed(OpenedKey) if c.get(OpenedKey).enabled ⇒ + case c @ Changed(OpenedKey) if c.get(OpenedKey).enabled => becomeOpen() - case GetVotes ⇒ + case GetVotes => sender() ! Votes(Map.empty, open = false) } @@ -53,36 +53,36 @@ class VotingService extends Actor { } def open: Receive = { - case v @ Vote(participant) ⇒ + case v @ Vote(participant) => val update = Update(CountersKey, PNCounterMap(), WriteLocal, request = Some(v)) { _.increment(participant, 1) } replicator ! update - case _: UpdateSuccess[_] ⇒ + case _: UpdateSuccess[_] => - case Close ⇒ + case Close => replicator ! Update(ClosedKey, Flag(), WriteAll(5.seconds))(_.switchOn) context.become(getVotes(open = false)) - case c @ Changed(ClosedKey) if c.get(ClosedKey).enabled ⇒ + case c @ Changed(ClosedKey) if c.get(ClosedKey).enabled => context.become(getVotes(open = false)) } def getVotes(open: Boolean): Receive = { - case GetVotes ⇒ + case GetVotes => replicator ! Get(CountersKey, ReadAll(3.seconds), Some(GetVotesReq(sender()))) - case g @ GetSuccess(CountersKey, Some(GetVotesReq(replyTo))) ⇒ + case g @ GetSuccess(CountersKey, Some(GetVotesReq(replyTo))) => val data = g.get(CountersKey) replyTo ! Votes(data.entries, open) - case NotFound(CountersKey, Some(GetVotesReq(replyTo))) ⇒ + case NotFound(CountersKey, Some(GetVotesReq(replyTo))) => replyTo ! Votes(Map.empty, open) - case _: GetFailure[_] ⇒ + case _: GetFailure[_] => - case _: UpdateSuccess[_] ⇒ + case _: UpdateSuccess[_] => } } diff --git a/akka-samples/akka-sample-distributed-data-scala/src/multi-jvm/scala/sample/distributeddata/ServiceRegistrySpec.scala b/akka-samples/akka-sample-distributed-data-scala/src/multi-jvm/scala/sample/distributeddata/ServiceRegistrySpec.scala index 5be54aa3ad..8f216849bc 100644 --- a/akka-samples/akka-sample-distributed-data-scala/src/multi-jvm/scala/sample/distributeddata/ServiceRegistrySpec.scala +++ b/akka-samples/akka-sample-distributed-data-scala/src/multi-jvm/scala/sample/distributeddata/ServiceRegistrySpec.scala @@ -27,7 +27,7 @@ object ServiceRegistrySpec extends MultiNodeConfig { class Service extends Actor { def receive = { - case s: String ⇒ sender() ! self.path.name + ": " + s + case s: String => sender() ! self.path.name + ": " + s } } diff --git a/akka-samples/akka-sample-distributed-data-scala/src/multi-jvm/scala/sample/distributeddata/VotingServiceSpec.scala b/akka-samples/akka-sample-distributed-data-scala/src/multi-jvm/scala/sample/distributeddata/VotingServiceSpec.scala index 339982e460..693d10ad42 100644 --- a/akka-samples/akka-sample-distributed-data-scala/src/multi-jvm/scala/sample/distributeddata/VotingServiceSpec.scala +++ b/akka-samples/akka-sample-distributed-data-scala/src/multi-jvm/scala/sample/distributeddata/VotingServiceSpec.scala @@ -72,7 +72,7 @@ class VotingServiceSpec extends MultiNodeSpec(VotingServiceSpec) with STMultiNod val p = TestProbe() awaitAssert { votingService.tell(GetVotes, p.ref) - p.expectMsgPF(3.seconds) { case Votes(_, true) ⇒ true } + p.expectMsgPF(3.seconds) { case Votes(_, true) => true } } for (n ← 1 to N) { votingService ! Vote("#" + ((n % 20) + 1)) @@ -83,7 +83,7 @@ class VotingServiceSpec extends MultiNodeSpec(VotingServiceSpec) with STMultiNod votingService ! Close } - val expected = (1 to 20).map(n ⇒ "#" + n -> BigInt(3L * N / 20)).toMap + val expected = (1 to 20).map(n => "#" + n -> BigInt(3L * N / 20)).toMap awaitAssert { votingService ! GetVotes expectMsg(3.seconds, Votes(expected, false)) diff --git a/akka-slf4j/src/test/scala/akka/event/slf4j/Slf4jLoggerSpec.scala b/akka-slf4j/src/test/scala/akka/event/slf4j/Slf4jLoggerSpec.scala index 4e299e3b04..e10d1a919f 100644 --- a/akka-slf4j/src/test/scala/akka/event/slf4j/Slf4jLoggerSpec.scala +++ b/akka-slf4j/src/test/scala/akka/event/slf4j/Slf4jLoggerSpec.scala @@ -96,7 +96,7 @@ class Slf4jLoggerSpec extends AkkaSpec(Slf4jLoggerSpec.config) with BeforeAndAft } "put custom MDC values when specified" in { - producer ! StringWithMDC("Message with custom MDC values", Map("ticketNumber" -> 3671, "ticketDesc" -> "Custom MDC Values")) + producer ! StringWithMDC("Message with custom MDC values", Map("ticketNumber" → 3671, "ticketDesc" → "Custom MDC Values")) awaitCond(outputString.contains("----"), 5 seconds) val s = outputString @@ -109,7 +109,7 @@ class Slf4jLoggerSpec extends AkkaSpec(Slf4jLoggerSpec.config) with BeforeAndAft } "Support null values in custom MDC" in { - producer ! StringWithMDC("Message with null custom MDC values", Map("ticketNumber" -> 3671, "ticketDesc" -> null)) + producer ! StringWithMDC("Message with null custom MDC values", Map("ticketNumber" → 3671, "ticketDesc" → null)) awaitCond(outputString.contains("----"), 5 seconds) val s = outputString diff --git a/akka-stream-testkit/src/main/scala/akka/stream/testkit/TestGraphStage.scala b/akka-stream-testkit/src/main/scala/akka/stream/testkit/TestGraphStage.scala index e809752844..6db3b858e3 100644 --- a/akka-stream-testkit/src/main/scala/akka/stream/testkit/TestGraphStage.scala +++ b/akka-stream-testkit/src/main/scala/akka/stream/testkit/TestGraphStage.scala @@ -16,12 +16,14 @@ object GraphStageMessages { } object TestSinkStage { - def apply[T, M](stageUnderTest: GraphStageWithMaterializedValue[SinkShape[T], M], - probe: TestProbe) = new TestSinkStage(stageUnderTest, probe) + def apply[T, M]( + stageUnderTest: GraphStageWithMaterializedValue[SinkShape[T], M], + probe: TestProbe) = new TestSinkStage(stageUnderTest, probe) } -private[testkit] class TestSinkStage[T, M](stageUnderTest: GraphStageWithMaterializedValue[SinkShape[T], M], - probe: TestProbe) +private[testkit] class TestSinkStage[T, M]( + stageUnderTest: GraphStageWithMaterializedValue[SinkShape[T], M], + probe: TestProbe) extends GraphStageWithMaterializedValue[SinkShape[T], M] { val in = Inlet[T]("testSinkStage.in") @@ -51,12 +53,14 @@ private[testkit] class TestSinkStage[T, M](stageUnderTest: GraphStageWithMateria } object TestSourceStage { - def apply[T, M](stageUnderTest: GraphStageWithMaterializedValue[SourceShape[T], M], - probe: TestProbe) = Source.fromGraph(new TestSourceStage(stageUnderTest, probe)) + def apply[T, M]( + stageUnderTest: GraphStageWithMaterializedValue[SourceShape[T], M], + probe: TestProbe) = Source.fromGraph(new TestSourceStage(stageUnderTest, probe)) } -private[testkit] class TestSourceStage[T, M](stageUnderTest: GraphStageWithMaterializedValue[SourceShape[T], M], - probe: TestProbe) +private[testkit] class TestSourceStage[T, M]( + stageUnderTest: GraphStageWithMaterializedValue[SourceShape[T], M], + probe: TestProbe) extends GraphStageWithMaterializedValue[SourceShape[T], M] { val out = Outlet[T]("testSourceStage.out") diff --git a/akka-stream-testkit/src/test/scala/akka/stream/testkit/ChainSetup.scala b/akka-stream-testkit/src/test/scala/akka/stream/testkit/ChainSetup.scala index 17df41f66f..fdea503048 100644 --- a/akka-stream-testkit/src/test/scala/akka/stream/testkit/ChainSetup.scala +++ b/akka-stream-testkit/src/test/scala/akka/stream/testkit/ChainSetup.scala @@ -8,18 +8,19 @@ import org.reactivestreams.Publisher import akka.stream.ActorMaterializer class ChainSetup[In, Out, M]( - stream: Flow[In, In, NotUsed] ⇒ Flow[In, Out, M], + stream: Flow[In, In, NotUsed] ⇒ Flow[In, Out, M], val settings: ActorMaterializerSettings, materializer: ActorMaterializer, - toPublisher: (Source[Out, _], ActorMaterializer) ⇒ Publisher[Out])(implicit val system: ActorSystem) { + toPublisher: (Source[Out, _], ActorMaterializer) ⇒ Publisher[Out])(implicit val system: ActorSystem) { def this(stream: Flow[In, In, NotUsed] ⇒ Flow[In, Out, M], settings: ActorMaterializerSettings, toPublisher: (Source[Out, _], ActorMaterializer) ⇒ Publisher[Out])(implicit system: ActorSystem) = this(stream, settings, ActorMaterializer(settings)(system), toPublisher)(system) - def this(stream: Flow[In, In, NotUsed] ⇒ Flow[In, Out, M], - settings: ActorMaterializerSettings, - materializerCreator: (ActorMaterializerSettings, ActorRefFactory) ⇒ ActorMaterializer, - toPublisher: (Source[Out, _], ActorMaterializer) ⇒ Publisher[Out])(implicit system: ActorSystem) = + def this( + stream: Flow[In, In, NotUsed] ⇒ Flow[In, Out, M], + settings: ActorMaterializerSettings, + materializerCreator: (ActorMaterializerSettings, ActorRefFactory) ⇒ ActorMaterializer, + toPublisher: (Source[Out, _], ActorMaterializer) ⇒ Publisher[Out])(implicit system: ActorSystem) = this(stream, settings, materializerCreator(settings, system), toPublisher)(system) val upstream = TestPublisher.manualProbe[In]() diff --git a/akka-stream-testkit/src/test/scala/akka/stream/testkit/Coroner.scala b/akka-stream-testkit/src/test/scala/akka/stream/testkit/Coroner.scala index e86a967bd6..086ac50751 100644 --- a/akka-stream-testkit/src/test/scala/akka/stream/testkit/Coroner.scala +++ b/akka-stream-testkit/src/test/scala/akka/stream/testkit/Coroner.scala @@ -79,7 +79,7 @@ object Coroner { // FIXME: remove once going back to project dependencies */ def watch(duration: FiniteDuration, reportTitle: String, out: PrintStream, startAndStopDuration: FiniteDuration = defaultStartAndStopDuration, - displayThreadCounts: Boolean = false): WatchHandle = { + displayThreadCounts: Boolean = false): WatchHandle = { val watchedHandle = new WatchHandleImpl(startAndStopDuration) diff --git a/akka-stream-testkit/src/test/scala/akka/stream/testkit/ScriptedTest.scala b/akka-stream-testkit/src/test/scala/akka/stream/testkit/ScriptedTest.scala index 3ee5815319..db2b5fe5f2 100644 --- a/akka-stream-testkit/src/test/scala/akka/stream/testkit/ScriptedTest.scala +++ b/akka-stream-testkit/src/test/scala/akka/stream/testkit/ScriptedTest.scala @@ -40,13 +40,13 @@ trait ScriptedTest extends Matchers { } final class Script[In, Out]( - val providedInputs: Vector[In], + val providedInputs: Vector[In], val expectedOutputs: Vector[Out], - val jumps: Vector[Int], - val inputCursor: Int, - val outputCursor: Int, + val jumps: Vector[Int], + val inputCursor: Int, + val outputCursor: Int, val outputEndCursor: Int, - val completed: Boolean) { + val completed: Boolean) { require(jumps.size == providedInputs.size) def provideInput: (In, Script[In, Out]) = @@ -88,12 +88,12 @@ trait ScriptedTest extends Matchers { } class ScriptRunner[In, Out, M]( - op: Flow[In, In, NotUsed] ⇒ Flow[In, Out, M], - settings: ActorMaterializerSettings, - script: Script[In, Out], + op: Flow[In, In, NotUsed] ⇒ Flow[In, Out, M], + settings: ActorMaterializerSettings, + script: Script[In, Out], maximumOverrun: Int, maximumRequest: Int, - maximumBuffer: Int)(implicit _system: ActorSystem) + maximumBuffer: Int)(implicit _system: ActorSystem) extends ChainSetup(op, settings, toPublisher) { var _debugLog = Vector.empty[String] diff --git a/akka-stream-testkit/src/test/scala/akka/stream/testkit/StreamTestDefaultMailbox.scala b/akka-stream-testkit/src/test/scala/akka/stream/testkit/StreamTestDefaultMailbox.scala index 6799addf66..60aa742c4c 100644 --- a/akka-stream-testkit/src/test/scala/akka/stream/testkit/StreamTestDefaultMailbox.scala +++ b/akka-stream-testkit/src/test/scala/akka/stream/testkit/StreamTestDefaultMailbox.scala @@ -25,7 +25,8 @@ private[akka] final case class StreamTestDefaultMailbox() extends MailboxType wi val actorClass = r.underlying.props.actorClass assert(actorClass != classOf[Actor], s"Don't use anonymous actor classes, actor class for $r was [${actorClass.getName}]") // StreamTcpManager is allowed to use another dispatcher - assert(!actorClass.getName.startsWith("akka.stream."), + assert( + !actorClass.getName.startsWith("akka.stream."), s"$r with actor class [${actorClass.getName}] must not run on default dispatcher in tests. " + "Did you forget to define `props.withDispatcher` when creating the actor? " + "Or did you forget to configure the `akka.stream.materializer` setting accordingly or force the " + diff --git a/akka-stream-testkit/src/test/scala/akka/stream/testkit/Utils.scala b/akka-stream-testkit/src/test/scala/akka/stream/testkit/Utils.scala index 214e068876..4b6131d381 100644 --- a/akka-stream-testkit/src/test/scala/akka/stream/testkit/Utils.scala +++ b/akka-stream-testkit/src/test/scala/akka/stream/testkit/Utils.scala @@ -28,7 +28,8 @@ object Utils { try probe.awaitAssert { impl.supervisor.tell(StreamSupervisor.GetChildren, probe.ref) children = probe.expectMsgType[StreamSupervisor.Children].children - assert(children.isEmpty, + assert( + children.isEmpty, s"expected no StreamSupervisor children, but got [${children.mkString(", ")}]") } catch { diff --git a/akka-stream-tests/src/test/scala/akka/stream/DslConsistencySpec.scala b/akka-stream-tests/src/test/scala/akka/stream/DslConsistencySpec.scala index 6982788c0d..a4ee8188a0 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/DslConsistencySpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/DslConsistencySpec.scala @@ -41,15 +41,15 @@ class DslConsistencySpec extends WordSpec with Matchers { val graphHelpers = Set("zipGraph", "zipWithGraph", "mergeGraph", "mergeSortedGraph", "interleaveGraph", "concatGraph", "prependGraph", "alsoToGraph") val allowMissing: Map[Class[_], Set[String]] = Map( - jFlowClass -> graphHelpers, - jSourceClass -> graphHelpers, + jFlowClass → graphHelpers, + jSourceClass → graphHelpers, // Java subflows can only be nested using .via and .to (due to type system restrictions) - jSubFlowClass -> (graphHelpers ++ Set("groupBy", "splitAfter", "splitWhen", "subFlow")), - jSubSourceClass -> (graphHelpers ++ Set("groupBy", "splitAfter", "splitWhen", "subFlow")), - sFlowClass -> Set("of"), - sSourceClass -> Set("adapt", "from"), - sSinkClass -> Set("adapt"), - sRunnableGraphClass -> Set("builder")) + jSubFlowClass → (graphHelpers ++ Set("groupBy", "splitAfter", "splitWhen", "subFlow")), + jSubSourceClass → (graphHelpers ++ Set("groupBy", "splitAfter", "splitWhen", "subFlow")), + sFlowClass → Set("of"), + sSourceClass → Set("adapt", "from"), + sSinkClass → Set("adapt"), + sRunnableGraphClass → Set("builder")) def materializing(m: Method): Boolean = m.getParameterTypes.contains(classOf[ActorMaterializer]) @@ -61,12 +61,12 @@ class DslConsistencySpec extends WordSpec with Matchers { "Java and Scala DSLs" must { - ("Source" -> List[Class[_]](sSourceClass, jSourceClass)) :: - ("SubSource" -> List[Class[_]](sSubSourceClass, jSubSourceClass)) :: - ("Flow" -> List[Class[_]](sFlowClass, jFlowClass)) :: - ("SubFlow" -> List[Class[_]](sSubFlowClass, jSubFlowClass)) :: - ("Sink" -> List[Class[_]](sSinkClass, jSinkClass)) :: - ("RunanbleFlow" -> List[Class[_]](sRunnableGraphClass, jRunnableGraphClass)) :: + ("Source" → List[Class[_]](sSourceClass, jSourceClass)) :: + ("SubSource" → List[Class[_]](sSubSourceClass, jSubSourceClass)) :: + ("Flow" → List[Class[_]](sFlowClass, jFlowClass)) :: + ("SubFlow" → List[Class[_]](sSubFlowClass, jSubFlowClass)) :: + ("Sink" → List[Class[_]](sSinkClass, jSinkClass)) :: + ("RunanbleFlow" → List[Class[_]](sRunnableGraphClass, jRunnableGraphClass)) :: Nil foreach { case (element, classes) ⇒ diff --git a/akka-stream-tests/src/test/scala/akka/stream/DslFactoriesConsistencySpec.scala b/akka-stream-tests/src/test/scala/akka/stream/DslFactoriesConsistencySpec.scala index 0d274b6624..ae3265f85c 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/DslFactoriesConsistencySpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/DslFactoriesConsistencySpec.scala @@ -17,12 +17,12 @@ class DslFactoriesConsistencySpec extends WordSpec with Matchers { Set("adapt") // the scaladsl -> javadsl bridge val `scala -> java aliases` = - ("apply" -> "create") :: - ("apply" -> "of") :: - ("apply" -> "from") :: - ("apply" -> "fromGraph") :: - ("apply" -> "fromIterator") :: - ("apply" -> "fromFunctions") :: + ("apply" → "create") :: + ("apply" → "of") :: + ("apply" → "from") :: + ("apply" → "fromGraph") :: + ("apply" → "fromIterator") :: + ("apply" → "fromFunctions") :: Nil // format: OFF diff --git a/akka-stream-tests/src/test/scala/akka/stream/FusingSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/FusingSpec.scala index 7553abe07c..39fc26a45d 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/FusingSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/FusingSpec.scala @@ -21,7 +21,7 @@ class FusingSpec extends AkkaSpec { implicit val materializer = ActorMaterializer() def graph(async: Boolean) = - Source.unfold(1)(x ⇒ Some(x -> x)).filter(_ % 2 == 1) + Source.unfold(1)(x ⇒ Some(x → x)).filter(_ % 2 == 1) .alsoTo(Flow[Int].fold(0)(_ + _).to(Sink.head.named("otherSink")).addAttributes(if (async) Attributes.asyncBoundary else Attributes.none)) .via(Flow[Int].fold(1)(_ + _).named("mainSink")) diff --git a/akka-stream-tests/src/test/scala/akka/stream/actor/ActorPublisherSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/actor/ActorPublisherSpec.scala index d4a8f8d986..65ef8830f3 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/actor/ActorPublisherSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/actor/ActorPublisherSpec.scala @@ -369,21 +369,20 @@ class ActorPublisherSpec extends AkkaSpec(ActorPublisherSpec.config) with Implic val sink1 = Sink.fromSubscriber(ActorSubscriber[String](system.actorOf(receiverProps(probe1.ref)))) val sink2: Sink[String, ActorRef] = Sink.actorSubscriber(receiverProps(probe2.ref)) - val senderRef2 = RunnableGraph.fromGraph(GraphDSL.create(Source.actorPublisher[Int](senderProps)) { implicit b ⇒ - source2 ⇒ - import GraphDSL.Implicits._ + val senderRef2 = RunnableGraph.fromGraph(GraphDSL.create(Source.actorPublisher[Int](senderProps)) { implicit b ⇒ source2 ⇒ + import GraphDSL.Implicits._ - val merge = b.add(Merge[Int](2)) - val bcast = b.add(Broadcast[String](2)) + val merge = b.add(Merge[Int](2)) + val bcast = b.add(Broadcast[String](2)) - source1 ~> merge.in(0) - source2.out ~> merge.in(1) + source1 ~> merge.in(0) + source2.out ~> merge.in(1) - merge.out.map(_.toString) ~> bcast.in + merge.out.map(_.toString) ~> bcast.in - bcast.out(0).map(_ + "mark") ~> sink1 - bcast.out(1) ~> sink2 - ClosedShape + bcast.out(0).map(_ + "mark") ~> sink1 + bcast.out(1) ~> sink2 + ClosedShape }).run() (0 to 10).foreach { diff --git a/akka-stream-tests/src/test/scala/akka/stream/actor/ActorSubscriberSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/actor/ActorSubscriberSpec.scala index 2df319d326..76578d24bf 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/actor/ActorSubscriberSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/actor/ActorSubscriberSpec.scala @@ -85,7 +85,7 @@ object ActorSubscriberSpec { def receive = { case OnNext(Msg(id, replyTo)) ⇒ - queue += (id -> replyTo) + queue += (id → replyTo) assert(queue.size <= 10, s"queued too many: ${queue.size}") router.route(Work(id), self) case Reply(id) ⇒ diff --git a/akka-stream-tests/src/test/scala/akka/stream/extra/FlowTimedSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/extra/FlowTimedSpec.scala index e3d3d61041..51dbef0805 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/extra/FlowTimedSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/extra/FlowTimedSpec.scala @@ -37,7 +37,7 @@ class FlowTimedSpec extends AkkaSpec with ScriptedTest { val n = 20 val testRuns = 1 to 2 - def script = Script((1 to n) map { x ⇒ Seq(x) -> Seq(x) }: _*) + def script = Script((1 to n) map { x ⇒ Seq(x) → Seq(x) }: _*) testRuns foreach (_ ⇒ runScript(script, settings) { flow ⇒ flow. map(identity). @@ -59,7 +59,7 @@ class FlowTimedSpec extends AkkaSpec with ScriptedTest { val testRuns = 1 to 3 - def script = Script((1 to n) map { x ⇒ Seq(x) -> Seq(x) }: _*) + def script = Script((1 to n) map { x ⇒ Seq(x) → Seq(x) }: _*) testRuns foreach (_ ⇒ runScript(script, settings) { flow ⇒ flow.timed(_.map(identity), onComplete = printInfo) }) diff --git a/akka-stream-tests/src/test/scala/akka/stream/impl/StreamLayoutSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/impl/StreamLayoutSpec.scala index fc5f4bde0f..63b25ec15b 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/impl/StreamLayoutSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/impl/StreamLayoutSpec.scala @@ -243,8 +243,8 @@ class StreamLayoutSpec extends AkkaSpec { materializer.subscribers.size should be(materializer.publishers.size) - val inToSubscriber: Map[InPort, TestSubscriber] = materializer.subscribers.map(s ⇒ s.port -> s).toMap - val outToPublisher: Map[OutPort, TestPublisher] = materializer.publishers.map(s ⇒ s.port -> s).toMap + val inToSubscriber: Map[InPort, TestSubscriber] = materializer.subscribers.map(s ⇒ s.port → s).toMap + val outToPublisher: Map[OutPort, TestPublisher] = materializer.publishers.map(s ⇒ s.port → s).toMap for (publisher ← materializer.publishers) { publisher.owner.isAtomic should be(true) diff --git a/akka-stream-tests/src/test/scala/akka/stream/impl/fusing/ActorGraphInterpreterSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/impl/fusing/ActorGraphInterpreterSpec.scala index 55035b1b80..7a48799576 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/impl/fusing/ActorGraphInterpreterSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/impl/fusing/ActorGraphInterpreterSpec.scala @@ -220,17 +220,16 @@ class ActorGraphInterpreterSpec extends AkkaSpec { val takeAll = Flow[Int].grouped(200).toMat(Sink.head)(Keep.right) - val (f1, f2) = RunnableGraph.fromGraph(GraphDSL.create(takeAll, takeAll)(Keep.both) { implicit b ⇒ - (out1, out2) ⇒ - import GraphDSL.Implicits._ - val bidi = b.add(rotatedBidi) + val (f1, f2) = RunnableGraph.fromGraph(GraphDSL.create(takeAll, takeAll)(Keep.both) { implicit b ⇒ (out1, out2) ⇒ + import GraphDSL.Implicits._ + val bidi = b.add(rotatedBidi) - Source(1 to 10) ~> bidi.in1 - out2 <~ bidi.out2 + Source(1 to 10) ~> bidi.in1 + out2 <~ bidi.out2 - bidi.in2 <~ Source(1 to 100) - bidi.out1 ~> out1 - ClosedShape + bidi.in2 <~ Source(1 to 100) + bidi.out1 ~> out1 + ClosedShape }).run() Await.result(f1, 3.seconds) should ===(1 to 100) diff --git a/akka-stream-tests/src/test/scala/akka/stream/impl/fusing/GraphInterpreterSpecKit.scala b/akka-stream-tests/src/test/scala/akka/stream/impl/fusing/GraphInterpreterSpecKit.scala index 09118ebe4c..0cae67e5bc 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/impl/fusing/GraphInterpreterSpecKit.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/impl/fusing/GraphInterpreterSpecKit.scala @@ -39,17 +39,17 @@ trait GraphInterpreterSpecKit extends AkkaSpec { var connections = Vector.empty[(Outlet[_], Inlet[_])] def connect[T](upstream: UpstreamBoundaryStageLogic[T], in: Inlet[T]): AssemblyBuilder = { - upstreams :+= upstream -> in + upstreams :+= upstream → in this } def connect[T](out: Outlet[T], downstream: DownstreamBoundaryStageLogic[T]): AssemblyBuilder = { - downstreams :+= out -> downstream + downstreams :+= out → downstream this } def connect[T](out: Outlet[T], in: Inlet[T]): AssemblyBuilder = { - connections :+= out -> in + connections :+= out → in this } diff --git a/akka-stream-tests/src/test/scala/akka/stream/impl/fusing/LifecycleInterpreterSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/impl/fusing/LifecycleInterpreterSpec.scala index 8960456239..8fed034313 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/impl/fusing/LifecycleInterpreterSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/impl/fusing/LifecycleInterpreterSpec.scala @@ -143,10 +143,10 @@ class LifecycleInterpreterSpec extends AkkaSpec with GraphInterpreterSpecKit { } private[akka] case class PreStartAndPostStopIdentity[T]( - onStart: () ⇒ Unit = () ⇒ (), - onStop: () ⇒ Unit = () ⇒ (), - onUpstreamCompleted: () ⇒ Unit = () ⇒ (), - onUpstreamFailed: Throwable ⇒ Unit = ex ⇒ ()) extends SimpleLinearGraphStage[T] { + onStart: () ⇒ Unit = () ⇒ (), + onStop: () ⇒ Unit = () ⇒ (), + onUpstreamCompleted: () ⇒ Unit = () ⇒ (), + onUpstreamFailed: Throwable ⇒ Unit = ex ⇒ ()) extends SimpleLinearGraphStage[T] { override def createLogic(attributes: Attributes): GraphStageLogic = new GraphStageLogic(shape) with InHandler with OutHandler { diff --git a/akka-stream-tests/src/test/scala/akka/stream/io/TcpSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/io/TcpSpec.scala index 9e507ff8c2..16dd3c4350 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/io/TcpSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/io/TcpSpec.scala @@ -555,10 +555,11 @@ class TcpSpec extends AkkaSpec("akka.stream.materializer.subscription-timeout.ti } } - def validateServerClientCommunication(testData: ByteString, - serverConnection: ServerConnection, - readProbe: TcpReadProbe, - writeProbe: TcpWriteProbe): Unit = { + def validateServerClientCommunication( + testData: ByteString, + serverConnection: ServerConnection, + readProbe: TcpReadProbe, + writeProbe: TcpWriteProbe): Unit = { serverConnection.write(testData) serverConnection.read(5) readProbe.read(5) should be(testData) diff --git a/akka-stream-tests/src/test/scala/akka/stream/io/TlsSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/io/TlsSpec.scala index 1be60ea4ca..2aa6617849 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/io/TlsSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/io/TlsSpec.scala @@ -405,12 +405,11 @@ class TlsSpec extends AkkaSpec("akka.loglevel=INFO\nakka.actor.debug.receive=off "reliably cancel subscriptions when TransportIn fails early" in assertAllStagesStopped { val ex = new Exception("hello") val (sub, out1, out2) = - RunnableGraph.fromGraph(GraphDSL.create(Source.asSubscriber[SslTlsOutbound], Sink.head[ByteString], Sink.head[SslTlsInbound])((_, _, _)) { implicit b ⇒ - (s, o1, o2) ⇒ - val tls = b.add(clientTls(EagerClose)) - s ~> tls.in1; tls.out1 ~> o1 - o2 <~ tls.out2; tls.in2 <~ Source.failed(ex) - ClosedShape + RunnableGraph.fromGraph(GraphDSL.create(Source.asSubscriber[SslTlsOutbound], Sink.head[ByteString], Sink.head[SslTlsInbound])((_, _, _)) { implicit b ⇒ (s, o1, o2) ⇒ + val tls = b.add(clientTls(EagerClose)) + s ~> tls.in1; tls.out1 ~> o1 + o2 <~ tls.out2; tls.in2 <~ Source.failed(ex) + ClosedShape }).run() the[Exception] thrownBy Await.result(out1, 1.second) should be(ex) the[Exception] thrownBy Await.result(out2, 1.second) should be(ex) @@ -423,12 +422,11 @@ class TlsSpec extends AkkaSpec("akka.loglevel=INFO\nakka.actor.debug.receive=off "reliably cancel subscriptions when UserIn fails early" in assertAllStagesStopped { val ex = new Exception("hello") val (sub, out1, out2) = - RunnableGraph.fromGraph(GraphDSL.create(Source.asSubscriber[ByteString], Sink.head[ByteString], Sink.head[SslTlsInbound])((_, _, _)) { implicit b ⇒ - (s, o1, o2) ⇒ - val tls = b.add(clientTls(EagerClose)) - Source.failed[SslTlsOutbound](ex) ~> tls.in1; tls.out1 ~> o1 - o2 <~ tls.out2; tls.in2 <~ s - ClosedShape + RunnableGraph.fromGraph(GraphDSL.create(Source.asSubscriber[ByteString], Sink.head[ByteString], Sink.head[SslTlsInbound])((_, _, _)) { implicit b ⇒ (s, o1, o2) ⇒ + val tls = b.add(clientTls(EagerClose)) + Source.failed[SslTlsOutbound](ex) ~> tls.in1; tls.out1 ~> o1 + o2 <~ tls.out2; tls.in2 <~ s + ClosedShape }).run() the[Exception] thrownBy Await.result(out1, 1.second) should be(ex) the[Exception] thrownBy Await.result(out2, 1.second) should be(ex) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/ActorRefBackpressureSinkSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/ActorRefBackpressureSinkSpec.scala index 2f52804bc1..eb94cc6f2d 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/ActorRefBackpressureSinkSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/ActorRefBackpressureSinkSpec.scala @@ -59,7 +59,8 @@ class ActorRefBackpressureSinkSpec extends AkkaSpec { "send the elements to the ActorRef" in assertAllStagesStopped { val fw = createActor(classOf[Fw]) - Source(List(1, 2, 3)).runWith(Sink.actorRefWithAck(fw, + Source(List(1, 2, 3)).runWith(Sink.actorRefWithAck( + fw, initMessage, ackMessage, completeMessage)) expectMsg("start") expectMsg(1) @@ -70,7 +71,8 @@ class ActorRefBackpressureSinkSpec extends AkkaSpec { "send the elements to the ActorRef2" in assertAllStagesStopped { val fw = createActor(classOf[Fw]) - val probe = TestSource.probe[Int].to(Sink.actorRefWithAck(fw, + val probe = TestSource.probe[Int].to(Sink.actorRefWithAck( + fw, initMessage, ackMessage, completeMessage)).run() probe.sendNext(1) expectMsg("start") @@ -85,7 +87,8 @@ class ActorRefBackpressureSinkSpec extends AkkaSpec { "cancel stream when actor terminates" in assertAllStagesStopped { val fw = createActor(classOf[Fw]) - val publisher = TestSource.probe[Int].to(Sink.actorRefWithAck(fw, + val publisher = TestSource.probe[Int].to(Sink.actorRefWithAck( + fw, initMessage, ackMessage, completeMessage)).run().sendNext(1) expectMsg(initMessage) expectMsg(1) @@ -95,7 +98,8 @@ class ActorRefBackpressureSinkSpec extends AkkaSpec { "send message only when backpressure received" in assertAllStagesStopped { val fw = createActor(classOf[Fw2]) - val publisher = TestSource.probe[Int].to(Sink.actorRefWithAck(fw, + val publisher = TestSource.probe[Int].to(Sink.actorRefWithAck( + fw, initMessage, ackMessage, completeMessage)).run() expectMsg(initMessage) @@ -138,7 +142,8 @@ class ActorRefBackpressureSinkSpec extends AkkaSpec { "work with one element buffer" in assertAllStagesStopped { val fw = createActor(classOf[Fw2]) val publisher = - TestSource.probe[Int].to(Sink.actorRefWithAck(fw, + TestSource.probe[Int].to(Sink.actorRefWithAck( + fw, initMessage, ackMessage, completeMessage) .withAttributes(inputBuffer(1, 1))).run() diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/BidiFlowSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/BidiFlowSpec.scala index 8caecb9065..85b8ff4212 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/BidiFlowSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/BidiFlowSpec.scala @@ -27,13 +27,12 @@ class BidiFlowSpec extends AkkaSpec { Flow[Long].map(x ⇒ x.toInt + 2).withAttributes(name("top")), Flow[String].map(ByteString(_)).withAttributes(name("bottom"))) - val bidiMat = BidiFlow.fromGraph(GraphDSL.create(Sink.head[Int]) { implicit b ⇒ - s ⇒ - Source.single(42) ~> s + val bidiMat = BidiFlow.fromGraph(GraphDSL.create(Sink.head[Int]) { implicit b ⇒ s ⇒ + Source.single(42) ~> s - val top = b.add(Flow[Int].map(x ⇒ x.toLong + 2)) - val bottom = b.add(Flow[ByteString].map(_.decodeString("UTF-8"))) - BidiShape(top.in, top.out, bottom.in, bottom.out) + val top = b.add(Flow[Int].map(x ⇒ x.toLong + 2)) + val bottom = b.add(Flow[ByteString].map(_.decodeString("UTF-8"))) + BidiShape(top.in, top.out, bottom.in, bottom.out) }) val str = "Hello World" @@ -42,13 +41,12 @@ class BidiFlowSpec extends AkkaSpec { "A BidiFlow" must { "work top/bottom in isolation" in { - val (top, bottom) = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Long], Sink.head[String])(Keep.both) { implicit b ⇒ - (st, sb) ⇒ - val s = b.add(bidi) + val (top, bottom) = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Long], Sink.head[String])(Keep.both) { implicit b ⇒ (st, sb) ⇒ + val s = b.add(bidi) - Source.single(1) ~> s.in1; s.out1 ~> st - sb <~ s.out2; s.in2 <~ Source.single(bytes) - ClosedShape + Source.single(1) ~> s.in1; s.out1 ~> st + sb <~ s.out2; s.in2 <~ Source.single(bytes) + ClosedShape }).run() Await.result(top, 1.second) should ===(3) @@ -81,30 +79,27 @@ class BidiFlowSpec extends AkkaSpec { } "materialize to its value" in { - val f = RunnableGraph.fromGraph(GraphDSL.create(bidiMat) { implicit b ⇒ - bidi ⇒ - Flow[String].map(Integer.valueOf(_).toInt) <~> bidi <~> Flow[Long].map(x ⇒ ByteString(s"Hello $x")) - ClosedShape + val f = RunnableGraph.fromGraph(GraphDSL.create(bidiMat) { implicit b ⇒ bidi ⇒ + Flow[String].map(Integer.valueOf(_).toInt) <~> bidi <~> Flow[Long].map(x ⇒ ByteString(s"Hello $x")) + ClosedShape }).run() Await.result(f, 1.second) should ===(42) } "combine materialization values" in assertAllStagesStopped { - val left = Flow.fromGraph(GraphDSL.create(Sink.head[Int]) { implicit b ⇒ - sink ⇒ - val bcast = b.add(Broadcast[Int](2)) - val merge = b.add(Merge[Int](2)) - val flow = b.add(Flow[String].map(Integer.valueOf(_).toInt)) - bcast ~> sink - Source.single(1) ~> bcast ~> merge - flow ~> merge - FlowShape(flow.in, merge.out) + val left = Flow.fromGraph(GraphDSL.create(Sink.head[Int]) { implicit b ⇒ sink ⇒ + val bcast = b.add(Broadcast[Int](2)) + val merge = b.add(Merge[Int](2)) + val flow = b.add(Flow[String].map(Integer.valueOf(_).toInt)) + bcast ~> sink + Source.single(1) ~> bcast ~> merge + flow ~> merge + FlowShape(flow.in, merge.out) }) - val right = Flow.fromGraph(GraphDSL.create(Sink.head[immutable.Seq[Long]]) { implicit b ⇒ - sink ⇒ - val flow = b.add(Flow[Long].grouped(10)) - flow ~> sink - FlowShape(flow.in, b.add(Source.single(ByteString("10"))).out) + val right = Flow.fromGraph(GraphDSL.create(Sink.head[immutable.Seq[Long]]) { implicit b ⇒ sink ⇒ + val flow = b.add(Flow[Long].grouped(10)) + flow ~> sink + FlowShape(flow.in, b.add(Source.single(ByteString("10"))).out) }) val ((l, m), r) = left.joinMat(bidiMat)(Keep.both).joinMat(right)(Keep.both).run() Await.result(l, 1.second) should ===(1) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowCollectSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowCollectSpec.scala index 717d23391d..f617e6f491 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowCollectSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowCollectSpec.scala @@ -27,7 +27,7 @@ class FlowCollectSpec extends AkkaSpec with ScriptedTest { "collect" in { def script = Script(TestConfig.RandomTestRange map { _ ⇒ val x = random.nextInt(0, 10000) - Seq(x) -> (if ((x & 1) == 0) Seq((x * x).toString) else Seq.empty[String]) + Seq(x) → (if ((x & 1) == 0) Seq((x * x).toString) else Seq.empty[String]) }: _*) TestConfig.RandomTestRange foreach (_ ⇒ runScript(script, settings)(_.collect { case x if x % 2 == 0 ⇒ (x * x).toString })) } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowDropSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowDropSpec.scala index f75317638b..edbe147696 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowDropSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowDropSpec.scala @@ -19,7 +19,7 @@ class FlowDropSpec extends AkkaSpec with ScriptedTest { "A Drop" must { "drop" in { - def script(d: Int) = Script(TestConfig.RandomTestRange map { n ⇒ Seq(n) -> (if (n <= d) Nil else Seq(n)) }: _*) + def script(d: Int) = Script(TestConfig.RandomTestRange map { n ⇒ Seq(n) → (if (n <= d) Nil else Seq(n)) }: _*) TestConfig.RandomTestRange foreach { _ ⇒ val d = Math.min(Math.max(random.nextInt(-10, 60), 0), 50) runScript(script(d), settings)(_.drop(d)) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowExpandSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowExpandSpec.scala index 10afb841fa..b35a89a758 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowExpandSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowExpandSpec.scala @@ -130,20 +130,20 @@ class FlowExpandSpec extends AkkaSpec { "work properly with finite extrapolations" in { val (source, sink) = TestSource.probe[Int] - .expand(i ⇒ Iterator.from(0).map(i -> _).take(3)) + .expand(i ⇒ Iterator.from(0).map(i → _).take(3)) .toMat(TestSink.probe)(Keep.both) .run() source .sendNext(1) sink .request(4) - .expectNext(1 -> 0, 1 -> 1, 1 -> 2) + .expectNext(1 → 0, 1 → 1, 1 → 2) .expectNoMsg(100.millis) source .sendNext(2) .sendComplete() sink - .expectNext(2 -> 0) + .expectNext(2 → 0) .expectComplete() } } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowFilterSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowFilterSpec.scala index 486ed1b6b4..cc089c0e30 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowFilterSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowFilterSpec.scala @@ -26,7 +26,7 @@ class FlowFilterSpec extends AkkaSpec with ScriptedTest { "A Filter" must { "filter" in { - def script = Script(TestConfig.RandomTestRange map { _ ⇒ val x = random.nextInt(); Seq(x) -> (if ((x & 1) == 0) Seq(x) else Seq()) }: _*) + def script = Script(TestConfig.RandomTestRange map { _ ⇒ val x = random.nextInt(); Seq(x) → (if ((x & 1) == 0) Seq(x) else Seq()) }: _*) TestConfig.RandomTestRange foreach (_ ⇒ runScript(script, settings)(_.filter(_ % 2 == 0))) } @@ -66,7 +66,7 @@ class FlowFilterSpec extends AkkaSpec with ScriptedTest { def script = Script(TestConfig.RandomTestRange map { _ ⇒ val x = random.nextInt() - Seq(x) -> (if ((x & 1) == 1) Seq(x) else Seq()) + Seq(x) → (if ((x & 1) == 1) Seq(x) else Seq()) }: _*) TestConfig.RandomTestRange foreach (_ ⇒ runScript(script, settings)(_.filterNot(_ % 2 == 0))) } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowGroupBySpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowGroupBySpec.scala index 7e0885e5c8..7cc2d17cde 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowGroupBySpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowGroupBySpec.scala @@ -31,7 +31,7 @@ import scala.concurrent.forkjoin.ThreadLocalRandom object FlowGroupBySpec { implicit class Lift[M](val f: SubFlow[Int, M, Source[Int, M]#Repr, RunnableGraph[M]]) extends AnyVal { - def lift(key: Int ⇒ Int) = f.prefixAndTail(1).map(p ⇒ key(p._1.head) -> (Source.single(p._1.head) ++ p._2)).concatSubstreams + def lift(key: Int ⇒ Int) = f.prefixAndTail(1).map(p ⇒ key(p._1.head) → (Source.single(p._1.head) ++ p._2)).concatSubstreams } } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowGroupedSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowGroupedSpec.scala index fa026efba4..5407af1732 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowGroupedSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowGroupedSpec.scala @@ -18,7 +18,7 @@ class FlowGroupedSpec extends AkkaSpec with ScriptedTest { "A Grouped" must { def randomSeq(n: Int) = immutable.Seq.fill(n)(random.nextInt()) - def randomTest(n: Int) = { val s = randomSeq(n); s -> immutable.Seq(s) } + def randomTest(n: Int) = { val s = randomSeq(n); s → immutable.Seq(s) } "group evenly" in { val testLen = random.nextInt(1, 16) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowGroupedWithinSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowGroupedWithinSpec.scala index b77757fd72..6755377f67 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowGroupedWithinSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowGroupedWithinSpec.scala @@ -126,13 +126,13 @@ class FlowGroupedWithinSpec extends AkkaSpec with ScriptedTest { } "group evenly" in { - def script = Script(TestConfig.RandomTestRange map { _ ⇒ val x, y, z = random.nextInt(); Seq(x, y, z) -> Seq(immutable.Seq(x, y, z)) }: _*) + def script = Script(TestConfig.RandomTestRange map { _ ⇒ val x, y, z = random.nextInt(); Seq(x, y, z) → Seq(immutable.Seq(x, y, z)) }: _*) TestConfig.RandomTestRange foreach (_ ⇒ runScript(script, settings)(_.groupedWithin(3, 10.minutes))) } "group with rest" in { - def script = Script((TestConfig.RandomTestRange.map { _ ⇒ val x, y, z = random.nextInt(); Seq(x, y, z) -> Seq(immutable.Seq(x, y, z)) } - :+ { val x = random.nextInt(); Seq(x) -> Seq(immutable.Seq(x)) }): _*) + def script = Script((TestConfig.RandomTestRange.map { _ ⇒ val x, y, z = random.nextInt(); Seq(x, y, z) → Seq(immutable.Seq(x, y, z)) } + :+ { val x = random.nextInt(); Seq(x) → Seq(immutable.Seq(x)) }): _*) TestConfig.RandomTestRange foreach (_ ⇒ runScript(script, settings)(_.groupedWithin(3, 10.minutes))) } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowJoinSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowJoinSpec.scala index 27f0519f5f..6c98f623b1 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowJoinSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowJoinSpec.scala @@ -60,16 +60,15 @@ class FlowJoinSpec extends AkkaSpec(ConfigFactory.parseString("akka.loglevel=INF "allow for merge cycle" in assertAllStagesStopped { val source = Source.single("lonely traveler") - val flow1 = Flow.fromGraph(GraphDSL.create(Sink.head[String]) { implicit b ⇒ - sink ⇒ - import GraphDSL.Implicits._ - val merge = b.add(Merge[String](2)) - val broadcast = b.add(Broadcast[String](2, eagerCancel = true)) - source ~> merge.in(0) - merge.out ~> broadcast.in - broadcast.out(0) ~> sink + val flow1 = Flow.fromGraph(GraphDSL.create(Sink.head[String]) { implicit b ⇒ sink ⇒ + import GraphDSL.Implicits._ + val merge = b.add(Merge[String](2)) + val broadcast = b.add(Broadcast[String](2, eagerCancel = true)) + source ~> merge.in(0) + merge.out ~> broadcast.in + broadcast.out(0) ~> sink - FlowShape(merge.in(1), broadcast.out(1)) + FlowShape(merge.in(1), broadcast.out(1)) }) whenReady(flow1.join(Flow[String]).run())(_ shouldBe "lonely traveler") @@ -78,16 +77,15 @@ class FlowJoinSpec extends AkkaSpec(ConfigFactory.parseString("akka.loglevel=INF "allow for merge preferred cycle" in assertAllStagesStopped { val source = Source.single("lonely traveler") - val flow1 = Flow.fromGraph(GraphDSL.create(Sink.head[String]) { implicit b ⇒ - sink ⇒ - import GraphDSL.Implicits._ - val merge = b.add(MergePreferred[String](1)) - val broadcast = b.add(Broadcast[String](2, eagerCancel = true)) - source ~> merge.preferred - merge.out ~> broadcast.in - broadcast.out(0) ~> sink + val flow1 = Flow.fromGraph(GraphDSL.create(Sink.head[String]) { implicit b ⇒ sink ⇒ + import GraphDSL.Implicits._ + val merge = b.add(MergePreferred[String](1)) + val broadcast = b.add(Broadcast[String](2, eagerCancel = true)) + source ~> merge.preferred + merge.out ~> broadcast.in + broadcast.out(0) ~> sink - FlowShape(merge.in(0), broadcast.out(1)) + FlowShape(merge.in(0), broadcast.out(1)) }) whenReady(flow1.join(Flow[String]).run())(_ shouldBe "lonely traveler") @@ -96,28 +94,26 @@ class FlowJoinSpec extends AkkaSpec(ConfigFactory.parseString("akka.loglevel=INF "allow for zip cycle" in assertAllStagesStopped { val source = Source(immutable.Seq("traveler1", "traveler2")) - val flow = Flow.fromGraph(GraphDSL.create(TestSink.probe[(String, String)]) { implicit b ⇒ - sink ⇒ - import GraphDSL.Implicits._ - val zip = b.add(Zip[String, String]) - val broadcast = b.add(Broadcast[(String, String)](2)) - source ~> zip.in0 - zip.out ~> broadcast.in - broadcast.out(0) ~> sink + val flow = Flow.fromGraph(GraphDSL.create(TestSink.probe[(String, String)]) { implicit b ⇒ sink ⇒ + import GraphDSL.Implicits._ + val zip = b.add(Zip[String, String]) + val broadcast = b.add(Broadcast[(String, String)](2)) + source ~> zip.in0 + zip.out ~> broadcast.in + broadcast.out(0) ~> sink - FlowShape(zip.in1, broadcast.out(1)) + FlowShape(zip.in1, broadcast.out(1)) }) - val feedback = Flow.fromGraph(GraphDSL.create(Source.single("ignition")) { implicit b ⇒ - ignition ⇒ - import GraphDSL.Implicits._ - val flow = b.add(Flow[(String, String)].map(_._1)) - val merge = b.add(Merge[String](2)) + val feedback = Flow.fromGraph(GraphDSL.create(Source.single("ignition")) { implicit b ⇒ ignition ⇒ + import GraphDSL.Implicits._ + val flow = b.add(Flow[(String, String)].map(_._1)) + val merge = b.add(Merge[String](2)) - ignition ~> merge.in(0) - flow ~> merge.in(1) + ignition ~> merge.in(0) + flow ~> merge.in(1) - FlowShape(flow.in, merge.out) + FlowShape(flow.in, merge.out) }) val probe = flow.join(feedback).run() @@ -126,16 +122,15 @@ class FlowJoinSpec extends AkkaSpec(ConfigFactory.parseString("akka.loglevel=INF } "allow for concat cycle" in assertAllStagesStopped { - val flow = Flow.fromGraph(GraphDSL.create(TestSource.probe[String](system), Sink.head[String])(Keep.both) { implicit b ⇒ - (source, sink) ⇒ - import GraphDSL.Implicits._ - val concat = b.add(Concat[String](2)) - val broadcast = b.add(Broadcast[String](2, eagerCancel = true)) - source ~> concat.in(0) - concat.out ~> broadcast.in - broadcast.out(0) ~> sink + val flow = Flow.fromGraph(GraphDSL.create(TestSource.probe[String](system), Sink.head[String])(Keep.both) { implicit b ⇒ (source, sink) ⇒ + import GraphDSL.Implicits._ + val concat = b.add(Concat[String](2)) + val broadcast = b.add(Broadcast[String](2, eagerCancel = true)) + source ~> concat.in(0) + concat.out ~> broadcast.in + broadcast.out(0) ~> sink - FlowShape(concat.in(1), broadcast.out(1)) + FlowShape(concat.in(1), broadcast.out(1)) }) val (probe, result) = flow.join(Flow[String]).run() @@ -149,16 +144,15 @@ class FlowJoinSpec extends AkkaSpec(ConfigFactory.parseString("akka.loglevel=INF "allow for interleave cycle" in assertAllStagesStopped { val source = Source.single("lonely traveler") - val flow1 = Flow.fromGraph(GraphDSL.create(Sink.head[String]) { implicit b ⇒ - sink ⇒ - import GraphDSL.Implicits._ - val merge = b.add(Interleave[String](2, 1)) - val broadcast = b.add(Broadcast[String](2, eagerCancel = true)) - source ~> merge.in(0) - merge.out ~> broadcast.in - broadcast.out(0) ~> sink + val flow1 = Flow.fromGraph(GraphDSL.create(Sink.head[String]) { implicit b ⇒ sink ⇒ + import GraphDSL.Implicits._ + val merge = b.add(Interleave[String](2, 1)) + val broadcast = b.add(Broadcast[String](2, eagerCancel = true)) + source ~> merge.in(0) + merge.out ~> broadcast.in + broadcast.out(0) ~> sink - FlowShape(merge.in(1), broadcast.out(1)) + FlowShape(merge.in(1), broadcast.out(1)) }) whenReady(flow1.join(Flow[String]).run())(_ shouldBe "lonely traveler") diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowKillSwitchSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowKillSwitchSpec.scala index f32ac774e1..8d00c85623 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowKillSwitchSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowKillSwitchSpec.scala @@ -272,15 +272,14 @@ class FlowKillSwitchSpec extends AkkaSpec { val switch1 = KillSwitches.shared("switch") val switch2 = KillSwitches.shared("switch") - val downstream = RunnableGraph.fromGraph(GraphDSL.create(TestSink.probe[Int]) { implicit b ⇒ - snk ⇒ - import GraphDSL.Implicits._ - val merge = b.add(Merge[Int](2)) + val downstream = RunnableGraph.fromGraph(GraphDSL.create(TestSink.probe[Int]) { implicit b ⇒ snk ⇒ + import GraphDSL.Implicits._ + val merge = b.add(Merge[Int](2)) - Source.maybe[Int].via(switch1.flow) ~> merge ~> snk - Source.maybe[Int].via(switch2.flow) ~> merge + Source.maybe[Int].via(switch1.flow) ~> merge ~> snk + Source.maybe[Int].via(switch2.flow) ~> merge - ClosedShape + ClosedShape }).run() downstream.ensureSubscription() diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapAsyncSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapAsyncSpec.scala index 37b77b3f48..40a5fdd911 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapAsyncSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapAsyncSpec.scala @@ -237,7 +237,7 @@ class FlowMapAsyncSpec extends AkkaSpec { if (counter.incrementAndGet() > parallelism) Future.failed(new Exception("parallelism exceeded")) else { val p = Promise[Int] - queue.offer(p -> System.nanoTime()) + queue.offer(p → System.nanoTime()) p.future } } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapAsyncUnorderedSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapAsyncUnorderedSpec.scala index f772acdd96..ef741d59bd 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapAsyncUnorderedSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapAsyncUnorderedSpec.scala @@ -33,7 +33,7 @@ class FlowMapAsyncUnorderedSpec extends AkkaSpec { "produce future elements in the order they are ready" in assertAllStagesStopped { val c = TestSubscriber.manualProbe[Int]() implicit val ec = system.dispatcher - val latch = (1 to 4).map(_ -> TestLatch(1)).toMap + val latch = (1 to 4).map(_ → TestLatch(1)).toMap val p = Source(1 to 4).mapAsyncUnordered(4)(n ⇒ Future { Await.ready(latch(n), 5.seconds) n @@ -229,7 +229,7 @@ class FlowMapAsyncUnorderedSpec extends AkkaSpec { if (counter.incrementAndGet() > parallelism) Future.failed(new Exception("parallelism exceeded")) else { val p = Promise[Int] - queue.offer(p -> System.nanoTime()) + queue.offer(p → System.nanoTime()) p.future } } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapConcatSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapConcatSpec.scala index d3eb54fb0c..5a7523a0c2 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapConcatSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapConcatSpec.scala @@ -20,12 +20,12 @@ class FlowMapConcatSpec extends AkkaSpec with ScriptedTest { "map and concat" in { val script = Script( - Seq(0) -> Seq(), - Seq(1) -> Seq(1), - Seq(2) -> Seq(2, 2), - Seq(3) -> Seq(3, 3, 3), - Seq(2) -> Seq(2, 2), - Seq(1) -> Seq(1)) + Seq(0) → Seq(), + Seq(1) → Seq(1), + Seq(2) → Seq(2, 2), + Seq(3) → Seq(3, 3, 3), + Seq(2) → Seq(2, 2), + Seq(1) → Seq(1)) TestConfig.RandomTestRange foreach (_ ⇒ runScript(script, settings)(_.mapConcat(x ⇒ (1 to x) map (_ ⇒ x)))) } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapSpec.scala index 3a585f2686..d5be156182 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowMapSpec.scala @@ -19,7 +19,7 @@ class FlowMapSpec extends AkkaSpec with ScriptedTest { "A Map" must { "map" in { - def script = Script(TestConfig.RandomTestRange map { _ ⇒ val x = random.nextInt(); Seq(x) -> Seq(x.toString) }: _*) + def script = Script(TestConfig.RandomTestRange map { _ ⇒ val x = random.nextInt(); Seq(x) → Seq(x.toString) }: _*) TestConfig.RandomTestRange foreach (_ ⇒ runScript(script, settings)(_.map(_.toString))) } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowSpec.scala index c1803aebe8..8e139ba23c 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowSpec.scala @@ -96,7 +96,7 @@ class FlowSpec extends AkkaSpec(ConfigFactory.parseString("akka.actor.debug.rece "A Flow" must { - for ((name, op) ← List("identity" -> identity, "identity2" -> identity2); n ← List(1, 2, 4)) { + for ((name, op) ← List("identity" → identity, "identity2" → identity2); n ← List(1, 2, 4)) { s"request initial elements from upstream ($name, $n)" in { new ChainSetup(op, settings.withInputBuffer(initialSize = n, maxSize = n), toPublisher) { upstream.expectRequest(upstreamSubscription, settings.maxInputBufferSize) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowSplitAfterSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowSplitAfterSpec.scala index 854942bc31..94b3d34331 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowSplitAfterSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowSplitAfterSpec.scala @@ -47,8 +47,8 @@ class FlowSplitAfterSpec extends AkkaSpec { } class SubstreamsSupport( - splitAfter: Int = 3, - elementCount: Int = 6, + splitAfter: Int = 3, + elementCount: Int = 6, substreamCancelStrategy: SubstreamCancelStrategy = SubstreamCancelStrategy.drain) { val source = Source(1 to elementCount) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowSplitWhenSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowSplitWhenSpec.scala index 92f63ee570..c1aa286526 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowSplitWhenSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowSplitWhenSpec.scala @@ -37,8 +37,8 @@ class FlowSplitWhenSpec extends AkkaSpec { } class SubstreamsSupport( - splitWhen: Int = 3, - elementCount: Int = 6, + splitWhen: Int = 3, + elementCount: Int = 6, substreamCancelStrategy: SubstreamCancelStrategy = SubstreamCancelStrategy.drain) { val source = Source(1 to elementCount) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowStatefulMapConcatSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowStatefulMapConcatSpec.scala index 922f6f9db7..76d24bf192 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowStatefulMapConcatSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowStatefulMapConcatSpec.scala @@ -20,10 +20,10 @@ class FlowStatefulMapConcatSpec extends AkkaSpec with ScriptedTest { "work in happy case" in { val script = Script( - Seq(2) -> Seq(), - Seq(1) -> Seq(1, 1), - Seq(3) -> Seq(3), - Seq(6) -> Seq(6, 6, 6)) + Seq(2) → Seq(), + Seq(1) → Seq(1, 1), + Seq(3) → Seq(3), + Seq(6) → Seq(6, 6, 6)) TestConfig.RandomTestRange foreach (_ ⇒ runScript(script, settings)(_.statefulMapConcat(() ⇒ { var prev: Option[Int] = None x ⇒ prev match { diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowTakeSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowTakeSpec.scala index 133ef846e2..380c291e2f 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowTakeSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/FlowTakeSpec.scala @@ -26,7 +26,7 @@ class FlowTakeSpec extends AkkaSpec with ScriptedTest { "A Take" must { "take" in { - def script(d: Int) = Script(TestConfig.RandomTestRange map { n ⇒ Seq(n) -> (if (n > d) Nil else Seq(n)) }: _*) + def script(d: Int) = Script(TestConfig.RandomTestRange map { n ⇒ Seq(n) → (if (n > d) Nil else Seq(n)) }: _*) TestConfig.RandomTestRange foreach { _ ⇒ val d = Math.min(Math.max(random.nextInt(-10, 60), 0), 50) runScript(script(d), settings)(_.take(d)) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphBackedFlowSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphBackedFlowSpec.scala index ee3e41a9a0..67bb7f1f1f 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphBackedFlowSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphBackedFlowSpec.scala @@ -63,10 +63,9 @@ class GraphFlowSpec extends AkkaSpec { "work with a Source and Sink" in { val probe = TestSubscriber.manualProbe[Int]() - val flow = Flow.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ - partial ⇒ - import GraphDSL.Implicits._ - FlowShape(partial.in, partial.out.map(_.toInt).outlet) + val flow = Flow.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ partial ⇒ + import GraphDSL.Implicits._ + FlowShape(partial.in, partial.out.map(_.toInt).outlet) }) source1.via(flow).to(Sink.fromSubscriber(probe)).run() @@ -77,8 +76,7 @@ class GraphFlowSpec extends AkkaSpec { "be transformable with a Pipe" in { val probe = TestSubscriber.manualProbe[Int]() - val flow = Flow.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ - partial ⇒ FlowShape(partial.in, partial.out) + val flow = Flow.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ partial ⇒ FlowShape(partial.in, partial.out) }) source1.via(flow).map(_.toInt).to(Sink.fromSubscriber(probe)).run() @@ -89,14 +87,12 @@ class GraphFlowSpec extends AkkaSpec { "work with another GraphFlow" in { val probe = TestSubscriber.manualProbe[Int]() - val flow1 = Flow.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ - partial ⇒ - FlowShape(partial.in, partial.out) + val flow1 = Flow.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ partial ⇒ + FlowShape(partial.in, partial.out) }) - val flow2 = Flow.fromGraph(GraphDSL.create(Flow[String].map(_.toInt)) { implicit b ⇒ - importFlow ⇒ - FlowShape(importFlow.in, importFlow.out) + val flow2 = Flow.fromGraph(GraphDSL.create(Flow[String].map(_.toInt)) { implicit b ⇒ importFlow ⇒ + FlowShape(importFlow.in, importFlow.out) }) source1.via(flow1).via(flow2).to(Sink.fromSubscriber(probe)).run() @@ -107,8 +103,7 @@ class GraphFlowSpec extends AkkaSpec { "be reusable multiple times" in { val probe = TestSubscriber.manualProbe[Int]() - val flow = Flow.fromGraph(GraphDSL.create(Flow[Int].map(_ * 2)) { implicit b ⇒ - importFlow ⇒ FlowShape(importFlow.in, importFlow.out) + val flow = Flow.fromGraph(GraphDSL.create(Flow[Int].map(_ * 2)) { implicit b ⇒ importFlow ⇒ FlowShape(importFlow.in, importFlow.out) }) RunnableGraph.fromGraph(GraphDSL.create() { implicit b ⇒ @@ -125,11 +120,10 @@ class GraphFlowSpec extends AkkaSpec { "work with a Sink" in { val probe = TestSubscriber.manualProbe[Int]() - val source = Source.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ - partial ⇒ - import GraphDSL.Implicits._ - source1 ~> partial.in - SourceShape(partial.out.map(_.toInt).outlet) + val source = Source.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ partial ⇒ + import GraphDSL.Implicits._ + source1 ~> partial.in + SourceShape(partial.out.map(_.toInt).outlet) }) source.to(Sink.fromSubscriber(probe)).run() @@ -150,11 +144,10 @@ class GraphFlowSpec extends AkkaSpec { val probe = TestSubscriber.manualProbe[Int]() - val source = Source.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ - partial ⇒ - import GraphDSL.Implicits._ - source1 ~> partial.in - SourceShape(partial.out) + val source = Source.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ partial ⇒ + import GraphDSL.Implicits._ + source1 ~> partial.in + SourceShape(partial.out) }) source.map(_.toInt).to(Sink.fromSubscriber(probe)).run() @@ -165,16 +158,14 @@ class GraphFlowSpec extends AkkaSpec { "work with an GraphFlow" in { val probe = TestSubscriber.manualProbe[Int]() - val source = Source.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ - partial ⇒ - import GraphDSL.Implicits._ - source1 ~> partial.in - SourceShape(partial.out) + val source = Source.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ partial ⇒ + import GraphDSL.Implicits._ + source1 ~> partial.in + SourceShape(partial.out) }) - val flow = Flow.fromGraph(GraphDSL.create(Flow[String].map(_.toInt)) { implicit b ⇒ - importFlow ⇒ - FlowShape(importFlow.in, importFlow.out) + val flow = Flow.fromGraph(GraphDSL.create(Flow[String].map(_.toInt)) { implicit b ⇒ importFlow ⇒ + FlowShape(importFlow.in, importFlow.out) }) source.via(flow).to(Sink.fromSubscriber(probe)).run() @@ -185,20 +176,18 @@ class GraphFlowSpec extends AkkaSpec { "be reusable multiple times" in { val probe = TestSubscriber.manualProbe[Int]() - val source = Source.fromGraph(GraphDSL.create(Source(1 to 5)) { implicit b ⇒ - s ⇒ - import GraphDSL.Implicits._ - SourceShape(s.out.map(_ * 2).outlet) + val source = Source.fromGraph(GraphDSL.create(Source(1 to 5)) { implicit b ⇒ s ⇒ + import GraphDSL.Implicits._ + SourceShape(s.out.map(_ * 2).outlet) }) - RunnableGraph.fromGraph(GraphDSL.create(source, source)(Keep.both) { implicit b ⇒ - (s1, s2) ⇒ - import GraphDSL.Implicits._ - val merge = b.add(Merge[Int](2)) - s1.out ~> merge.in(0) - merge.out ~> Sink.fromSubscriber(probe) - s2.out.map(_ * 10) ~> merge.in(1) - ClosedShape + RunnableGraph.fromGraph(GraphDSL.create(source, source)(Keep.both) { implicit b ⇒ (s1, s2) ⇒ + import GraphDSL.Implicits._ + val merge = b.add(Merge[Int](2)) + s1.out ~> merge.in(0) + merge.out ~> Sink.fromSubscriber(probe) + s2.out.map(_ * 10) ~> merge.in(1) + ClosedShape }).run() validateProbe(probe, 10, Set(2, 4, 6, 8, 10, 20, 40, 60, 80, 100)) @@ -209,11 +198,10 @@ class GraphFlowSpec extends AkkaSpec { "work with a Source" in { val probe = TestSubscriber.manualProbe[Int]() - val sink = Sink.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ - partial ⇒ - import GraphDSL.Implicits._ - partial.out.map(_.toInt) ~> Sink.fromSubscriber(probe) - SinkShape(partial.in) + val sink = Sink.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ partial ⇒ + import GraphDSL.Implicits._ + partial.out.map(_.toInt) ~> Sink.fromSubscriber(probe) + SinkShape(partial.in) }) source1.to(sink).run() @@ -225,8 +213,7 @@ class GraphFlowSpec extends AkkaSpec { val probe = TestSubscriber.manualProbe[Int]() val pubSink = Sink.asPublisher[Int](false) - val sink = Sink.fromGraph(GraphDSL.create(pubSink) { implicit b ⇒ - p ⇒ SinkShape(p.in) + val sink = Sink.fromGraph(GraphDSL.create(pubSink) { implicit b ⇒ p ⇒ SinkShape(p.in) }) val mm = source1.runWith(sink) @@ -238,12 +225,11 @@ class GraphFlowSpec extends AkkaSpec { "be transformable with a Pipe" in { val probe = TestSubscriber.manualProbe[Int]() - val sink = Sink.fromGraph(GraphDSL.create(partialGraph, Flow[String].map(_.toInt))(Keep.both) { implicit b ⇒ - (partial, flow) ⇒ - import GraphDSL.Implicits._ - flow.out ~> partial.in - partial.out.map(_.toInt) ~> Sink.fromSubscriber(probe) - SinkShape(flow.in) + val sink = Sink.fromGraph(GraphDSL.create(partialGraph, Flow[String].map(_.toInt))(Keep.both) { implicit b ⇒ (partial, flow) ⇒ + import GraphDSL.Implicits._ + flow.out ~> partial.in + partial.out.map(_.toInt) ~> Sink.fromSubscriber(probe) + SinkShape(flow.in) }) val iSink = Flow[Int].map(_.toString).to(sink) @@ -256,16 +242,14 @@ class GraphFlowSpec extends AkkaSpec { val probe = TestSubscriber.manualProbe[Int]() - val flow = Flow.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ - partial ⇒ - FlowShape(partial.in, partial.out) + val flow = Flow.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ partial ⇒ + FlowShape(partial.in, partial.out) }) - val sink = Sink.fromGraph(GraphDSL.create(Flow[String].map(_.toInt)) { implicit b ⇒ - flow ⇒ - import GraphDSL.Implicits._ - flow.out ~> Sink.fromSubscriber(probe) - SinkShape(flow.in) + val sink = Sink.fromGraph(GraphDSL.create(Flow[String].map(_.toInt)) { implicit b ⇒ flow ⇒ + import GraphDSL.Implicits._ + flow.out ~> Sink.fromSubscriber(probe) + SinkShape(flow.in) }) source1.via(flow).to(sink).run() @@ -280,32 +264,28 @@ class GraphFlowSpec extends AkkaSpec { val inSource = Source.asSubscriber[Int] val outSink = Sink.asPublisher[Int](false) - val flow = Flow.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ - partial ⇒ - import GraphDSL.Implicits._ - FlowShape(partial.in, partial.out.map(_.toInt).outlet) + val flow = Flow.fromGraph(GraphDSL.create(partialGraph) { implicit b ⇒ partial ⇒ + import GraphDSL.Implicits._ + FlowShape(partial.in, partial.out.map(_.toInt).outlet) }) - val source = Source.fromGraph(GraphDSL.create(Flow[Int].map(_.toString), inSource)(Keep.right) { implicit b ⇒ - (flow, src) ⇒ - import GraphDSL.Implicits._ - src.out ~> flow.in - SourceShape(flow.out) + val source = Source.fromGraph(GraphDSL.create(Flow[Int].map(_.toString), inSource)(Keep.right) { implicit b ⇒ (flow, src) ⇒ + import GraphDSL.Implicits._ + src.out ~> flow.in + SourceShape(flow.out) }) - val sink = Sink.fromGraph(GraphDSL.create(Flow[String].map(_.toInt), outSink)(Keep.right) { implicit b ⇒ - (flow, snk) ⇒ - import GraphDSL.Implicits._ - flow.out ~> snk.in - SinkShape(flow.in) + val sink = Sink.fromGraph(GraphDSL.create(Flow[String].map(_.toInt), outSink)(Keep.right) { implicit b ⇒ (flow, snk) ⇒ + import GraphDSL.Implicits._ + flow.out ~> snk.in + SinkShape(flow.in) }) - val (m1, m2, m3) = RunnableGraph.fromGraph(GraphDSL.create(source, flow, sink)(Tuple3.apply) { implicit b ⇒ - (src, f, snk) ⇒ - import GraphDSL.Implicits._ - src.out.map(_.toInt) ~> f.in - f.out.map(_.toString) ~> snk.in - ClosedShape + val (m1, m2, m3) = RunnableGraph.fromGraph(GraphDSL.create(source, flow, sink)(Tuple3.apply) { implicit b ⇒ (src, f, snk) ⇒ + import GraphDSL.Implicits._ + src.out.map(_.toInt) ~> f.in + f.out.map(_.toString) ~> snk.in + ClosedShape }).run() val subscriber = m1 @@ -321,21 +301,18 @@ class GraphFlowSpec extends AkkaSpec { val inSource = Source.asSubscriber[Int] val outSink = Sink.asPublisher[Int](false) - val source = Source.fromGraph(GraphDSL.create(inSource) { implicit b ⇒ - src ⇒ - SourceShape(src.out) + val source = Source.fromGraph(GraphDSL.create(inSource) { implicit b ⇒ src ⇒ + SourceShape(src.out) }) - val sink = Sink.fromGraph(GraphDSL.create(outSink) { implicit b ⇒ - snk ⇒ - SinkShape(snk.in) + val sink = Sink.fromGraph(GraphDSL.create(outSink) { implicit b ⇒ snk ⇒ + SinkShape(snk.in) }) - val (m1, m2) = RunnableGraph.fromGraph(GraphDSL.create(source, sink)(Keep.both) { implicit b ⇒ - (src, snk) ⇒ - import GraphDSL.Implicits._ - src.out ~> snk.in - ClosedShape + val (m1, m2) = RunnableGraph.fromGraph(GraphDSL.create(source, sink)(Keep.both) { implicit b ⇒ (src, snk) ⇒ + import GraphDSL.Implicits._ + src.out ~> snk.in + ClosedShape }).run() val subscriber = m1 diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphBalanceSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphBalanceSpec.scala index 81f755995d..25737fdf65 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphBalanceSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphBalanceSpec.scala @@ -47,13 +47,12 @@ class GraphBalanceSpec extends AkkaSpec { "support waiting for demand from all downstream subscriptions" in { val s1 = TestSubscriber.manualProbe[Int]() - val p2 = RunnableGraph.fromGraph(GraphDSL.create(Sink.asPublisher[Int](false)) { implicit b ⇒ - p2Sink ⇒ - val balance = b.add(Balance[Int](2, waitForAllDownstreams = true)) - Source(List(1, 2, 3)) ~> balance.in - balance.out(0) ~> Sink.fromSubscriber(s1) - balance.out(1) ~> p2Sink - ClosedShape + val p2 = RunnableGraph.fromGraph(GraphDSL.create(Sink.asPublisher[Int](false)) { implicit b ⇒ p2Sink ⇒ + val balance = b.add(Balance[Int](2, waitForAllDownstreams = true)) + Source(List(1, 2, 3)) ~> balance.in + balance.out(0) ~> Sink.fromSubscriber(s1) + balance.out(1) ~> p2Sink + ClosedShape }).run() val sub1 = s1.expectSubscription() @@ -78,14 +77,13 @@ class GraphBalanceSpec extends AkkaSpec { "support waiting for demand from all non-cancelled downstream subscriptions" in assertAllStagesStopped { val s1 = TestSubscriber.manualProbe[Int]() - val (p2, p3) = RunnableGraph.fromGraph(GraphDSL.create(Sink.asPublisher[Int](false), Sink.asPublisher[Int](false))(Keep.both) { implicit b ⇒ - (p2Sink, p3Sink) ⇒ - val balance = b.add(Balance[Int](3, waitForAllDownstreams = true)) - Source(List(1, 2, 3)) ~> balance.in - balance.out(0) ~> Sink.fromSubscriber(s1) - balance.out(1) ~> p2Sink - balance.out(2) ~> p3Sink - ClosedShape + val (p2, p3) = RunnableGraph.fromGraph(GraphDSL.create(Sink.asPublisher[Int](false), Sink.asPublisher[Int](false))(Keep.both) { implicit b ⇒ (p2Sink, p3Sink) ⇒ + val balance = b.add(Balance[Int](3, waitForAllDownstreams = true)) + Source(List(1, 2, 3)) ~> balance.in + balance.out(0) ~> Sink.fromSubscriber(s1) + balance.out(1) ~> p2Sink + balance.out(2) ~> p3Sink + ClosedShape }).run() val sub1 = s1.expectSubscription() @@ -125,17 +123,15 @@ class GraphBalanceSpec extends AkkaSpec { "work with 5-way balance" in { val sink = Sink.head[Seq[Int]] - val (s1, s2, s3, s4, s5) = RunnableGraph.fromGraph(GraphDSL.create(sink, sink, sink, sink, sink)(Tuple5.apply) { - implicit b ⇒ - (f1, f2, f3, f4, f5) ⇒ - val balance = b.add(Balance[Int](5, waitForAllDownstreams = true)) - Source(0 to 14) ~> balance.in - balance.out(0).grouped(15) ~> f1 - balance.out(1).grouped(15) ~> f2 - balance.out(2).grouped(15) ~> f3 - balance.out(3).grouped(15) ~> f4 - balance.out(4).grouped(15) ~> f5 - ClosedShape + val (s1, s2, s3, s4, s5) = RunnableGraph.fromGraph(GraphDSL.create(sink, sink, sink, sink, sink)(Tuple5.apply) { implicit b ⇒ (f1, f2, f3, f4, f5) ⇒ + val balance = b.add(Balance[Int](5, waitForAllDownstreams = true)) + Source(0 to 14) ~> balance.in + balance.out(0).grouped(15) ~> f1 + balance.out(1).grouped(15) ~> f2 + balance.out(2).grouped(15) ~> f3 + balance.out(3).grouped(15) ~> f4 + balance.out(4).grouped(15) ~> f5 + ClosedShape }).run() Set(s1, s2, s3, s4, s5) flatMap (Await.result(_, 3.seconds)) should be((0 to 14).toSet) @@ -145,14 +141,13 @@ class GraphBalanceSpec extends AkkaSpec { val numElementsForSink = 10000 val outputs = Sink.fold[Int, Int](0)(_ + _) - val results = RunnableGraph.fromGraph(GraphDSL.create(outputs, outputs, outputs)(List(_, _, _)) { implicit b ⇒ - (o1, o2, o3) ⇒ - val balance = b.add(Balance[Int](3, waitForAllDownstreams = true)) - Source.repeat(1).take(numElementsForSink * 3) ~> balance.in - balance.out(0) ~> o1 - balance.out(1) ~> o2 - balance.out(2) ~> o3 - ClosedShape + val results = RunnableGraph.fromGraph(GraphDSL.create(outputs, outputs, outputs)(List(_, _, _)) { implicit b ⇒ (o1, o2, o3) ⇒ + val balance = b.add(Balance[Int](3, waitForAllDownstreams = true)) + Source.repeat(1).take(numElementsForSink * 3) ~> balance.in + balance.out(0) ~> o1 + balance.out(1) ~> o2 + balance.out(2) ~> o3 + ClosedShape }).run() import system.dispatcher @@ -165,14 +160,13 @@ class GraphBalanceSpec extends AkkaSpec { "fairly balance between three outputs" in { val probe = TestSink.probe[Int] - val (p1, p2, p3) = RunnableGraph.fromGraph(GraphDSL.create(probe, probe, probe)(Tuple3.apply) { implicit b ⇒ - (o1, o2, o3) ⇒ - val balance = b.add(Balance[Int](3)) - Source(1 to 7) ~> balance.in - balance.out(0) ~> o1 - balance.out(1) ~> o2 - balance.out(2) ~> o3 - ClosedShape + val (p1, p2, p3) = RunnableGraph.fromGraph(GraphDSL.create(probe, probe, probe)(Tuple3.apply) { implicit b ⇒ (o1, o2, o3) ⇒ + val balance = b.add(Balance[Int](3)) + Source(1 to 7) ~> balance.in + balance.out(0) ~> o1 + balance.out(1) ~> o2 + balance.out(2) ~> o3 + ClosedShape }).run() p1.requestNext(1) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphBroadcastSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphBroadcastSpec.scala index 9997a01d68..6de5b1a1a8 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphBroadcastSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphBroadcastSpec.scala @@ -71,17 +71,16 @@ class GraphBroadcastSpec extends AkkaSpec { headSink, headSink, headSink)( - (fut1, fut2, fut3, fut4, fut5) ⇒ Future.sequence(List(fut1, fut2, fut3, fut4, fut5))) { implicit b ⇒ - (p1, p2, p3, p4, p5) ⇒ - val bcast = b.add(Broadcast[Int](5)) - Source(List(1, 2, 3)) ~> bcast.in - bcast.out(0).grouped(5) ~> p1.in - bcast.out(1).grouped(5) ~> p2.in - bcast.out(2).grouped(5) ~> p3.in - bcast.out(3).grouped(5) ~> p4.in - bcast.out(4).grouped(5) ~> p5.in - ClosedShape - }).run() + (fut1, fut2, fut3, fut4, fut5) ⇒ Future.sequence(List(fut1, fut2, fut3, fut4, fut5))) { implicit b ⇒ (p1, p2, p3, p4, p5) ⇒ + val bcast = b.add(Broadcast[Int](5)) + Source(List(1, 2, 3)) ~> bcast.in + bcast.out(0).grouped(5) ~> p1.in + bcast.out(1).grouped(5) ~> p2.in + bcast.out(2).grouped(5) ~> p3.in + bcast.out(3).grouped(5) ~> p4.in + bcast.out(4).grouped(5) ~> p5.in + ClosedShape + }).run() Await.result(result, 3.seconds) should be(List.fill(5)(List(1, 2, 3))) } @@ -101,35 +100,33 @@ class GraphBroadcastSpec extends AkkaSpec { headSink, headSink, headSink, headSink, headSink, headSink, headSink, headSink, headSink, headSink, headSink, headSink, headSink, headSink, headSink, - headSink, headSink)(combine) { - implicit b ⇒ - (p1, p2, p3, p4, p5, p6, p7, p8, p9, p10, p11, p12, p13, p14, p15, p16, p17, p18, p19, p20, p21, p22) ⇒ - val bcast = b.add(Broadcast[Int](22)) - Source(List(1, 2, 3)) ~> bcast.in - bcast.out(0).grouped(5) ~> p1.in - bcast.out(1).grouped(5) ~> p2.in - bcast.out(2).grouped(5) ~> p3.in - bcast.out(3).grouped(5) ~> p4.in - bcast.out(4).grouped(5) ~> p5.in - bcast.out(5).grouped(5) ~> p6.in - bcast.out(6).grouped(5) ~> p7.in - bcast.out(7).grouped(5) ~> p8.in - bcast.out(8).grouped(5) ~> p9.in - bcast.out(9).grouped(5) ~> p10.in - bcast.out(10).grouped(5) ~> p11.in - bcast.out(11).grouped(5) ~> p12.in - bcast.out(12).grouped(5) ~> p13.in - bcast.out(13).grouped(5) ~> p14.in - bcast.out(14).grouped(5) ~> p15.in - bcast.out(15).grouped(5) ~> p16.in - bcast.out(16).grouped(5) ~> p17.in - bcast.out(17).grouped(5) ~> p18.in - bcast.out(18).grouped(5) ~> p19.in - bcast.out(19).grouped(5) ~> p20.in - bcast.out(20).grouped(5) ~> p21.in - bcast.out(21).grouped(5) ~> p22.in - ClosedShape - }).run() + headSink, headSink)(combine) { implicit b ⇒ (p1, p2, p3, p4, p5, p6, p7, p8, p9, p10, p11, p12, p13, p14, p15, p16, p17, p18, p19, p20, p21, p22) ⇒ + val bcast = b.add(Broadcast[Int](22)) + Source(List(1, 2, 3)) ~> bcast.in + bcast.out(0).grouped(5) ~> p1.in + bcast.out(1).grouped(5) ~> p2.in + bcast.out(2).grouped(5) ~> p3.in + bcast.out(3).grouped(5) ~> p4.in + bcast.out(4).grouped(5) ~> p5.in + bcast.out(5).grouped(5) ~> p6.in + bcast.out(6).grouped(5) ~> p7.in + bcast.out(7).grouped(5) ~> p8.in + bcast.out(8).grouped(5) ~> p9.in + bcast.out(9).grouped(5) ~> p10.in + bcast.out(10).grouped(5) ~> p11.in + bcast.out(11).grouped(5) ~> p12.in + bcast.out(12).grouped(5) ~> p13.in + bcast.out(13).grouped(5) ~> p14.in + bcast.out(14).grouped(5) ~> p15.in + bcast.out(15).grouped(5) ~> p16.in + bcast.out(16).grouped(5) ~> p17.in + bcast.out(17).grouped(5) ~> p18.in + bcast.out(18).grouped(5) ~> p19.in + bcast.out(19).grouped(5) ~> p20.in + bcast.out(20).grouped(5) ~> p21.in + bcast.out(21).grouped(5) ~> p22.in + ClosedShape + }).run() Await.result(result, 3.seconds) should be(List.fill(22)(List(1, 2, 3))) } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphDSLCompileSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphDSLCompileSpec.scala index 496d4cbbcc..aed95477e2 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphDSLCompileSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphDSLCompileSpec.scala @@ -200,7 +200,7 @@ class GraphDSLCompileSpec extends AkkaSpec { val unzip = b.add(Unzip[Int, String]()) val out = Sink.asPublisher[(Int, String)](false) import GraphDSL.Implicits._ - Source(List(1 -> "a", 2 -> "b", 3 -> "c")) ~> unzip.in + Source(List(1 → "a", 2 → "b", 3 → "c")) ~> unzip.in unzip.out0 ~> Flow[Int].map(_ * 2) ~> zip.in0 unzip.out1 ~> zip.in1 zip.out ~> out @@ -298,7 +298,7 @@ class GraphDSLCompileSpec extends AkkaSpec { b.add(Source.fromIterator(apples)) ~> Flow[Apple] ~> b.add(Sink.asPublisher[Fruit](false)) appleSource ~> Flow[Apple] ~> merge.in(10) - Source(List(1 -> "a", 2 -> "b", 3 -> "c")) ~> unzip.in + Source(List(1 → "a", 2 → "b", 3 → "c")) ~> unzip.in unzip.out1 ~> whatever unzip.out0 ~> b.add(Sink.asPublisher[Any](false)) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphMatValueSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphMatValueSpec.scala index 2452adbce9..631dcc5a54 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphMatValueSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphMatValueSpec.scala @@ -30,11 +30,10 @@ class GraphMatValueSpec extends AkkaSpec { "expose the materialized value as source" in { val sub = TestSubscriber.manualProbe[Int]() - val f = RunnableGraph.fromGraph(GraphDSL.create(foldSink) { implicit b ⇒ - fold ⇒ - Source(1 to 10) ~> fold - b.materializedValue.mapAsync(4)(identity) ~> Sink.fromSubscriber(sub) - ClosedShape + val f = RunnableGraph.fromGraph(GraphDSL.create(foldSink) { implicit b ⇒ fold ⇒ + Source(1 to 10) ~> fold + b.materializedValue.mapAsync(4)(identity) ~> Sink.fromSubscriber(sub) + ClosedShape }).run() val r1 = Await.result(f, 3.seconds) @@ -47,15 +46,14 @@ class GraphMatValueSpec extends AkkaSpec { "expose the materialized value as source multiple times" in { val sub = TestSubscriber.manualProbe[Int]() - val f = RunnableGraph.fromGraph(GraphDSL.create(foldSink) { implicit b ⇒ - fold ⇒ - val zip = b.add(ZipWith[Int, Int, Int](_ + _)) - Source(1 to 10) ~> fold - b.materializedValue.mapAsync(4)(identity) ~> zip.in0 - b.materializedValue.mapAsync(4)(identity) ~> zip.in1 + val f = RunnableGraph.fromGraph(GraphDSL.create(foldSink) { implicit b ⇒ fold ⇒ + val zip = b.add(ZipWith[Int, Int, Int](_ + _)) + Source(1 to 10) ~> fold + b.materializedValue.mapAsync(4)(identity) ~> zip.in0 + b.materializedValue.mapAsync(4)(identity) ~> zip.in1 - zip.out ~> Sink.fromSubscriber(sub) - ClosedShape + zip.out ~> Sink.fromSubscriber(sub) + ClosedShape }).run() val r1 = Await.result(f, 3.seconds) @@ -66,10 +64,9 @@ class GraphMatValueSpec extends AkkaSpec { } // Exposes the materialized value as a stream value - val foldFeedbackSource: Source[Future[Int], Future[Int]] = Source.fromGraph(GraphDSL.create(foldSink) { implicit b ⇒ - fold ⇒ - Source(1 to 10) ~> fold - SourceShape(b.materializedValue) + val foldFeedbackSource: Source[Future[Int], Future[Int]] = Source.fromGraph(GraphDSL.create(foldSink) { implicit b ⇒ fold ⇒ + Source(1 to 10) ~> fold + SourceShape(b.materializedValue) }) "allow exposing the materialized value as port" in { @@ -84,21 +81,19 @@ class GraphMatValueSpec extends AkkaSpec { } "work properly with nesting and reusing" in { - val compositeSource1 = Source.fromGraph(GraphDSL.create(foldFeedbackSource, foldFeedbackSource)(Keep.both) { implicit b ⇒ - (s1, s2) ⇒ - val zip = b.add(ZipWith[Int, Int, Int](_ + _)) + val compositeSource1 = Source.fromGraph(GraphDSL.create(foldFeedbackSource, foldFeedbackSource)(Keep.both) { implicit b ⇒ (s1, s2) ⇒ + val zip = b.add(ZipWith[Int, Int, Int](_ + _)) - s1.out.mapAsync(4)(identity) ~> zip.in0 - s2.out.mapAsync(4)(identity).map(_ * 100) ~> zip.in1 - SourceShape(zip.out) + s1.out.mapAsync(4)(identity) ~> zip.in0 + s2.out.mapAsync(4)(identity).map(_ * 100) ~> zip.in1 + SourceShape(zip.out) }) - val compositeSource2 = Source.fromGraph(GraphDSL.create(compositeSource1, compositeSource1)(Keep.both) { implicit b ⇒ - (s1, s2) ⇒ - val zip = b.add(ZipWith[Int, Int, Int](_ + _)) - s1.out ~> zip.in0 - s2.out.map(_ * 10000) ~> zip.in1 - SourceShape(zip.out) + val compositeSource2 = Source.fromGraph(GraphDSL.create(compositeSource1, compositeSource1)(Keep.both) { implicit b ⇒ (s1, s2) ⇒ + val zip = b.add(ZipWith[Int, Int, Int](_ + _)) + s1.out ~> zip.in0 + s2.out.map(_ * 10000) ~> zip.in1 + SourceShape(zip.out) }) val (((f1, f2), (f3, f4)), result) = compositeSource2.toMat(Sink.head)(Keep.both).run() @@ -112,22 +107,18 @@ class GraphMatValueSpec extends AkkaSpec { } "work also when the source’s module is copied" in { - val foldFlow: Flow[Int, Int, Future[Int]] = Flow.fromGraph(GraphDSL.create(foldSink) { - implicit builder ⇒ - fold ⇒ - FlowShape(fold.in, builder.materializedValue.mapAsync(4)(identity).outlet) + val foldFlow: Flow[Int, Int, Future[Int]] = Flow.fromGraph(GraphDSL.create(foldSink) { implicit builder ⇒ fold ⇒ + FlowShape(fold.in, builder.materializedValue.mapAsync(4)(identity).outlet) }) Await.result(Source(1 to 10).via(foldFlow).runWith(Sink.head), 3.seconds) should ===(55) } "work also when the source’s module is copied and the graph is extended before using the matValSrc" in { - val foldFlow: Flow[Int, Int, Future[Int]] = Flow.fromGraph(GraphDSL.create(foldSink) { - implicit builder ⇒ - fold ⇒ - val map = builder.add(Flow[Future[Int]].mapAsync(4)(identity)) - builder.materializedValue ~> map - FlowShape(fold.in, map.outlet) + val foldFlow: Flow[Int, Int, Future[Int]] = Flow.fromGraph(GraphDSL.create(foldSink) { implicit builder ⇒ fold ⇒ + val map = builder.add(Flow[Future[Int]].mapAsync(4)(identity)) + builder.materializedValue ~> map + FlowShape(fold.in, map.outlet) }) Await.result(Source(1 to 10).via(foldFlow).runWith(Sink.head), 3.seconds) should ===(55) @@ -140,11 +131,10 @@ class GraphMatValueSpec extends AkkaSpec { Source.empty.mapMaterializedValue(_ ⇒ done = true) ~> Sink.ignore ClosedShape } - val r = RunnableGraph.fromGraph(GraphDSL.create(Sink.ignore) { implicit b ⇒ - (s) ⇒ - b.add(g) - Source(1 to 10) ~> s - ClosedShape + val r = RunnableGraph.fromGraph(GraphDSL.create(Sink.ignore) { implicit b ⇒ (s) ⇒ + b.add(g) + Source(1 to 10) ~> s + ClosedShape }) r.run().futureValue should ===(akka.Done) done should ===(true) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphMergePreferredSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphMergePreferredSpec.scala index 12527bdf8f..4ca4898f7c 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphMergePreferredSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphMergePreferredSpec.scala @@ -32,32 +32,30 @@ class GraphMergePreferredSpec extends TwoStreamsSetup { val preferred = Source(Stream.fill(numElements)(1)) val aux = Source(Stream.fill(numElements)(2)) - val result = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Seq[Int]]) { implicit b ⇒ - sink ⇒ - val merge = b.add(MergePreferred[Int](3)) - preferred ~> merge.preferred + val result = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Seq[Int]]) { implicit b ⇒ sink ⇒ + val merge = b.add(MergePreferred[Int](3)) + preferred ~> merge.preferred - merge.out.grouped(numElements * 2) ~> sink.in - aux ~> merge.in(0) - aux ~> merge.in(1) - aux ~> merge.in(2) - ClosedShape + merge.out.grouped(numElements * 2) ~> sink.in + aux ~> merge.in(0) + aux ~> merge.in(1) + aux ~> merge.in(2) + ClosedShape }).run() Await.result(result, 3.seconds).filter(_ == 1).size should be(numElements) } "eventually pass through all elements" in { - val result = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Seq[Int]]) { implicit b ⇒ - sink ⇒ - val merge = b.add(MergePreferred[Int](3)) - Source(1 to 100) ~> merge.preferred + val result = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Seq[Int]]) { implicit b ⇒ sink ⇒ + val merge = b.add(MergePreferred[Int](3)) + Source(1 to 100) ~> merge.preferred - merge.out.grouped(500) ~> sink.in - Source(101 to 200) ~> merge.in(0) - Source(201 to 300) ~> merge.in(1) - Source(301 to 400) ~> merge.in(2) - ClosedShape + merge.out.grouped(500) ~> sink.in + Source(101 to 200) ~> merge.in(0) + Source(201 to 300) ~> merge.in(1) + Source(301 to 400) ~> merge.in(2) + ClosedShape }).run() Await.result(result, 3.seconds).toSet should ===((1 to 400).toSet) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphMergeSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphMergeSpec.scala index ef11c89324..7308c7b849 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphMergeSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphMergeSpec.scala @@ -167,13 +167,12 @@ class GraphMergeSpec extends TwoStreamsSetup { val src1 = Source.asSubscriber[Int] val src2 = Source.asSubscriber[Int] - val (graphSubscriber1, graphSubscriber2) = RunnableGraph.fromGraph(GraphDSL.create(src1, src2)((_, _)) { implicit b ⇒ - (s1, s2) ⇒ - val merge = b.add(Merge[Int](2)) - s1.out ~> merge.in(0) - s2.out ~> merge.in(1) - merge.out ~> Sink.fromSubscriber(down) - ClosedShape + val (graphSubscriber1, graphSubscriber2) = RunnableGraph.fromGraph(GraphDSL.create(src1, src2)((_, _)) { implicit b ⇒ (s1, s2) ⇒ + val merge = b.add(Merge[Int](2)) + s1.out ~> merge.in(0) + s2.out ~> merge.in(1) + merge.out ~> Sink.fromSubscriber(down) + ClosedShape }).run() val downstream = down.expectSubscription() diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphOpsIntegrationSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphOpsIntegrationSpec.scala index d5cc067fa8..cad98ad609 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphOpsIntegrationSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphOpsIntegrationSpec.scala @@ -55,16 +55,15 @@ class GraphOpsIntegrationSpec extends AkkaSpec { "GraphDSLs" must { "support broadcast - merge layouts" in { - val resultFuture = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Seq[Int]]) { implicit b ⇒ - (sink) ⇒ - val bcast = b.add(Broadcast[Int](2)) - val merge = b.add(Merge[Int](2)) + val resultFuture = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Seq[Int]]) { implicit b ⇒ (sink) ⇒ + val bcast = b.add(Broadcast[Int](2)) + val merge = b.add(Merge[Int](2)) - Source(List(1, 2, 3)) ~> bcast.in - bcast.out(0) ~> merge.in(0) - bcast.out(1).map(_ + 3) ~> merge.in(1) - merge.out.grouped(10) ~> sink.in - ClosedShape + Source(List(1, 2, 3)) ~> bcast.in + bcast.out(0) ~> merge.in(0) + bcast.out(1).map(_ + 3) ~> merge.in(1) + merge.out.grouped(10) ~> sink.in + ClosedShape }).run() Await.result(resultFuture, 3.seconds).sorted should be(List(1, 2, 3, 4, 5, 6)) @@ -72,17 +71,16 @@ class GraphOpsIntegrationSpec extends AkkaSpec { "support balance - merge (parallelization) layouts" in { val elements = 0 to 10 - val out = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Seq[Int]]) { implicit b ⇒ - (sink) ⇒ - val balance = b.add(Balance[Int](5)) - val merge = b.add(Merge[Int](5)) + val out = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Seq[Int]]) { implicit b ⇒ (sink) ⇒ + val balance = b.add(Balance[Int](5)) + val merge = b.add(Merge[Int](5)) - Source(elements) ~> balance.in + Source(elements) ~> balance.in - for (i ← 0 until 5) balance.out(i) ~> merge.in(i) + for (i ← 0 until 5) balance.out(i) ~> merge.in(i) - merge.out.grouped(elements.size * 2) ~> sink.in - ClosedShape + merge.out.grouped(elements.size * 2) ~> sink.in + ClosedShape }).run() Await.result(out, 3.seconds).sorted should be(elements) @@ -92,43 +90,42 @@ class GraphOpsIntegrationSpec extends AkkaSpec { // see https://en.wikipedia.org/wiki/Topological_sorting#mediaviewer/File:Directed_acyclic_graph.png val seqSink = Sink.head[Seq[Int]] - val (resultFuture2, resultFuture9, resultFuture10) = RunnableGraph.fromGraph(GraphDSL.create(seqSink, seqSink, seqSink)(Tuple3.apply) { implicit b ⇒ - (sink2, sink9, sink10) ⇒ - val b3 = b.add(Broadcast[Int](2)) - val b7 = b.add(Broadcast[Int](2)) - val b11 = b.add(Broadcast[Int](3)) - val m8 = b.add(Merge[Int](2)) - val m9 = b.add(Merge[Int](2)) - val m10 = b.add(Merge[Int](2)) - val m11 = b.add(Merge[Int](2)) - val in3 = Source(List(3)) - val in5 = Source(List(5)) - val in7 = Source(List(7)) + val (resultFuture2, resultFuture9, resultFuture10) = RunnableGraph.fromGraph(GraphDSL.create(seqSink, seqSink, seqSink)(Tuple3.apply) { implicit b ⇒ (sink2, sink9, sink10) ⇒ + val b3 = b.add(Broadcast[Int](2)) + val b7 = b.add(Broadcast[Int](2)) + val b11 = b.add(Broadcast[Int](3)) + val m8 = b.add(Merge[Int](2)) + val m9 = b.add(Merge[Int](2)) + val m10 = b.add(Merge[Int](2)) + val m11 = b.add(Merge[Int](2)) + val in3 = Source(List(3)) + val in5 = Source(List(5)) + val in7 = Source(List(7)) - // First layer - in7 ~> b7.in - b7.out(0) ~> m11.in(0) - b7.out(1) ~> m8.in(0) + // First layer + in7 ~> b7.in + b7.out(0) ~> m11.in(0) + b7.out(1) ~> m8.in(0) - in5 ~> m11.in(1) + in5 ~> m11.in(1) - in3 ~> b3.in - b3.out(0) ~> m8.in(1) - b3.out(1) ~> m10.in(0) + in3 ~> b3.in + b3.out(0) ~> m8.in(1) + b3.out(1) ~> m10.in(0) - // Second layer - m11.out ~> b11.in - b11.out(0).grouped(1000) ~> sink2.in // Vertex 2 is omitted since it has only one in and out - b11.out(1) ~> m9.in(0) - b11.out(2) ~> m10.in(1) + // Second layer + m11.out ~> b11.in + b11.out(0).grouped(1000) ~> sink2.in // Vertex 2 is omitted since it has only one in and out + b11.out(1) ~> m9.in(0) + b11.out(2) ~> m10.in(1) - m8.out ~> m9.in(1) + m8.out ~> m9.in(1) - // Third layer - m9.out.grouped(1000) ~> sink9.in - m10.out.grouped(1000) ~> sink10.in + // Third layer + m9.out.grouped(1000) ~> sink9.in + m10.out.grouped(1000) ~> sink10.in - ClosedShape + ClosedShape }).run() Await.result(resultFuture2, 3.seconds).sorted should be(List(5, 7)) @@ -139,16 +136,15 @@ class GraphOpsIntegrationSpec extends AkkaSpec { "allow adding of flows to sources and sinks to flows" in { - val resultFuture = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Seq[Int]]) { implicit b ⇒ - (sink) ⇒ - val bcast = b.add(Broadcast[Int](2)) - val merge = b.add(Merge[Int](2)) + val resultFuture = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Seq[Int]]) { implicit b ⇒ (sink) ⇒ + val bcast = b.add(Broadcast[Int](2)) + val merge = b.add(Merge[Int](2)) - Source(List(1, 2, 3)).map(_ * 2) ~> bcast.in - bcast.out(0) ~> merge.in(0) - bcast.out(1).map(_ + 3) ~> merge.in(1) - merge.out.grouped(10) ~> sink.in - ClosedShape + Source(List(1, 2, 3)).map(_ * 2) ~> bcast.in + bcast.out(0) ~> merge.in(0) + bcast.out(1).map(_ + 3) ~> merge.in(1) + merge.out.grouped(10) ~> sink.in + ClosedShape }).run() Await.result(resultFuture, 3.seconds) should contain theSameElementsAs (Seq(2, 4, 6, 5, 7, 9)) @@ -173,24 +169,23 @@ class GraphOpsIntegrationSpec extends AkkaSpec { "be possible to use as lego bricks" in { val shuffler = Shuffle(Flow[Int].map(_ + 1)) - val f: Future[Seq[Int]] = RunnableGraph.fromGraph(GraphDSL.create(shuffler, shuffler, shuffler, Sink.head[Seq[Int]])((_, _, _, fut) ⇒ fut) { implicit b ⇒ - (s1, s2, s3, sink) ⇒ - val merge = b.add(Merge[Int](2)) + val f: Future[Seq[Int]] = RunnableGraph.fromGraph(GraphDSL.create(shuffler, shuffler, shuffler, Sink.head[Seq[Int]])((_, _, _, fut) ⇒ fut) { implicit b ⇒ (s1, s2, s3, sink) ⇒ + val merge = b.add(Merge[Int](2)) - Source(List(1, 2, 3)) ~> s1.in1 - Source(List(10, 11, 12)) ~> s1.in2 + Source(List(1, 2, 3)) ~> s1.in1 + Source(List(10, 11, 12)) ~> s1.in2 - s1.out1 ~> s2.in1 - s1.out2 ~> s2.in2 + s1.out1 ~> s2.in1 + s1.out2 ~> s2.in2 - s2.out1 ~> s3.in1 - s2.out2 ~> s3.in2 + s2.out1 ~> s3.in1 + s2.out2 ~> s3.in2 - s3.out1 ~> merge.in(0) - s3.out2 ~> merge.in(1) + s3.out1 ~> merge.in(0) + s3.out2 ~> merge.in(1) - merge.out.grouped(1000) ~> sink - ClosedShape + merge.out.grouped(1000) ~> sink + ClosedShape }).run() val result = Await.result(f, 3.seconds) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphPartialSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphPartialSpec.scala index 4e82b11829..cb4ffdf612 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphPartialSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphPartialSpec.scala @@ -26,35 +26,32 @@ class GraphPartialSpec extends AkkaSpec { FlowShape(bcast.in, zip.out) } - val (_, _, result) = RunnableGraph.fromGraph(GraphDSL.create(doubler, doubler, Sink.head[Seq[Int]])(Tuple3.apply) { implicit b ⇒ - (d1, d2, sink) ⇒ - Source(List(1, 2, 3)) ~> d1.in - d1.out ~> d2.in - d2.out.grouped(100) ~> sink.in - ClosedShape + val (_, _, result) = RunnableGraph.fromGraph(GraphDSL.create(doubler, doubler, Sink.head[Seq[Int]])(Tuple3.apply) { implicit b ⇒ (d1, d2, sink) ⇒ + Source(List(1, 2, 3)) ~> d1.in + d1.out ~> d2.in + d2.out.grouped(100) ~> sink.in + ClosedShape }).run() Await.result(result, 3.seconds) should be(List(4, 8, 12)) } "be able to build and reuse simple materializing partial graphs" in { - val doubler = GraphDSL.create(Sink.head[Seq[Int]]) { implicit b ⇒ - sink ⇒ - val bcast = b.add(Broadcast[Int](3)) - val zip = b.add(ZipWith((a: Int, b: Int) ⇒ a + b)) + val doubler = GraphDSL.create(Sink.head[Seq[Int]]) { implicit b ⇒ sink ⇒ + val bcast = b.add(Broadcast[Int](3)) + val zip = b.add(ZipWith((a: Int, b: Int) ⇒ a + b)) - bcast.out(0) ~> zip.in0 - bcast.out(1) ~> zip.in1 - bcast.out(2).grouped(100) ~> sink.in - FlowShape(bcast.in, zip.out) + bcast.out(0) ~> zip.in0 + bcast.out(1) ~> zip.in1 + bcast.out(2).grouped(100) ~> sink.in + FlowShape(bcast.in, zip.out) } - val (sub1, sub2, result) = RunnableGraph.fromGraph(GraphDSL.create(doubler, doubler, Sink.head[Seq[Int]])(Tuple3.apply) { implicit b ⇒ - (d1, d2, sink) ⇒ - Source(List(1, 2, 3)) ~> d1.in - d1.out ~> d2.in - d2.out.grouped(100) ~> sink.in - ClosedShape + val (sub1, sub2, result) = RunnableGraph.fromGraph(GraphDSL.create(doubler, doubler, Sink.head[Seq[Int]])(Tuple3.apply) { implicit b ⇒ (d1, d2, sink) ⇒ + Source(List(1, 2, 3)) ~> d1.in + d1.out ~> d2.in + d2.out.grouped(100) ~> sink.in + ClosedShape }).run() Await.result(result, 3.seconds) should be(List(4, 8, 12)) @@ -65,28 +62,26 @@ class GraphPartialSpec extends AkkaSpec { "be able to build and reuse complex materializing partial graphs" in { val summer = Sink.fold[Int, Int](0)(_ + _) - val doubler = GraphDSL.create(summer, summer)(Tuple2.apply) { implicit b ⇒ - (s1, s2) ⇒ - val bcast = b.add(Broadcast[Int](3)) - val bcast2 = b.add(Broadcast[Int](2)) - val zip = b.add(ZipWith((a: Int, b: Int) ⇒ a + b)) + val doubler = GraphDSL.create(summer, summer)(Tuple2.apply) { implicit b ⇒ (s1, s2) ⇒ + val bcast = b.add(Broadcast[Int](3)) + val bcast2 = b.add(Broadcast[Int](2)) + val zip = b.add(ZipWith((a: Int, b: Int) ⇒ a + b)) - bcast.out(0) ~> zip.in0 - bcast.out(1) ~> zip.in1 - bcast.out(2) ~> s1.in + bcast.out(0) ~> zip.in0 + bcast.out(1) ~> zip.in1 + bcast.out(2) ~> s1.in - zip.out ~> bcast2.in - bcast2.out(0) ~> s2.in + zip.out ~> bcast2.in + bcast2.out(0) ~> s2.in - FlowShape(bcast.in, bcast2.out(1)) + FlowShape(bcast.in, bcast2.out(1)) } - val (sub1, sub2, result) = RunnableGraph.fromGraph(GraphDSL.create(doubler, doubler, Sink.head[Seq[Int]])(Tuple3.apply) { implicit b ⇒ - (d1, d2, sink) ⇒ - Source(List(1, 2, 3)) ~> d1.in - d1.out ~> d2.in - d2.out.grouped(100) ~> sink.in - ClosedShape + val (sub1, sub2, result) = RunnableGraph.fromGraph(GraphDSL.create(doubler, doubler, Sink.head[Seq[Int]])(Tuple3.apply) { implicit b ⇒ (d1, d2, sink) ⇒ + Source(List(1, 2, 3)) ~> d1.in + d1.out ~> d2.in + d2.out.grouped(100) ~> sink.in + ClosedShape }).run() Await.result(result, 3.seconds) should be(List(4, 8, 12)) @@ -97,17 +92,15 @@ class GraphPartialSpec extends AkkaSpec { } "be able to expose the ports of imported graphs" in { - val p = GraphDSL.create(Flow[Int].map(_ + 1)) { implicit b ⇒ - flow ⇒ - FlowShape(flow.in, flow.out) + val p = GraphDSL.create(Flow[Int].map(_ + 1)) { implicit b ⇒ flow ⇒ + FlowShape(flow.in, flow.out) } - val fut = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Int], p)(Keep.left) { implicit b ⇒ - (sink, flow) ⇒ - import GraphDSL.Implicits._ - Source.single(0) ~> flow.in - flow.out ~> sink.in - ClosedShape + val fut = RunnableGraph.fromGraph(GraphDSL.create(Sink.head[Int], p)(Keep.left) { implicit b ⇒ (sink, flow) ⇒ + import GraphDSL.Implicits._ + Source.single(0) ~> flow.in + flow.out ~> sink.in + ClosedShape }).run() Await.result(fut, 3.seconds) should be(1) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphPartitionSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphPartitionSpec.scala index a8e97b28ac..a30c3a31f3 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphPartitionSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphPartitionSpec.scala @@ -23,18 +23,17 @@ class GraphPartitionSpec extends AkkaSpec { "partition to three subscribers" in assertAllStagesStopped { - val (s1, s2, s3) = RunnableGraph.fromGraph(GraphDSL.create(Sink.seq[Int], Sink.seq[Int], Sink.seq[Int])(Tuple3.apply) { implicit b ⇒ - (sink1, sink2, sink3) ⇒ - val partition = b.add(Partition[Int](3, { - case g if (g > 3) ⇒ 0 - case l if (l < 3) ⇒ 1 - case e if (e == 3) ⇒ 2 - })) - Source(List(1, 2, 3, 4, 5)) ~> partition.in - partition.out(0) ~> sink1.in - partition.out(1) ~> sink2.in - partition.out(2) ~> sink3.in - ClosedShape + val (s1, s2, s3) = RunnableGraph.fromGraph(GraphDSL.create(Sink.seq[Int], Sink.seq[Int], Sink.seq[Int])(Tuple3.apply) { implicit b ⇒ (sink1, sink2, sink3) ⇒ + val partition = b.add(Partition[Int](3, { + case g if (g > 3) ⇒ 0 + case l if (l < 3) ⇒ 1 + case e if (e == 3) ⇒ 2 + })) + Source(List(1, 2, 3, 4, 5)) ~> partition.in + partition.out(0) ~> sink1.in + partition.out(1) ~> sink2.in + partition.out(2) ~> sink3.in + ClosedShape }).run() s1.futureValue.toSet should ===(Set(4, 5)) @@ -124,16 +123,15 @@ class GraphPartitionSpec extends AkkaSpec { val s = Sink.seq[Int] val input = Set(5, 2, 9, 1, 1, 1, 10) - val g = RunnableGraph.fromGraph(GraphDSL.create(s) { implicit b ⇒ - sink ⇒ - val partition = b.add(Partition[Int](2, { case l if l < 4 ⇒ 0; case _ ⇒ 1 })) - val merge = b.add(Merge[Int](2)) - Source(input) ~> partition.in - partition.out(0) ~> merge.in(0) - partition.out(1) ~> merge.in(1) - merge.out ~> sink.in + val g = RunnableGraph.fromGraph(GraphDSL.create(s) { implicit b ⇒ sink ⇒ + val partition = b.add(Partition[Int](2, { case l if l < 4 ⇒ 0; case _ ⇒ 1 })) + val merge = b.add(Merge[Int](2)) + Source(input) ~> partition.in + partition.out(0) ~> merge.in(0) + partition.out(1) ~> merge.in(1) + merge.out ~> sink.in - ClosedShape + ClosedShape }) val result = Await.result(g.run(), remainingOrDefault) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphUnzipSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphUnzipSpec.scala index 9dbb847352..d0f9be0c78 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphUnzipSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphUnzipSpec.scala @@ -25,7 +25,7 @@ class GraphUnzipSpec extends AkkaSpec { RunnableGraph.fromGraph(GraphDSL.create() { implicit b ⇒ val unzip = b.add(Unzip[Int, String]()) - Source(List(1 -> "a", 2 -> "b", 3 -> "c")) ~> unzip.in + Source(List(1 → "a", 2 → "b", 3 → "c")) ~> unzip.in unzip.out1 ~> Flow[String].buffer(16, OverflowStrategy.backpressure) ~> Sink.fromSubscriber(c2) unzip.out0 ~> Flow[Int].buffer(16, OverflowStrategy.backpressure).map(_ * 2) ~> Sink.fromSubscriber(c1) ClosedShape @@ -55,7 +55,7 @@ class GraphUnzipSpec extends AkkaSpec { RunnableGraph.fromGraph(GraphDSL.create() { implicit b ⇒ val unzip = b.add(Unzip[Int, String]()) - Source(List(1 -> "a", 2 -> "b", 3 -> "c")) ~> unzip.in + Source(List(1 → "a", 2 → "b", 3 → "c")) ~> unzip.in unzip.out0 ~> Sink.fromSubscriber(c1) unzip.out1 ~> Sink.fromSubscriber(c2) ClosedShape @@ -77,7 +77,7 @@ class GraphUnzipSpec extends AkkaSpec { RunnableGraph.fromGraph(GraphDSL.create() { implicit b ⇒ val unzip = b.add(Unzip[Int, String]()) - Source(List(1 -> "a", 2 -> "b", 3 -> "c")) ~> unzip.in + Source(List(1 → "a", 2 → "b", 3 → "c")) ~> unzip.in unzip.out0 ~> Sink.fromSubscriber(c1) unzip.out1 ~> Sink.fromSubscriber(c2) ClosedShape @@ -99,7 +99,7 @@ class GraphUnzipSpec extends AkkaSpec { RunnableGraph.fromGraph(GraphDSL.create() { implicit b ⇒ val unzip = b.add(Unzip[Int, String]()) - Source(List(1 -> "a", 2 -> "b", 3 -> "c")) ~> unzip.in + Source(List(1 → "a", 2 → "b", 3 → "c")) ~> unzip.in unzip.out0 ~> Sink.fromSubscriber(c1) unzip.out1 ~> Sink.fromSubscriber(c2) ClosedShape @@ -122,7 +122,7 @@ class GraphUnzipSpec extends AkkaSpec { RunnableGraph.fromGraph(GraphDSL.create() { implicit b ⇒ val unzip = b.add(Unzip[Int, String]()) - Source(List(1 -> "a", 2 -> "b", 3 -> "c")) ~> unzip.in + Source(List(1 → "a", 2 → "b", 3 → "c")) ~> unzip.in unzip.out0 ~> Sink.fromSubscriber(c1) unzip.out1 ~> Sink.fromSubscriber(c2) ClosedShape @@ -158,10 +158,10 @@ class GraphUnzipSpec extends AkkaSpec { sub1.request(3) sub2.request(3) p1.expectRequest(p1Sub, 16) - p1Sub.sendNext(1 -> "a") + p1Sub.sendNext(1 → "a") c1.expectNext(1) c2.expectNext("a") - p1Sub.sendNext(2 -> "b") + p1Sub.sendNext(2 → "b") c1.expectNext(2) c2.expectNext("b") sub1.cancel() @@ -174,7 +174,7 @@ class GraphUnzipSpec extends AkkaSpec { RunnableGraph.fromGraph(GraphDSL.create() { implicit b ⇒ val zip = b.add(Zip[Int, String]()) val unzip = b.add(Unzip[Int, String]()) - Source(List(1 -> "a", 2 -> "b", 3 -> "c")) ~> unzip.in + Source(List(1 → "a", 2 → "b", 3 → "c")) ~> unzip.in unzip.out0 ~> zip.in0 unzip.out1 ~> zip.in1 zip.out ~> Sink.fromSubscriber(c1) @@ -183,9 +183,9 @@ class GraphUnzipSpec extends AkkaSpec { val sub1 = c1.expectSubscription() sub1.request(5) - c1.expectNext(1 -> "a") - c1.expectNext(2 -> "b") - c1.expectNext(3 -> "c") + c1.expectNext(1 → "a") + c1.expectNext(2 → "b") + c1.expectNext(3 → "c") c1.expectComplete() } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphZipNSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphZipNSpec.scala index e10399f3df..95c51c4e2a 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphZipNSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphZipNSpec.scala @@ -59,15 +59,14 @@ class GraphZipNSpec extends TwoStreamsSetup { val upstream2 = TestPublisher.probe[Int]() val downstream = TestSubscriber.probe[immutable.Seq[Int]]() - RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ - out ⇒ - val zipN = b.add(ZipN[Int](2)) + RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ out ⇒ + val zipN = b.add(ZipN[Int](2)) - Source.fromPublisher(upstream1) ~> zipN.in(0) - Source.fromPublisher(upstream2) ~> zipN.in(1) - zipN.out ~> out + Source.fromPublisher(upstream1) ~> zipN.in(0) + Source.fromPublisher(upstream2) ~> zipN.in(1) + zipN.out ~> out - ClosedShape + ClosedShape }).run() upstream1.sendNext(1) @@ -85,15 +84,14 @@ class GraphZipNSpec extends TwoStreamsSetup { val upstream2 = TestPublisher.probe[Int]() val downstream = TestSubscriber.probe[immutable.Seq[Int]]() - RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ - out ⇒ - val zipN = b.add(ZipN[Int](2)) + RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ out ⇒ + val zipN = b.add(ZipN[Int](2)) - Source.fromPublisher(upstream1) ~> zipN.in(0) - Source.fromPublisher(upstream2) ~> zipN.in(1) - zipN.out ~> out + Source.fromPublisher(upstream1) ~> zipN.in(0) + Source.fromPublisher(upstream2) ~> zipN.in(1) + zipN.out ~> out - ClosedShape + ClosedShape }).run() downstream.request(1) @@ -112,15 +110,14 @@ class GraphZipNSpec extends TwoStreamsSetup { val upstream2 = TestPublisher.probe[Int]() val downstream = TestSubscriber.probe[immutable.Seq[Int]]() - RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ - out ⇒ - val zipN = b.add(ZipN[Int](2)) + RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ out ⇒ + val zipN = b.add(ZipN[Int](2)) - Source.fromPublisher(upstream1) ~> zipN.in(0) - Source.fromPublisher(upstream2) ~> zipN.in(1) - zipN.out ~> out + Source.fromPublisher(upstream1) ~> zipN.in(0) + Source.fromPublisher(upstream2) ~> zipN.in(1) + zipN.out ~> out - ClosedShape + ClosedShape }).run() upstream1.sendNext(1) @@ -138,15 +135,14 @@ class GraphZipNSpec extends TwoStreamsSetup { val upstream2 = TestPublisher.probe[Int]() val downstream = TestSubscriber.probe[immutable.Seq[Int]]() - RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ - out ⇒ - val zipN = b.add(ZipN[Int](2)) + RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ out ⇒ + val zipN = b.add(ZipN[Int](2)) - Source.fromPublisher(upstream1) ~> zipN.in(0) - Source.fromPublisher(upstream2) ~> zipN.in(1) - zipN.out ~> out + Source.fromPublisher(upstream1) ~> zipN.in(0) + Source.fromPublisher(upstream2) ~> zipN.in(1) + zipN.out ~> out - ClosedShape + ClosedShape }).run() upstream1.sendNext(1) @@ -165,15 +161,14 @@ class GraphZipNSpec extends TwoStreamsSetup { val upstream2 = TestPublisher.probe[Int]() val downstream = TestSubscriber.probe[immutable.Seq[Int]]() - RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ - out ⇒ - val zipN = b.add(ZipN[Int](2)) + RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ out ⇒ + val zipN = b.add(ZipN[Int](2)) - Source.fromPublisher(upstream1) ~> zipN.in(0) - Source.fromPublisher(upstream2) ~> zipN.in(1) - zipN.out ~> out + Source.fromPublisher(upstream1) ~> zipN.in(0) + Source.fromPublisher(upstream2) ~> zipN.in(1) + zipN.out ~> out - ClosedShape + ClosedShape }).run() downstream.ensureSubscription() diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphZipSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphZipSpec.scala index 83762d8b9a..c6e6576eda 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphZipSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/GraphZipSpec.scala @@ -57,15 +57,14 @@ class GraphZipSpec extends TwoStreamsSetup { val upstream1 = TestPublisher.probe[Int]() val upstream2 = TestPublisher.probe[String]() - val completed = RunnableGraph.fromGraph(GraphDSL.create(Sink.ignore) { implicit b ⇒ - out ⇒ - val zip = b.add(Zip[Int, String]()) + val completed = RunnableGraph.fromGraph(GraphDSL.create(Sink.ignore) { implicit b ⇒ out ⇒ + val zip = b.add(Zip[Int, String]()) - Source.fromPublisher(upstream1) ~> zip.in0 - Source.fromPublisher(upstream2) ~> zip.in1 - zip.out ~> out + Source.fromPublisher(upstream1) ~> zip.in0 + Source.fromPublisher(upstream2) ~> zip.in1 + zip.out ~> out - ClosedShape + ClosedShape }).run() upstream1.sendNext(1) @@ -83,15 +82,14 @@ class GraphZipSpec extends TwoStreamsSetup { val upstream2 = TestPublisher.probe[String]() val downstream = TestSubscriber.probe[(Int, String)]() - RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ - out ⇒ - val zip = b.add(Zip[Int, String]()) + RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ out ⇒ + val zip = b.add(Zip[Int, String]()) - Source.fromPublisher(upstream1) ~> zip.in0 - Source.fromPublisher(upstream2) ~> zip.in1 - zip.out ~> out + Source.fromPublisher(upstream1) ~> zip.in0 + Source.fromPublisher(upstream2) ~> zip.in1 + zip.out ~> out - ClosedShape + ClosedShape }).run() downstream.request(1) @@ -110,15 +108,14 @@ class GraphZipSpec extends TwoStreamsSetup { val upstream2 = TestPublisher.probe[String]() val downstream = TestSubscriber.probe[(Int, String)]() - RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ - out ⇒ - val zip = b.add(Zip[Int, String]()) + RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ out ⇒ + val zip = b.add(Zip[Int, String]()) - Source.fromPublisher(upstream1) ~> zip.in0 - Source.fromPublisher(upstream2) ~> zip.in1 - zip.out ~> out + Source.fromPublisher(upstream1) ~> zip.in0 + Source.fromPublisher(upstream2) ~> zip.in1 + zip.out ~> out - ClosedShape + ClosedShape }).run() upstream1.sendNext(1) @@ -136,15 +133,14 @@ class GraphZipSpec extends TwoStreamsSetup { val upstream2 = TestPublisher.probe[String]() val downstream = TestSubscriber.probe[(Int, String)]() - RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ - out ⇒ - val zip = b.add(Zip[Int, String]()) + RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ out ⇒ + val zip = b.add(Zip[Int, String]()) - Source.fromPublisher(upstream1) ~> zip.in0 - Source.fromPublisher(upstream2) ~> zip.in1 - zip.out ~> out + Source.fromPublisher(upstream1) ~> zip.in0 + Source.fromPublisher(upstream2) ~> zip.in1 + zip.out ~> out - ClosedShape + ClosedShape }).run() upstream1.sendNext(1) @@ -163,15 +159,14 @@ class GraphZipSpec extends TwoStreamsSetup { val upstream2 = TestPublisher.probe[String]() val downstream = TestSubscriber.probe[(Int, String)]() - RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ - out ⇒ - val zip = b.add(Zip[Int, String]()) + RunnableGraph.fromGraph(GraphDSL.create(Sink.fromSubscriber(downstream)) { implicit b ⇒ out ⇒ + val zip = b.add(Zip[Int, String]()) - Source.fromPublisher(upstream1) ~> zip.in0 - Source.fromPublisher(upstream2) ~> zip.in1 - zip.out ~> out + Source.fromPublisher(upstream1) ~> zip.in0 + Source.fromPublisher(upstream2) ~> zip.in1 + zip.out ~> out - ClosedShape + ClosedShape }).run() downstream.ensureSubscription() diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/PublisherSinkSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/PublisherSinkSpec.scala index aa2b5cddb3..53e728e67e 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/PublisherSinkSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/PublisherSinkSpec.scala @@ -19,16 +19,15 @@ class PublisherSinkSpec extends AkkaSpec { "be unique when created twice" in assertAllStagesStopped { - val (pub1, pub2) = RunnableGraph.fromGraph(GraphDSL.create(Sink.asPublisher[Int](false), Sink.asPublisher[Int](false))(Keep.both) { implicit b ⇒ - (p1, p2) ⇒ - import GraphDSL.Implicits._ + val (pub1, pub2) = RunnableGraph.fromGraph(GraphDSL.create(Sink.asPublisher[Int](false), Sink.asPublisher[Int](false))(Keep.both) { implicit b ⇒ (p1, p2) ⇒ + import GraphDSL.Implicits._ - val bcast = b.add(Broadcast[Int](2)) + val bcast = b.add(Broadcast[Int](2)) - Source(0 to 5) ~> bcast.in - bcast.out(0).map(_ * 2) ~> p1.in - bcast.out(1) ~> p2.in - ClosedShape + Source(0 to 5) ~> bcast.in + bcast.out(0).map(_ * 2) ~> p1.in + bcast.out(1) ~> p2.in + ClosedShape }).run() val f1 = Source.fromPublisher(pub1).map(identity).runFold(0)(_ + _) diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/ReverseArrowSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/ReverseArrowSpec.scala index 075526a7f5..1025f07ab0 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/ReverseArrowSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/ReverseArrowSpec.scala @@ -17,18 +17,16 @@ class ReverseArrowSpec extends AkkaSpec { "Reverse Arrows in the Graph DSL" must { "work from Inlets" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - s.in <~ source - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + s.in <~ source + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "work from SinkShape" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - s <~ source - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + s <~ source + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } @@ -66,133 +64,120 @@ class ReverseArrowSpec extends AkkaSpec { } "work from FlowShape" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - val f: FlowShape[Int, Int] = b.add(Flow[Int]) - f <~ source - f ~> s - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + val f: FlowShape[Int, Int] = b.add(Flow[Int]) + f <~ source + f ~> s + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "work from UniformFanInShape" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - val f: UniformFanInShape[Int, Int] = b.add(Merge[Int](2)) - f <~ source - f <~ Source.empty - f ~> s - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + val f: UniformFanInShape[Int, Int] = b.add(Merge[Int](2)) + f <~ source + f <~ Source.empty + f ~> s + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "work from UniformFanOutShape" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - val f: UniformFanOutShape[Int, Int] = b.add(Broadcast[Int](2)) - f <~ source - f ~> Sink.ignore - f ~> s - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + val f: UniformFanOutShape[Int, Int] = b.add(Broadcast[Int](2)) + f <~ source + f ~> Sink.ignore + f ~> s + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "work towards Outlets" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - val o: Outlet[Int] = b.add(source).out - s <~ o - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + val o: Outlet[Int] = b.add(source).out + s <~ o + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "work towards SourceShape" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - val o: SourceShape[Int] = b.add(source) - s <~ o - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + val o: SourceShape[Int] = b.add(source) + s <~ o + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "work towards Source" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - s <~ source - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + s <~ source + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "work towards FlowShape" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - val f: FlowShape[Int, Int] = b.add(Flow[Int]) - s <~ f - source ~> f - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + val f: FlowShape[Int, Int] = b.add(Flow[Int]) + s <~ f + source ~> f + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "work towards UniformFanInShape" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - val f: UniformFanInShape[Int, Int] = b.add(Merge[Int](2)) - s <~ f - Source.empty ~> f - source ~> f - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + val f: UniformFanInShape[Int, Int] = b.add(Merge[Int](2)) + s <~ f + Source.empty ~> f + source ~> f + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "fail towards already full UniformFanInShape" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - val f: UniformFanInShape[Int, Int] = b.add(Merge[Int](2)) - val src = b.add(source) - Source.empty ~> f - src ~> f - (the[IllegalArgumentException] thrownBy (s <~ f <~ src)).getMessage should include("no more inlets free") - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + val f: UniformFanInShape[Int, Int] = b.add(Merge[Int](2)) + val src = b.add(source) + Source.empty ~> f + src ~> f + (the[IllegalArgumentException] thrownBy (s <~ f <~ src)).getMessage should include("no more inlets free") + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "work towards UniformFanOutShape" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - val f: UniformFanOutShape[Int, Int] = b.add(Broadcast[Int](2)) - s <~ f - Sink.ignore <~ f - source ~> f - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + val f: UniformFanOutShape[Int, Int] = b.add(Broadcast[Int](2)) + s <~ f + Sink.ignore <~ f + source ~> f + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "fail towards already full UniformFanOutShape" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - val f: UniformFanOutShape[Int, Int] = b.add(Broadcast[Int](2)) - val sink2: SinkShape[Int] = b.add(Sink.ignore) - val src = b.add(source) - src ~> f - sink2 <~ f - (the[IllegalArgumentException] thrownBy (s <~ f <~ src)).getMessage should include("already connected") - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + val f: UniformFanOutShape[Int, Int] = b.add(Broadcast[Int](2)) + val sink2: SinkShape[Int] = b.add(Sink.ignore) + val src = b.add(source) + src ~> f + sink2 <~ f + (the[IllegalArgumentException] thrownBy (s <~ f <~ src)).getMessage should include("already connected") + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "work across a Flow" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - s <~ Flow[Int] <~ source - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + s <~ Flow[Int] <~ source + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } "work across a FlowShape" in { - Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ - s ⇒ - s <~ b.add(Flow[Int]) <~ source - ClosedShape + Await.result(RunnableGraph.fromGraph(GraphDSL.create(sink) { implicit b ⇒ s ⇒ + s <~ b.add(Flow[Int]) <~ source + ClosedShape }).run(), 1.second) should ===(Seq(1, 2, 3)) } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/SinkForeachParallelSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/SinkForeachParallelSpec.scala index 6bfa3d83c3..5b1458eb40 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/SinkForeachParallelSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/SinkForeachParallelSpec.scala @@ -23,7 +23,7 @@ class SinkForeachParallelSpec extends AkkaSpec { implicit val ec = system.dispatcher val probe = TestProbe() - val latch = (1 to 4).map(_ -> TestLatch(1)).toMap + val latch = (1 to 4).map(_ → TestLatch(1)).toMap val p = Source(1 to 4).runWith(Sink.foreachParallel(4)((n: Int) ⇒ { Await.ready(latch(n), 5.seconds) probe.ref ! n @@ -48,7 +48,7 @@ class SinkForeachParallelSpec extends AkkaSpec { implicit val ec = system.dispatcher val probe = TestProbe() - val latch = (1 to 5).map(_ -> TestLatch()).toMap + val latch = (1 to 5).map(_ → TestLatch()).toMap val p = Source(1 to 5).runWith(Sink.foreachParallel(4)((n: Int) ⇒ { probe.ref ! n diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/SinkSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/SinkSpec.scala index 2e67760b12..4a1b9e492c 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/SinkSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/SinkSpec.scala @@ -42,12 +42,11 @@ class SinkSpec extends AkkaSpec with DefaultTimeout with ScalaFutures { "be composable with importing 1 module" in { val probes = Array.fill(3)(TestSubscriber.manualProbe[Int]) - val sink = Sink.fromGraph(GraphDSL.create(Sink.fromSubscriber(probes(0))) { implicit b ⇒ - s0 ⇒ - val bcast = b.add(Broadcast[Int](3)) - bcast.out(0) ~> Flow[Int].filter(_ == 0) ~> s0.in - for (i ← 1 to 2) bcast.out(i).filter(_ == i) ~> Sink.fromSubscriber(probes(i)) - SinkShape(bcast.in) + val sink = Sink.fromGraph(GraphDSL.create(Sink.fromSubscriber(probes(0))) { implicit b ⇒ s0 ⇒ + val bcast = b.add(Broadcast[Int](3)) + bcast.out(0) ~> Flow[Int].filter(_ == 0) ~> s0.in + for (i ← 1 to 2) bcast.out(i).filter(_ == i) ~> Sink.fromSubscriber(probes(i)) + SinkShape(bcast.in) }) Source(List(0, 1, 2)).runWith(sink) @@ -59,13 +58,12 @@ class SinkSpec extends AkkaSpec with DefaultTimeout with ScalaFutures { "be composable with importing 2 modules" in { val probes = Array.fill(3)(TestSubscriber.manualProbe[Int]) - val sink = Sink.fromGraph(GraphDSL.create(Sink.fromSubscriber(probes(0)), Sink.fromSubscriber(probes(1)))(List(_, _)) { implicit b ⇒ - (s0, s1) ⇒ - val bcast = b.add(Broadcast[Int](3)) - bcast.out(0).filter(_ == 0) ~> s0.in - bcast.out(1).filter(_ == 1) ~> s1.in - bcast.out(2).filter(_ == 2) ~> Sink.fromSubscriber(probes(2)) - SinkShape(bcast.in) + val sink = Sink.fromGraph(GraphDSL.create(Sink.fromSubscriber(probes(0)), Sink.fromSubscriber(probes(1)))(List(_, _)) { implicit b ⇒ (s0, s1) ⇒ + val bcast = b.add(Broadcast[Int](3)) + bcast.out(0).filter(_ == 0) ~> s0.in + bcast.out(1).filter(_ == 1) ~> s1.in + bcast.out(2).filter(_ == 2) ~> Sink.fromSubscriber(probes(2)) + SinkShape(bcast.in) }) Source(List(0, 1, 2)).runWith(sink) @@ -77,13 +75,12 @@ class SinkSpec extends AkkaSpec with DefaultTimeout with ScalaFutures { "be composable with importing 3 modules" in { val probes = Array.fill(3)(TestSubscriber.manualProbe[Int]) - val sink = Sink.fromGraph(GraphDSL.create(Sink.fromSubscriber(probes(0)), Sink.fromSubscriber(probes(1)), Sink.fromSubscriber(probes(2)))(List(_, _, _)) { implicit b ⇒ - (s0, s1, s2) ⇒ - val bcast = b.add(Broadcast[Int](3)) - bcast.out(0).filter(_ == 0) ~> s0.in - bcast.out(1).filter(_ == 1) ~> s1.in - bcast.out(2).filter(_ == 2) ~> s2.in - SinkShape(bcast.in) + val sink = Sink.fromGraph(GraphDSL.create(Sink.fromSubscriber(probes(0)), Sink.fromSubscriber(probes(1)), Sink.fromSubscriber(probes(2)))(List(_, _, _)) { implicit b ⇒ (s0, s1, s2) ⇒ + val bcast = b.add(Broadcast[Int](3)) + bcast.out(0).filter(_ == 0) ~> s0.in + bcast.out(1).filter(_ == 1) ~> s1.in + bcast.out(2).filter(_ == 2) ~> s2.in + SinkShape(bcast.in) }) Source(List(0, 1, 2)).runWith(sink) @@ -142,10 +139,11 @@ class SinkSpec extends AkkaSpec with DefaultTimeout with ScalaFutures { "Java collector Sink" must { import scala.compat.java8.FunctionConverters._ - class TestCollector(_supplier: () ⇒ Supplier[Array[Int]], - _accumulator: () ⇒ BiConsumer[Array[Int], Int], - _combiner: () ⇒ BinaryOperator[Array[Int]], - _finisher: () ⇒ function.Function[Array[Int], Int]) extends Collector[Int, Array[Int], Int] { + class TestCollector( + _supplier: () ⇒ Supplier[Array[Int]], + _accumulator: () ⇒ BiConsumer[Array[Int], Int], + _combiner: () ⇒ BinaryOperator[Array[Int]], + _finisher: () ⇒ function.Function[Array[Int], Int]) extends Collector[Int, Array[Int], Int] { override def supplier(): Supplier[Array[Int]] = _supplier() override def combiner(): BinaryOperator[Array[Int]] = _combiner() override def finisher(): function.Function[Array[Int], Int] = _finisher() diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/SourceSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/SourceSpec.scala index a784c89d7a..1beda33549 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/SourceSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/SourceSpec.scala @@ -143,16 +143,15 @@ class SourceSpec extends AkkaSpec with DefaultTimeout { val source = Source.asSubscriber[Int] val out = TestSubscriber.manualProbe[Int] - val s = Source.fromGraph(GraphDSL.create(source, source, source, source, source)(immutable.Seq(_, _, _, _, _)) { implicit b ⇒ - (i0, i1, i2, i3, i4) ⇒ - import GraphDSL.Implicits._ - val m = b.add(Merge[Int](5)) - i0.out ~> m.in(0) - i1.out ~> m.in(1) - i2.out ~> m.in(2) - i3.out ~> m.in(3) - i4.out ~> m.in(4) - SourceShape(m.out) + val s = Source.fromGraph(GraphDSL.create(source, source, source, source, source)(immutable.Seq(_, _, _, _, _)) { implicit b ⇒ (i0, i1, i2, i3, i4) ⇒ + import GraphDSL.Implicits._ + val m = b.add(Merge[Int](5)) + i0.out ~> m.in(0) + i1.out ~> m.in(1) + i2.out ~> m.in(2) + i3.out ~> m.in(3) + i4.out ~> m.in(4) + SourceShape(m.out) }).to(Sink.fromSubscriber(out)).run() for (i ← 0 to 4) probes(i).subscribe(s(i)) @@ -241,11 +240,11 @@ class SourceSpec extends AkkaSpec with DefaultTimeout { EventFilter[RuntimeException](message = "expected", occurrences = 1) intercept whenReady( Source.unfold((0, 1)) { - case (a, _) if a > 10000000 ⇒ throw t - case (a, b) ⇒ Some((b, a + b) → a) - }.runFold(List.empty[Int]) { case (xs, x) ⇒ x :: xs }.failed) { - _ should be theSameInstanceAs (t) - } + case (a, _) if a > 10000000 ⇒ throw t + case (a, b) ⇒ Some((b, a + b) → a) + }.runFold(List.empty[Int]) { case (xs, x) ⇒ x :: xs }.failed) { + _ should be theSameInstanceAs (t) + } } "generate a finite fibonacci sequence asynchronously" in { diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/StageActorRefSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/StageActorRefSpec.scala index 6ff9e9d9d5..566e036383 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/StageActorRefSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/StageActorRefSpec.scala @@ -228,7 +228,7 @@ object StageActorRefSpec { }) } - logic -> p.future + logic → p.future } } diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/UnfoldResourceAsyncSourceSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/UnfoldResourceAsyncSourceSpec.scala index a5dc0ae744..669f8a6e6e 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/UnfoldResourceAsyncSourceSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/UnfoldResourceAsyncSourceSpec.scala @@ -62,10 +62,11 @@ class UnfoldResourceAsyncSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { val closePromiseCalled = Promise[Done]() val resource = new BufferedReader(new FileReader(manyLinesFile)) - val p = Source.unfoldResourceAsync[String, BufferedReader](() ⇒ { - createPromiseCalled.success(Done) - createPromise.future - }, + val p = Source.unfoldResourceAsync[String, BufferedReader]( + () ⇒ { + createPromiseCalled.success(Done) + createPromise.future + }, reader ⇒ { readPromiseCalled.success(Done) readPromise.future @@ -107,10 +108,11 @@ class UnfoldResourceAsyncSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { val closePromiseCalled = Promise[Done]() val resource = new BufferedReader(new FileReader(manyLinesFile)) - val p = Source.unfoldResourceAsync[String, BufferedReader](() ⇒ { - createPromiseCalled.success(Done) - createPromise.future - }, + val p = Source.unfoldResourceAsync[String, BufferedReader]( + () ⇒ { + createPromiseCalled.success(Done) + createPromise.future + }, reader ⇒ { readPromiseCalled.success(Done) readPromise.future @@ -134,7 +136,8 @@ class UnfoldResourceAsyncSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { } "continue when Strategy is Resume and exception happened" in assertAllStagesStopped { - val p = Source.unfoldResourceAsync[String, BufferedReader](open, + val p = Source.unfoldResourceAsync[String, BufferedReader]( + open, reader ⇒ { val s = reader.readLine() if (s != null && s.contains("b")) throw TE("") else Promise.successful(Option(s)).future @@ -154,7 +157,8 @@ class UnfoldResourceAsyncSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { } "close and open stream again when Strategy is Restart" in assertAllStagesStopped { - val p = Source.unfoldResourceAsync[String, BufferedReader](open, + val p = Source.unfoldResourceAsync[String, BufferedReader]( + open, reader ⇒ { val s = reader.readLine() if (s != null && s.contains("b")) throw TE("") else Promise.successful(Option(s)).future @@ -175,7 +179,8 @@ class UnfoldResourceAsyncSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { "work with ByteString as well" in assertAllStagesStopped { val chunkSize = 50 val buffer = Array.ofDim[Char](chunkSize) - val p = Source.unfoldResourceAsync[ByteString, Reader](open, + val p = Source.unfoldResourceAsync[ByteString, Reader]( + open, reader ⇒ { val p = Promise[Option[ByteString]] val s = reader.read(buffer) @@ -210,7 +215,8 @@ class UnfoldResourceAsyncSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { val sys = ActorSystem("dispatcher-testing", UnboundedMailboxConfig) val materializer = ActorMaterializer()(sys) try { - val p = Source.unfoldResourceAsync[String, BufferedReader](open, + val p = Source.unfoldResourceAsync[String, BufferedReader]( + open, read, close).runWith(TestSink.probe)(materializer) materializer.asInstanceOf[ActorMaterializerImpl].supervisor.tell(StreamSupervisor.GetChildren, testActor) @@ -220,7 +226,8 @@ class UnfoldResourceAsyncSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { } "fail when create throws exception" in assertAllStagesStopped { - val p = Source.unfoldResourceAsync[String, BufferedReader](() ⇒ throw TE(""), + val p = Source.unfoldResourceAsync[String, BufferedReader]( + () ⇒ throw TE(""), read, close).runWith(Sink.asPublisher(false)) val c = TestSubscriber.manualProbe[String]() p.subscribe(c) @@ -230,7 +237,8 @@ class UnfoldResourceAsyncSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { } "fail when close throws exception" in assertAllStagesStopped { - val p = Source.unfoldResourceAsync[String, BufferedReader](open, + val p = Source.unfoldResourceAsync[String, BufferedReader]( + open, read, reader ⇒ throw TE("")) .runWith(Sink.asPublisher(false)) val c = TestSubscriber.manualProbe[String]() diff --git a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/UnfoldResourceSourceSpec.scala b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/UnfoldResourceSourceSpec.scala index 1c4b7ed68e..bfd560f2f1 100644 --- a/akka-stream-tests/src/test/scala/akka/stream/scaladsl/UnfoldResourceSourceSpec.scala +++ b/akka-stream-tests/src/test/scala/akka/stream/scaladsl/UnfoldResourceSourceSpec.scala @@ -43,7 +43,8 @@ class UnfoldResourceSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { "Unfold Resource Source" must { "read contents from a file" in assertAllStagesStopped { - val p = Source.unfoldResource[String, BufferedReader](() ⇒ new BufferedReader(new FileReader(manyLinesFile)), + val p = Source.unfoldResource[String, BufferedReader]( + () ⇒ new BufferedReader(new FileReader(manyLinesFile)), reader ⇒ Option(reader.readLine()), reader ⇒ reader.close()) .runWith(Sink.asPublisher(false)) @@ -69,7 +70,8 @@ class UnfoldResourceSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { } "continue when Strategy is Resume and exception happened" in assertAllStagesStopped { - val p = Source.unfoldResource[String, BufferedReader](() ⇒ new BufferedReader(new FileReader(manyLinesFile)), + val p = Source.unfoldResource[String, BufferedReader]( + () ⇒ new BufferedReader(new FileReader(manyLinesFile)), reader ⇒ { val s = reader.readLine() if (s != null && s.contains("b")) throw TE("") else Option(s) @@ -90,7 +92,8 @@ class UnfoldResourceSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { } "close and open stream again when Strategy is Restart" in assertAllStagesStopped { - val p = Source.unfoldResource[String, BufferedReader](() ⇒ new BufferedReader(new FileReader(manyLinesFile)), + val p = Source.unfoldResource[String, BufferedReader]( + () ⇒ new BufferedReader(new FileReader(manyLinesFile)), reader ⇒ { val s = reader.readLine() if (s != null && s.contains("b")) throw TE("") else Option(s) @@ -112,7 +115,8 @@ class UnfoldResourceSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { "work with ByteString as well" in assertAllStagesStopped { val chunkSize = 50 val buffer = Array.ofDim[Char](chunkSize) - val p = Source.unfoldResource[ByteString, Reader](() ⇒ new BufferedReader(new FileReader(manyLinesFile)), + val p = Source.unfoldResource[ByteString, Reader]( + () ⇒ new BufferedReader(new FileReader(manyLinesFile)), reader ⇒ { val s = reader.read(buffer) if (s > 0) Some(ByteString(buffer.mkString("")).take(s)) else None @@ -143,7 +147,8 @@ class UnfoldResourceSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { val sys = ActorSystem("dispatcher-testing", UnboundedMailboxConfig) val materializer = ActorMaterializer()(sys) try { - val p = Source.unfoldResource[String, BufferedReader](() ⇒ new BufferedReader(new FileReader(manyLinesFile)), + val p = Source.unfoldResource[String, BufferedReader]( + () ⇒ new BufferedReader(new FileReader(manyLinesFile)), reader ⇒ Option(reader.readLine()), reader ⇒ reader.close()).runWith(TestSink.probe)(materializer) @@ -154,7 +159,8 @@ class UnfoldResourceSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { } "fail when create throws exception" in assertAllStagesStopped { - val p = Source.unfoldResource[String, BufferedReader](() ⇒ throw TE(""), + val p = Source.unfoldResource[String, BufferedReader]( + () ⇒ throw TE(""), reader ⇒ Option(reader.readLine()), reader ⇒ reader.close()) .runWith(Sink.asPublisher(false)) @@ -166,7 +172,8 @@ class UnfoldResourceSourceSpec extends AkkaSpec(UnboundedMailboxConfig) { } "fail when close throws exception" in assertAllStagesStopped { - val p = Source.unfoldResource[String, BufferedReader](() ⇒ new BufferedReader(new FileReader(manyLinesFile)), + val p = Source.unfoldResource[String, BufferedReader]( + () ⇒ new BufferedReader(new FileReader(manyLinesFile)), reader ⇒ Option(reader.readLine()), reader ⇒ throw TE("")) .runWith(Sink.asPublisher(false)) diff --git a/akka-stream/src/main/scala/akka/stream/ActorMaterializer.scala b/akka-stream/src/main/scala/akka/stream/ActorMaterializer.scala index 4f06227db3..1e7ede7b60 100644 --- a/akka-stream/src/main/scala/akka/stream/ActorMaterializer.scala +++ b/akka-stream/src/main/scala/akka/stream/ActorMaterializer.scala @@ -202,16 +202,16 @@ object ActorMaterializerSettings { * Create [[ActorMaterializerSettings]] from individual settings (Scala). */ def apply( - initialInputBufferSize: Int, - maxInputBufferSize: Int, - dispatcher: String, - supervisionDecider: Supervision.Decider, + initialInputBufferSize: Int, + maxInputBufferSize: Int, + dispatcher: String, + supervisionDecider: Supervision.Decider, subscriptionTimeoutSettings: StreamSubscriptionTimeoutSettings, - debugLogging: Boolean, - outputBurstLimit: Int, - fuzzingMode: Boolean, - autoFusing: Boolean, - maxFixedBufferSize: Int) = + debugLogging: Boolean, + outputBurstLimit: Int, + fuzzingMode: Boolean, + autoFusing: Boolean, + maxFixedBufferSize: Int) = new ActorMaterializerSettings( initialInputBufferSize, maxInputBufferSize, dispatcher, supervisionDecider, subscriptionTimeoutSettings, debugLogging, outputBurstLimit, fuzzingMode, autoFusing, maxFixedBufferSize) @@ -243,16 +243,16 @@ object ActorMaterializerSettings { * Create [[ActorMaterializerSettings]] from individual settings (Java). */ def create( - initialInputBufferSize: Int, - maxInputBufferSize: Int, - dispatcher: String, - supervisionDecider: Supervision.Decider, + initialInputBufferSize: Int, + maxInputBufferSize: Int, + dispatcher: String, + supervisionDecider: Supervision.Decider, subscriptionTimeoutSettings: StreamSubscriptionTimeoutSettings, - debugLogging: Boolean, - outputBurstLimit: Int, - fuzzingMode: Boolean, - autoFusing: Boolean, - maxFixedBufferSize: Int) = + debugLogging: Boolean, + outputBurstLimit: Int, + fuzzingMode: Boolean, + autoFusing: Boolean, + maxFixedBufferSize: Int) = new ActorMaterializerSettings( initialInputBufferSize, maxInputBufferSize, dispatcher, supervisionDecider, subscriptionTimeoutSettings, debugLogging, outputBurstLimit, fuzzingMode, autoFusing, maxFixedBufferSize) @@ -277,28 +277,29 @@ object ActorMaterializerSettings { * Please refer to the `withX` methods for descriptions of the individual settings. */ final class ActorMaterializerSettings private ( - val initialInputBufferSize: Int, - val maxInputBufferSize: Int, - val dispatcher: String, - val supervisionDecider: Supervision.Decider, + val initialInputBufferSize: Int, + val maxInputBufferSize: Int, + val dispatcher: String, + val supervisionDecider: Supervision.Decider, val subscriptionTimeoutSettings: StreamSubscriptionTimeoutSettings, - val debugLogging: Boolean, - val outputBurstLimit: Int, - val fuzzingMode: Boolean, - val autoFusing: Boolean, - val maxFixedBufferSize: Int, - val syncProcessingLimit: Int) { + val debugLogging: Boolean, + val outputBurstLimit: Int, + val fuzzingMode: Boolean, + val autoFusing: Boolean, + val maxFixedBufferSize: Int, + val syncProcessingLimit: Int) { - def this(initialInputBufferSize: Int, - maxInputBufferSize: Int, - dispatcher: String, - supervisionDecider: Supervision.Decider, - subscriptionTimeoutSettings: StreamSubscriptionTimeoutSettings, - debugLogging: Boolean, - outputBurstLimit: Int, - fuzzingMode: Boolean, - autoFusing: Boolean, - maxFixedBufferSize: Int) { + def this( + initialInputBufferSize: Int, + maxInputBufferSize: Int, + dispatcher: String, + supervisionDecider: Supervision.Decider, + subscriptionTimeoutSettings: StreamSubscriptionTimeoutSettings, + debugLogging: Boolean, + outputBurstLimit: Int, + fuzzingMode: Boolean, + autoFusing: Boolean, + maxFixedBufferSize: Int) { this(initialInputBufferSize, maxInputBufferSize, dispatcher, supervisionDecider, subscriptionTimeoutSettings, debugLogging, outputBurstLimit, fuzzingMode, autoFusing, maxFixedBufferSize, defaultMaxFixedBufferSize) } @@ -310,17 +311,17 @@ final class ActorMaterializerSettings private ( require(initialInputBufferSize <= maxInputBufferSize, s"initialInputBufferSize($initialInputBufferSize) must be <= maxInputBufferSize($maxInputBufferSize)") private def copy( - initialInputBufferSize: Int = this.initialInputBufferSize, - maxInputBufferSize: Int = this.maxInputBufferSize, - dispatcher: String = this.dispatcher, - supervisionDecider: Supervision.Decider = this.supervisionDecider, + initialInputBufferSize: Int = this.initialInputBufferSize, + maxInputBufferSize: Int = this.maxInputBufferSize, + dispatcher: String = this.dispatcher, + supervisionDecider: Supervision.Decider = this.supervisionDecider, subscriptionTimeoutSettings: StreamSubscriptionTimeoutSettings = this.subscriptionTimeoutSettings, - debugLogging: Boolean = this.debugLogging, - outputBurstLimit: Int = this.outputBurstLimit, - fuzzingMode: Boolean = this.fuzzingMode, - autoFusing: Boolean = this.autoFusing, - maxFixedBufferSize: Int = this.maxFixedBufferSize, - syncProcessingLimit: Int = this.syncProcessingLimit) = { + debugLogging: Boolean = this.debugLogging, + outputBurstLimit: Int = this.outputBurstLimit, + fuzzingMode: Boolean = this.fuzzingMode, + autoFusing: Boolean = this.autoFusing, + maxFixedBufferSize: Int = this.maxFixedBufferSize, + syncProcessingLimit: Int = this.syncProcessingLimit) = { new ActorMaterializerSettings( initialInputBufferSize, maxInputBufferSize, dispatcher, supervisionDecider, subscriptionTimeoutSettings, debugLogging, outputBurstLimit, fuzzingMode, autoFusing, maxFixedBufferSize, syncProcessingLimit) diff --git a/akka-stream/src/main/scala/akka/stream/Attributes.scala b/akka-stream/src/main/scala/akka/stream/Attributes.scala index 2a76dcc916..e46a53c356 100644 --- a/akka-stream/src/main/scala/akka/stream/Attributes.scala +++ b/akka-stream/src/main/scala/akka/stream/Attributes.scala @@ -74,7 +74,7 @@ final case class Attributes(attributeList: List[Attributes.Attribute] = Nil) { * Java API: Get the first (least specific) attribute of a given `Class` or subclass thereof. */ def getFirstAttribute[T <: Attribute](c: Class[T]): Optional[T] = - attributeList.collectFirst { case attr if c.isInstance(attr) => c cast attr }.asJava + attributeList.collectFirst { case attr if c.isInstance(attr) ⇒ c cast attr }.asJava /** * Scala API: get all attributes of a given type (or subtypes thereof). @@ -105,7 +105,7 @@ final case class Attributes(attributeList: List[Attributes.Attribute] = Nil) { */ def get[T <: Attribute: ClassTag]: Option[T] = { val c = classTag[T].runtimeClass.asInstanceOf[Class[T]] - attributeList.reverseIterator.collectFirst[T] { case attr if c.isInstance(attr) => c.cast(attr) } + attributeList.reverseIterator.collectFirst[T] { case attr if c.isInstance(attr) ⇒ c.cast(attr) } } /** @@ -113,7 +113,7 @@ final case class Attributes(attributeList: List[Attributes.Attribute] = Nil) { */ def getFirst[T <: Attribute: ClassTag]: Option[T] = { val c = classTag[T].runtimeClass.asInstanceOf[Class[T]] - attributeList.collectFirst { case attr if c.isInstance(attr) => c.cast(attr) } + attributeList.collectFirst { case attr if c.isInstance(attr) ⇒ c.cast(attr) } } /** diff --git a/akka-stream/src/main/scala/akka/stream/Fusing.scala b/akka-stream/src/main/scala/akka/stream/Fusing.scala index 6ff1277fd5..b89641eef5 100644 --- a/akka-stream/src/main/scala/akka/stream/Fusing.scala +++ b/akka-stream/src/main/scala/akka/stream/Fusing.scala @@ -38,8 +38,9 @@ object Fusing { * holds more information on the operation structure of the contained stream * topology for convenient graph traversal. */ - case class FusedGraph[+S <: Shape @uncheckedVariance, +M](override val module: FusedModule, - override val shape: S) extends Graph[S, M] { + case class FusedGraph[+S <: Shape @uncheckedVariance, +M]( + override val module: FusedModule, + override val shape: S) extends Graph[S, M] { // the @uncheckedVariance look like a compiler bug ... why does it work in Graph but not here? override def withAttributes(attr: Attributes) = copy(module = module.withAttributes(attr)) } @@ -47,8 +48,8 @@ object Fusing { object FusedGraph { def unapply[S <: Shape, M](g: Graph[S, M]): Option[(FusedModule, S)] = g.module match { - case f: FusedModule => Some((f, g.shape)) - case _ => None + case f: FusedModule ⇒ Some((f, g.shape)) + case _ ⇒ None } } @@ -59,10 +60,11 @@ object Fusing { * the wirings in a more accessible form, allowing traversal from port to upstream * or downstream port and from there to the owning module (or graph vertex). */ - final case class StructuralInfo(upstreams: immutable.Map[InPort, OutPort], - downstreams: immutable.Map[OutPort, InPort], - inOwners: immutable.Map[InPort, Module], - outOwners: immutable.Map[OutPort, Module], - allModules: Set[Module]) + final case class StructuralInfo( + upstreams: immutable.Map[InPort, OutPort], + downstreams: immutable.Map[OutPort, InPort], + inOwners: immutable.Map[InPort, Module], + outOwners: immutable.Map[OutPort, Module], + allModules: Set[Module]) } diff --git a/akka-stream/src/main/scala/akka/stream/Materializer.scala b/akka-stream/src/main/scala/akka/stream/Materializer.scala index 32d739def7..5b0a6b3729 100644 --- a/akka-stream/src/main/scala/akka/stream/Materializer.scala +++ b/akka-stream/src/main/scala/akka/stream/Materializer.scala @@ -78,6 +78,6 @@ private[akka] object NoMaterializer extends Materializer { * Context parameter to the `create` methods of sources and sinks. */ private[akka] case class MaterializationContext( - materializer: Materializer, + materializer: Materializer, effectiveAttributes: Attributes, - stageName: String) + stageName: String) diff --git a/akka-stream/src/main/scala/akka/stream/Shape.scala b/akka-stream/src/main/scala/akka/stream/Shape.scala index 1afe64802f..9c8556900e 100644 --- a/akka-stream/src/main/scala/akka/stream/Shape.scala +++ b/akka-stream/src/main/scala/akka/stream/Shape.scala @@ -306,10 +306,11 @@ object SinkShape { * +------+ * }}} */ -final case class BidiShape[-In1, +Out1, -In2, +Out2](in1: Inlet[In1 @uncheckedVariance], - out1: Outlet[Out1 @uncheckedVariance], - in2: Inlet[In2 @uncheckedVariance], - out2: Outlet[Out2 @uncheckedVariance]) extends Shape { +final case class BidiShape[-In1, +Out1, -In2, +Out2]( + in1: Inlet[In1 @uncheckedVariance], + out1: Outlet[Out1 @uncheckedVariance], + in2: Inlet[In2 @uncheckedVariance], + out2: Outlet[Out2 @uncheckedVariance]) extends Shape { //#implementation-details-elided override val inlets: immutable.Seq[Inlet[_]] = List(in1, in2) override val outlets: immutable.Seq[Outlet[_]] = List(out1, out2) @@ -335,10 +336,11 @@ object BidiShape { BidiShape(top.in, top.out, bottom.in, bottom.out) /** Java API */ - def of[In1, Out1, In2, Out2](in1: Inlet[In1 @uncheckedVariance], - out1: Outlet[Out1 @uncheckedVariance], - in2: Inlet[In2 @uncheckedVariance], - out2: Outlet[Out2 @uncheckedVariance]): BidiShape[In1, Out1, In2, Out2] = + def of[In1, Out1, In2, Out2]( + in1: Inlet[In1 @uncheckedVariance], + out1: Outlet[Out1 @uncheckedVariance], + in2: Inlet[In2 @uncheckedVariance], + out2: Outlet[Out2 @uncheckedVariance]): BidiShape[In1, Out1, In2, Out2] = BidiShape(in1, out1, in2, out2) } diff --git a/akka-stream/src/main/scala/akka/stream/SslTlsOptions.scala b/akka-stream/src/main/scala/akka/stream/SslTlsOptions.scala index 944f6c3d35..7f02f4e1c0 100644 --- a/akka-stream/src/main/scala/akka/stream/SslTlsOptions.scala +++ b/akka-stream/src/main/scala/akka/stream/SslTlsOptions.scala @@ -190,9 +190,9 @@ object TLSProtocol { */ case class NegotiateNewSession( enabledCipherSuites: Option[immutable.Seq[String]], - enabledProtocols: Option[immutable.Seq[String]], - clientAuth: Option[TLSClientAuth], - sslParameters: Option[SSLParameters]) extends SslTlsOutbound { + enabledProtocols: Option[immutable.Seq[String]], + clientAuth: Option[TLSClientAuth], + sslParameters: Option[SSLParameters]) extends SslTlsOutbound { /** * Java API: Make a copy of this message with the given `enabledCipherSuites`. diff --git a/akka-stream/src/main/scala/akka/stream/actor/ActorPublisher.scala b/akka-stream/src/main/scala/akka/stream/actor/ActorPublisher.scala index ee930b4b24..7eec474a83 100644 --- a/akka-stream/src/main/scala/akka/stream/actor/ActorPublisher.scala +++ b/akka-stream/src/main/scala/akka/stream/actor/ActorPublisher.scala @@ -303,7 +303,8 @@ trait ActorPublisher[T] extends Actor { tryOnComplete(sub) case Active | Canceled ⇒ tryOnSubscribe(sub, CancelledSubscription) - tryOnError(sub, + tryOnError( + sub, if (subscriber == sub) ReactiveStreamsCompliance.canNotSubscribeTheSameSubscriberMultipleTimesException else ReactiveStreamsCompliance.canNotSubscribeTheSameSubscriberMultipleTimesException) } diff --git a/akka-stream/src/main/scala/akka/stream/impl/ActorMaterializerImpl.scala b/akka-stream/src/main/scala/akka/stream/impl/ActorMaterializerImpl.scala index 065ec7092a..a8077aa412 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/ActorMaterializerImpl.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/ActorMaterializerImpl.scala @@ -26,12 +26,13 @@ import akka.stream.impl.fusing.GraphInterpreterShell /** * INTERNAL API */ -private[akka] case class ActorMaterializerImpl(system: ActorSystem, - override val settings: ActorMaterializerSettings, - dispatchers: Dispatchers, - supervisor: ActorRef, - haveShutDown: AtomicBoolean, - flowNames: SeqActorName) extends ActorMaterializer { +private[akka] case class ActorMaterializerImpl( + system: ActorSystem, + override val settings: ActorMaterializerSettings, + dispatchers: Dispatchers, + supervisor: ActorRef, + haveShutDown: AtomicBoolean, + flowNames: SeqActorName) extends ActorMaterializer { import akka.stream.impl.Stages._ private val _logger = Logging.getLogger(system, this) override def logger = _logger @@ -78,8 +79,9 @@ private[akka] case class ActorMaterializerImpl(system: ActorSystem, override def materialize[Mat](_runnableGraph: Graph[ClosedShape, Mat]): Mat = materialize(_runnableGraph, null) - private[stream] def materialize[Mat](_runnableGraph: Graph[ClosedShape, Mat], - subflowFuser: GraphInterpreterShell ⇒ ActorRef): Mat = { + private[stream] def materialize[Mat]( + _runnableGraph: Graph[ClosedShape, Mat], + subflowFuser: GraphInterpreterShell ⇒ ActorRef): Mat = { val runnableGraph = if (settings.autoFusing) Fusing.aggressive(_runnableGraph) else _runnableGraph @@ -142,7 +144,8 @@ private[akka] case class ActorMaterializerImpl(system: ActorSystem, case stage: GraphStageModule ⇒ val graph = - GraphModule(GraphAssembly(stage.shape.inlets, stage.shape.outlets, stage.stage), + GraphModule( + GraphAssembly(stage.shape.inlets, stage.shape.outlets, stage.stage), stage.shape, stage.attributes, Array(stage)) matGraph(graph, effectiveAttributes, matVal) } diff --git a/akka-stream/src/main/scala/akka/stream/impl/ActorRefBackpressureSinkStage.scala b/akka-stream/src/main/scala/akka/stream/impl/ActorRefBackpressureSinkStage.scala index 2060317e26..50f90da798 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/ActorRefBackpressureSinkStage.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/ActorRefBackpressureSinkStage.scala @@ -15,9 +15,9 @@ import akka.stream.stage._ * INTERNAL API */ private[akka] class ActorRefBackpressureSinkStage[In](ref: ActorRef, onInitMessage: Any, - ackMessage: Any, + ackMessage: Any, onCompleteMessage: Any, - onFailureMessage: (Throwable) ⇒ Any) + onFailureMessage: (Throwable) ⇒ Any) extends GraphStage[SinkShape[In]] { val in: Inlet[In] = Inlet[In]("ActorRefBackpressureSink.in") override def initialAttributes = DefaultAttributes.actorRefWithAck diff --git a/akka-stream/src/main/scala/akka/stream/impl/CompletedPublishers.scala b/akka-stream/src/main/scala/akka/stream/impl/CompletedPublishers.scala index 9061de47fd..53cb12edd0 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/CompletedPublishers.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/CompletedPublishers.scala @@ -47,7 +47,7 @@ private[akka] final case class ErrorPublisher(t: Throwable, name: String) extend */ private[akka] final case class MaybePublisher[T]( promise: Promise[Option[T]], - name: String)(implicit ec: ExecutionContext) extends Publisher[T] { + name: String)(implicit ec: ExecutionContext) extends Publisher[T] { import ReactiveStreamsCompliance._ private[this] class MaybeSubscription(subscriber: Subscriber[_ >: T]) extends Subscription { diff --git a/akka-stream/src/main/scala/akka/stream/impl/FanoutProcessor.scala b/akka-stream/src/main/scala/akka/stream/impl/FanoutProcessor.scala index 3fe69931c0..908dc63246 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/FanoutProcessor.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/FanoutProcessor.scala @@ -7,10 +7,11 @@ import org.reactivestreams.Subscriber /** * INTERNAL API */ -private[akka] abstract class FanoutOutputs(val maxBufferSize: Int, - val initialBufferSize: Int, - self: ActorRef, - val pump: Pump) +private[akka] abstract class FanoutOutputs( + val maxBufferSize: Int, + val initialBufferSize: Int, + self: ActorRef, + val pump: Pump) extends DefaultOutputTransferStates with SubscriberManagement[Any] { diff --git a/akka-stream/src/main/scala/akka/stream/impl/ResizableMultiReaderRingBuffer.scala b/akka-stream/src/main/scala/akka/stream/impl/ResizableMultiReaderRingBuffer.scala index a073ffc964..478393ac41 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/ResizableMultiReaderRingBuffer.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/ResizableMultiReaderRingBuffer.scala @@ -13,12 +13,15 @@ import ResizableMultiReaderRingBuffer._ * Contrary to many other ring buffer implementations this one does not automatically overwrite the oldest * elements, rather, if full, the buffer tries to grow and rejects further writes if max capacity is reached. */ -private[akka] class ResizableMultiReaderRingBuffer[T](initialSize: Int, // constructor param, not field - maxSize: Int, // constructor param, not field - val cursors: Cursors) { - require(Integer.lowestOneBit(maxSize) == maxSize && 0 < maxSize && maxSize <= Int.MaxValue / 2, +private[akka] class ResizableMultiReaderRingBuffer[T]( + initialSize: Int, // constructor param, not field + maxSize: Int, // constructor param, not field + val cursors: Cursors) { + require( + Integer.lowestOneBit(maxSize) == maxSize && 0 < maxSize && maxSize <= Int.MaxValue / 2, "maxSize must be a power of 2 that is > 0 and < Int.MaxValue/2") - require(Integer.lowestOneBit(initialSize) == initialSize && 0 < initialSize && initialSize <= maxSize, + require( + Integer.lowestOneBit(initialSize) == initialSize && 0 < initialSize && initialSize <= maxSize, "initialSize must be a power of 2 that is > 0 and <= maxSize") private[this] val maxSizeBit = Integer.numberOfTrailingZeros(maxSize) diff --git a/akka-stream/src/main/scala/akka/stream/impl/Sinks.scala b/akka-stream/src/main/scala/akka/stream/impl/Sinks.scala index 3fb9bbe8ab..0c4295627a 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/Sinks.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/Sinks.scala @@ -95,7 +95,7 @@ private[akka] class PublisherSink[In](val attributes: Attributes, shape: SinkSha */ private[akka] final class FanoutPublisherSink[In]( val attributes: Attributes, - shape: SinkShape[In]) + shape: SinkShape[In]) extends SinkModule[In, Publisher[In]](shape) { override def create(context: MaterializationContext): (Subscriber[In], Publisher[In]) = { @@ -176,12 +176,13 @@ private[akka] final class ActorSubscriberSink[In](props: Props, val attributes: */ private[akka] final class ActorRefSink[In](ref: ActorRef, onCompleteMessage: Any, val attributes: Attributes, - shape: SinkShape[In]) extends SinkModule[In, NotUsed](shape) { + shape: SinkShape[In]) extends SinkModule[In, NotUsed](shape) { override def create(context: MaterializationContext) = { val actorMaterializer = ActorMaterializer.downcast(context.materializer) val effectiveSettings = actorMaterializer.effectiveSettings(context.effectiveAttributes) - val subscriberRef = actorMaterializer.actorOf(context, + val subscriberRef = actorMaterializer.actorOf( + context, ActorRefSinkActor.props(ref, effectiveSettings.maxInputBufferSize, onCompleteMessage)) (akka.stream.actor.ActorSubscriber[In](subscriberRef), NotUsed) } diff --git a/akka-stream/src/main/scala/akka/stream/impl/Sources.scala b/akka-stream/src/main/scala/akka/stream/impl/Sources.scala index b79eab55ab..326d6f283f 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/Sources.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/Sources.scala @@ -195,9 +195,10 @@ private[akka] final class SourceQueueAdapter[T](delegate: SourceQueueWithComplet /** * INTERNAL API */ -private[stream] final class UnfoldResourceSource[T, S](create: () ⇒ S, - readData: (S) ⇒ Option[T], - close: (S) ⇒ Unit) extends GraphStage[SourceShape[T]] { +private[stream] final class UnfoldResourceSource[T, S]( + create: () ⇒ S, + readData: (S) ⇒ Option[T], + close: (S) ⇒ Unit) extends GraphStage[SourceShape[T]] { val out = Outlet[T]("UnfoldResourceSource.out") override val shape = SourceShape(out) override def initialAttributes: Attributes = DefaultAttributes.unfoldResourceSource @@ -251,9 +252,10 @@ private[stream] final class UnfoldResourceSource[T, S](create: () ⇒ S, override def toString = "UnfoldResourceSource" } -private[stream] final class UnfoldResourceSourceAsync[T, S](create: () ⇒ Future[S], - readData: (S) ⇒ Future[Option[T]], - close: (S) ⇒ Future[Done]) extends GraphStage[SourceShape[T]] { +private[stream] final class UnfoldResourceSourceAsync[T, S]( + create: () ⇒ Future[S], + readData: (S) ⇒ Future[Option[T]], + close: (S) ⇒ Future[Done]) extends GraphStage[SourceShape[T]] { val out = Outlet[T]("UnfoldResourceSourceAsync.out") override val shape = SourceShape(out) override def initialAttributes: Attributes = DefaultAttributes.unfoldResourceSourceAsync diff --git a/akka-stream/src/main/scala/akka/stream/impl/StreamLayout.scala b/akka-stream/src/main/scala/akka/stream/impl/StreamLayout.scala index e351a38c8b..3d7e0752fd 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/StreamLayout.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/StreamLayout.scala @@ -204,10 +204,12 @@ object StreamLayout { final def wire(from: OutPort, to: InPort): Module = { if (Debug) validate(this) - require(outPorts(from), + require( + outPorts(from), if (downstreams.contains(from)) s"The output port [$from] is already connected" else s"The output port [$from] is not part of the underlying graph.") - require(inPorts(to), + require( + inPorts(to), if (upstreams.contains(to)) s"The input port [$to] is already connected" else s"The input port [$to] is not part of the underlying graph.") @@ -360,7 +362,7 @@ object StreamLayout { if (IgnorableMatValComp(that)) Ignore else - Transform(_ => NotUsed, that.materializedValueComputation) + Transform(_ ⇒ NotUsed, that.materializedValueComputation) CompositeModule( if (that.isSealed) Set(that) else that.subModules, @@ -386,9 +388,10 @@ object StreamLayout { override def materializedValueComputation: MaterializedValueNode = Ignore } - final case class CopiedModule(override val shape: Shape, - override val attributes: Attributes, - copyOf: Module) extends Module { + final case class CopiedModule( + override val shape: Shape, + override val attributes: Attributes, + copyOf: Module) extends Module { override val subModules: Set[Module] = Set(copyOf) override def withAttributes(attr: Attributes): Module = @@ -411,12 +414,12 @@ object StreamLayout { } final case class CompositeModule( - override val subModules: Set[Module], - override val shape: Shape, - override val downstreams: Map[OutPort, InPort], - override val upstreams: Map[InPort, OutPort], - override val materializedValueComputation: MaterializedValueNode, - override val attributes: Attributes) extends Module { + override val subModules: Set[Module], + override val shape: Shape, + override val downstreams: Map[OutPort, InPort], + override val upstreams: Map[InPort, OutPort], + override val materializedValueComputation: MaterializedValueNode, + override val attributes: Attributes) extends Module { override def replaceShape(s: Shape): Module = if (s != shape) { @@ -443,13 +446,13 @@ object StreamLayout { } final case class FusedModule( - override val subModules: Set[Module], - override val shape: Shape, - override val downstreams: Map[OutPort, InPort], - override val upstreams: Map[InPort, OutPort], - override val materializedValueComputation: MaterializedValueNode, - override val attributes: Attributes, - info: Fusing.StructuralInfo) extends Module { + override val subModules: Set[Module], + override val shape: Shape, + override val downstreams: Map[OutPort, InPort], + override val upstreams: Map[InPort, OutPort], + override val materializedValueComputation: MaterializedValueNode, + override val attributes: Attributes, + info: Fusing.StructuralInfo) extends Module { override def isFused: Boolean = true @@ -555,14 +558,14 @@ private[stream] final class VirtualProcessor[T] extends AtomicReference[AnyRef] override def subscribe(s: Subscriber[_ >: T]): Unit = { @tailrec def rec(sub: Subscriber[Any]): Unit = get() match { - case null => if (!compareAndSet(null, s)) rec(sub) - case subscription: Subscription => + case null ⇒ if (!compareAndSet(null, s)) rec(sub) + case subscription: Subscription ⇒ if (compareAndSet(subscription, Both(sub))) establishSubscription(sub, subscription) else rec(sub) - case pub: Publisher[_] => + case pub: Publisher[_] ⇒ if (compareAndSet(pub, Inert)) pub.subscribe(sub) else rec(sub) - case _ => + case _ ⇒ rejectAdditionalSubscriber(sub, "VirtualProcessor") } @@ -576,19 +579,19 @@ private[stream] final class VirtualProcessor[T] extends AtomicReference[AnyRef] override final def onSubscribe(s: Subscription): Unit = { @tailrec def rec(obj: AnyRef): Unit = get() match { - case null => if (!compareAndSet(null, obj)) rec(obj) - case subscriber: Subscriber[_] => + case null ⇒ if (!compareAndSet(null, obj)) rec(obj) + case subscriber: Subscriber[_] ⇒ obj match { - case subscription: Subscription => + case subscription: Subscription ⇒ if (compareAndSet(subscriber, Both.create(subscriber))) establishSubscription(subscriber, subscription) else rec(obj) - case pub: Publisher[_] => + case pub: Publisher[_] ⇒ getAndSet(Inert) match { - case Inert => // nothing to be done - case _ => pub.subscribe(subscriber.asInstanceOf[Subscriber[Any]]) + case Inert ⇒ // nothing to be done + case _ ⇒ pub.subscribe(subscriber.asInstanceOf[Subscriber[Any]]) } } - case _ => + case _ ⇒ // spec violation tryCancel(s) } @@ -604,7 +607,7 @@ private[stream] final class VirtualProcessor[T] extends AtomicReference[AnyRef] val wrapped = new WrappedSubscription(subscription) try subscriber.onSubscribe(wrapped) catch { - case NonFatal(ex) => + case NonFatal(ex) ⇒ set(Inert) tryCancel(subscription) tryOnError(subscriber, ex) @@ -619,22 +622,22 @@ private[stream] final class VirtualProcessor[T] extends AtomicReference[AnyRef] */ @tailrec def rec(ex: Throwable): Unit = get() match { - case null => + case null ⇒ if (!compareAndSet(null, ErrorPublisher(ex, "failed-VirtualProcessor"))) rec(ex) else if (t == null) throw ex - case s: Subscription => + case s: Subscription ⇒ if (!compareAndSet(s, ErrorPublisher(ex, "failed-VirtualProcessor"))) rec(ex) else if (t == null) throw ex - case Both(s) => + case Both(s) ⇒ set(Inert) try tryOnError(s, ex) finally if (t == null) throw ex // must throw NPE, rule 2:13 - case s: Subscriber[_] => // spec violation + case s: Subscriber[_] ⇒ // spec violation getAndSet(Inert) match { - case Inert => // nothing to be done - case _ => ErrorPublisher(ex, "failed-VirtualProcessor").subscribe(s) + case Inert ⇒ // nothing to be done + case _ ⇒ ErrorPublisher(ex, "failed-VirtualProcessor").subscribe(s) } - case _ => // spec violation or cancellation race, but nothing we can do + case _ ⇒ // spec violation or cancellation race, but nothing we can do } val ex = if (t == null) exceptionMustNotBeNullException else t @@ -643,15 +646,15 @@ private[stream] final class VirtualProcessor[T] extends AtomicReference[AnyRef] @tailrec override final def onComplete(): Unit = get() match { - case null => if (!compareAndSet(null, EmptyPublisher)) onComplete() - case s: Subscription => if (!compareAndSet(s, EmptyPublisher)) onComplete() - case Both(s) => + case null ⇒ if (!compareAndSet(null, EmptyPublisher)) onComplete() + case s: Subscription ⇒ if (!compareAndSet(s, EmptyPublisher)) onComplete() + case Both(s) ⇒ set(Inert) tryOnComplete(s) - case s: Subscriber[_] => // spec violation + case s: Subscriber[_] ⇒ // spec violation set(Inert) EmptyPublisher.subscribe(s) - case _ => // spec violation or cancellation race, but nothing we can do + case _ ⇒ // spec violation or cancellation race, but nothing we can do } override def onNext(t: T): Unit = @@ -659,32 +662,32 @@ private[stream] final class VirtualProcessor[T] extends AtomicReference[AnyRef] val ex = elementMustNotBeNullException @tailrec def rec(): Unit = get() match { - case x @ (null | _: Subscription) => if (!compareAndSet(x, ErrorPublisher(ex, "failed-VirtualProcessor"))) rec() - case s: Subscriber[_] => try s.onError(ex) catch { case NonFatal(_) => } finally set(Inert) - case Both(s) => try s.onError(ex) catch { case NonFatal(_) => } finally set(Inert) - case _ => // spec violation or cancellation race, but nothing we can do + case x @ (null | _: Subscription) ⇒ if (!compareAndSet(x, ErrorPublisher(ex, "failed-VirtualProcessor"))) rec() + case s: Subscriber[_] ⇒ try s.onError(ex) catch { case NonFatal(_) ⇒ } finally set(Inert) + case Both(s) ⇒ try s.onError(ex) catch { case NonFatal(_) ⇒ } finally set(Inert) + case _ ⇒ // spec violation or cancellation race, but nothing we can do } rec() throw ex // must throw NPE, rule 2:13 } else { @tailrec def rec(): Unit = get() match { - case Both(s) => + case Both(s) ⇒ try s.onNext(t) catch { - case NonFatal(e) => + case NonFatal(e) ⇒ set(Inert) throw new IllegalStateException("Subscriber threw exception, this is in violation of rule 2:13", e) } - case s: Subscriber[_] => // spec violation + case s: Subscriber[_] ⇒ // spec violation val ex = new IllegalStateException(noDemand) getAndSet(Inert) match { - case Inert => // nothing to be done - case _ => ErrorPublisher(ex, "failed-VirtualProcessor").subscribe(s) + case Inert ⇒ // nothing to be done + case _ ⇒ ErrorPublisher(ex, "failed-VirtualProcessor").subscribe(s) } throw ex - case Inert | _: Publisher[_] => // nothing to be done - case other => + case Inert | _: Publisher[_] ⇒ // nothing to be done + case other ⇒ val pub = ErrorPublisher(new IllegalStateException(noDemand), "failed-VirtualPublisher") if (!compareAndSet(other, pub)) rec() else throw pub.t @@ -699,9 +702,9 @@ private[stream] final class VirtualProcessor[T] extends AtomicReference[AnyRef] if (n < 1) { tryCancel(real) getAndSet(Inert) match { - case Both(s) => rejectDueToNonPositiveDemand(s) - case Inert => // another failure has won the race - case _ => // this cannot possibly happen, but signaling errors is impossible at this point + case Both(s) ⇒ rejectDueToNonPositiveDemand(s) + case Inert ⇒ // another failure has won the race + case _ ⇒ // this cannot possibly happen, but signaling errors is impossible at this point } } else real.request(n) } @@ -738,12 +741,12 @@ private[impl] class VirtualPublisher[T] extends AtomicReference[AnyRef] with Pub requireNonNullSubscriber(subscriber) @tailrec def rec(): Unit = { get() match { - case null => if (!compareAndSet(null, subscriber)) rec() - case pub: Publisher[_] => + case null ⇒ if (!compareAndSet(null, subscriber)) rec() + case pub: Publisher[_] ⇒ if (compareAndSet(pub, Inert.subscriber)) { pub.asInstanceOf[Publisher[T]].subscribe(subscriber) } else rec() - case _: Subscriber[_] => rejectAdditionalSubscriber(subscriber, "Sink.asPublisher(fanout = false)") + case _: Subscriber[_] ⇒ rejectAdditionalSubscriber(subscriber, "Sink.asPublisher(fanout = false)") } } rec() // return value is boolean only to make the expressions above compile @@ -751,11 +754,11 @@ private[impl] class VirtualPublisher[T] extends AtomicReference[AnyRef] with Pub @tailrec final def registerPublisher(pub: Publisher[_]): Unit = get() match { - case null => if (!compareAndSet(null, pub)) registerPublisher(pub) - case sub: Subscriber[r] => + case null ⇒ if (!compareAndSet(null, pub)) registerPublisher(pub) + case sub: Subscriber[r] ⇒ set(Inert.subscriber) pub.asInstanceOf[Publisher[r]].subscribe(sub) - case _ => throw new IllegalStateException("internal error") + case _ ⇒ throw new IllegalStateException("internal error") } } @@ -884,14 +887,14 @@ private[stream] abstract class MaterializerSession(val topLevel: StreamLayout.Mo exitScope(copied) case composite @ (_: CompositeModule | _: FusedModule) ⇒ materializedValues.put(composite, materializeComposite(composite, subEffectiveAttributes)) - case EmptyModule => // nothing to do or say + case EmptyModule ⇒ // nothing to do or say } } if (MaterializerSession.Debug) { println(f"resolving module [${System.identityHashCode(module)}%08x] computation ${module.materializedValueComputation}") println(s" matValSrc = $matValSrc") - println(s" matVals =\n ${materializedValues.asScala.map(p ⇒ "%08x".format(System.identityHashCode(p._1)) -> p._2).mkString("\n ")}") + println(s" matVals =\n ${materializedValues.asScala.map(p ⇒ "%08x".format(System.identityHashCode(p._1)) → p._2).mkString("\n ")}") } val ret = resolveMaterialized(module.materializedValueComputation, materializedValues, 2) @@ -934,11 +937,11 @@ private[stream] abstract class MaterializerSession(val topLevel: StreamLayout.Mo subscribers.put(in, subscriberOrVirtual) currentLayout.upstreams.get(in) match { - case Some(upstream) => + case Some(upstream) ⇒ val publisher = publishers.get(upstream) if (publisher ne null) doSubscribe(publisher, subscriberOrVirtual) // Interface (unconnected) ports of the current scope will be wired when exiting the scope (or some parent scope) - case None => + case None ⇒ } } @@ -946,27 +949,28 @@ private[stream] abstract class MaterializerSession(val topLevel: StreamLayout.Mo publishers.put(out, publisher) currentLayout.downstreams.get(out) match { - case Some(downstream) => + case Some(downstream) ⇒ val subscriber = subscribers.get(downstream) if (subscriber ne null) doSubscribe(publisher, subscriber) - // Interface (unconnected) ports of the current scope will be wired when exiting the scope - case None => + // Interface (unconnected) ports of the current scope will be wired when exiting the scope + case None ⇒ } } private def doSubscribe(publisher: Publisher[_ <: Any], subscriberOrVirtual: AnyRef): Unit = subscriberOrVirtual match { - case s: Subscriber[_] => publisher.subscribe(s.asInstanceOf[Subscriber[Any]]) - case v: VirtualPublisher[_] => v.registerPublisher(publisher) + case s: Subscriber[_] ⇒ publisher.subscribe(s.asInstanceOf[Subscriber[Any]]) + case v: VirtualPublisher[_] ⇒ v.registerPublisher(publisher) } } /** - * INTERNAL API - */ -private[akka] final case class ProcessorModule[In, Out, Mat](val createProcessor: () ⇒ (Processor[In, Out], Mat), - attributes: Attributes = DefaultAttributes.processor) extends StreamLayout.AtomicModule { + * INTERNAL API + */ +private[akka] final case class ProcessorModule[In, Out, Mat]( + val createProcessor: () ⇒ (Processor[In, Out], Mat), + attributes: Attributes = DefaultAttributes.processor) extends StreamLayout.AtomicModule { val inPort = Inlet[In]("ProcessorModule.in") val outPort = Outlet[Out]("ProcessorModule.out") override val shape = new FlowShape(inPort, outPort) diff --git a/akka-stream/src/main/scala/akka/stream/impl/StreamSubscriptionTimeout.scala b/akka-stream/src/main/scala/akka/stream/impl/StreamSubscriptionTimeout.scala index da782c555d..7493958db4 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/StreamSubscriptionTimeout.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/StreamSubscriptionTimeout.scala @@ -89,7 +89,8 @@ private[akka] trait StreamSubscriptionTimeoutSupport { } private def warn(target: Publisher[_], timeout: FiniteDuration): Unit = { - log.warning("Timed out {} detected (after {} ms)! You should investigate if you either cancel or consume all {} instances", + log.warning( + "Timed out {} detected (after {} ms)! You should investigate if you either cancel or consume all {} instances", target, timeout.toMillis, target.getClass.getCanonicalName) } diff --git a/akka-stream/src/main/scala/akka/stream/impl/SubFlowImpl.scala b/akka-stream/src/main/scala/akka/stream/impl/SubFlowImpl.scala index 4cb2c28f89..f0a52a62a9 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/SubFlowImpl.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/SubFlowImpl.scala @@ -14,9 +14,10 @@ object SubFlowImpl { } } -class SubFlowImpl[In, Out, Mat, F[+_], C](val subFlow: Flow[In, Out, NotUsed], - mergeBackFunction: SubFlowImpl.MergeBack[In, F], - finishFunction: Sink[In, NotUsed] ⇒ C) +class SubFlowImpl[In, Out, Mat, F[+_], C]( + val subFlow: Flow[In, Out, NotUsed], + mergeBackFunction: SubFlowImpl.MergeBack[In, F], + finishFunction: Sink[In, NotUsed] ⇒ C) extends SubFlow[Out, Mat, F, C] { override def via[T, Mat2](flow: Graph[FlowShape[Out, T], Mat2]): Repr[T] = diff --git a/akka-stream/src/main/scala/akka/stream/impl/Throttle.scala b/akka-stream/src/main/scala/akka/stream/impl/Throttle.scala index 42cb4023f9..54a740cff4 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/Throttle.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/Throttle.scala @@ -14,11 +14,12 @@ import scala.concurrent.duration.{ FiniteDuration, _ } /** * INTERNAL API */ -private[stream] class Throttle[T](cost: Int, - per: FiniteDuration, - maximumBurst: Int, - costCalculation: (T) ⇒ Int, - mode: ThrottleMode) +private[stream] class Throttle[T]( + cost: Int, + per: FiniteDuration, + maximumBurst: Int, + costCalculation: (T) ⇒ Int, + mode: ThrottleMode) extends SimpleLinearGraphStage[T] { require(cost > 0, "cost must be > 0") require(per.toNanos > 0, "per time must be > 0") diff --git a/akka-stream/src/main/scala/akka/stream/impl/fusing/ActorGraphInterpreter.scala b/akka-stream/src/main/scala/akka/stream/impl/fusing/ActorGraphInterpreter.scala index 724c1511f6..1258ec103a 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/fusing/ActorGraphInterpreter.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/fusing/ActorGraphInterpreter.scala @@ -308,13 +308,13 @@ private[stream] object ActorGraphInterpreter { * INTERNAL API */ private[stream] final class GraphInterpreterShell( - assembly: GraphAssembly, - inHandlers: Array[InHandler], + assembly: GraphAssembly, + inHandlers: Array[InHandler], outHandlers: Array[OutHandler], - logics: Array[GraphStageLogic], - shape: Shape, - settings: ActorMaterializerSettings, - val mat: ActorMaterializerImpl) { + logics: Array[GraphStageLogic], + shape: Shape, + settings: ActorMaterializerSettings, + val mat: ActorMaterializerImpl) { import ActorGraphInterpreter._ diff --git a/akka-stream/src/main/scala/akka/stream/impl/fusing/Fusing.scala b/akka-stream/src/main/scala/akka/stream/impl/fusing/Fusing.scala index 273e0cb672..4930267cb0 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/fusing/Fusing.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/fusing/Fusing.scala @@ -30,7 +30,7 @@ private[stream] object Fusing { def aggressive[S <: Shape, M](g: Graph[S, M]): FusedGraph[S, M] = g match { case fg: FusedGraph[_, _] ⇒ fg - case FusedGraph(module, shape) => FusedGraph(module, shape) + case FusedGraph(module, shape) ⇒ FusedGraph(module, shape) case _ ⇒ doAggressive(g) } @@ -160,7 +160,7 @@ private[stream] object Fusing { } pos += 1 - case _ => throw new IllegalArgumentException("unexpected module structure") + case _ ⇒ throw new IllegalArgumentException("unexpected module structure") } val outsB2 = new Array[Outlet[_]](insB2.size) @@ -186,7 +186,7 @@ private[stream] object Fusing { } } pos += 1 - case _ => throw new IllegalArgumentException("unexpected module structure") + case _ ⇒ throw new IllegalArgumentException("unexpected module structure") } /* @@ -217,8 +217,8 @@ private[stream] object Fusing { // FIXME attributes should contain some naming info and async boundary where needed val firstModule = group.iterator.next() match { - case c: CopiedModule => c - case _ => throw new IllegalArgumentException("unexpected module structure") + case c: CopiedModule ⇒ c + case _ ⇒ throw new IllegalArgumentException("unexpected module structure") } val async = if (isAsync(firstModule)) Attributes(AsyncBoundary) else Attributes.none val disp = dispatcher(firstModule) match { @@ -253,11 +253,12 @@ private[stream] object Fusing { * correspondence is then used during materialization to trigger these sources * when “their” node has received its value. */ - private def descend(m: Module, - inheritedAttributes: Attributes, - struct: BuildStructuralInfo, - openGroup: ju.Set[Module], - indent: Int): List[(Module, MaterializedValueNode)] = { + private def descend( + m: Module, + inheritedAttributes: Attributes, + struct: BuildStructuralInfo, + openGroup: ju.Set[Module], + indent: Int): List[(Module, MaterializedValueNode)] = { def log(msg: String): Unit = println(" " * indent + msg) val async = m match { case _: GraphStageModule ⇒ m.attributes.contains(AsyncBoundary) @@ -327,7 +328,7 @@ private[stream] object Fusing { struct.registerInternals(newShape, indent) copy - case _ => throw new IllegalArgumentException("unexpected module structure") + case _ ⇒ throw new IllegalArgumentException("unexpected module structure") } val newgm = gm.copy(shape = oldShape.copyFromPorts(oldIns.toList, oldOuts.toList), matValIDs = newids) // make sure to add all the port mappings from old GraphModule Shape to new shape @@ -336,14 +337,14 @@ private[stream] object Fusing { var result = List.empty[(Module, MaterializedValueNode)] var i = 0 while (i < mvids.length) { - result ::= mvids(i) -> Atomic(newids(i)) + result ::= mvids(i) → Atomic(newids(i)) i += 1 } - result ::= m -> Atomic(newgm) + result ::= m → Atomic(newgm) result case _ ⇒ if (Debug) log(s"atomic module $m") - List(m -> struct.addModule(m, localGroup, inheritedAttributes, indent)) + List(m → struct.addModule(m, localGroup, inheritedAttributes, indent)) } } else { val attributes = inheritedAttributes and m.attributes @@ -351,7 +352,7 @@ private[stream] object Fusing { case CopiedModule(shape, _, copyOf) ⇒ val ret = descend(copyOf, attributes, struct, localGroup, indent + 1) match { - case xs @ (_, mat) :: _ ⇒ (m -> mat) :: xs + case xs @ (_, mat) :: _ ⇒ (m → mat) :: xs case _ ⇒ throw new IllegalArgumentException("cannot happen") } struct.rewire(copyOf.shape, shape, indent) @@ -390,7 +391,7 @@ private[stream] object Fusing { val ms = c.copyOf.asInstanceOf[GraphStageModule].stage.asInstanceOf[MaterializedValueSource[Any]] val mapped = ms.computation match { case Atomic(sub) ⇒ subMat(sub) - case Ignore => Ignore + case Ignore ⇒ Ignore case other ⇒ matNodeMapping.get(other) } if (Debug) log(s"materialized value source: ${c.copyOf} -> $mapped") @@ -400,7 +401,7 @@ private[stream] object Fusing { struct.replace(c, replacement, localGroup) } // the result for each level is the materialized value computation - List(m -> newMat) + List(m → newMat) } } } diff --git a/akka-stream/src/main/scala/akka/stream/impl/fusing/GraphInterpreter.scala b/akka-stream/src/main/scala/akka/stream/impl/fusing/GraphInterpreter.scala index 751a9ebd2a..fe6ba47446 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/fusing/GraphInterpreter.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/fusing/GraphInterpreter.scala @@ -99,12 +99,13 @@ private[akka] object GraphInterpreter { * corresponding segments of these arrays matches the exact same order of the ports in the [[Shape]]. * */ - final class GraphAssembly(val stages: Array[GraphStageWithMaterializedValue[Shape, Any]], - val originalAttributes: Array[Attributes], - val ins: Array[Inlet[_]], - val inOwners: Array[Int], - val outs: Array[Outlet[_]], - val outOwners: Array[Int]) { + final class GraphAssembly( + val stages: Array[GraphStageWithMaterializedValue[Shape, Any]], + val originalAttributes: Array[Attributes], + val ins: Array[Inlet[_]], + val inOwners: Array[Int], + val outs: Array[Outlet[_]], + val outOwners: Array[Int]) { require(ins.length == inOwners.length && inOwners.length == outs.length && outs.length == outOwners.length) def connectionCount: Int = ins.length @@ -119,10 +120,11 @@ private[akka] object GraphInterpreter { * - array of the logics * - materialized value */ - def materialize(inheritedAttributes: Attributes, - copiedModules: Array[Module], - matVal: ju.Map[Module, Any], - register: MaterializedValueSource[Any] ⇒ Unit): (Array[InHandler], Array[OutHandler], Array[GraphStageLogic]) = { + def materialize( + inheritedAttributes: Attributes, + copiedModules: Array[Module], + matVal: ju.Map[Module, Any], + register: MaterializedValueSource[Any] ⇒ Unit): (Array[InHandler], Array[OutHandler], Array[GraphStageLogic]) = { val logics = Array.ofDim[GraphStageLogic](stages.length) var i = 0 @@ -208,9 +210,10 @@ private[akka] object GraphInterpreter { /** * INTERNAL API */ - final def apply(inlets: immutable.Seq[Inlet[_]], - outlets: immutable.Seq[Outlet[_]], - stages: GraphStageWithMaterializedValue[Shape, _]*): GraphAssembly = { + final def apply( + inlets: immutable.Seq[Inlet[_]], + outlets: immutable.Seq[Outlet[_]], + stages: GraphStageWithMaterializedValue[Shape, _]*): GraphAssembly = { // add the contents of an iterator to an array starting at idx @tailrec def add[T](i: Iterator[T], a: Array[T], idx: Int): Array[T] = if (i.hasNext) { @@ -345,14 +348,14 @@ private[akka] object GraphInterpreter { */ private[stream] final class GraphInterpreter( private val assembly: GraphInterpreter.GraphAssembly, - val materializer: Materializer, - val log: LoggingAdapter, - val inHandlers: Array[InHandler], // Lookup table for the InHandler of a connection - val outHandlers: Array[OutHandler], // Lookup table for the outHandler of the connection - val logics: Array[GraphStageLogic], // Array of stage logics - val onAsyncInput: (GraphStageLogic, Any, (Any) ⇒ Unit) ⇒ Unit, - val fuzzingMode: Boolean, - val context: ActorRef) { + val materializer: Materializer, + val log: LoggingAdapter, + val inHandlers: Array[InHandler], // Lookup table for the InHandler of a connection + val outHandlers: Array[OutHandler], // Lookup table for the outHandler of the connection + val logics: Array[GraphStageLogic], // Array of stage logics + val onAsyncInput: (GraphStageLogic, Any, (Any) ⇒ Unit) ⇒ Unit, + val fuzzingMode: Boolean, + val context: ActorRef) { import GraphInterpreter._ // Maintains additional information for events, basically elements in-flight, or failure. diff --git a/akka-stream/src/main/scala/akka/stream/impl/fusing/GraphStages.scala b/akka-stream/src/main/scala/akka/stream/impl/fusing/GraphStages.scala index 88319b8e83..7b53a33510 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/fusing/GraphStages.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/fusing/GraphStages.scala @@ -25,9 +25,10 @@ import scala.util.Try /** * INTERNAL API */ -private[akka] final case class GraphStageModule(shape: Shape, - attributes: Attributes, - stage: GraphStageWithMaterializedValue[Shape, Any]) extends AtomicModule { +private[akka] final case class GraphStageModule( + shape: Shape, + attributes: Attributes, + stage: GraphStageWithMaterializedValue[Shape, Any]) extends AtomicModule { override def carbonCopy: Module = CopiedModule(shape.deepCopy(), Attributes.none, this) override def replaceShape(s: Shape): Module = diff --git a/akka-stream/src/main/scala/akka/stream/impl/fusing/IteratorInterpreter.scala b/akka-stream/src/main/scala/akka/stream/impl/fusing/IteratorInterpreter.scala index 31be808ca3..263cece018 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/fusing/IteratorInterpreter.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/fusing/IteratorInterpreter.scala @@ -100,7 +100,7 @@ private[akka] object IteratorInterpreter { * INTERNAL API */ private[akka] class IteratorInterpreter[I, O]( - val input: Iterator[I], + val input: Iterator[I], val stages: Seq[GraphStageWithMaterializedValue[FlowShape[_, _], Any]]) { import akka.stream.impl.fusing.IteratorInterpreter._ diff --git a/akka-stream/src/main/scala/akka/stream/impl/fusing/Ops.scala b/akka-stream/src/main/scala/akka/stream/impl/fusing/Ops.scala index f90e34e4bb..9e50f57ea2 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/fusing/Ops.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/fusing/Ops.scala @@ -540,22 +540,22 @@ private[akka] final case class Buffer[T](size: Int, overflowStrategy: OverflowSt if (buffer.isFull) buffer.dropHead() buffer.enqueue(elem) ctx.pull() - case DropTail ⇒ (ctx, elem) ⇒ + case DropTail ⇒ (ctx, elem) ⇒ if (buffer.isFull) buffer.dropTail() buffer.enqueue(elem) ctx.pull() - case DropBuffer ⇒ (ctx, elem) ⇒ + case DropBuffer ⇒ (ctx, elem) ⇒ if (buffer.isFull) buffer.clear() buffer.enqueue(elem) ctx.pull() - case DropNew ⇒ (ctx, elem) ⇒ + case DropNew ⇒ (ctx, elem) ⇒ if (!buffer.isFull) buffer.enqueue(elem) ctx.pull() - case Backpressure ⇒ (ctx, elem) ⇒ + case Backpressure ⇒ (ctx, elem) ⇒ buffer.enqueue(elem) if (buffer.isFull) ctx.holdUpstream() else ctx.pull() - case Fail ⇒ (ctx, elem) ⇒ + case Fail ⇒ (ctx, elem) ⇒ if (buffer.isFull) ctx.fail(new BufferOverflowException(s"Buffer overflow (max capacity was: $size)!")) else { buffer.enqueue(elem) @@ -908,7 +908,7 @@ private[akka] final case class MapAsyncUnordered[In, Out](parallelism: Int, f: I */ private[akka] final case class Log[T](name: String, extract: T ⇒ Any, logAdapter: Option[LoggingAdapter], - decider: Supervision.Decider) extends PushStage[T, T] { + decider: Supervision.Decider) extends PushStage[T, T] { import Log._ diff --git a/akka-stream/src/main/scala/akka/stream/impl/io/ByteStringParser.scala b/akka-stream/src/main/scala/akka/stream/impl/io/ByteStringParser.scala index 45d83b41aa..1a0f75563f 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/io/ByteStringParser.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/io/ByteStringParser.scala @@ -82,9 +82,10 @@ private[akka] object ByteStringParser { * @param acceptUpstreamFinish - if true - stream will complete when received `onUpstreamFinish`, if "false" * - onTruncation will be called */ - case class ParseResult[+T](result: Option[T], - nextStep: ParseStep[T], - acceptUpstreamFinish: Boolean = true) + case class ParseResult[+T]( + result: Option[T], + nextStep: ParseStep[T], + acceptUpstreamFinish: Boolean = true) trait ParseStep[+T] { /** diff --git a/akka-stream/src/main/scala/akka/stream/impl/io/InputStreamSinkStage.scala b/akka-stream/src/main/scala/akka/stream/impl/io/InputStreamSinkStage.scala index f0ac7c9a1e..b953a08cea 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/io/InputStreamSinkStage.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/io/InputStreamSinkStage.scala @@ -90,9 +90,10 @@ final private[stream] class InputStreamSinkStage(readTimeout: FiniteDuration) ex * INTERNAL API * InputStreamAdapter that interacts with InputStreamSinkStage */ -private[akka] class InputStreamAdapter(sharedBuffer: BlockingQueue[StreamToAdapterMessage], - sendToStage: (AdapterToStageMessage) ⇒ Unit, - readTimeout: FiniteDuration) +private[akka] class InputStreamAdapter( + sharedBuffer: BlockingQueue[StreamToAdapterMessage], + sendToStage: (AdapterToStageMessage) ⇒ Unit, + readTimeout: FiniteDuration) extends InputStream { var isInitialized = false diff --git a/akka-stream/src/main/scala/akka/stream/impl/io/OutputStreamSourceStage.scala b/akka-stream/src/main/scala/akka/stream/impl/io/OutputStreamSourceStage.scala index 12bab04e08..441444af95 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/io/OutputStreamSourceStage.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/io/OutputStreamSourceStage.scala @@ -154,10 +154,11 @@ final private[stream] class OutputStreamSourceStage(writeTimeout: FiniteDuration } } -private[akka] class OutputStreamAdapter(dataQueue: BlockingQueue[ByteString], - downstreamStatus: AtomicReference[DownstreamStatus], - sendToStage: (AdapterToStageMessage) ⇒ Future[Unit], - writeTimeout: FiniteDuration) +private[akka] class OutputStreamAdapter( + dataQueue: BlockingQueue[ByteString], + downstreamStatus: AtomicReference[DownstreamStatus], + sendToStage: (AdapterToStageMessage) ⇒ Future[Unit], + writeTimeout: FiniteDuration) extends OutputStream { var isActive = true diff --git a/akka-stream/src/main/scala/akka/stream/impl/io/TLSActor.scala b/akka-stream/src/main/scala/akka/stream/impl/io/TLSActor.scala index 381b0ec20a..3addd75cd6 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/io/TLSActor.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/io/TLSActor.scala @@ -25,14 +25,15 @@ import akka.stream.TLSProtocol._ */ private[akka] object TLSActor { - def props(settings: ActorMaterializerSettings, - sslContext: SSLContext, - sslConfig: Option[AkkaSSLConfig], - firstSession: NegotiateNewSession, - role: TLSRole, - closing: TLSClosing, - hostInfo: Option[(String, Int)], - tracing: Boolean = false): Props = + def props( + settings: ActorMaterializerSettings, + sslContext: SSLContext, + sslConfig: Option[AkkaSSLConfig], + firstSession: NegotiateNewSession, + role: TLSRole, + closing: TLSClosing, + hostInfo: Option[(String, Int)], + tracing: Boolean = false): Props = Props(new TLSActor(settings, sslContext, sslConfig, firstSession, role, closing, hostInfo, tracing)).withDeploy(Deploy.local) final val TransportIn = 0 @@ -45,11 +46,12 @@ private[akka] object TLSActor { /** * INTERNAL API. */ -private[akka] class TLSActor(settings: ActorMaterializerSettings, - sslContext: SSLContext, - externalSslConfig: Option[AkkaSSLConfig], - firstSession: NegotiateNewSession, role: TLSRole, closing: TLSClosing, - hostInfo: Option[(String, Int)], tracing: Boolean) +private[akka] class TLSActor( + settings: ActorMaterializerSettings, + sslContext: SSLContext, + externalSslConfig: Option[AkkaSSLConfig], + firstSession: NegotiateNewSession, role: TLSRole, closing: TLSClosing, + hostInfo: Option[(String, Int)], tracing: Boolean) extends Actor with ActorLogging with Pump { import TLSActor._ diff --git a/akka-stream/src/main/scala/akka/stream/impl/io/TcpStages.scala b/akka-stream/src/main/scala/akka/stream/impl/io/TcpStages.scala index 048a541b04..b93b385597 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/io/TcpStages.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/io/TcpStages.scala @@ -26,13 +26,14 @@ import scala.concurrent.{ Future, Promise } /** * INTERNAL API */ -private[stream] class ConnectionSourceStage(val tcpManager: ActorRef, - val endpoint: InetSocketAddress, - val backlog: Int, - val options: immutable.Traversable[SocketOption], - val halfClose: Boolean, - val idleTimeout: Duration, - val bindShutdownTimeout: FiniteDuration) +private[stream] class ConnectionSourceStage( + val tcpManager: ActorRef, + val endpoint: InetSocketAddress, + val backlog: Int, + val options: immutable.Traversable[SocketOption], + val halfClose: Boolean, + val idleTimeout: Duration, + val bindShutdownTimeout: FiniteDuration) extends GraphStageWithMaterializedValue[SourceShape[StreamTcp.IncomingConnection], Future[StreamTcp.ServerBinding]] { import ConnectionSourceStage._ @@ -159,10 +160,10 @@ private[stream] object TcpConnectionStage { def halfClose: Boolean } case class Outbound( - manager: ActorRef, - connectCmd: Connect, + manager: ActorRef, + connectCmd: Connect, localAddressPromise: Promise[InetSocketAddress], - halfClose: Boolean) extends TcpRole + halfClose: Boolean) extends TcpRole case class Inbound(connection: ActorRef, halfClose: Boolean) extends TcpRole /* @@ -272,7 +273,8 @@ private[stream] object TcpConnectionStage { override def onUpstreamFailure(ex: Throwable): Unit = { if (connection != null) { if (interpreter.log.isDebugEnabled) { - interpreter.log.debug("Aborting tcp connection because of upstream failure: {}\n{}", + interpreter.log.debug( + "Aborting tcp connection because of upstream failure: {}\n{}", ex.getMessage, ex.getStackTrace.mkString("\n")) } @@ -317,12 +319,13 @@ private[stream] class IncomingConnectionStage(connection: ActorRef, remoteAddres /** * INTERNAL API */ -private[stream] class OutgoingConnectionStage(manager: ActorRef, - remoteAddress: InetSocketAddress, - localAddress: Option[InetSocketAddress] = None, - options: immutable.Traversable[SocketOption] = Nil, - halfClose: Boolean = true, - connectTimeout: Duration = Duration.Inf) +private[stream] class OutgoingConnectionStage( + manager: ActorRef, + remoteAddress: InetSocketAddress, + localAddress: Option[InetSocketAddress] = None, + options: immutable.Traversable[SocketOption] = Nil, + halfClose: Boolean = true, + connectTimeout: Duration = Duration.Inf) extends GraphStageWithMaterializedValue[FlowShape[ByteString, ByteString], Future[StreamTcp.OutgoingConnection]] { import TcpConnectionStage._ diff --git a/akka-stream/src/main/scala/akka/stream/impl/io/TlsModule.scala b/akka-stream/src/main/scala/akka/stream/impl/io/TlsModule.scala index 71e6214ffd..e5b31bd6bf 100644 --- a/akka-stream/src/main/scala/akka/stream/impl/io/TlsModule.scala +++ b/akka-stream/src/main/scala/akka/stream/impl/io/TlsModule.scala @@ -14,10 +14,10 @@ import com.typesafe.sslconfig.akka.AkkaSSLConfig private[akka] final case class TlsModule(plainIn: Inlet[SslTlsOutbound], plainOut: Outlet[SslTlsInbound], cipherIn: Inlet[ByteString], cipherOut: Outlet[ByteString], shape: Shape, attributes: Attributes, - sslContext: SSLContext, - sslConfig: Option[AkkaSSLConfig], + sslContext: SSLContext, + sslConfig: Option[AkkaSSLConfig], firstSession: NegotiateNewSession, - role: TLSRole, closing: TLSClosing, hostInfo: Option[(String, Int)]) extends AtomicModule { + role: TLSRole, closing: TLSClosing, hostInfo: Option[(String, Int)]) extends AtomicModule { override def withAttributes(att: Attributes): TlsModule = copy(attributes = att) override def carbonCopy: TlsModule = diff --git a/akka-stream/src/main/scala/akka/stream/javadsl/BidiFlow.scala b/akka-stream/src/main/scala/akka/stream/javadsl/BidiFlow.scala index 716d8b1365..88ba60b061 100644 --- a/akka-stream/src/main/scala/akka/stream/javadsl/BidiFlow.scala +++ b/akka-stream/src/main/scala/akka/stream/javadsl/BidiFlow.scala @@ -46,8 +46,8 @@ object BidiFlow { * */ def fromFlowsMat[I1, O1, I2, O2, M1, M2, M]( - flow1: Graph[FlowShape[I1, O1], M1], - flow2: Graph[FlowShape[I2, O2], M2], + flow1: Graph[FlowShape[I1, O1], M1], + flow2: Graph[FlowShape[I2, O2], M2], combine: function.Function2[M1, M2, M]): BidiFlow[I1, O1, I2, O2, M] = { new BidiFlow(scaladsl.BidiFlow.fromFlowsMat(flow1, flow2)(combinerToScala(combine))) } diff --git a/akka-stream/src/main/scala/akka/stream/javadsl/Flow.scala b/akka-stream/src/main/scala/akka/stream/javadsl/Flow.scala index f546754483..5ec142d2bb 100644 --- a/akka-stream/src/main/scala/akka/stream/javadsl/Flow.scala +++ b/akka-stream/src/main/scala/akka/stream/javadsl/Flow.scala @@ -800,27 +800,27 @@ final class Flow[-In, +Out, +Mat](delegate: scaladsl.Flow[In, Out, Mat]) extends new Flow(delegate.recoverWith(pf)) /** - * RecoverWithRetries allows to switch to alternative Source on flow failure. It will stay in effect after - * a failure has been recovered up to `attempts` number of times so that each time there is a failure - * it is fed into the `pf` and a new Source may be materialized. Note that if you pass in 0, this won't - * attempt to recover at all. Passing in -1 will behave exactly the same as `recoverWith`. - * - * Since the underlying failure signal onError arrives out-of-band, it might jump over existing elements. - * This stage can recover the failure signal, but not the skipped elements, which will be dropped. - * - * '''Emits when''' element is available from the upstream or upstream is failed and element is available - * from alternative Source - * - * '''Backpressures when''' downstream backpressures - * - * '''Completes when''' upstream completes or upstream failed with exception pf can handle - * - * '''Cancels when''' downstream cancels - * - * @param attempts Maximum number of retries or -1 to retry indefinitely - * @param pf Receives the failure cause and returns the new Source to be materialized if any - * @throws IllegalArgumentException if `attempts` is a negative number other than -1 - */ + * RecoverWithRetries allows to switch to alternative Source on flow failure. It will stay in effect after + * a failure has been recovered up to `attempts` number of times so that each time there is a failure + * it is fed into the `pf` and a new Source may be materialized. Note that if you pass in 0, this won't + * attempt to recover at all. Passing in -1 will behave exactly the same as `recoverWith`. + * + * Since the underlying failure signal onError arrives out-of-band, it might jump over existing elements. + * This stage can recover the failure signal, but not the skipped elements, which will be dropped. + * + * '''Emits when''' element is available from the upstream or upstream is failed and element is available + * from alternative Source + * + * '''Backpressures when''' downstream backpressures + * + * '''Completes when''' upstream completes or upstream failed with exception pf can handle + * + * '''Cancels when''' downstream cancels + * + * @param attempts Maximum number of retries or -1 to retry indefinitely + * @param pf Receives the failure cause and returns the new Source to be materialized if any + * @throws IllegalArgumentException if `attempts` is a negative number other than -1 + */ def recoverWithRetries[T >: Out](attempts: Int, pf: PartialFunction[Throwable, _ <: Graph[SourceShape[T], NotUsed]]): javadsl.Flow[In, T, Mat @uncheckedVariance] = new Flow(delegate.recoverWithRetries(attempts, pf)) @@ -1364,8 +1364,9 @@ final class Flow[-In, +Out, +Mat](delegate: scaladsl.Flow[In, Out, Mat]) extends * * @see [[#alsoTo]] */ - def alsoToMat[M2, M3](that: Graph[SinkShape[Out], M2], - matF: function.Function2[Mat, M2, M3]): javadsl.Flow[In, Out, M3] = + def alsoToMat[M2, M3]( + that: Graph[SinkShape[Out], M2], + matF: function.Function2[Mat, M2, M3]): javadsl.Flow[In, Out, M3] = new Flow(delegate.alsoToMat(that)(combinerToScala(matF))) /** @@ -1453,8 +1454,9 @@ final class Flow[-In, +Out, +Mat](delegate: scaladsl.Flow[In, Out, Mat]) extends * * @see [[#merge]] */ - def mergeMat[T >: Out, M, M2](that: Graph[SourceShape[T], M], - matF: function.Function2[Mat, M, M2]): javadsl.Flow[In, T, M2] = + def mergeMat[T >: Out, M, M2]( + that: Graph[SourceShape[T], M], + matF: function.Function2[Mat, M, M2]): javadsl.Flow[In, T, M2] = mergeMat(that, matF, eagerComplete = false) /** @@ -1466,9 +1468,10 @@ final class Flow[-In, +Out, +Mat](delegate: scaladsl.Flow[In, Out, Mat]) extends * * @see [[#merge]] */ - def mergeMat[T >: Out, M, M2](that: Graph[SourceShape[T], M], - matF: function.Function2[Mat, M, M2], - eagerComplete: Boolean): javadsl.Flow[In, T, M2] = + def mergeMat[T >: Out, M, M2]( + that: Graph[SourceShape[T], M], + matF: function.Function2[Mat, M, M2], + eagerComplete: Boolean): javadsl.Flow[In, T, M2] = new Flow(delegate.mergeMat(that)(combinerToScala(matF))) /** @@ -1527,9 +1530,11 @@ final class Flow[-In, +Out, +Mat](delegate: scaladsl.Flow[In, Out, Mat]) extends * * @see [[#zip]] */ - def zipMat[T, M, M2](that: Graph[SourceShape[T], M], - matF: function.Function2[Mat, M, M2]): javadsl.Flow[In, Out @uncheckedVariance Pair T, M2] = - this.viaMat(Flow.fromGraph(GraphDSL.create(that, + def zipMat[T, M, M2]( + that: Graph[SourceShape[T], M], + matF: function.Function2[Mat, M, M2]): javadsl.Flow[In, Out @uncheckedVariance Pair T, M2] = + this.viaMat(Flow.fromGraph(GraphDSL.create( + that, new function.Function2[GraphDSL.Builder[M], SourceShape[T], FlowShape[Out, Out @uncheckedVariance Pair T]] { def apply(b: GraphDSL.Builder[M], s: SourceShape[T]): FlowShape[Out, Out @uncheckedVariance Pair T] = { val zip: FanInShape2[Out, T, Out Pair T] = b.add(Zip.create[Out, T]) @@ -1550,8 +1555,9 @@ final class Flow[-In, +Out, +Mat](delegate: scaladsl.Flow[In, Out, Mat]) extends * * '''Cancels when''' downstream cancels */ - def zipWith[Out2, Out3](that: Graph[SourceShape[Out2], _], - combine: function.Function2[Out, Out2, Out3]): javadsl.Flow[In, Out3, Mat] = + def zipWith[Out2, Out3]( + that: Graph[SourceShape[Out2], _], + combine: function.Function2[Out, Out2, Out3]): javadsl.Flow[In, Out3, Mat] = new Flow(delegate.zipWith[Out2, Out3](that)(combinerToScala(combine))) /** @@ -1563,9 +1569,10 @@ final class Flow[-In, +Out, +Mat](delegate: scaladsl.Flow[In, Out, Mat]) extends * * @see [[#zipWith]] */ - def zipWithMat[Out2, Out3, M, M2](that: Graph[SourceShape[Out2], M], - combine: function.Function2[Out, Out2, Out3], - matF: function.Function2[Mat, M, M2]): javadsl.Flow[In, Out3, M2] = + def zipWithMat[Out2, Out3, M, M2]( + that: Graph[SourceShape[Out2], M], + combine: function.Function2[Out, Out2, Out3], + matF: function.Function2[Mat, M, M2]): javadsl.Flow[In, Out3, M2] = new Flow(delegate.zipWithMat[Out2, Out3, M, M2](that)(combinerToScala(combine))(combinerToScala(matF))) /** @@ -1615,18 +1622,18 @@ final class Flow[-In, +Out, +Mat](delegate: scaladsl.Flow[In, Out, Mat]) extends new Flow(delegate.idleTimeout(timeout)) /** - * If the time between the emission of an element and the following downstream demand exceeds the provided timeout, - * the stream is failed with a [[java.util.concurrent.TimeoutException]]. The timeout is checked periodically, - * so the resolution of the check is one period (equals to timeout value). - * - * '''Emits when''' upstream emits an element - * - * '''Backpressures when''' downstream backpressures - * - * '''Completes when''' upstream completes or fails if timeout elapses between element emission and downstream demand. - * - * '''Cancels when''' downstream cancels - */ + * If the time between the emission of an element and the following downstream demand exceeds the provided timeout, + * the stream is failed with a [[java.util.concurrent.TimeoutException]]. The timeout is checked periodically, + * so the resolution of the check is one period (equals to timeout value). + * + * '''Emits when''' upstream emits an element + * + * '''Backpressures when''' downstream backpressures + * + * '''Completes when''' upstream completes or fails if timeout elapses between element emission and downstream demand. + * + * '''Cancels when''' downstream cancels + */ def backpressureTimeout(timeout: FiniteDuration): javadsl.Flow[In, Out, Mat] = new Flow(delegate.backpressureTimeout(timeout)) @@ -1737,11 +1744,11 @@ final class Flow[-In, +Out, +Mat](delegate: scaladsl.Flow[In, Out, Mat]) extends new Flow(delegate.watchTermination()((left, right) ⇒ matF(left, right.toJava))) /** - * Materializes to `FlowMonitor[Out]` that allows monitoring of the the current flow. All events are propagated - * by the monitor unchanged. Note that the monitor inserts a memory barrier every time it processes an - * event, and may therefor affect performance. - * The `combine` function is used to combine the `FlowMonitor` with this flow's materialized value. - */ + * Materializes to `FlowMonitor[Out]` that allows monitoring of the the current flow. All events are propagated + * by the monitor unchanged. Note that the monitor inserts a memory barrier every time it processes an + * event, and may therefor affect performance. + * The `combine` function is used to combine the `FlowMonitor` with this flow's materialized value. + */ def monitor[M]()(combine: function.Function2[Mat, FlowMonitor[Out], M]): javadsl.Flow[In, Out, M] = new Flow(delegate.monitor()(combinerToScala(combine))) diff --git a/akka-stream/src/main/scala/akka/stream/javadsl/Framing.scala b/akka-stream/src/main/scala/akka/stream/javadsl/Framing.scala index c3002bfc09..b7b21030b1 100644 --- a/akka-stream/src/main/scala/akka/stream/javadsl/Framing.scala +++ b/akka-stream/src/main/scala/akka/stream/javadsl/Framing.scala @@ -66,9 +66,10 @@ object Framing { * this Flow will fail the stream. This length *includes* the header (i.e the offset and * the length of the size field) */ - def lengthField(fieldLength: Int, - fieldOffset: Int, - maximumFrameLength: Int): Flow[ByteString, ByteString, NotUsed] = + def lengthField( + fieldLength: Int, + fieldOffset: Int, + maximumFrameLength: Int): Flow[ByteString, ByteString, NotUsed] = scaladsl.Framing.lengthField(fieldLength, fieldOffset, maximumFrameLength).asJava /** @@ -85,10 +86,11 @@ object Framing { * the length of the size field) * @param byteOrder The ''ByteOrder'' to be used when decoding the field */ - def lengthField(fieldLength: Int, - fieldOffset: Int, - maximumFrameLength: Int, - byteOrder: ByteOrder): Flow[ByteString, ByteString, NotUsed] = + def lengthField( + fieldLength: Int, + fieldOffset: Int, + maximumFrameLength: Int, + byteOrder: ByteOrder): Flow[ByteString, ByteString, NotUsed] = scaladsl.Framing.lengthField(fieldLength, fieldOffset, maximumFrameLength, byteOrder).asJava /** diff --git a/akka-stream/src/main/scala/akka/stream/javadsl/Graph.scala b/akka-stream/src/main/scala/akka/stream/javadsl/Graph.scala index 7a70645f70..a5fbb9f855 100644 --- a/akka-stream/src/main/scala/akka/stream/javadsl/Graph.scala +++ b/akka-stream/src/main/scala/akka/stream/javadsl/Graph.scala @@ -278,7 +278,7 @@ object ZipN { object ZipWithN { def create[A, O](zipper: function.Function[java.util.List[A], O], n: Int): Graph[UniformFanInShape[A, O], NotUsed] = { import scala.collection.JavaConverters._ - scaladsl.ZipWithN[A, O](seq => zipper.apply(seq.asJava))(n) + scaladsl.ZipWithN[A, O](seq ⇒ zipper.apply(seq.asJava))(n) } } diff --git a/akka-stream/src/main/scala/akka/stream/javadsl/Source.scala b/akka-stream/src/main/scala/akka/stream/javadsl/Source.scala index 54c94b8215..2362794819 100644 --- a/akka-stream/src/main/scala/akka/stream/javadsl/Source.scala +++ b/akka-stream/src/main/scala/akka/stream/javadsl/Source.scala @@ -305,7 +305,7 @@ object Source { */ def zipWithN[T, O](zipper: function.Function[java.util.List[T], O], sources: java.util.List[Source[T, _ <: Any]]): Source[O, NotUsed] = { val seq = if (sources != null) Util.immutableSeq(sources).map(_.asScala) else immutable.Seq() - new Source(scaladsl.Source.zipWithN[T, O](seq => zipper.apply(seq.asJava))(seq)) + new Source(scaladsl.Source.zipWithN[T, O](seq ⇒ zipper.apply(seq.asJava))(seq)) } /** @@ -341,61 +341,65 @@ object Source { new Source(scaladsl.Source.queue[T](bufferSize, overflowStrategy).mapMaterializedValue(new SourceQueueAdapter(_))) /** - * Start a new `Source` from some resource which can be opened, read and closed. - * Interaction with resource happens in a blocking way. - * - * Example: - * {{{ - * Source.unfoldResource( - * () -> new BufferedReader(new FileReader("...")), - * reader -> reader.readLine(), - * reader -> reader.close()) - * }}} - * - * You can use the supervision strategy to handle exceptions for `read` function. All exceptions thrown by `create` - * or `close` will fail the stream. - * - * `Restart` supervision strategy will close and create blocking IO again. Default strategy is `Stop` which means - * that stream will be terminated on error in `read` function by default. - * - * You can configure the default dispatcher for this Source by changing the `akka.stream.blocking-io-dispatcher` or - * set it for a given Source by using [[ActorAttributes]]. - * - * @param create - function that is called on stream start and creates/opens resource. - * @param read - function that reads data from opened resource. It is called each time backpressure signal - * is received. Stream calls close and completes when `read` returns None. - * @param close - function that closes resource - */ - def unfoldResource[T, S](create: function.Creator[S], - read: function.Function[S, Optional[T]], - close: function.Procedure[S]): javadsl.Source[T, NotUsed] = - new Source(scaladsl.Source.unfoldResource[T,S](create.create, + * Start a new `Source` from some resource which can be opened, read and closed. + * Interaction with resource happens in a blocking way. + * + * Example: + * {{{ + * Source.unfoldResource( + * () -> new BufferedReader(new FileReader("...")), + * reader -> reader.readLine(), + * reader -> reader.close()) + * }}} + * + * You can use the supervision strategy to handle exceptions for `read` function. All exceptions thrown by `create` + * or `close` will fail the stream. + * + * `Restart` supervision strategy will close and create blocking IO again. Default strategy is `Stop` which means + * that stream will be terminated on error in `read` function by default. + * + * You can configure the default dispatcher for this Source by changing the `akka.stream.blocking-io-dispatcher` or + * set it for a given Source by using [[ActorAttributes]]. + * + * @param create - function that is called on stream start and creates/opens resource. + * @param read - function that reads data from opened resource. It is called each time backpressure signal + * is received. Stream calls close and completes when `read` returns None. + * @param close - function that closes resource + */ + def unfoldResource[T, S]( + create: function.Creator[S], + read: function.Function[S, Optional[T]], + close: function.Procedure[S]): javadsl.Source[T, NotUsed] = + new Source(scaladsl.Source.unfoldResource[T, S]( + create.create, (s: S) ⇒ read.apply(s).asScala, close.apply)) /** - * Start a new `Source` from some resource which can be opened, read and closed. - * It's similar to `unfoldResource` but takes functions that return `CopletionStage` instead of plain values. - * - * You can use the supervision strategy to handle exceptions for `read` function or failures of produced `Futures`. - * All exceptions thrown by `create` or `close` as well as fails of returned futures will fail the stream. - * - * `Restart` supervision strategy will close and create resource. Default strategy is `Stop` which means - * that stream will be terminated on error in `read` function (or future) by default. - * - * You can configure the default dispatcher for this Source by changing the `akka.stream.blocking-io-dispatcher` or - * set it for a given Source by using [[ActorAttributes]]. - * - * @param create - function that is called on stream start and creates/opens resource. - * @param read - function that reads data from opened resource. It is called each time backpressure signal - * is received. Stream calls close and completes when `CompletionStage` from read function returns None. - * @param close - function that closes resource - */ - def unfoldResourceAsync[T, S](create: function.Creator[CompletionStage[S]], - read: function.Function[S, CompletionStage[Optional[T]]], - close: function.Function[S, CompletionStage[Done]]): javadsl.Source[T, NotUsed] = - new Source(scaladsl.Source.unfoldResourceAsync[T,S](() ⇒ create.create().toScala, - (s: S) ⇒ read.apply(s).toScala.map(_.asScala)(akka.dispatch.ExecutionContexts.sameThreadExecutionContext), - (s: S) ⇒ close.apply(s).toScala)) + * Start a new `Source` from some resource which can be opened, read and closed. + * It's similar to `unfoldResource` but takes functions that return `CopletionStage` instead of plain values. + * + * You can use the supervision strategy to handle exceptions for `read` function or failures of produced `Futures`. + * All exceptions thrown by `create` or `close` as well as fails of returned futures will fail the stream. + * + * `Restart` supervision strategy will close and create resource. Default strategy is `Stop` which means + * that stream will be terminated on error in `read` function (or future) by default. + * + * You can configure the default dispatcher for this Source by changing the `akka.stream.blocking-io-dispatcher` or + * set it for a given Source by using [[ActorAttributes]]. + * + * @param create - function that is called on stream start and creates/opens resource. + * @param read - function that reads data from opened resource. It is called each time backpressure signal + * is received. Stream calls close and completes when `CompletionStage` from read function returns None. + * @param close - function that closes resource + */ + def unfoldResourceAsync[T, S]( + create: function.Creator[CompletionStage[S]], + read: function.Function[S, CompletionStage[Optional[T]]], + close: function.Function[S, CompletionStage[Done]]): javadsl.Source[T, NotUsed] = + new Source(scaladsl.Source.unfoldResourceAsync[T, S]( + () ⇒ create.create().toScala, + (s: S) ⇒ read.apply(s).toScala.map(_.asScala)(akka.dispatch.ExecutionContexts.sameThreadExecutionContext), + (s: S) ⇒ close.apply(s).toScala)) } /** @@ -577,8 +581,9 @@ final class Source[+Out, +Mat](delegate: scaladsl.Source[Out, Mat]) extends Grap * * @see [[#concat]]. */ - def concatMat[T >: Out, M, M2](that: Graph[SourceShape[T], M], - matF: function.Function2[Mat, M, M2]): javadsl.Source[T, M2] = + def concatMat[T >: Out, M, M2]( + that: Graph[SourceShape[T], M], + matF: function.Function2[Mat, M, M2]): javadsl.Source[T, M2] = new Source(delegate.concatMat(that)(combinerToScala(matF))) /** @@ -617,8 +622,9 @@ final class Source[+Out, +Mat](delegate: scaladsl.Source[Out, Mat]) extends Grap * * @see [[#prepend]]. */ - def prependMat[T >: Out, M, M2](that: Graph[SourceShape[T], M], - matF: function.Function2[Mat, M, M2]): javadsl.Source[T, M2] = + def prependMat[T >: Out, M, M2]( + that: Graph[SourceShape[T], M], + matF: function.Function2[Mat, M, M2]): javadsl.Source[T, M2] = new Source(delegate.prependMat(that)(combinerToScala(matF))) /** @@ -645,8 +651,9 @@ final class Source[+Out, +Mat](delegate: scaladsl.Source[Out, Mat]) extends Grap * * @see [[#alsoTo]] */ - def alsoToMat[M2, M3](that: Graph[SinkShape[Out], M2], - matF: function.Function2[Mat, M2, M3]): javadsl.Source[Out, M3] = + def alsoToMat[M2, M3]( + that: Graph[SinkShape[Out], M2], + matF: function.Function2[Mat, M2, M3]): javadsl.Source[Out, M3] = new Source(delegate.alsoToMat(that)(combinerToScala(matF))) /** @@ -718,8 +725,9 @@ final class Source[+Out, +Mat](delegate: scaladsl.Source[Out, Mat]) extends Grap * * @see [[#merge]]. */ - def mergeMat[T >: Out, M, M2](that: Graph[SourceShape[T], M], - matF: function.Function2[Mat, M, M2]): javadsl.Source[T, M2] = + def mergeMat[T >: Out, M, M2]( + that: Graph[SourceShape[T], M], + matF: function.Function2[Mat, M, M2]): javadsl.Source[T, M2] = new Source(delegate.mergeMat(that)(combinerToScala(matF))) /** @@ -778,8 +786,9 @@ final class Source[+Out, +Mat](delegate: scaladsl.Source[Out, Mat]) extends Grap * * @see [[#zip]]. */ - def zipMat[T, M, M2](that: Graph[SourceShape[T], M], - matF: function.Function2[Mat, M, M2]): javadsl.Source[Out @uncheckedVariance Pair T, M2] = + def zipMat[T, M, M2]( + that: Graph[SourceShape[T], M], + matF: function.Function2[Mat, M, M2]): javadsl.Source[Out @uncheckedVariance Pair T, M2] = this.viaMat(Flow.create[Out].zipMat(that, Keep.right[NotUsed, M]), matF) /** @@ -794,8 +803,9 @@ final class Source[+Out, +Mat](delegate: scaladsl.Source[Out, Mat]) extends Grap * * '''Cancels when''' downstream cancels */ - def zipWith[Out2, Out3](that: Graph[SourceShape[Out2], _], - combine: function.Function2[Out, Out2, Out3]): javadsl.Source[Out3, Mat] = + def zipWith[Out2, Out3]( + that: Graph[SourceShape[Out2], _], + combine: function.Function2[Out, Out2, Out3]): javadsl.Source[Out3, Mat] = new Source(delegate.zipWith[Out2, Out3](that)(combinerToScala(combine))) /** @@ -807,9 +817,10 @@ final class Source[+Out, +Mat](delegate: scaladsl.Source[Out, Mat]) extends Grap * * @see [[#zipWith]]. */ - def zipWithMat[Out2, Out3, M, M2](that: Graph[SourceShape[Out2], M], - combine: function.Function2[Out, Out2, Out3], - matF: function.Function2[Mat, M, M2]): javadsl.Source[Out3, M2] = + def zipWithMat[Out2, Out3, M, M2]( + that: Graph[SourceShape[Out2], M], + combine: function.Function2[Out, Out2, Out3], + matF: function.Function2[Mat, M, M2]): javadsl.Source[Out3, M2] = new Source(delegate.zipWithMat[Out2, Out3, M, M2](that)(combinerToScala(combine))(combinerToScala(matF))) /** @@ -877,27 +888,26 @@ final class Source[+Out, +Mat](delegate: scaladsl.Source[Out, Mat]) extends Grap def recoverWith[T >: Out](pf: PartialFunction[Throwable, _ <: Graph[SourceShape[T], NotUsed]]): Source[T, Mat @uncheckedVariance] = new Source(delegate.recoverWith(pf)) - /** - * RecoverWithRetries allows to switch to alternative Source on flow failure. It will stay in effect after - * a failure has been recovered up to `attempts` number of times so that each time there is a failure - * it is fed into the `pf` and a new Source may be materialized. Note that if you pass in 0, this won't - * attempt to recover at all. Passing in a negative number will behave exactly the same as `recoverWith`. - * - * Since the underlying failure signal onError arrives out-of-band, it might jump over existing elements. - * This stage can recover the failure signal, but not the skipped elements, which will be dropped. - * - * '''Emits when''' element is available from the upstream or upstream is failed and element is available - * from alternative Source - * - * '''Backpressures when''' downstream backpressures - * - * '''Completes when''' upstream completes or upstream failed with exception pf can handle - * - * '''Cancels when''' downstream cancels - * - */ - def recoverWithRetries[T >: Out](attempts: Int, pf: PartialFunction[Throwable, _ <: Graph[SourceShape[T], NotUsed]]): Source[T, Mat @uncheckedVariance] = + * RecoverWithRetries allows to switch to alternative Source on flow failure. It will stay in effect after + * a failure has been recovered up to `attempts` number of times so that each time there is a failure + * it is fed into the `pf` and a new Source may be materialized. Note that if you pass in 0, this won't + * attempt to recover at all. Passing in a negative number will behave exactly the same as `recoverWith`. + * + * Since the underlying failure signal onError arrives out-of-band, it might jump over existing elements. + * This stage can recover the failure signal, but not the skipped elements, which will be dropped. + * + * '''Emits when''' element is available from the upstream or upstream is failed and element is available + * from alternative Source + * + * '''Backpressures when''' downstream backpressures + * + * '''Completes when''' upstream completes or upstream failed with exception pf can handle + * + * '''Cancels when''' downstream cancels + * + */ + def recoverWithRetries[T >: Out](attempts: Int, pf: PartialFunction[Throwable, _ <: Graph[SourceShape[T], NotUsed]]): Source[T, Mat @uncheckedVariance] = new Source(delegate.recoverWithRetries(attempts, pf)) /** * Transform each input element into an `Iterable` of output elements that is @@ -1827,18 +1837,18 @@ final class Source[+Out, +Mat](delegate: scaladsl.Source[Out, Mat]) extends Grap new Source(delegate.idleTimeout(timeout)) /** - * If the time between the emission of an element and the following downstream demand exceeds the provided timeout, - * the stream is failed with a [[java.util.concurrent.TimeoutException]]. The timeout is checked periodically, - * so the resolution of the check is one period (equals to timeout value). - * - * '''Emits when''' upstream emits an element - * - * '''Backpressures when''' downstream backpressures - * - * '''Completes when''' upstream completes or fails if timeout elapses between element emission and downstream demand. - * - * '''Cancels when''' downstream cancels - */ + * If the time between the emission of an element and the following downstream demand exceeds the provided timeout, + * the stream is failed with a [[java.util.concurrent.TimeoutException]]. The timeout is checked periodically, + * so the resolution of the check is one period (equals to timeout value). + * + * '''Emits when''' upstream emits an element + * + * '''Backpressures when''' downstream backpressures + * + * '''Completes when''' upstream completes or fails if timeout elapses between element emission and downstream demand. + * + * '''Cancels when''' downstream cancels + */ def backpressureTimeout(timeout: FiniteDuration): javadsl.Source[Out, Mat] = new Source(delegate.backpressureTimeout(timeout)) @@ -1949,11 +1959,11 @@ final class Source[+Out, +Mat](delegate: scaladsl.Source[Out, Mat]) extends Grap new Source(delegate.watchTermination()((left, right) ⇒ matF(left, right.toJava))) /** - * Materializes to `FlowMonitor[Out]` that allows monitoring of the the current flow. All events are propagated - * by the monitor unchanged. Note that the monitor inserts a memory barrier every time it processes an - * event, and may therefor affect performance. - * The `combine` function is used to combine the `FlowMonitor` with this flow's materialized value. - */ + * Materializes to `FlowMonitor[Out]` that allows monitoring of the the current flow. All events are propagated + * by the monitor unchanged. Note that the monitor inserts a memory barrier every time it processes an + * event, and may therefor affect performance. + * The `combine` function is used to combine the `FlowMonitor` with this flow's materialized value. + */ def monitor[M]()(combine: function.Function2[Mat, FlowMonitor[Out], M]): javadsl.Source[Out, M] = new Source(delegate.monitor()(combinerToScala(combine))) diff --git a/akka-stream/src/main/scala/akka/stream/javadsl/StreamConverters.scala b/akka-stream/src/main/scala/akka/stream/javadsl/StreamConverters.scala index 9b4ecb7de1..71492c1399 100644 --- a/akka-stream/src/main/scala/akka/stream/javadsl/StreamConverters.scala +++ b/akka-stream/src/main/scala/akka/stream/javadsl/StreamConverters.scala @@ -150,57 +150,56 @@ object StreamConverters { def asOutputStream(): javadsl.Source[ByteString, OutputStream] = new Source(scaladsl.StreamConverters.asOutputStream()) - /** - * Creates a sink which materializes into Java 8 ``Stream`` that can be run to trigger demand through the sink. - * Elements emitted through the stream will be available for reading through the Java 8 ``Stream``. - * - * The Java 8 ``Stream`` will be ended when the stream flowing into this ``Sink`` completes, and closing the Java - * ``Stream`` will cancel the inflow of this ``Sink``. - * - * Java 8 ``Stream`` throws exception in case reactive stream failed. - * - * Be aware that Java ``Stream`` blocks current thread while waiting on next element from downstream. - * As it is interacting wit blocking API the implementation runs on a separate dispatcher - * configured through the ``akka.stream.blocking-io-dispatcher``. - */ + * Creates a sink which materializes into Java 8 ``Stream`` that can be run to trigger demand through the sink. + * Elements emitted through the stream will be available for reading through the Java 8 ``Stream``. + * + * The Java 8 ``Stream`` will be ended when the stream flowing into this ``Sink`` completes, and closing the Java + * ``Stream`` will cancel the inflow of this ``Sink``. + * + * Java 8 ``Stream`` throws exception in case reactive stream failed. + * + * Be aware that Java ``Stream`` blocks current thread while waiting on next element from downstream. + * As it is interacting wit blocking API the implementation runs on a separate dispatcher + * configured through the ``akka.stream.blocking-io-dispatcher``. + */ def asJavaStream[T](): Sink[T, java.util.stream.Stream[T]] = new Sink(scaladsl.StreamConverters.asJavaStream()) /** - * Creates a source that wraps a Java 8 ``Stream``. ``Source`` uses a stream iterator to get all its - * elements and send them downstream on demand. - * - * Example usage: `Source.fromJavaStream(() -> IntStream.rangeClosed(1, 10))` - * - * You can use [[Source.async]] to create asynchronous boundaries between synchronous java stream - * and the rest of flow. - */ + * Creates a source that wraps a Java 8 ``Stream``. ``Source`` uses a stream iterator to get all its + * elements and send them downstream on demand. + * + * Example usage: `Source.fromJavaStream(() -> IntStream.rangeClosed(1, 10))` + * + * You can use [[Source.async]] to create asynchronous boundaries between synchronous java stream + * and the rest of flow. + */ def fromJavaStream[O, S <: java.util.stream.BaseStream[O, S]](stream: function.Creator[java.util.stream.BaseStream[O, S]]): javadsl.Source[O, NotUsed] = new Source(scaladsl.StreamConverters.fromJavaStream(stream.create)) /** - * Creates a sink which materializes into a ``CompletionStage`` which will be completed with a result of the Java 8 ``Collector`` - * transformation and reduction operations. This allows usage of Java 8 streams transformations for reactive streams. - * The Collector`` will trigger demand downstream. Elements emitted through the stream will be accumulated into a mutable - * result container, optionally transformed into a final representation after all input elements have been processed. - * The ``Collector`` can also do reduction at the end. Reduction processing is performed sequentially - * - * Note that a flow can be materialized multiple times, so the function producing the ``Collector`` must be able - * to handle multiple invocations. - */ + * Creates a sink which materializes into a ``CompletionStage`` which will be completed with a result of the Java 8 ``Collector`` + * transformation and reduction operations. This allows usage of Java 8 streams transformations for reactive streams. + * The Collector`` will trigger demand downstream. Elements emitted through the stream will be accumulated into a mutable + * result container, optionally transformed into a final representation after all input elements have been processed. + * The ``Collector`` can also do reduction at the end. Reduction processing is performed sequentially + * + * Note that a flow can be materialized multiple times, so the function producing the ``Collector`` must be able + * to handle multiple invocations. + */ def javaCollector[T, R](collector: function.Creator[Collector[T, _ <: Any, R]]): Sink[T, CompletionStage[R]] = new Sink(scaladsl.StreamConverters.javaCollector[T, R](() ⇒ collector.create()).toCompletionStage()) /** - * Creates a sink which materializes into a ``CompletionStage`` which will be completed with a result of the Java 8 ``Collector`` - * transformation and reduction operations. This allows usage of Java 8 streams transformations for reactive streams. - * The ``Collector`` will trigger demand downstream. Elements emitted through the stream will be accumulated into a mutable - * result container, optionally transformed into a final representation after all input elements have been processed. - * ``Collector`` can also do reduction at the end. Reduction processing is performed in parallel based on graph ``Balance``. - * - * Note that a flow can be materialized multiple times, so the function producing the ``Collector`` must be able - * to handle multiple invocations. - */ + * Creates a sink which materializes into a ``CompletionStage`` which will be completed with a result of the Java 8 ``Collector`` + * transformation and reduction operations. This allows usage of Java 8 streams transformations for reactive streams. + * The ``Collector`` will trigger demand downstream. Elements emitted through the stream will be accumulated into a mutable + * result container, optionally transformed into a final representation after all input elements have been processed. + * ``Collector`` can also do reduction at the end. Reduction processing is performed in parallel based on graph ``Balance``. + * + * Note that a flow can be materialized multiple times, so the function producing the ``Collector`` must be able + * to handle multiple invocations. + */ def javaCollectorParallelUnordered[T, R](parallelism: Int)(collector: function.Creator[Collector[T, _ <: Any, R]]): Sink[T, CompletionStage[R]] = new Sink(scaladsl.StreamConverters.javaCollectorParallelUnordered[T, R](parallelism)(() ⇒ collector.create()).toCompletionStage()) diff --git a/akka-stream/src/main/scala/akka/stream/javadsl/SubFlow.scala b/akka-stream/src/main/scala/akka/stream/javadsl/SubFlow.scala index 444a6c5a04..1e8e562253 100644 --- a/akka-stream/src/main/scala/akka/stream/javadsl/SubFlow.scala +++ b/akka-stream/src/main/scala/akka/stream/javadsl/SubFlow.scala @@ -634,29 +634,27 @@ class SubFlow[-In, +Out, +Mat](delegate: scaladsl.SubFlow[Out, Mat, scaladsl.Flo new SubFlow(delegate.recoverWith(pf)) /** - * RecoverWithRetries allows to switch to alternative Source on flow failure. It will stay in effect after - * a failure has been recovered up to `attempts` number of times so that each time there is a failure - * it is fed into the `pf` and a new Source may be materialized. Note that if you pass in 0, this won't - * attempt to recover at all. Passing in a negative number will behave exactly the same as `recoverWith`. - * - * Since the underlying failure signal onError arrives out-of-band, it might jump over existing elements. - * This stage can recover the failure signal, but not the skipped elements, which will be dropped. - * - * '''Emits when''' element is available from the upstream or upstream is failed and element is available - * from alternative Source - * - * '''Backpressures when''' downstream backpressures - * - * '''Completes when''' upstream completes or upstream failed with exception pf can handle - * - * '''Cancels when''' downstream cancels - * - */ + * RecoverWithRetries allows to switch to alternative Source on flow failure. It will stay in effect after + * a failure has been recovered up to `attempts` number of times so that each time there is a failure + * it is fed into the `pf` and a new Source may be materialized. Note that if you pass in 0, this won't + * attempt to recover at all. Passing in a negative number will behave exactly the same as `recoverWith`. + * + * Since the underlying failure signal onError arrives out-of-band, it might jump over existing elements. + * This stage can recover the failure signal, but not the skipped elements, which will be dropped. + * + * '''Emits when''' element is available from the upstream or upstream is failed and element is available + * from alternative Source + * + * '''Backpressures when''' downstream backpressures + * + * '''Completes when''' upstream completes or upstream failed with exception pf can handle + * + * '''Cancels when''' downstream cancels + * + */ def recoverWithRetries[T >: Out](attempts: Int, pf: PartialFunction[Throwable, _ <: Graph[SourceShape[T], NotUsed]]): SubFlow[In, T, Mat @uncheckedVariance] = new SubFlow(delegate.recoverWithRetries(attempts, pf)) - - /** * Terminate processing (and cancel the upstream publisher) after the given * number of elements. Due to input buffering some elements may have been @@ -1065,8 +1063,9 @@ class SubFlow[-In, +Out, +Mat](delegate: scaladsl.SubFlow[Out, Mat, scaladsl.Flo * * '''Cancels when''' downstream cancels */ - def zipWith[Out2, Out3](that: Graph[SourceShape[Out2], _], - combine: function.Function2[Out, Out2, Out3]): SubFlow[In, Out3, Mat] = + def zipWith[Out2, Out3]( + that: Graph[SourceShape[Out2], _], + combine: function.Function2[Out, Out2, Out3]): SubFlow[In, Out3, Mat] = new SubFlow(delegate.zipWith[Out2, Out3](that)(combinerToScala(combine))) /** @@ -1116,18 +1115,18 @@ class SubFlow[-In, +Out, +Mat](delegate: scaladsl.SubFlow[Out, Mat, scaladsl.Flo new SubFlow(delegate.idleTimeout(timeout)) /** - * If the time between the emission of an element and the following downstream demand exceeds the provided timeout, - * the stream is failed with a [[java.util.concurrent.TimeoutException]]. The timeout is checked periodically, - * so the resolution of the check is one period (equals to timeout value). - * - * '''Emits when''' upstream emits an element - * - * '''Backpressures when''' downstream backpressures - * - * '''Completes when''' upstream completes or fails if timeout elapses between element emission and downstream demand. - * - * '''Cancels when''' downstream cancels - */ + * If the time between the emission of an element and the following downstream demand exceeds the provided timeout, + * the stream is failed with a [[java.util.concurrent.TimeoutException]]. The timeout is checked periodically, + * so the resolution of the check is one period (equals to timeout value). + * + * '''Emits when''' upstream emits an element + * + * '''Backpressures when''' downstream backpressures + * + * '''Completes when''' upstream completes or fails if timeout elapses between element emission and downstream demand. + * + * '''Cancels when''' downstream cancels + */ def backpressureTimeout(timeout: FiniteDuration): SubFlow[In, Out, Mat] = new SubFlow(delegate.backpressureTimeout(timeout)) diff --git a/akka-stream/src/main/scala/akka/stream/javadsl/SubSource.scala b/akka-stream/src/main/scala/akka/stream/javadsl/SubSource.scala index 5eaf3958b1..da0061adc9 100644 --- a/akka-stream/src/main/scala/akka/stream/javadsl/SubSource.scala +++ b/akka-stream/src/main/scala/akka/stream/javadsl/SubSource.scala @@ -632,24 +632,24 @@ class SubSource[+Out, +Mat](delegate: scaladsl.SubFlow[Out, Mat, scaladsl.Source new SubSource(delegate.recoverWith(pf)) /** - * RecoverWithRetries allows to switch to alternative Source on flow failure. It will stay in effect after - * a failure has been recovered up to `attempts` number of times so that each time there is a failure - * it is fed into the `pf` and a new Source may be materialized. Note that if you pass in 0, this won't - * attempt to recover at all. Passing in a negative number will behave exactly the same as `recoverWith`. - * - * Since the underlying failure signal onError arrives out-of-band, it might jump over existing elements. - * This stage can recover the failure signal, but not the skipped elements, which will be dropped. - * - * '''Emits when''' element is available from the upstream or upstream is failed and element is available - * from alternative Source - * - * '''Backpressures when''' downstream backpressures - * - * '''Completes when''' upstream completes or upstream failed with exception pf can handle - * - * '''Cancels when''' downstream cancels - * - */ + * RecoverWithRetries allows to switch to alternative Source on flow failure. It will stay in effect after + * a failure has been recovered up to `attempts` number of times so that each time there is a failure + * it is fed into the `pf` and a new Source may be materialized. Note that if you pass in 0, this won't + * attempt to recover at all. Passing in a negative number will behave exactly the same as `recoverWith`. + * + * Since the underlying failure signal onError arrives out-of-band, it might jump over existing elements. + * This stage can recover the failure signal, but not the skipped elements, which will be dropped. + * + * '''Emits when''' element is available from the upstream or upstream is failed and element is available + * from alternative Source + * + * '''Backpressures when''' downstream backpressures + * + * '''Completes when''' upstream completes or upstream failed with exception pf can handle + * + * '''Cancels when''' downstream cancels + * + */ def recoverWithRetries[T >: Out](attempts: Int, pf: PartialFunction[Throwable, _ <: Graph[SourceShape[T], NotUsed]]): SubSource[T, Mat @uncheckedVariance] = new SubSource(delegate.recoverWithRetries(attempts, pf)) @@ -1062,8 +1062,9 @@ class SubSource[+Out, +Mat](delegate: scaladsl.SubFlow[Out, Mat, scaladsl.Source * * '''Cancels when''' downstream cancels */ - def zipWith[Out2, Out3](that: Graph[SourceShape[Out2], _], - combine: function.Function2[Out, Out2, Out3]): SubSource[Out3, Mat] = + def zipWith[Out2, Out3]( + that: Graph[SourceShape[Out2], _], + combine: function.Function2[Out, Out2, Out3]): SubSource[Out3, Mat] = new SubSource(delegate.zipWith[Out2, Out3](that)(combinerToScala(combine))) /** @@ -1113,18 +1114,18 @@ class SubSource[+Out, +Mat](delegate: scaladsl.SubFlow[Out, Mat, scaladsl.Source new SubSource(delegate.idleTimeout(timeout)) /** - * If the time between the emission of an element and the following downstream demand exceeds the provided timeout, - * the stream is failed with a [[java.util.concurrent.TimeoutException]]. The timeout is checked periodically, - * so the resolution of the check is one period (equals to timeout value). - * - * '''Emits when''' upstream emits an element - * - * '''Backpressures when''' downstream backpressures - * - * '''Completes when''' upstream completes or fails if timeout elapses between element emission and downstream demand. - * - * '''Cancels when''' downstream cancels - */ + * If the time between the emission of an element and the following downstream demand exceeds the provided timeout, + * the stream is failed with a [[java.util.concurrent.TimeoutException]]. The timeout is checked periodically, + * so the resolution of the check is one period (equals to timeout value). + * + * '''Emits when''' upstream emits an element + * + * '''Backpressures when''' downstream backpressures + * + * '''Completes when''' upstream completes or fails if timeout elapses between element emission and downstream demand. + * + * '''Cancels when''' downstream cancels + */ def backpressureTimeout(timeout: FiniteDuration): SubSource[Out, Mat] = new SubSource(delegate.backpressureTimeout(timeout)) diff --git a/akka-stream/src/main/scala/akka/stream/javadsl/Tcp.scala b/akka-stream/src/main/scala/akka/stream/javadsl/Tcp.scala index d05c4a8da0..fb77dc5cb2 100644 --- a/akka-stream/src/main/scala/akka/stream/javadsl/Tcp.scala +++ b/akka-stream/src/main/scala/akka/stream/javadsl/Tcp.scala @@ -120,12 +120,13 @@ class Tcp(system: ExtendedActorSystem) extends akka.actor.Extension { * independently whether the client is still attempting to write. This setting is recommended * for servers, and therefore it is the default setting. */ - def bind(interface: String, - port: Int, - backlog: Int, - options: JIterable[SocketOption], - halfClose: Boolean, - idleTimeout: Duration): Source[IncomingConnection, CompletionStage[ServerBinding]] = + def bind( + interface: String, + port: Int, + backlog: Int, + options: JIterable[SocketOption], + halfClose: Boolean, + idleTimeout: Duration): Source[IncomingConnection, CompletionStage[ServerBinding]] = Source.fromGraph(delegate.bind(interface, port, backlog, immutableSeq(options), halfClose, idleTimeout) .map(new IncomingConnection(_)) .mapMaterializedValue(_.map(new ServerBinding(_))(ec).toJava)) @@ -159,12 +160,13 @@ class Tcp(system: ExtendedActorSystem) extends akka.actor.Extension { * If set to false, the connection will immediately closed once the client closes its write side, * independently whether the server is still attempting to write. */ - def outgoingConnection(remoteAddress: InetSocketAddress, - localAddress: Optional[InetSocketAddress], - options: JIterable[SocketOption], - halfClose: Boolean, - connectTimeout: Duration, - idleTimeout: Duration): Flow[ByteString, ByteString, CompletionStage[OutgoingConnection]] = + def outgoingConnection( + remoteAddress: InetSocketAddress, + localAddress: Optional[InetSocketAddress], + options: JIterable[SocketOption], + halfClose: Boolean, + connectTimeout: Duration, + idleTimeout: Duration): Flow[ByteString, ByteString, CompletionStage[OutgoingConnection]] = Flow.fromGraph(delegate.outgoingConnection(remoteAddress, localAddress.asScala, immutableSeq(options), halfClose, connectTimeout, idleTimeout) .mapMaterializedValue(_.map(new OutgoingConnection(_))(ec).toJava)) diff --git a/akka-stream/src/main/scala/akka/stream/scaladsl/BidiFlow.scala b/akka-stream/src/main/scala/akka/stream/scaladsl/BidiFlow.scala index 7e195c0462..3bc954ebd4 100644 --- a/akka-stream/src/main/scala/akka/stream/scaladsl/BidiFlow.scala +++ b/akka-stream/src/main/scala/akka/stream/scaladsl/BidiFlow.scala @@ -194,8 +194,7 @@ object BidiFlow { def fromFlowsMat[I1, O1, I2, O2, M1, M2, M]( flow1: Graph[FlowShape[I1, O1], M1], flow2: Graph[FlowShape[I2, O2], M2])(combine: (M1, M2) ⇒ M): BidiFlow[I1, O1, I2, O2, M] = - fromGraph(GraphDSL.create(flow1, flow2)(combine) { - implicit b ⇒ (f1, f2) ⇒ BidiShape(f1.in, f1.out, f2.in, f2.out) + fromGraph(GraphDSL.create(flow1, flow2)(combine) { implicit b ⇒ (f1, f2) ⇒ BidiShape(f1.in, f1.out, f2.in, f2.out) }) /** @@ -216,8 +215,9 @@ object BidiFlow { * }}} * */ - def fromFlows[I1, O1, I2, O2, M1, M2](flow1: Graph[FlowShape[I1, O1], M1], - flow2: Graph[FlowShape[I2, O2], M2]): BidiFlow[I1, O1, I2, O2, NotUsed] = + def fromFlows[I1, O1, I2, O2, M1, M2]( + flow1: Graph[FlowShape[I1, O1], M1], + flow2: Graph[FlowShape[I2, O2], M2]): BidiFlow[I1, O1, I2, O2, NotUsed] = fromFlowsMat(flow1, flow2)(Keep.none) /** diff --git a/akka-stream/src/main/scala/akka/stream/scaladsl/Flow.scala b/akka-stream/src/main/scala/akka/stream/scaladsl/Flow.scala index 1a7bd530cf..12ca3f4e73 100644 --- a/akka-stream/src/main/scala/akka/stream/scaladsl/Flow.scala +++ b/akka-stream/src/main/scala/akka/stream/scaladsl/Flow.scala @@ -3,7 +3,7 @@ */ package akka.stream.scaladsl -import akka.event.{Logging, LoggingAdapter} +import akka.event.{ Logging, LoggingAdapter } import akka.stream._ import akka.Done import akka.stream.impl.Stages.DefaultAttributes @@ -26,7 +26,7 @@ import akka.NotUsed * A `Flow` is a set of stream processing steps that has one open input and one open output. */ final class Flow[-In, +Out, +Mat](private[stream] override val module: Module) - extends FlowOpsMat[Out, Mat] with Graph[FlowShape[In, Out], Mat] { + extends FlowOpsMat[Out, Mat] with Graph[FlowShape[In, Out], Mat] { override val shape: FlowShape[In, Out] = module.shape.asInstanceOf[FlowShape[In, Out]] @@ -49,8 +49,8 @@ final class Flow[-In, +Out, +Mat](private[stream] override val module: Module) val m = flow.module val mat = if (combine == Keep.left) { - if (IgnorableMatValComp(m)) Ignore else Transform(_ => NotUsed, Atomic(m)) - } else Combine(combine.asInstanceOf[(Any, Any) => Any], Ignore, Atomic(m)) + if (IgnorableMatValComp(m)) Ignore else Transform(_ ⇒ NotUsed, Atomic(m)) + } else Combine(combine.asInstanceOf[(Any, Any) ⇒ Any], Ignore, Atomic(m)) new Flow(CompositeModule(Set(m), m.shape, empty, empty, mat, Attributes.none)) } else { val flowCopy = flow.module.carbonCopy @@ -434,28 +434,28 @@ trait FlowOps[+Out, +Mat] { via(new RecoverWith(-1, pf)) /** - * RecoverWithRetries allows to switch to alternative Source on flow failure. It will stay in effect after - * a failure has been recovered up to `attempts` number of times so that each time there is a failure - * it is fed into the `pf` and a new Source may be materialized. Note that if you pass in 0, this won't - * attempt to recover at all. Passing -1 will behave exactly the same as `recoverWith`. - * - * Since the underlying failure signal onError arrives out-of-band, it might jump over existing elements. - * This stage can recover the failure signal, but not the skipped elements, which will be dropped. - * - * '''Emits when''' element is available from the upstream or upstream is failed and element is available - * from alternative Source - * - * '''Backpressures when''' downstream backpressures - * - * '''Completes when''' upstream completes or upstream failed with exception pf can handle - * - * '''Cancels when''' downstream cancels - * - * @param attempts Maximum number of retries or -1 to retry indefinitely - * @param pf Receives the failure cause and returns the new Source to be materialized if any - * @throws IllegalArgumentException if `attempts` is a negative number other than -1 - * - */ + * RecoverWithRetries allows to switch to alternative Source on flow failure. It will stay in effect after + * a failure has been recovered up to `attempts` number of times so that each time there is a failure + * it is fed into the `pf` and a new Source may be materialized. Note that if you pass in 0, this won't + * attempt to recover at all. Passing -1 will behave exactly the same as `recoverWith`. + * + * Since the underlying failure signal onError arrives out-of-band, it might jump over existing elements. + * This stage can recover the failure signal, but not the skipped elements, which will be dropped. + * + * '''Emits when''' element is available from the upstream or upstream is failed and element is available + * from alternative Source + * + * '''Backpressures when''' downstream backpressures + * + * '''Completes when''' upstream completes or upstream failed with exception pf can handle + * + * '''Cancels when''' downstream cancels + * + * @param attempts Maximum number of retries or -1 to retry indefinitely + * @param pf Receives the failure cause and returns the new Source to be materialized if any + * @throws IllegalArgumentException if `attempts` is a negative number other than -1 + * + */ def recoverWithRetries[T >: Out](attempts: Int, pf: PartialFunction[Throwable, Graph[SourceShape[T], NotUsed]]): Repr[T] = via(new RecoverWith(attempts, pf)) @@ -492,7 +492,7 @@ trait FlowOps[+Out, +Mat] { * '''Cancels when''' downstream cancels * */ - def mapConcat[T](f: Out ⇒ immutable.Iterable[T]): Repr[T] = statefulMapConcat(() => f) + def mapConcat[T](f: Out ⇒ immutable.Iterable[T]): Repr[T] = statefulMapConcat(() ⇒ f) /** * Transform each input element into an `Iterable` of output elements that is @@ -1029,7 +1029,7 @@ trait FlowOps[+Out, +Mat] { * * See also [[FlowOps.conflate]], [[FlowOps.limit]], [[FlowOps.limitWeighted]] [[FlowOps.batch]] [[FlowOps.batchWeighted]] */ - def conflate[O2 >: Out](aggregate: (O2, O2) => O2): Repr[O2] = conflateWithSeed[O2](ConstantFun.scalaIdentityFunction)(aggregate) + def conflate[O2 >: Out](aggregate: (O2, O2) ⇒ O2): Repr[O2] = conflateWithSeed[O2](ConstantFun.scalaIdentityFunction)(aggregate) /** * Allows a faster upstream to progress independently of a slower subscriber by aggregating elements into batches @@ -1442,18 +1442,18 @@ trait FlowOps[+Out, +Mat] { def idleTimeout(timeout: FiniteDuration): Repr[Out] = via(new Timers.Idle[Out](timeout)) /** - * If the time between the emission of an element and the following downstream demand exceeds the provided timeout, - * the stream is failed with a [[scala.concurrent.TimeoutException]]. The timeout is checked periodically, - * so the resolution of the check is one period (equals to timeout value). - * - * '''Emits when''' upstream emits an element - * - * '''Backpressures when''' downstream backpressures - * - * '''Completes when''' upstream completes or fails if timeout elapses between element emission and downstream demand. - * - * '''Cancels when''' downstream cancels - */ + * If the time between the emission of an element and the following downstream demand exceeds the provided timeout, + * the stream is failed with a [[scala.concurrent.TimeoutException]]. The timeout is checked periodically, + * so the resolution of the check is one period (equals to timeout value). + * + * '''Emits when''' upstream emits an element + * + * '''Backpressures when''' downstream backpressures + * + * '''Completes when''' upstream completes or fails if timeout elapses between element emission and downstream demand. + * + * '''Cancels when''' downstream cancels + */ def backpressureTimeout(timeout: FiniteDuration): Repr[Out] = via(new Timers.BackpressureTimeout[Out](timeout)) /** @@ -1600,11 +1600,10 @@ trait FlowOps[+Out, +Mat] { def zip[U](that: Graph[SourceShape[U], _]): Repr[(Out, U)] = via(zipGraph(that)) protected def zipGraph[U, M](that: Graph[SourceShape[U], M]): Graph[FlowShape[Out @uncheckedVariance, (Out, U)], M] = - GraphDSL.create(that) { implicit b ⇒ - r ⇒ - val zip = b.add(Zip[Out, U]()) - r ~> zip.in1 - FlowShape(zip.in0, zip.out) + GraphDSL.create(that) { implicit b ⇒ r ⇒ + val zip = b.add(Zip[Out, U]()) + r ~> zip.in1 + FlowShape(zip.in0, zip.out) } /** @@ -1623,11 +1622,10 @@ trait FlowOps[+Out, +Mat] { via(zipWithGraph(that)(combine)) protected def zipWithGraph[Out2, Out3, M](that: Graph[SourceShape[Out2], M])(combine: (Out, Out2) ⇒ Out3): Graph[FlowShape[Out @uncheckedVariance, Out3], M] = - GraphDSL.create(that) { implicit b ⇒ - r ⇒ - val zip = b.add(ZipWith[Out, Out2, Out3](combine)) - r ~> zip.in1 - FlowShape(zip.in0, zip.out) + GraphDSL.create(that) { implicit b ⇒ r ⇒ + val zip = b.add(ZipWith[Out, Out2, Out3](combine)) + r ~> zip.in1 + FlowShape(zip.in0, zip.out) } /** @@ -1656,13 +1654,13 @@ trait FlowOps[+Out, +Mat] { def interleave[U >: Out](that: Graph[SourceShape[U], _], segmentSize: Int): Repr[U] = via(interleaveGraph(that, segmentSize)) - protected def interleaveGraph[U >: Out, M](that: Graph[SourceShape[U], M], - segmentSize: Int): Graph[FlowShape[Out @uncheckedVariance, U], M] = - GraphDSL.create(that) { implicit b ⇒ - r ⇒ - val interleave = b.add(Interleave[U](2, segmentSize)) - r ~> interleave.in(1) - FlowShape(interleave.in(0), interleave.out) + protected def interleaveGraph[U >: Out, M]( + that: Graph[SourceShape[U], M], + segmentSize: Int): Graph[FlowShape[Out @uncheckedVariance, U], M] = + GraphDSL.create(that) { implicit b ⇒ r ⇒ + val interleave = b.add(Interleave[U](2, segmentSize)) + r ~> interleave.in(1) + FlowShape(interleave.in(0), interleave.out) } /** @@ -1681,11 +1679,10 @@ trait FlowOps[+Out, +Mat] { via(mergeGraph(that, eagerComplete)) protected def mergeGraph[U >: Out, M](that: Graph[SourceShape[U], M], eagerComplete: Boolean): Graph[FlowShape[Out @uncheckedVariance, U], M] = - GraphDSL.create(that) { implicit b ⇒ - r ⇒ - val merge = b.add(Merge[U](2, eagerComplete)) - r ~> merge.in(1) - FlowShape(merge.in(0), merge.out) + GraphDSL.create(that) { implicit b ⇒ r ⇒ + val merge = b.add(Merge[U](2, eagerComplete)) + r ~> merge.in(1) + FlowShape(merge.in(0), merge.out) } /** @@ -1707,11 +1704,10 @@ trait FlowOps[+Out, +Mat] { via(mergeSortedGraph(that)) protected def mergeSortedGraph[U >: Out, M](that: Graph[SourceShape[U], M])(implicit ord: Ordering[U]): Graph[FlowShape[Out @uncheckedVariance, U], M] = - GraphDSL.create(that) { implicit b ⇒ - r ⇒ - val merge = b.add(new MergeSorted[U]) - r ~> merge.in1 - FlowShape(merge.in0, merge.out) + GraphDSL.create(that) { implicit b ⇒ r ⇒ + val merge = b.add(new MergeSorted[U]) + r ~> merge.in1 + FlowShape(merge.in0, merge.out) } /** @@ -1736,11 +1732,10 @@ trait FlowOps[+Out, +Mat] { via(concatGraph(that)) protected def concatGraph[U >: Out, Mat2](that: Graph[SourceShape[U], Mat2]): Graph[FlowShape[Out @uncheckedVariance, U], Mat2] = - GraphDSL.create(that) { implicit b ⇒ - r ⇒ - val merge = b.add(Concat[U]()) - r ~> merge.in(1) - FlowShape(merge.in(0), merge.out) + GraphDSL.create(that) { implicit b ⇒ r ⇒ + val merge = b.add(Concat[U]()) + r ~> merge.in(1) + FlowShape(merge.in(0), merge.out) } /** @@ -1765,11 +1760,10 @@ trait FlowOps[+Out, +Mat] { via(prependGraph(that)) protected def prependGraph[U >: Out, Mat2](that: Graph[SourceShape[U], Mat2]): Graph[FlowShape[Out @uncheckedVariance, U], Mat2] = - GraphDSL.create(that) { implicit b ⇒ - r ⇒ - val merge = b.add(Concat[U]()) - r ~> merge.in(0) - FlowShape(merge.in(1), merge.out) + GraphDSL.create(that) { implicit b ⇒ r ⇒ + val merge = b.add(Concat[U]()) + r ~> merge.in(0) + FlowShape(merge.in(1), merge.out) } /** @@ -1815,12 +1809,11 @@ trait FlowOps[+Out, +Mat] { def alsoTo(that: Graph[SinkShape[Out], _]): Repr[Out] = via(alsoToGraph(that)) protected def alsoToGraph[M](that: Graph[SinkShape[Out], M]): Graph[FlowShape[Out @uncheckedVariance, Out], M] = - GraphDSL.create(that) { implicit b ⇒ - r ⇒ - import GraphDSL.Implicits._ - val bcast = b.add(Broadcast[Out](2)) - bcast.out(1) ~> r - FlowShape(bcast.in, bcast.out(0)) + GraphDSL.create(that) { implicit b ⇒ r ⇒ + import GraphDSL.Implicits._ + val bcast = b.add(Broadcast[Out](2)) + bcast.out(1) ~> r + FlowShape(bcast.in, bcast.out(0)) } def withAttributes(attr: Attributes): Repr[Out] @@ -1837,10 +1830,10 @@ trait FlowOps[+Out, +Mat] { } /** - * INTERNAL API: this trait will be changed in binary-incompatible ways for classes that are derived from it! - * Do not implement this interface outside the Akka code base! - * - * Binary compatibility is only maintained for callers of this trait’s interface. + * INTERNAL API: this trait will be changed in binary-incompatible ways for classes that are derived from it! + * Do not implement this interface outside the Akka code base! + * + * Binary compatibility is only maintained for callers of this trait’s interface. */ trait FlowOpsMat[+Out, +Mat] extends FlowOps[Out, Mat] { @@ -2033,12 +2026,12 @@ trait FlowOpsMat[+Out, +Mat] extends FlowOps[Out, Mat] { def mapMaterializedValue[Mat2](f: Mat ⇒ Mat2): ReprMat[Out, Mat2] /** - * Materializes to `FlowMonitor[Out]` that allows monitoring of the the current flow. All events are propagated - * by the monitor unchanged. Note that the monitor inserts a memory barrier every time it processes an - * event, and may therefor affect performance. - * The `combine` function is used to combine the `FlowMonitor` with this flow's materialized value. - */ - def monitor[Mat2]()(combine: (Mat, FlowMonitor[Out]) => Mat2): ReprMat[Out, Mat2] = + * Materializes to `FlowMonitor[Out]` that allows monitoring of the the current flow. All events are propagated + * by the monitor unchanged. Note that the monitor inserts a memory barrier every time it processes an + * event, and may therefor affect performance. + * The `combine` function is used to combine the `FlowMonitor` with this flow's materialized value. + */ + def monitor[Mat2]()(combine: (Mat, FlowMonitor[Out]) ⇒ Mat2): ReprMat[Out, Mat2] = viaMat(GraphStages.monitor)(combine) /** diff --git a/akka-stream/src/main/scala/akka/stream/scaladsl/Framing.scala b/akka-stream/src/main/scala/akka/stream/scaladsl/Framing.scala index b6527ad59f..7ff38cae36 100644 --- a/akka-stream/src/main/scala/akka/stream/scaladsl/Framing.scala +++ b/akka-stream/src/main/scala/akka/stream/scaladsl/Framing.scala @@ -48,10 +48,11 @@ object Framing { * the length of the size field) * @param byteOrder The ''ByteOrder'' to be used when decoding the field */ - def lengthField(fieldLength: Int, - fieldOffset: Int = 0, - maximumFrameLength: Int, - byteOrder: ByteOrder = ByteOrder.LITTLE_ENDIAN): Flow[ByteString, ByteString, NotUsed] = { + def lengthField( + fieldLength: Int, + fieldOffset: Int = 0, + maximumFrameLength: Int, + byteOrder: ByteOrder = ByteOrder.LITTLE_ENDIAN): Flow[ByteString, ByteString, NotUsed] = { require(fieldLength >= 1 && fieldLength <= 4, "Length field length must be 1, 2, 3 or 4.") Flow[ByteString].via(new LengthFieldFramingStage(fieldLength, fieldOffset, maximumFrameLength, byteOrder)) .named("lengthFieldFraming") @@ -209,10 +210,10 @@ object Framing { } private final class LengthFieldFramingStage( - val lengthFieldLength: Int, - val lengthFieldOffset: Int, + val lengthFieldLength: Int, + val lengthFieldOffset: Int, val maximumFrameLength: Int, - val byteOrder: ByteOrder) extends GraphStage[FlowShape[ByteString, ByteString]] { + val byteOrder: ByteOrder) extends GraphStage[FlowShape[ByteString, ByteString]] { private val minimumChunkSize = lengthFieldOffset + lengthFieldLength private val intDecoder = byteOrder match { case ByteOrder.BIG_ENDIAN ⇒ bigEndianDecoder diff --git a/akka-stream/src/main/scala/akka/stream/scaladsl/Graph.scala b/akka-stream/src/main/scala/akka/stream/scaladsl/Graph.scala index d30a726c1c..8c73568d52 100644 --- a/akka-stream/src/main/scala/akka/stream/scaladsl/Graph.scala +++ b/akka-stream/src/main/scala/akka/stream/scaladsl/Graph.scala @@ -761,7 +761,7 @@ object ZipWithN { /** * Create a new `ZipWithN`. */ - def apply[A, O](zipper: immutable.Seq[A] => O)(n: Int) = new ZipWithN[A, O](zipper)(n) + def apply[A, O](zipper: immutable.Seq[A] ⇒ O)(n: Int) = new ZipWithN[A, O](zipper)(n) } /** @@ -777,7 +777,7 @@ object ZipWithN { * * '''Cancels when''' downstream cancels */ -class ZipWithN[A, O](zipper: immutable.Seq[A] => O)(n: Int) extends GraphStage[UniformFanInShape[A, O]] { +class ZipWithN[A, O](zipper: immutable.Seq[A] ⇒ O)(n: Int) extends GraphStage[UniformFanInShape[A, O]] { override def initialAttributes = DefaultAttributes.zipWithN override val shape = new UniformFanInShape[A, O](n) def out = shape.out @@ -801,7 +801,7 @@ class ZipWithN[A, O](zipper: immutable.Seq[A] => O)(n: Int) extends GraphStage[U inSeq.foreach(pullInlet) } - inSeq.foreach(in => { + inSeq.foreach(in ⇒ { setHandler(in, new InHandler { override def onPush(): Unit = { pending -= 1 @@ -1096,7 +1096,7 @@ object GraphDSL extends GraphApply { } private class PortOpsImpl[+Out](override val outlet: Outlet[Out @uncheckedVariance], b: Builder[_]) - extends PortOps[Out] { + extends PortOps[Out] { override def withAttributes(attr: Attributes): Repr[Out] = throw settingAttrNotSupported override def addAttributes(attr: Attributes): Repr[Out] = throw settingAttrNotSupported diff --git a/akka-stream/src/main/scala/akka/stream/scaladsl/StreamConverters.scala b/akka-stream/src/main/scala/akka/stream/scaladsl/StreamConverters.scala index b9a1408a24..3da00a38cb 100644 --- a/akka-stream/src/main/scala/akka/stream/scaladsl/StreamConverters.scala +++ b/akka-stream/src/main/scala/akka/stream/scaladsl/StreamConverters.scala @@ -6,16 +6,16 @@ package akka.stream.scaladsl import java.io.{ OutputStream, InputStream } import java.util.Spliterators import java.util.concurrent.atomic.AtomicReference -import java.util.stream.{Collector, StreamSupport} +import java.util.stream.{ Collector, StreamSupport } -import akka.stream.{Attributes, SinkShape, IOResult} +import akka.stream.{ Attributes, SinkShape, IOResult } import akka.stream.impl._ import akka.stream.impl.Stages.DefaultAttributes import akka.stream.impl.io.{ InputStreamSinkStage, OutputStreamSink, OutputStreamSourceStage, InputStreamSource } import akka.util.ByteString import scala.concurrent.duration.Duration._ -import scala.concurrent.{Await, Future} +import scala.concurrent.{ Await, Future } import scala.concurrent.duration._ import akka.NotUsed @@ -97,101 +97,100 @@ object StreamConverters { Sink.fromGraph(new InputStreamSinkStage(readTimeout)) /** - * Creates a sink which materializes into a ``Future`` which will be completed with result of the Java 8 ``Collector`` transformation - * and reduction operations. This allows usage of Java 8 streams transformations for reactive streams. The ``Collector`` will trigger - * demand downstream. Elements emitted through the stream will be accumulated into a mutable result container, optionally transformed - * into a final representation after all input elements have been processed. The ``Collector`` can also do reduction - * at the end. Reduction processing is performed sequentially - * - * Note that a flow can be materialized multiple times, so the function producing the ``Collector`` must be able - * to handle multiple invocations. - */ + * Creates a sink which materializes into a ``Future`` which will be completed with result of the Java 8 ``Collector`` transformation + * and reduction operations. This allows usage of Java 8 streams transformations for reactive streams. The ``Collector`` will trigger + * demand downstream. Elements emitted through the stream will be accumulated into a mutable result container, optionally transformed + * into a final representation after all input elements have been processed. The ``Collector`` can also do reduction + * at the end. Reduction processing is performed sequentially + * + * Note that a flow can be materialized multiple times, so the function producing the ``Collector`` must be able + * to handle multiple invocations. + */ def javaCollector[T, R](collectorFactory: () ⇒ java.util.stream.Collector[T, _ <: Any, R]): Sink[T, Future[R]] = Flow[T].fold(() ⇒ - new CollectorState[T,R](collectorFactory().asInstanceOf[Collector[T, Any, R]])) { (state, elem) ⇒ () ⇒ state().update(elem) } + new CollectorState[T, R](collectorFactory().asInstanceOf[Collector[T, Any, R]])) { (state, elem) ⇒ () ⇒ state().update(elem) } .map(state ⇒ state().finish()) .toMat(Sink.head)(Keep.right).withAttributes(DefaultAttributes.javaCollector) /** - * Creates a sink which materializes into a ``Future`` which will be completed with result of the Java 8 ``Collector`` transformation - * and reduction operations. This allows usage of Java 8 streams transformations for reactive streams. The ``Collector`` will trigger demand - * downstream. Elements emitted through the stream will be accumulated into a mutable result container, optionally transformed - * into a final representation after all input elements have been processed. The ``Collector`` can also do reduction - * at the end. Reduction processing is performed in parallel based on graph ``Balance``. - * - * Note that a flow can be materialized multiple times, so the function producing the ``Collector`` must be able - * to handle multiple invocations. - */ + * Creates a sink which materializes into a ``Future`` which will be completed with result of the Java 8 ``Collector`` transformation + * and reduction operations. This allows usage of Java 8 streams transformations for reactive streams. The ``Collector`` will trigger demand + * downstream. Elements emitted through the stream will be accumulated into a mutable result container, optionally transformed + * into a final representation after all input elements have been processed. The ``Collector`` can also do reduction + * at the end. Reduction processing is performed in parallel based on graph ``Balance``. + * + * Note that a flow can be materialized multiple times, so the function producing the ``Collector`` must be able + * to handle multiple invocations. + */ def javaCollectorParallelUnordered[T, R](parallelism: Int)(collectorFactory: () ⇒ java.util.stream.Collector[T, _ <: Any, R]): Sink[T, Future[R]] = { if (parallelism == 1) javaCollector[T, R](collectorFactory) else { - Sink.fromGraph(GraphDSL.create(Sink.head[R]) { implicit b ⇒ - sink ⇒ - import GraphDSL.Implicits._ - val collector = collectorFactory().asInstanceOf[Collector[T, Any, R]] - val balance = b.add(Balance[T](parallelism)) - val merge = b.add(Merge[() ⇒ CollectorState[T, R]](parallelism)) + Sink.fromGraph(GraphDSL.create(Sink.head[R]) { implicit b ⇒ sink ⇒ + import GraphDSL.Implicits._ + val collector = collectorFactory().asInstanceOf[Collector[T, Any, R]] + val balance = b.add(Balance[T](parallelism)) + val merge = b.add(Merge[() ⇒ CollectorState[T, R]](parallelism)) - for (i ← 0 until parallelism) { - val worker = Flow[T] - .fold(() => new CollectorState(collector)) { (state, elem) ⇒ () ⇒ state().update(elem) } - .async + for (i ← 0 until parallelism) { + val worker = Flow[T] + .fold(() ⇒ new CollectorState(collector)) { (state, elem) ⇒ () ⇒ state().update(elem) } + .async - balance.out(i) ~> worker ~> merge.in(i) - } + balance.out(i) ~> worker ~> merge.in(i) + } - merge.out - .fold(() => new ReducerState(collector)) { (state, elem) ⇒ () ⇒ state().update(elem().accumulated) } - .map(state => state().finish()) ~> sink.in + merge.out + .fold(() ⇒ new ReducerState(collector)) { (state, elem) ⇒ () ⇒ state().update(elem().accumulated) } + .map(state ⇒ state().finish()) ~> sink.in - SinkShape(balance.in) + SinkShape(balance.in) }).withAttributes(DefaultAttributes.javaCollectorParallelUnordered) } } /** - * Creates a sink which materializes into Java 8 ``Stream`` that can be run to trigger demand through the sink. - * Elements emitted through the stream will be available for reading through the Java 8 ``Stream``. - * - * The Java 8 ``Stream`` will be ended when the stream flowing into this ``Sink`` completes, and closing the Java - * ``Stream`` will cancel the inflow of this ``Sink``. - * - * Java 8 ``Stream`` throws exception in case reactive stream failed. - * - * Be aware that Java ``Stream`` blocks current thread while waiting on next element from downstream. - * As it is interacting wit blocking API the implementation runs on a separate dispatcher - * configured through the ``akka.stream.blocking-io-dispatcher``. - */ + * Creates a sink which materializes into Java 8 ``Stream`` that can be run to trigger demand through the sink. + * Elements emitted through the stream will be available for reading through the Java 8 ``Stream``. + * + * The Java 8 ``Stream`` will be ended when the stream flowing into this ``Sink`` completes, and closing the Java + * ``Stream`` will cancel the inflow of this ``Sink``. + * + * Java 8 ``Stream`` throws exception in case reactive stream failed. + * + * Be aware that Java ``Stream`` blocks current thread while waiting on next element from downstream. + * As it is interacting wit blocking API the implementation runs on a separate dispatcher + * configured through the ``akka.stream.blocking-io-dispatcher``. + */ def asJavaStream[T](): Sink[T, java.util.stream.Stream[T]] = { Sink.fromGraph(new QueueSink[T]()) .mapMaterializedValue(queue ⇒ StreamSupport.stream( - Spliterators.spliteratorUnknownSize(new java.util.Iterator[T] { - var nextElementFuture: Future[Option[T]] = queue.pull() - var nextElement: Option[T] = null + Spliterators.spliteratorUnknownSize(new java.util.Iterator[T] { + var nextElementFuture: Future[Option[T]] = queue.pull() + var nextElement: Option[T] = null - override def hasNext: Boolean = { - nextElement = Await.result(nextElementFuture, Inf) - nextElement.isDefined - } + override def hasNext: Boolean = { + nextElement = Await.result(nextElementFuture, Inf) + nextElement.isDefined + } - override def next(): T = { - val next = nextElement.get - nextElementFuture = queue.pull() - next - } - }, 0), false).onClose(new Runnable { def run = queue.cancel() })) - .withAttributes(DefaultAttributes.asJavaStream) + override def next(): T = { + val next = nextElement.get + nextElementFuture = queue.pull() + next + } + }, 0), false).onClose(new Runnable { def run = queue.cancel() })) + .withAttributes(DefaultAttributes.asJavaStream) } /** - * Creates a source that wraps a Java 8 ``Stream``. ``Source`` uses a stream iterator to get all its - * elements and send them downstream on demand. - * - * Example usage: `Source.fromJavaStream(() ⇒ IntStream.rangeClosed(1, 10))` - * - * You can use [[Source.async]] to create asynchronous boundaries between synchronous Java ``Stream`` - * and the rest of flow. - */ + * Creates a source that wraps a Java 8 ``Stream``. ``Source`` uses a stream iterator to get all its + * elements and send them downstream on demand. + * + * Example usage: `Source.fromJavaStream(() ⇒ IntStream.rangeClosed(1, 10))` + * + * You can use [[Source.async]] to create asynchronous boundaries between synchronous Java ``Stream`` + * and the rest of flow. + */ def fromJavaStream[T, S <: java.util.stream.BaseStream[T, S]](stream: () ⇒ java.util.stream.BaseStream[T, S]): Source[T, NotUsed] = { import scala.collection.JavaConverters._ Source.fromIterator(() ⇒ stream().iterator().asScala).withAttributes(DefaultAttributes.fromJavaStream) diff --git a/akka-stream/src/main/scala/akka/stream/scaladsl/TLS.scala b/akka-stream/src/main/scala/akka/stream/scaladsl/TLS.scala index 496dfafb15..ca54ea50c1 100644 --- a/akka-stream/src/main/scala/akka/stream/scaladsl/TLS.scala +++ b/akka-stream/src/main/scala/akka/stream/scaladsl/TLS.scala @@ -63,10 +63,11 @@ object TLS { * The SSLEngine may use this information e.g. when an endpoint identification algorithm was * configured using [[javax.net.ssl.SSLParameters.setEndpointIdentificationAlgorithm]]. */ - def apply(sslContext: SSLContext, - sslConfig: Option[AkkaSSLConfig], - firstSession: NegotiateNewSession, role: TLSRole, - closing: TLSClosing = IgnoreComplete, hostInfo: Option[(String, Int)] = None): scaladsl.BidiFlow[SslTlsOutbound, ByteString, ByteString, SslTlsInbound, NotUsed] = + def apply( + sslContext: SSLContext, + sslConfig: Option[AkkaSSLConfig], + firstSession: NegotiateNewSession, role: TLSRole, + closing: TLSClosing = IgnoreComplete, hostInfo: Option[(String, Int)] = None): scaladsl.BidiFlow[SslTlsOutbound, ByteString, ByteString, SslTlsInbound, NotUsed] = new scaladsl.BidiFlow(TlsModule(Attributes.none, sslContext, sslConfig, firstSession, role, closing, hostInfo)) /** @@ -85,9 +86,10 @@ object TLS { * The SSLEngine may use this information e.g. when an endpoint identification algorithm was * configured using [[javax.net.ssl.SSLParameters.setEndpointIdentificationAlgorithm]]. */ - def apply(sslContext: SSLContext, - firstSession: NegotiateNewSession, role: TLSRole, - closing: TLSClosing, hostInfo: Option[(String, Int)]): scaladsl.BidiFlow[SslTlsOutbound, ByteString, ByteString, SslTlsInbound, NotUsed] = + def apply( + sslContext: SSLContext, + firstSession: NegotiateNewSession, role: TLSRole, + closing: TLSClosing, hostInfo: Option[(String, Int)]): scaladsl.BidiFlow[SslTlsOutbound, ByteString, ByteString, SslTlsInbound, NotUsed] = new scaladsl.BidiFlow(TlsModule(Attributes.none, sslContext, None, firstSession, role, closing, hostInfo)) /** @@ -106,8 +108,9 @@ object TLS { * The SSLEngine may use this information e.g. when an endpoint identification algorithm was * configured using [[javax.net.ssl.SSLParameters.setEndpointIdentificationAlgorithm]]. */ - def apply(sslContext: SSLContext, - firstSession: NegotiateNewSession, role: TLSRole): scaladsl.BidiFlow[SslTlsOutbound, ByteString, ByteString, SslTlsInbound, NotUsed] = + def apply( + sslContext: SSLContext, + firstSession: NegotiateNewSession, role: TLSRole): scaladsl.BidiFlow[SslTlsOutbound, ByteString, ByteString, SslTlsInbound, NotUsed] = new scaladsl.BidiFlow(TlsModule(Attributes.none, sslContext, None, firstSession, role, IgnoreComplete, None)) } diff --git a/akka-stream/src/main/scala/akka/stream/scaladsl/Tcp.scala b/akka-stream/src/main/scala/akka/stream/scaladsl/Tcp.scala index dc03455ed9..bdcbf0ad99 100644 --- a/akka-stream/src/main/scala/akka/stream/scaladsl/Tcp.scala +++ b/akka-stream/src/main/scala/akka/stream/scaladsl/Tcp.scala @@ -31,9 +31,9 @@ object Tcp extends ExtensionId[Tcp] with ExtensionIdProvider { * Represents an accepted incoming TCP connection. */ final case class IncomingConnection( - localAddress: InetSocketAddress, + localAddress: InetSocketAddress, remoteAddress: InetSocketAddress, - flow: Flow[ByteString, ByteString, NotUsed]) { + flow: Flow[ByteString, ByteString, NotUsed]) { /** * Handles the connection using the given flow, which is materialized exactly once and the respective @@ -87,12 +87,13 @@ final class Tcp(system: ExtendedActorSystem) extends akka.actor.Extension { * independently whether the client is still attempting to write. This setting is recommended * for servers, and therefore it is the default setting. */ - def bind(interface: String, - port: Int, - backlog: Int = 100, - options: immutable.Traversable[SocketOption] = Nil, - halfClose: Boolean = false, - idleTimeout: Duration = Duration.Inf): Source[IncomingConnection, Future[ServerBinding]] = + def bind( + interface: String, + port: Int, + backlog: Int = 100, + options: immutable.Traversable[SocketOption] = Nil, + halfClose: Boolean = false, + idleTimeout: Duration = Duration.Inf): Source[IncomingConnection, Future[ServerBinding]] = Source.fromGraph(new ConnectionSourceStage( IO(IoTcp)(system), new InetSocketAddress(interface, port), @@ -126,13 +127,13 @@ final class Tcp(system: ExtendedActorSystem) extends akka.actor.Extension { * for servers, and therefore it is the default setting. */ def bindAndHandle( - handler: Flow[ByteString, ByteString, _], - interface: String, - port: Int, - backlog: Int = 100, - options: immutable.Traversable[SocketOption] = Nil, - halfClose: Boolean = false, - idleTimeout: Duration = Duration.Inf)(implicit m: Materializer): Future[ServerBinding] = { + handler: Flow[ByteString, ByteString, _], + interface: String, + port: Int, + backlog: Int = 100, + options: immutable.Traversable[SocketOption] = Nil, + halfClose: Boolean = false, + idleTimeout: Duration = Duration.Inf)(implicit m: Materializer): Future[ServerBinding] = { bind(interface, port, backlog, options, halfClose, idleTimeout).to(Sink.foreach { conn: IncomingConnection ⇒ conn.flow.join(handler).run() }).run() @@ -154,12 +155,13 @@ final class Tcp(system: ExtendedActorSystem) extends akka.actor.Extension { * If set to false, the connection will immediately closed once the client closes its write side, * independently whether the server is still attempting to write. */ - def outgoingConnection(remoteAddress: InetSocketAddress, - localAddress: Option[InetSocketAddress] = None, - options: immutable.Traversable[SocketOption] = Nil, - halfClose: Boolean = true, - connectTimeout: Duration = Duration.Inf, - idleTimeout: Duration = Duration.Inf): Flow[ByteString, ByteString, Future[OutgoingConnection]] = { + def outgoingConnection( + remoteAddress: InetSocketAddress, + localAddress: Option[InetSocketAddress] = None, + options: immutable.Traversable[SocketOption] = Nil, + halfClose: Boolean = true, + connectTimeout: Duration = Duration.Inf, + idleTimeout: Duration = Duration.Inf): Flow[ByteString, ByteString, Future[OutgoingConnection]] = { val tcpFlow = Flow.fromGraph(new OutgoingConnectionStage( IO(IoTcp)(system), diff --git a/akka-stream/src/main/scala/akka/stream/stage/GraphStage.scala b/akka-stream/src/main/scala/akka/stream/stage/GraphStage.scala index 3b0ce2f82d..c6bf767138 100644 --- a/akka-stream/src/main/scala/akka/stream/stage/GraphStage.scala +++ b/akka-stream/src/main/scala/akka/stream/stage/GraphStage.scala @@ -123,9 +123,10 @@ object GraphStageLogic { /** * Minimal actor to work with other actors and watch them in a synchronous ways */ - final class StageActor(materializer: ActorMaterializer, - getAsyncCallback: StageActorRef.Receive ⇒ AsyncCallback[(ActorRef, Any)], - initialReceive: StageActorRef.Receive) { + final class StageActor( + materializer: ActorMaterializer, + getAsyncCallback: StageActorRef.Receive ⇒ AsyncCallback[(ActorRef, Any)], + initialReceive: StageActorRef.Receive) { private val callback = getAsyncCallback(internalReceive) private def cell = materializer.supervisor match { @@ -1149,9 +1150,9 @@ abstract class TimerGraphStageLogic(_shape: Shape) extends GraphStageLogic(_shap * adding the new timer. */ final protected def schedulePeriodicallyWithInitialDelay( - timerKey: Any, + timerKey: Any, initialDelay: FiniteDuration, - interval: FiniteDuration): Unit = { + interval: FiniteDuration): Unit = { cancelTimer(timerKey) val id = timerIdGen.next() val task = interpreter.materializer.schedulePeriodically(initialDelay, interval, new Runnable { diff --git a/akka-stream/src/main/scala/akka/stream/stage/Stage.scala b/akka-stream/src/main/scala/akka/stream/stage/Stage.scala index d65ae4fbd9..1ddb08d392 100644 --- a/akka-stream/src/main/scala/akka/stream/stage/Stage.scala +++ b/akka-stream/src/main/scala/akka/stream/stage/Stage.scala @@ -38,8 +38,8 @@ private[stream] object AbstractStage { private class PushPullGraphLogic[In, Out]( private val shape: FlowShape[In, Out], - val attributes: Attributes, - val stage: AbstractStage[In, Out, Directive, Directive, Context[Out], LifecycleContext]) + val attributes: Attributes, + val stage: AbstractStage[In, Out, Directive, Directive, Context[Out], LifecycleContext]) extends GraphStageLogic(shape) with DetachedContext[Out] { final override def materializer: Materializer = interpreter.materializer @@ -163,7 +163,7 @@ private[stream] object AbstractStage { } class PushPullGraphStageWithMaterializedValue[-In, +Out, Ext, +Mat]( - val factory: (Attributes) ⇒ (Stage[In, Out], Mat), + val factory: (Attributes) ⇒ (Stage[In, Out], Mat), stageAttributes: Attributes) extends GraphStageWithMaterializedValue[FlowShape[In, Out], Mat] { diff --git a/akka-testkit/src/main/scala/akka/testkit/CallingThreadDispatcher.scala b/akka-testkit/src/main/scala/akka/testkit/CallingThreadDispatcher.scala index a27a795d55..3167b4f0fb 100644 --- a/akka-testkit/src/main/scala/akka/testkit/CallingThreadDispatcher.scala +++ b/akka-testkit/src/main/scala/akka/testkit/CallingThreadDispatcher.scala @@ -52,16 +52,16 @@ private[testkit] class CallingThreadDispatcherQueues extends Extension { queues = (Map.newBuilder[CallingThreadMailbox, Set[WeakReference[MessageQueue]]] /: queues) { case (m, (k, v)) ⇒ val nv = v filter (_.get ne null) - if (nv.isEmpty) m else m += (k -> nv) + if (nv.isEmpty) m else m += (k → nv) }.result } protected[akka] def registerQueue(mbox: CallingThreadMailbox, q: MessageQueue): Unit = synchronized { if (queues contains mbox) { val newSet = queues(mbox) + new WeakReference(q) - queues += mbox -> newSet + queues += mbox → newSet } else { - queues += mbox -> Set(new WeakReference(q)) + queues += mbox → Set(new WeakReference(q)) } val now = System.nanoTime if (now - lastGC > 1000000000l) { diff --git a/akka-testkit/src/main/scala/akka/testkit/TestActorRef.scala b/akka-testkit/src/main/scala/akka/testkit/TestActorRef.scala index aa63c9dcf4..0de892a837 100644 --- a/akka-testkit/src/main/scala/akka/testkit/TestActorRef.scala +++ b/akka-testkit/src/main/scala/akka/testkit/TestActorRef.scala @@ -19,10 +19,10 @@ import akka.pattern.ask * @since 1.1 */ class TestActorRef[T <: Actor]( - _system: ActorSystem, - _props: Props, + _system: ActorSystem, + _props: Props, _supervisor: ActorRef, - name: String) + name: String) extends { val props = _props.withDispatcher( @@ -149,7 +149,8 @@ object TestActorRef { def apply[T <: Actor](implicit t: ClassTag[T], system: ActorSystem): TestActorRef[T] = apply[T](randomName) private def dynamicCreateRecover[U]: PartialFunction[Throwable, U] = { - case exception ⇒ throw ActorInitializationException(null, + case exception ⇒ throw ActorInitializationException( + null, "Could not instantiate Actor" + "\nMake sure Actor is NOT defined inside a class/trait," + "\nif so put it outside the class/trait, f.e. in a companion object," + diff --git a/akka-testkit/src/main/scala/akka/testkit/TestEventListener.scala b/akka-testkit/src/main/scala/akka/testkit/TestEventListener.scala index 1ad68acc04..b93d374989 100644 --- a/akka-testkit/src/main/scala/akka/testkit/TestEventListener.scala +++ b/akka-testkit/src/main/scala/akka/testkit/TestEventListener.scala @@ -95,7 +95,8 @@ abstract class EventFilter(occurrences: Int) { * `occurrences` parameter specifies. */ def assertDone(max: Duration): Unit = - assert(awaitDone(max), + assert( + awaitDone(max), if (todo > 0) s"$todo messages outstanding on $this" else s"received ${-todo} excess messages on $this") @@ -199,7 +200,8 @@ object EventFilter { * source filter).'' */ def warning(message: String = null, source: String = null, start: String = "", pattern: String = null, occurrences: Int = Int.MaxValue): EventFilter = - WarningFilter(Option(source), + WarningFilter( + Option(source), if (message ne null) Left(message) else Option(pattern) map (new Regex(_)) toRight start, message ne null)(occurrences) @@ -218,7 +220,8 @@ object EventFilter { * source filter).'' */ def info(message: String = null, source: String = null, start: String = "", pattern: String = null, occurrences: Int = Int.MaxValue): EventFilter = - InfoFilter(Option(source), + InfoFilter( + Option(source), if (message ne null) Left(message) else Option(pattern) map (new Regex(_)) toRight start, message ne null)(occurrences) @@ -237,7 +240,8 @@ object EventFilter { * source filter).'' */ def debug(message: String = null, source: String = null, start: String = "", pattern: String = null, occurrences: Int = Int.MaxValue): EventFilter = - DebugFilter(Option(source), + DebugFilter( + Option(source), if (message ne null) Left(message) else Option(pattern) map (new Regex(_)) toRight start, message ne null)(occurrences) @@ -271,9 +275,9 @@ object EventFilter { * If you want to match all Error events, the most efficient is to use Left(""). */ final case class ErrorFilter( - throwable: Class[_], - override val source: Option[String], - override val message: Either[String, Regex], + throwable: Class[_], + override val source: Option[String], + override val message: Either[String, Regex], override val complete: Boolean)(occurrences: Int) extends EventFilter(occurrences) { def matches(event: LogEvent) = { @@ -323,8 +327,8 @@ final case class ErrorFilter( * If you want to match all Warning events, the most efficient is to use Left(""). */ final case class WarningFilter( - override val source: Option[String], - override val message: Either[String, Regex], + override val source: Option[String], + override val message: Either[String, Regex], override val complete: Boolean)(occurrences: Int) extends EventFilter(occurrences) { def matches(event: LogEvent) = { @@ -350,7 +354,8 @@ final case class WarningFilter( * whether the event’s message must match the given message string or pattern completely */ def this(source: String, message: String, pattern: Boolean, complete: Boolean, occurrences: Int) = - this(Option(source), + this( + Option(source), if (message eq null) Left("") else if (pattern) Right(new Regex(message)) else Left(message), @@ -366,8 +371,8 @@ final case class WarningFilter( * If you want to match all Info events, the most efficient is to use Left(""). */ final case class InfoFilter( - override val source: Option[String], - override val message: Either[String, Regex], + override val source: Option[String], + override val message: Either[String, Regex], override val complete: Boolean)(occurrences: Int) extends EventFilter(occurrences) { def matches(event: LogEvent) = { @@ -393,7 +398,8 @@ final case class InfoFilter( * whether the event’s message must match the given message string or pattern completely */ def this(source: String, message: String, pattern: Boolean, complete: Boolean, occurrences: Int) = - this(Option(source), + this( + Option(source), if (message eq null) Left("") else if (pattern) Right(new Regex(message)) else Left(message), @@ -409,8 +415,8 @@ final case class InfoFilter( * If you want to match all Debug events, the most efficient is to use Left(""). */ final case class DebugFilter( - override val source: Option[String], - override val message: Either[String, Regex], + override val source: Option[String], + override val message: Either[String, Regex], override val complete: Boolean)(occurrences: Int) extends EventFilter(occurrences) { def matches(event: LogEvent) = { @@ -436,7 +442,8 @@ final case class DebugFilter( * whether the event’s message must match the given message string or pattern completely */ def this(source: String, message: String, pattern: Boolean, complete: Boolean, occurrences: Int) = - this(Option(source), + this( + Option(source), if (message eq null) Left("") else if (pattern) Right(new Regex(message)) else Left(message), diff --git a/akka-testkit/src/main/scala/akka/testkit/TestFSMRef.scala b/akka-testkit/src/main/scala/akka/testkit/TestFSMRef.scala index 36be493c82..72bee30571 100644 --- a/akka-testkit/src/main/scala/akka/testkit/TestFSMRef.scala +++ b/akka-testkit/src/main/scala/akka/testkit/TestFSMRef.scala @@ -33,10 +33,10 @@ import scala.reflect.ClassTag * @since 1.2 */ class TestFSMRef[S, D, T <: Actor]( - system: ActorSystem, - props: Props, + system: ActorSystem, + props: Props, supervisor: ActorRef, - name: String)(implicit ev: T <:< FSM[S, D]) + name: String)(implicit ev: T <:< FSM[S, D]) extends TestActorRef[T](system, props, supervisor, name) { private def fsm: T = underlyingActor diff --git a/akka-testkit/src/main/scala/akka/testkit/TestKit.scala b/akka-testkit/src/main/scala/akka/testkit/TestKit.scala index c92392427e..2016816ae6 100644 --- a/akka-testkit/src/main/scala/akka/testkit/TestKit.scala +++ b/akka-testkit/src/main/scala/akka/testkit/TestKit.scala @@ -123,8 +123,9 @@ trait TestKitBase { */ val testActor: ActorRef = { val impl = system.asInstanceOf[ExtendedActorSystem] - val ref = impl.systemActorOf(TestActor.props(queue) - .withDispatcher(CallingThreadDispatcher.Id), + val ref = impl.systemActorOf( + TestActor.props(queue) + .withDispatcher(CallingThreadDispatcher.Id), "%s-%d".format(testActorName, TestKit.testActorId.incrementAndGet)) awaitCond(ref match { case r: RepointableRef ⇒ r.isStarted @@ -500,7 +501,8 @@ trait TestKitBase { private def checkMissingAndUnexpected(missing: Seq[Any], unexpected: Seq[Any], missingMessage: String, unexpectedMessage: String): Unit = { - assert(missing.isEmpty && unexpected.isEmpty, + assert( + missing.isEmpty && unexpected.isEmpty, (if (missing.isEmpty) "" else missing.mkString(missingMessage + " [", ", ", "] ")) + (if (unexpected.isEmpty) "" else unexpected.mkString(unexpectedMessage + " [", ", ", "]"))) } @@ -679,9 +681,10 @@ trait TestKitBase { * * If verifySystemShutdown is true, then an exception will be thrown on failure. */ - def shutdown(actorSystem: ActorSystem = system, - duration: Duration = 5.seconds.dilated.min(10.seconds), - verifySystemShutdown: Boolean = false) { + def shutdown( + actorSystem: ActorSystem = system, + duration: Duration = 5.seconds.dilated.min(10.seconds), + verifySystemShutdown: Boolean = false) { TestKit.shutdownActorSystem(actorSystem, duration, verifySystemShutdown) } @@ -771,9 +774,10 @@ object TestKit { * * If verifySystemShutdown is true, then an exception will be thrown on failure. */ - def shutdownActorSystem(actorSystem: ActorSystem, - duration: Duration = 10.seconds, - verifySystemShutdown: Boolean = false): Unit = { + def shutdownActorSystem( + actorSystem: ActorSystem, + duration: Duration = 10.seconds, + verifySystemShutdown: Boolean = false): Unit = { actorSystem.terminate() try Await.ready(actorSystem.whenTerminated, duration) catch { case _: TimeoutException ⇒ diff --git a/akka-testkit/src/main/scala/akka/testkit/package.scala b/akka-testkit/src/main/scala/akka/testkit/package.scala index 46bd5ea61f..c073e59357 100644 --- a/akka-testkit/src/main/scala/akka/testkit/package.scala +++ b/akka-testkit/src/main/scala/akka/testkit/package.scala @@ -3,7 +3,6 @@ */ package akka - import akka.actor.ActorSystem import scala.concurrent.duration.{ Duration, FiniteDuration } import scala.reflect.ClassTag diff --git a/akka-testkit/src/test/scala/akka/testkit/AkkaSpec.scala b/akka-testkit/src/test/scala/akka/testkit/AkkaSpec.scala index c7cda3df81..7a1675b405 100644 --- a/akka-testkit/src/test/scala/akka/testkit/AkkaSpec.scala +++ b/akka-testkit/src/test/scala/akka/testkit/AkkaSpec.scala @@ -55,12 +55,13 @@ object AkkaSpec { } abstract class AkkaSpec(_system: ActorSystem) - extends TestKit(_system) with WordSpecLike with Matchers with BeforeAndAfterAll with WatchedByCoroner - with ConversionCheckedTripleEquals with ScalaFutures { + extends TestKit(_system) with WordSpecLike with Matchers with BeforeAndAfterAll with WatchedByCoroner + with ConversionCheckedTripleEquals with ScalaFutures { implicit val patience = PatienceConfig(testKitSettings.DefaultTimeout.duration) - def this(config: Config) = this(ActorSystem(AkkaSpec.getCallerName(getClass), + def this(config: Config) = this(ActorSystem( + AkkaSpec.getCallerName(getClass), ConfigFactory.load(config.withFallback(AkkaSpec.testConf)))) def this(s: String) = this(ConfigFactory.parseString(s)) diff --git a/akka-testkit/src/test/scala/akka/testkit/AkkaSpecSpec.scala b/akka-testkit/src/test/scala/akka/testkit/AkkaSpecSpec.scala index e24a4d646e..e9a2b051ca 100644 --- a/akka-testkit/src/test/scala/akka/testkit/AkkaSpecSpec.scala +++ b/akka-testkit/src/test/scala/akka/testkit/AkkaSpecSpec.scala @@ -34,8 +34,8 @@ class AkkaSpecSpec extends WordSpec with Matchers { // verbose config just for demonstration purposes, please leave in in case of debugging import scala.collection.JavaConverters._ val conf = Map( - "akka.actor.debug.lifecycle" -> true, "akka.actor.debug.event-stream" -> true, - "akka.loglevel" -> "DEBUG", "akka.stdout-loglevel" -> "DEBUG") + "akka.actor.debug.lifecycle" → true, "akka.actor.debug.event-stream" → true, + "akka.loglevel" → "DEBUG", "akka.stdout-loglevel" → "DEBUG") val system = ActorSystem("AkkaSpec1", ConfigFactory.parseMap(conf.asJava).withFallback(AkkaSpec.testConf)) var refs = Seq.empty[ActorRef] val spec = new AkkaSpec(system) { refs = Seq(testActor, system.actorOf(Props.empty, "name")) } diff --git a/akka-testkit/src/test/scala/akka/testkit/Coroner.scala b/akka-testkit/src/test/scala/akka/testkit/Coroner.scala index 9edabd8d16..1ce81c9d39 100644 --- a/akka-testkit/src/test/scala/akka/testkit/Coroner.scala +++ b/akka-testkit/src/test/scala/akka/testkit/Coroner.scala @@ -78,7 +78,7 @@ object Coroner { */ def watch(duration: FiniteDuration, reportTitle: String, out: PrintStream, startAndStopDuration: FiniteDuration = defaultStartAndStopDuration, - displayThreadCounts: Boolean = false): WatchHandle = { + displayThreadCounts: Boolean = false): WatchHandle = { val watchedHandle = new WatchHandleImpl(startAndStopDuration) diff --git a/akka-testkit/src/test/scala/akka/testkit/TestTimeSpec.scala b/akka-testkit/src/test/scala/akka/testkit/TestTimeSpec.scala index e8a62440fd..d280bfb113 100644 --- a/akka-testkit/src/test/scala/akka/testkit/TestTimeSpec.scala +++ b/akka-testkit/src/test/scala/akka/testkit/TestTimeSpec.scala @@ -3,7 +3,7 @@ package akka.testkit import scala.concurrent.duration._ import org.scalatest.exceptions.TestFailedException -class TestTimeSpec extends AkkaSpec(Map("akka.test.timefactor" -> 2.0)) { +class TestTimeSpec extends AkkaSpec(Map("akka.test.timefactor" → 2.0)) { "A TestKit" must { diff --git a/akka-testkit/src/test/scala/akka/testkit/metrics/FileDescriptorMetricSet.scala b/akka-testkit/src/test/scala/akka/testkit/metrics/FileDescriptorMetricSet.scala index 7ecf45d4d2..3d28cda3bd 100644 --- a/akka-testkit/src/test/scala/akka/testkit/metrics/FileDescriptorMetricSet.scala +++ b/akka-testkit/src/test/scala/akka/testkit/metrics/FileDescriptorMetricSet.scala @@ -18,15 +18,15 @@ private[akka] class FileDescriptorMetricSet(os: OperatingSystemMXBean = Manageme override def getMetrics: util.Map[String, Metric] = { Map[String, Metric]( - name("file-descriptors", "open") -> new Gauge[Long] { + name("file-descriptors", "open") → new Gauge[Long] { override def getValue: Long = invoke("getOpenFileDescriptorCount") }, - name("file-descriptors", "max") -> new Gauge[Long] { + name("file-descriptors", "max") → new Gauge[Long] { override def getValue: Long = invoke("getMaxFileDescriptorCount") }, - name("file-descriptors", "ratio") -> new FileDescriptorRatioGauge(os)).asJava + name("file-descriptors", "ratio") → new FileDescriptorRatioGauge(os)).asJava } private def invoke(name: String): Long = { diff --git a/akka-testkit/src/test/scala/akka/testkit/metrics/HdrHistogram.scala b/akka-testkit/src/test/scala/akka/testkit/metrics/HdrHistogram.scala index 943f020050..9ab2ced147 100644 --- a/akka-testkit/src/test/scala/akka/testkit/metrics/HdrHistogram.scala +++ b/akka-testkit/src/test/scala/akka/testkit/metrics/HdrHistogram.scala @@ -16,9 +16,9 @@ import org.{ HdrHistogram ⇒ hdr } * integer between 0 and 5. */ private[akka] class HdrHistogram( - highestTrackableValue: Long, + highestTrackableValue: Long, numberOfSignificantValueDigits: Int, - val unit: String = "") + val unit: String = "") extends Metric { private val hist = new hdr.Histogram(highestTrackableValue, numberOfSignificantValueDigits) diff --git a/akka-testkit/src/test/scala/akka/testkit/metrics/MetricsKit.scala b/akka-testkit/src/test/scala/akka/testkit/metrics/MetricsKit.scala index 00ecb7ade8..2990f2cc98 100644 --- a/akka-testkit/src/test/scala/akka/testkit/metrics/MetricsKit.scala +++ b/akka-testkit/src/test/scala/akka/testkit/metrics/MetricsKit.scala @@ -191,7 +191,7 @@ trait AkkaMetricRegistry { for { (key, metric) ← getMetrics.asScala if clazz.isInstance(metric) - } yield key -> metric.asInstanceOf[T] + } yield key → metric.asInstanceOf[T] } private[akka] class MetricsKitSettings(config: Config) { diff --git a/akka-testkit/src/test/scala/akka/testkit/metrics/MetricsKitOps.scala b/akka-testkit/src/test/scala/akka/testkit/metrics/MetricsKitOps.scala index 016e864cea..6f46358d72 100644 --- a/akka-testkit/src/test/scala/akka/testkit/metrics/MetricsKitOps.scala +++ b/akka-testkit/src/test/scala/akka/testkit/metrics/MetricsKitOps.scala @@ -91,6 +91,6 @@ private[metrics] trait MetricsPrefix extends MetricSet { abstract override def getMetrics: util.Map[String, Metric] = { // does not have to be fast, is only called once during registering registry import collection.JavaConverters._ - (super.getMetrics.asScala.map { case (k, v) ⇒ (prefix / k).toString -> v }).asJava + (super.getMetrics.asScala.map { case (k, v) ⇒ (prefix / k).toString → v }).asJava } } diff --git a/akka-testkit/src/test/scala/akka/testkit/metrics/reporter/AkkaConsoleReporter.scala b/akka-testkit/src/test/scala/akka/testkit/metrics/reporter/AkkaConsoleReporter.scala index da56d171e4..69d0e77a10 100644 --- a/akka-testkit/src/test/scala/akka/testkit/metrics/reporter/AkkaConsoleReporter.scala +++ b/akka-testkit/src/test/scala/akka/testkit/metrics/reporter/AkkaConsoleReporter.scala @@ -15,8 +15,8 @@ import scala.reflect.ClassTag */ class AkkaConsoleReporter( registry: AkkaMetricRegistry, - verbose: Boolean, - output: PrintStream = System.out) + verbose: Boolean, + output: PrintStream = System.out) extends ScheduledReporter(registry.asInstanceOf[MetricRegistry], "akka-console-reporter", MetricFilter.ALL, TimeUnit.SECONDS, TimeUnit.NANOSECONDS) { private final val ConsoleWidth = 80 diff --git a/akka-typed/src/main/scala/akka/typed/ActorContext.scala b/akka-typed/src/main/scala/akka/typed/ActorContext.scala index 459240729b..f8593a9bee 100644 --- a/akka-typed/src/main/scala/akka/typed/ActorContext.scala +++ b/akka-typed/src/main/scala/akka/typed/ActorContext.scala @@ -155,9 +155,9 @@ trait ActorContext[T] { * See [[EffectfulActorContext]] for more advanced uses. */ class StubbedActorContext[T]( - val name: String, + val name: String, override val props: Props[T])( - override implicit val system: ActorSystem[Nothing]) extends ActorContext[T] { + override implicit val system: ActorSystem[Nothing]) extends ActorContext[T] { val inbox = Inbox.sync[T](name) override val self = inbox.ref @@ -169,7 +169,7 @@ class StubbedActorContext[T]( override def child(name: String): Option[ActorRef[Nothing]] = _children get name map (_.ref) override def spawnAnonymous[U](props: Props[U]): ActorRef[U] = { val i = Inbox.sync[U](childName.next()) - _children += i.ref.untypedRef.path.name -> i + _children += i.ref.untypedRef.path.name → i i.ref } override def spawn[U](props: Props[U], name: String): ActorRef[U] = @@ -177,12 +177,12 @@ class StubbedActorContext[T]( case Some(_) ⇒ throw new untyped.InvalidActorNameException(s"actor name $name is already taken") case None ⇒ val i = Inbox.sync[U](name) - _children += name -> i + _children += name → i i.ref } override def actorOf(props: untyped.Props): untyped.ActorRef = { val i = Inbox.sync[Any](childName.next()) - _children += i.ref.untypedRef.path.name -> i + _children += i.ref.untypedRef.path.name → i i.ref.untypedRef } override def actorOf(props: untyped.Props, name: String): untyped.ActorRef = @@ -190,7 +190,7 @@ class StubbedActorContext[T]( case Some(_) ⇒ throw new untyped.InvalidActorNameException(s"actor name $name is already taken") case None ⇒ val i = Inbox.sync[Any](name) - _children += name -> i + _children += name → i i.ref.untypedRef } override def stop(child: ActorRef[Nothing]): Boolean = { diff --git a/akka-typed/src/main/scala/akka/typed/ActorSystem.scala b/akka-typed/src/main/scala/akka/typed/ActorSystem.scala index 0357243743..2d338f2731 100644 --- a/akka-typed/src/main/scala/akka/typed/ActorSystem.scala +++ b/akka-typed/src/main/scala/akka/typed/ActorSystem.scala @@ -127,8 +127,8 @@ object ActorSystem { private class Wrapper(val untyped: ExtendedActorSystem) extends ActorSystem[Nothing](untyped.name) with ScalaActorRef[Nothing] def apply[T](name: String, guardianProps: Props[T], - config: Option[Config] = None, - classLoader: Option[ClassLoader] = None, + config: Option[Config] = None, + classLoader: Option[ClassLoader] = None, executionContext: Option[ExecutionContext] = None): ActorSystem[T] = { val cl = classLoader.getOrElse(akka.actor.ActorSystem.findClassLoader()) val appConfig = config.getOrElse(ConfigFactory.load(cl)) diff --git a/akka-typed/src/main/scala/akka/typed/Ask.scala b/akka-typed/src/main/scala/akka/typed/Ask.scala index f63bc50966..1cd33d67a5 100644 --- a/akka-typed/src/main/scala/akka/typed/Ask.scala +++ b/akka-typed/src/main/scala/akka/typed/Ask.scala @@ -37,11 +37,13 @@ object AskPattern { private class PromiseRef[U](actorRef: ActorRef[_], timeout: Timeout) { val (ref: ActorRef[U], future: Future[U], promiseRef: PromiseActorRef) = actorRef.untypedRef match { case ref: InternalActorRef if ref.isTerminated ⇒ - (ActorRef[U](ref.provider.deadLetters), + ( + ActorRef[U](ref.provider.deadLetters), Future.failed[U](new AskTimeoutException(s"Recipient[$actorRef] had already been terminated."))) case ref: InternalActorRef ⇒ if (timeout.duration.length <= 0) - (ActorRef[U](ref.provider.deadLetters), + ( + ActorRef[U](ref.provider.deadLetters), Future.failed[U](new IllegalArgumentException(s"Timeout length must be positive, question not sent to [$actorRef]"))) else { val a = PromiseActorRef(ref.provider, timeout, actorRef, "unknown") diff --git a/akka-typed/src/main/scala/akka/typed/Behavior.scala b/akka-typed/src/main/scala/akka/typed/Behavior.scala index b68f3eee7a..ebeb630a0a 100644 --- a/akka-typed/src/main/scala/akka/typed/Behavior.scala +++ b/akka-typed/src/main/scala/akka/typed/Behavior.scala @@ -3,7 +3,6 @@ */ package akka.typed - /** * The behavior of an actor defines how it reacts to the messages that it * receives. The message may either be of the type that the Actor declares diff --git a/akka-typed/src/test/scala/akka/typed/ActorContextSpec.scala b/akka-typed/src/test/scala/akka/typed/ActorContextSpec.scala index 7144ff798a..0fad48a56a 100644 --- a/akka-typed/src/test/scala/akka/typed/ActorContextSpec.scala +++ b/akka-typed/src/test/scala/akka/typed/ActorContextSpec.scala @@ -193,10 +193,11 @@ class ActorContextSpec extends TypedSpec(ConfigFactory.parseString( * The latter is very useful in order to avoid disturbances with GotSignal(PostStop) in * test procedures that stop this child. */ - def mkChild(name: Option[String], - monitor: ActorRef[Event], - self: ActorRef[Event], - inert: Boolean = false): StepWise.Steps[Event, (ActorRef[Command], ActorRef[Command])] = { + def mkChild( + name: Option[String], + monitor: ActorRef[Event], + self: ActorRef[Event], + inert: Boolean = false): StepWise.Steps[Event, (ActorRef[Command], ActorRef[Command])] = { val s = startWith.keep { subj ⇒ subj ! MkChild(name, monitor, self) diff --git a/akka-typed/src/test/scala/akka/typed/StepWise.scala b/akka-typed/src/test/scala/akka/typed/StepWise.scala index 91074a38f6..7c614072f0 100644 --- a/akka-typed/src/test/scala/akka/typed/StepWise.scala +++ b/akka-typed/src/test/scala/akka/typed/StepWise.scala @@ -91,7 +91,7 @@ object StepWise { copy(ops = MultiMessage(timeout, count, (msgs, value) ⇒ { f.asInstanceOf[(Seq[Any], Any) ⇒ Any](msgs, value); value }, getTrace()) :: ops) def expectFailureKeep(timeout: FiniteDuration)(f: (Failed, U) ⇒ Failed.Decision): Steps[T, U] = - copy(ops = Failure(timeout, (failed, value) ⇒ f.asInstanceOf[(Failed, Any) ⇒ Failed.Decision](failed, value) -> value, getTrace()) :: ops) + copy(ops = Failure(timeout, (failed, value) ⇒ f.asInstanceOf[(Failed, Any) ⇒ Failed.Decision](failed, value) → value, getTrace()) :: ops) def expectTerminationKeep(timeout: FiniteDuration)(f: (Terminated, U) ⇒ Unit): Steps[T, U] = copy(ops = Termination(timeout, (t, value) ⇒ { f.asInstanceOf[(Terminated, Any) ⇒ Any](t, value); value }, getTrace()) :: ops) diff --git a/akka-typed/src/test/scala/akka/typed/TypedSpec.scala b/akka-typed/src/test/scala/akka/typed/TypedSpec.scala index c7aa92fd44..5e38e24f54 100644 --- a/akka-typed/src/test/scala/akka/typed/TypedSpec.scala +++ b/akka-typed/src/test/scala/akka/typed/TypedSpec.scala @@ -68,11 +68,11 @@ abstract class TypedSpec(config: Config) extends Spec with Matchers with BeforeA } def muteExpectedException[T <: Exception: ClassTag]( - message: String = null, - source: String = null, - start: String = "", - pattern: String = null, - occurrences: Int = Int.MaxValue): EventFilter = { + message: String = null, + source: String = null, + start: String = "", + pattern: String = null, + occurrences: Int = Int.MaxValue): EventFilter = { val filter = EventFilter(message, source, start, pattern, occurrences) system.eventStream.publish(Mute(filter)) filter diff --git a/project/Formatting.scala b/project/Formatting.scala index f74a89c22f..5ef02c6957 100644 --- a/project/Formatting.scala +++ b/project/Formatting.scala @@ -9,31 +9,35 @@ import com.typesafe.sbt.SbtScalariform import com.typesafe.sbt.SbtScalariform.ScalariformKeys object Formatting { - lazy val formatSettings = SbtScalariform.scalariformSettings ++ Seq( - ScalariformKeys.preferences in Compile := formattingPreferences, - ScalariformKeys.preferences in Test := formattingPreferences, - ScalariformKeys.preferences in MultiJvm := formattingPreferences + lazy val formatSettings = Seq( + ScalariformKeys.preferences in Compile <<= formattingPreferences, + ScalariformKeys.preferences in Test <<= formattingPreferences, + ScalariformKeys.preferences in MultiJvm <<= formattingPreferences ) - lazy val docFormatSettings = SbtScalariform.scalariformSettings ++ Seq( - ScalariformKeys.preferences in Compile := docFormattingPreferences, - ScalariformKeys.preferences in Test := docFormattingPreferences, - ScalariformKeys.preferences in MultiJvm := docFormattingPreferences + lazy val docFormatSettings = Seq( + ScalariformKeys.preferences in Compile <<= docFormattingPreferences, + ScalariformKeys.preferences in Test <<= docFormattingPreferences, + ScalariformKeys.preferences in MultiJvm <<= docFormattingPreferences ) - def formattingPreferences = { + def formattingPreferences = Def.setting { import scalariform.formatter.preferences._ - FormattingPreferences() + ScalariformKeys.preferences.value .setPreference(RewriteArrowSymbols, true) .setPreference(AlignParameters, true) .setPreference(AlignSingleLineCaseStatements, true) + .setPreference(DanglingCloseParenthesis, Preserve) + .setPreference(DoubleIndentClassDeclaration, false) } - def docFormattingPreferences = { + def docFormattingPreferences = Def.setting { import scalariform.formatter.preferences._ - FormattingPreferences() + ScalariformKeys.preferences.value .setPreference(RewriteArrowSymbols, false) .setPreference(AlignParameters, true) .setPreference(AlignSingleLineCaseStatements, true) + .setPreference(DanglingCloseParenthesis, Preserve) + .setPreference(DoubleIndentClassDeclaration, false) } } diff --git a/project/plugins.sbt b/project/plugins.sbt index 9b5025d278..e863d3bbdb 100644 --- a/project/plugins.sbt +++ b/project/plugins.sbt @@ -9,7 +9,7 @@ resolvers += "Bintray Jcenter" at "https://jcenter.bintray.com/" addSbtPlugin("com.typesafe.sbt" % "sbt-multi-jvm" % "0.3.8") //#sbt-multi-jvm -addSbtPlugin("com.typesafe.sbt" % "sbt-scalariform" % "1.2.0") +addSbtPlugin("org.scalariform" % "sbt-scalariform" % "1.6.0") addSbtPlugin("com.typesafe.sbt" % "sbt-site" % "0.7.1")